Selpercatinib
drug drugOn this page
Also known as Loxo-292LY-3527723LY3527723Ret inhibitor loxo-292RetevmoRetsevmo
Summary
Selpercatinib (CHEMBL4559134) is an approved small molecule (ATC L01EX22) targeting RET; indicated across 10 conditions including non-small cell lung carcinoma and neoplasm; with CIViC clinical evidence for 31 variant-indication associations (e.g. RET Fusion in lung non-small cell carcinoma).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: L01EX22
- Targets: 1 (RET)
- Indications: 10 conditions
- Clinical trials: 36
- Precision-oncology evidence (CIViC): 31 variant–indication associations
- Chemistry: 525.6 Da · C29H31N7O3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL4559134 |
| Name | Selpercatinib |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 134436906 |
| ATC | L01EX22 |
| Molecular formula | C29H31N7O3 |
| Molecular weight | 525.6 |
| InChIKey | XIIOFHFUYBLOLW-UHFFFAOYSA-N |
SMILES: CC(C)(COC1=CN2C(=C(C=N2)C#N)C(=C1)C3=CN=C(C=C3)N4CC5CC(C4)N5CC6=CN=C(C=C6)OC)O
IUPAC name: 6-(2-hydroxy-2-methylpropoxy)-4-[6-[6-[(6-methoxy-3-pyridinyl)methyl]-3,6-diazabicyclo[3.1.1]heptan-3-yl]-3-pyridinyl]pyrazolo[1,5-a]pyridine-3-carbonitrile
Also known as: Loxo-292, LOXO-292, LY-3527723, LY3527723, Ret inhibitor loxo-292, Retevmo, Retsevmo, Selpercatinib, SELPERCATINIB
Patent coverage: 656 distinct patent families (1,409 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 1,277 (91%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| RET | ret proto-oncogene | Inhibition | 7.85 | 0.4% | P07949 |
Broader ChEMBL bioactivity targets: 2 (assay-derived). Sample: Proto-oncogene tyrosine-protein kinase receptor Ret, Vascular endothelial growth factor receptor 2.
Bioactivity
ChEMBL activities: 31 potent at pChembl ≥ 5 of 31 total. Top 100 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| RET | 10 | IC50 | 0.1 | nM | CHEMBL_ACT_29235488 |
| RET | 9.75 | IC50 | 0.18 | nM | CHEMBL_ACT_29146647 |
| RET | 9.52 | IC50 | 0.3 | nM | CHEMBL_ACT_29235523 |
| RET | 9.4 | IC50 | 0.4 | nM | CHEMBL_ACT_24867232 |
| RET | 9.4 | IC50 | 0.4 | nM | CHEMBL_ACT_25016240 |
| RET | 9.4 | IC50 | 0.4 | nM | CHEMBL_ACT_25935703 |
| RET | 9.38 | IC50 | 0.42 | nM | CHEMBL_ACT_24867237 |
| RET | 9.38 | IC50 | 0.42 | nM | CHEMBL_ACT_25016242 |
| RET | 9.15 | IC50 | 0.7 | nM | CHEMBL_ACT_24867247 |
| RET | 9.1 | IC50 | 0.8 | nM | CHEMBL_ACT_25016244 |
| RET | 8.91 | IC50 | 1.24 | nM | CHEMBL_ACT_24419670 |
| RET | 8.68 | IC50 | 2.1 | nM | CHEMBL_ACT_29235586 |
| RET | 8.64 | IC50 | 2.3 | nM | CHEMBL_ACT_29119327 |
| RET | 8.55 | IC50 | 2.8 | nM | CHEMBL_ACT_25061386 |
| RET | 8.44 | IC50 | 3.6 | nM | CHEMBL_ACT_29235453 |
| RET | 7.85 | IC50 | 14 | nM | CHEMBL_ACT_26998390 |
| RET | 7.85 | IC50 | 14 | nM | CHEMBL_ACT_27031706 |
| RET | 7.85 | IC50 | 14 | nM | CHEMBL_ACT_27874016 |
| RET | 7.85 | IC50 | 14 | nM | CHEMBL_ACT_28281512 |
| RET | 7.82 | IC50 | 15.1 | nM | CHEMBL_ACT_26998450 |
| RET | 7.62 | IC50 | 24.1 | nM | CHEMBL_ACT_27031709 |
| RET | 7.62 | IC50 | 24.1 | nM | CHEMBL_ACT_27874019 |
| RET | 7.62 | IC50 | 24.1 | nM | CHEMBL_ACT_28281515 |
| RET | 7.53 | IC50 | 29.3 | nM | CHEMBL_ACT_26998399 |
| RET | 7.02 | IC50 | 95.3 | nM | CHEMBL_ACT_29235588 |
| KDR | 7 | IC50 | 100 | nM | CHEMBL_ACT_24867252 |
| RET | 6.97 | IC50 | 107.3 | nM | CHEMBL_ACT_29235590 |
| RET | 6.61 | IC50 | 244.1 | nM | CHEMBL_ACT_29235558 |
| RET | 6.28 | IC50 | 531 | nM | CHEMBL_ACT_27031712 |
| RET | 6.28 | IC50 | 531 | nM | CHEMBL_ACT_27874022 |
| RET | 6.28 | IC50 | 531 | nM | CHEMBL_ACT_28281518 |
Target pathways
Aggregated over 1 target gene(s): RET.
Top Reactome pathways
5 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| RAF/MAP kinase cascade | 1 | RET |
| RET signaling | 1 | RET |
| NPAS4 regulates expression of target genes | 1 | RET |
| Formation of the nephric duct | 1 | RET |
| Formation of the ureteric bud | 1 | RET |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| MAPK cascade | 1 |
| ureteric bud development | 1 |
| neural crest cell migration | 1 |
| embryonic epithelial tube formation | 1 |
| homophilic cell-cell adhesion | 1 |
| neuron cell-cell adhesion | 1 |
| signal transduction | 1 |
| cell surface receptor protein tyrosine kinase signaling pathway | 1 |
| axon guidance | 1 |
| posterior midgut development | 1 |
| positive regulation of gene expression | 1 |
| positive regulation of neuron projection development | 1 |
| regulation of cell adhesion | 1 |
| positive regulation of cell migration | 1 |
| membrane protein proteolysis | 1 |
Indications & clinical
Indications
4 approved indications. FDA phase 4, plus an anticancer drug’s labelled cancer uses (which ChEMBL often logs at phase 3).
| Indication | Phase | MONDO | EFO |
|---|---|---|---|
| non-small cell lung carcinoma | 4 | MONDO:0005233 | EFO:0003060 |
| neoplasm | 4 | MONDO:0005070 | EFO:0000616 |
| thyroid gland papillary carcinoma | 4 | MONDO:0005075 | EFO:0000641 |
| thyroid tumor | 4 | MONDO:0015074 | EFO:0003841 |
3 diseases in clinical trials (phase 1–3, investigational — not approved indications). Highest ChEMBL trial phase per disease; a non-cancer approved use is occasionally logged at phase 3 here.
| Disease (in trials) | Phase | MONDO | EFO |
|---|---|---|---|
| thyroid gland follicular carcinoma | 2 | MONDO:0005034 | EFO:0000501 |
| liver disorder | 1 | MONDO:0005154 | EFO:0001421 |
| kidney failure | 1 | MONDO:0001106 | HP:0000083 |
3 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 36.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE1 | 15 |
| PHASE2 | 11 |
| PHASE3 | 3 |
| Not specified | 3 |
| PHASE1/PHASE2 | 2 |
| PHASE4 | 1 |
| EARLY_PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT07010393 | PHASE4 | NOT_YET_RECRUITING | Genotype-Driven Neoadjuvant Therapy for Locally Advanced Thyroid Cancer: A Real-World Cohort Study |
| NCT04194944 | PHASE3 | ACTIVE_NOT_RECRUITING | A Study of Selpercatinib (LY3527723) in Participants With Advanced or Metastatic RET Fusion-Positive Non-Small Cell Lung Cancer |
| NCT04211337 | PHASE3 | ACTIVE_NOT_RECRUITING | A Study of Selpercatinib (LY3527723) in Participants With RET-Mutant Medullary Thyroid Cancer |
| NCT04819100 | PHASE3 | ACTIVE_NOT_RECRUITING | A Study of Selpercatinib After Surgery or Radiation in Participants With Non-Small Cell Lung Cancer (NSCLC) |
| NCT02925234 | PHASE2 | RECRUITING | The Drug Rediscovery Protocol (DRUP Trial) |
| NCT03155620 | PHASE2 | ACTIVE_NOT_RECRUITING | Targeted Therapy Directed by Genetic Testing in Treating Pediatric Patients With Relapsed or Refractory Advanced Solid Tumors, Non-Hodgkin Lymphomas, or Histiocytic Disorders (The Pediatric MATCH Screening Trial) |
| NCT03157128 | PHASE1/PHASE2 | ACTIVE_NOT_RECRUITING | A Study of Selpercatinib (LOXO-292) in Participants With Advanced Solid Tumors, RET Fusion-Positive Solid Tumors, and Medullary Thyroid Cancer (LIBRETTO-001) |
| NCT03899792 | PHASE1/PHASE2 | ACTIVE_NOT_RECRUITING | A Study of Oral LOXO-292 (Selpercatinib) in Pediatric Participants With Advanced Solid or Primary Central Nervous System (CNS) Tumors |
| NCT03944772 | PHASE2 | ACTIVE_NOT_RECRUITING | Phase 2 Platform Study in Patients With Advanced Non-Small Lung Cancer Who Progressed on First-Line Osimertinib Therapy (ORCHARD) |
| NCT04268550 | PHASE2 | ACTIVE_NOT_RECRUITING | Targeted Treatment for RET Fusion-Positive Advanced Non-Small Cell Lung Cancer (A LUNG-MAP Treatment Trial) |
| NCT04280081 | PHASE2 | ACTIVE_NOT_RECRUITING | A Study of Selpercatinib (LY3527723) in Participants With Advanced Solid Tumors Including RET Fusion-positive Solid Tumors, Medullary Thyroid Cancer and Other Tumors With RET Activation |
| NCT04320888 | PHASE2 | ACTIVE_NOT_RECRUITING | Selpercatinib for the Treatment of Advanced Solid Tumors, Lymphomas, or Histiocytic Disorders With Activating RET Gene Alterations, a Pediatric MATCH Treatment Trial |
| NCT04759911 | PHASE2 | ACTIVE_NOT_RECRUITING | Selpercatinib Before Surgery for the Treatment of RET-Altered Thyroid Cancer |
| NCT05668962 | PHASE2 | RECRUITING | Restor. I-131 Upt. + Selpercatinib in RET F-P RAI-R TC |
| NCT06458036 | PHASE2 | RECRUITING | Selpercatinib Pre-RAI in Patients With RET Fusion Thyroid Cancer (RAISE) |
| NCT04591431 | PHASE2 | UNKNOWN | The Rome Trial From Histology to Target: the Road to Personalize Target Therapy and Immunotherapy |
| NCT05364645 | PHASE2 | WITHDRAWN | Testing the Use of Targeted Treatment for RET Positive Advanced Non-small Cell Lung Cancer |
| NCT04782076 | PHASE1 | COMPLETED | A Drug Drug Interaction (DDI) Study of Selpercatinib and Dabigatran in Healthy Participants |
| NCT05089019 | PHASE1 | COMPLETED | A Study Comparing Two Formulations of Selpercatinib (LY3527723) in Healthy Participants |
| NCT05136404 | PHASE1 | COMPLETED | A Relative Bioavailability Study of Selpercatinib (LY3527723) in Healthy Participants |
| NCT05324124 | PHASE1 | COMPLETED | A Study of the Effect of Food on Selpercatinib (LY3527723) in Healthy Participants |
| NCT05338476 | PHASE1 | COMPLETED | A Study of Effects of Selpercatinib (LY3527723) on Midazolam in Healthy Participants |
| NCT05338489 | PHASE1 | COMPLETED | A Study of Effects of Itraconazole and Rifampin on Selpercatinib (LY3527723) in Healthy Participants |
| NCT05338502 | PHASE1 | COMPLETED | Study of H2 Antagonist and a Proton Pump Inhibitor of Selpercatinib in Healthy Participants |
| NCT05338515 | PHASE1 | COMPLETED | A Study of Selpercatinib (LY3527723) in Healthy Participants |
| NCT05436912 | PHASE1 | COMPLETED | A Study of Effects of Selpercatinib in Hepatically Impaired Participants and Healthy Participants |
| NCT05468164 | PHASE1 | COMPLETED | A Study of Effect of Food and a Proton Pump Inhibitor on Selpercatinib (LY3527723) in Healthy Participants |
| NCT05469100 | PHASE1 | COMPLETED | A Study of Effect of Selpercatinib (LY3527723) in Participants With Normal and Impaired Renal Function |
| NCT05469113 | PHASE1 | COMPLETED | A Study of Effects of Selpercatinib (LY3527723) on Repaglinide in Healthy Participants |
| NCT05630274 | PHASE1 | COMPLETED | A Study of Effect of Selpercatinib (LY3527723) on Corrected QT (QTc) Interval in Healthy Participants |
| NCT05630287 | PHASE1 | COMPLETED | A Study of Absorption, Metabolism, Excretion, and Absolute Bioavailability of Carbon-14-Labelled [14C] Selpercatinib (LY3527723) in Healthy Male Participants |
| NCT05906836 | PHASE1 | COMPLETED | A Drug Drug Interaction (DDI) Study of Selpercatinib (LY3527723) and Rosuvastatin in Healthy Participants |
| NCT07146893 | EARLY_PHASE1 | NOT_YET_RECRUITING | Feasibility Study for Repurposing RET Inhibitors |
| NCT06532149 | Not specified | RECRUITING | ERectile Dysfunctions, gOnadotoxicity and Sexual Health Assessment in Men With Lung Cancer |
| NCT03906331 | Not specified | APPROVED_FOR_MARKETING | Expanded Access for the Treatment of Cancers With Rearranged During Transfection (RET) Activation |
| NCT07543887 | Not specified | COMPLETED | Selpercatinib and Body Composition |
Clinical evidence (CIViC)
Variant × indication × effect (31 predictive associations from 40 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| RET Fusion | Lung Non-small Cell Carcinoma | Sensitivity/Response | Selpercatinib | CIViC A | EID11318 +3 |
| RET Mutation | Medullary Thyroid Carcinoma | Sensitivity/Response | Selpercatinib | CIViC A | EID12157 +2 |
| RET Fusion OR RET Mutation | Solid Tumor | Sensitivity/Response | Selpercatinib | CIViC A | EID12056 +1 |
| RET Fusion | Thyroid Cancer | Sensitivity/Response | Selpercatinib | CIViC A | EID8852 |
| RET M918T | Medullary Thyroid Carcinoma | Sensitivity/Response | Selpercatinib | CIViC A | EID12598 |
| RET E632_L633del | Medullary Thyroid Carcinoma | Sensitivity/Response | Selpercatinib | CIViC B | EID11875 +2 |
| KIF5B::RET Fusion | Lung Cancer | Sensitivity/Response | Selpercatinib | CIViC B | EID7067 |
| RET Fusion | Solid Tumor | Sensitivity/Response | Selpercatinib | CIViC B | EID12134 |
| RET Fusion | Papillary Thyroid Carcinoma | Sensitivity/Response | Selpercatinib | CIViC B | EID7069 |
| RET V804M | Medullary Thyroid Carcinoma | Sensitivity/Response | Selpercatinib | CIViC C | EID6951 +1 |
| KIF5B::RET Fusion | Lung Non-small Cell Carcinoma | Sensitivity/Response | Selpercatinib | CIViC C | EID6948 |
| RET D378_G685>E | Medullary Thyroid Carcinoma | Sensitivity/Response | Selpercatinib | CIViC C | EID11658 |
| RET M918T AND RET V804M | Medullary Thyroid Carcinoma | Sensitivity/Response | Selpercatinib | CIViC C | EID6950 |
| KIF5B::RET Fusion AND ( RET G810C OR RET G810S OR RET G810R ) | Lung Non-small Cell Carcinoma | Resistance | Selpercatinib | CIViC C | EID8195 |
| KIF5B::RET Fusion AND RET G810S | Lung Non-small Cell Carcinoma | Resistance | Selpercatinib | CIViC C | EID12496 |
| RET G810C | Cancer | Resistance | Pralsetinib + Selpercatinib | CIViC C | EID8918 |
| RET G810S | Medullary Thyroid Carcinoma | Resistance | Pralsetinib + Selpercatinib | CIViC C | EID8919 |
| RET M918T AND RET G810S | Medullary Thyroid Carcinoma | Resistance | Selpercatinib | CIViC C | EID8196 |
| RET Y806C | Medullary Thyroid Carcinoma | Resistance | Pralsetinib + Selpercatinib | CIViC C | EID8920 |
| RET Y806N | Medullary Thyroid Carcinoma | Resistance | Pralsetinib + Selpercatinib | CIViC C | EID8921 |
| KIF5B::RET Fusion | Cancer | Sensitivity/Response | Selpercatinib | CIViC D | EID12814 |
| RET C618R | Cancer | Sensitivity/Response | Selpercatinib | CIViC D | EID11877 |
| RET D898_E901del | Cancer | Sensitivity/Response | Pralsetinib + Selpercatinib | CIViC D | EID11870 |
| RET E632_L633del | Cancer | Sensitivity/Response | Selpercatinib | CIViC D | EID12712 |
| RET Fusion | Cancer | Sensitivity/Response | Selpercatinib | CIViC D | EID6949 |
| RET M918T | Cancer | Sensitivity/Response | Pralsetinib + Selpercatinib | CIViC D | EID11867 |
| RET M918T | Cancer | Sensitivity/Response | Selpercatinib | CIViC D | EID11876 |
| RET T930K | Cancer | Sensitivity/Response | Pralsetinib + Selpercatinib | CIViC D | EID11869 |
| RET T930P | Cancer | Sensitivity/Response | Pralsetinib + Selpercatinib | CIViC D | EID11868 |
| RET E632_L633del | Cancer | Resistance | Selpercatinib + Pralsetinib | CIViC D | EID12715 |
+1 more predictive associations (showing top 30 by level).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
109 molecules share ≥1 primary target. Top 100 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AFATINIB | ChEMBL + PubChem | Phase 4 (approved) | RET |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | RET |
| FOSTAMATINIB | ChEMBL + PubChem | Phase 4 (approved) | RET |
| GEFITINIB | ChEMBL + PubChem | Phase 4 (approved) | RET |
| PAZOPANIB | ChEMBL + PubChem | Phase 4 (approved) | RET |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | RET |
| ALECTINIB | ChEMBL | Phase 4 (approved) | RET |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | RET |
| AXITINIB | ChEMBL | Phase 4 (approved) | RET |
| BARICITINIB | ChEMBL | Phase 4 (approved) | RET |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | RET |
| BRIGATINIB | ChEMBL | Phase 4 (approved) | RET |
| CABOZANTINIB | ChEMBL | Phase 4 (approved) | RET |
| CAPIVASERTIB | ChEMBL | Phase 4 (approved) | RET |
| CERITINIB | ChEMBL | Phase 4 (approved) | RET |
| CYCLOBENZAPRINE | ChEMBL | Phase 4 (approved) | RET |
| DASATINIB | ChEMBL | Phase 4 (approved) | RET |
| ENTRECTINIB | ChEMBL | Phase 4 (approved) | RET |
| ERLOTINIB | ChEMBL | Phase 4 (approved) | RET |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | RET |
| GILTERITINIB | ChEMBL | Phase 4 (approved) | RET |
| IBRUTINIB | ChEMBL | Phase 4 (approved) | RET |
| INFIGRATINIB | ChEMBL | Phase 4 (approved) | RET |
| LAPATINIB | ChEMBL | Phase 4 (approved) | RET |
| LENVATINIB | ChEMBL | Phase 4 (approved) | RET |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | RET |
| NILOTINIB | ChEMBL | Phase 4 (approved) | RET |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | RET |
| NORTRIPTYLINE | ChEMBL | Phase 4 (approved) | RET |
| PALBOCICLIB | ChEMBL | Phase 4 (approved) | RET |
| PONATINIB | ChEMBL | Phase 4 (approved) | RET |
| PRALSETINIB | ChEMBL | Phase 4 (approved) | RET |
| QUIZARTINIB | ChEMBL | Phase 4 (approved) | RET |
| RUXOLITINIB | ChEMBL | Phase 4 (approved) | RET |
| SORAFENIB | ChEMBL | Phase 4 (approved) | RET |
| SUNITINIB | ChEMBL | Phase 4 (approved) | RET |
| TIVOZANIB | ChEMBL | Phase 4 (approved) | RET |
| TOFACITINIB | ChEMBL | Phase 4 (approved) | RET |
| UPADACITINIB | ChEMBL | Phase 4 (approved) | RET |
| VANDETANIB | ChEMBL | Phase 4 (approved) | RET |
| VEMURAFENIB | ChEMBL | Phase 4 (approved) | RET |
| ALISERTIB | ChEMBL | Phase 3 | RET |
| AMITRIPTYLINOXIDE | ChEMBL | Phase 3 | RET |
| BARASERTIB | ChEMBL | Phase 3 | RET |
| BRIVANIB | ChEMBL | Phase 3 | RET |
| BRIVANIB ALANINATE | ChEMBL | Phase 3 | RET |
| CANERTINIB | ChEMBL | Phase 3 | RET |
| CEDIRANIB | ChEMBL | Phase 3 | RET |
| CRENOLANIB | ChEMBL | Phase 3 | RET |
| DEFACTINIB | ChEMBL | Phase 3 | RET |
| DOVITINIB | ChEMBL | Phase 3 | RET |
| LESTAURTINIB | ChEMBL | Phase 3 | RET |
| LINIFANIB | ChEMBL | Phase 3 | RET |
| MOTESANIB | ChEMBL | Phase 3 | RET |
| ORANTINIB | ChEMBL | Phase 3 | RET |
| POZIOTINIB | ChEMBL | Phase 3 | RET |
| QUERCETIN | ChEMBL | Phase 3 | RET |
| RIVOCERANIB | ChEMBL | Phase 3 | RET |
| SARACATINIB | ChEMBL | Phase 3 | RET |
| SEMAXANIB | ChEMBL | Phase 3 | RET |
| TESEVATINIB | ChEMBL | Phase 3 | RET |
| VATALANIB | ChEMBL | Phase 3 | RET |
| AEE-788 | ChEMBL | Phase 2 | RET |
| AT-9283 | ChEMBL | Phase 2 | RET |
| AZD-1480 | ChEMBL | Phase 2 | RET |
| BAFETINIB | ChEMBL | Phase 2 | RET |
| BEMCENTINIB | ChEMBL | Phase 2 | RET |
| BFH-772 | ChEMBL | Phase 2 | RET |
| BMS-690514 | ChEMBL | Phase 2 | RET |
| BMS-754807 | ChEMBL | Phase 2 | RET |
| BMS-777607 | ChEMBL | Phase 2 | RET |
| CENISERTIB | ChEMBL | Phase 2 | RET |
| CEP-11981 | ChEMBL | Phase 2 | RET |
| CEP-32496 | ChEMBL | Phase 2 | RET |
| CERDULATINIB | ChEMBL | Phase 2 | RET |
| DANUSERTIB | ChEMBL | Phase 2 | RET |
| DEFOSBARASERTIB | ChEMBL | Phase 2 | RET |
| DORAMAPIMOD | ChEMBL | Phase 2 | RET |
| ENMD-2076 | ChEMBL | Phase 2 | RET |
| FGFR INHIBITOR DEBIO 1347 | ChEMBL | Phase 2 | RET |
| FORETINIB | ChEMBL | Phase 2 | RET |
| GOLVATINIB | ChEMBL | Phase 2 | RET |
| ILORASERTIB | ChEMBL | Phase 2 | RET |
| LUCITANIB | ChEMBL | Phase 2 | RET |
| MERESTINIB | ChEMBL | Phase 2 | RET |
| MILCICLIB | ChEMBL | Phase 2 | RET |
| MIVAVOTINIB | ChEMBL | Phase 2 | RET |
| MK-2461 | ChEMBL | Phase 2 | RET |
| NARAZACICLIB | ChEMBL | Phase 2 | RET |
| OSI-027 | ChEMBL | Phase 2 | RET |
| OSI-632 | ChEMBL | Phase 2 | RET |
| PEXMETINIB | ChEMBL | Phase 2 | RET |
| R-406 | ChEMBL | Phase 2 | RET |
| RAF-265 | ChEMBL | Phase 2 | RET |
| REBASTINIB | ChEMBL | Phase 2 | RET |
| SAPITINIB | ChEMBL | Phase 2 | RET |
| SCH-900776 | ChEMBL | Phase 2 | RET |
| SU-014813 | ChEMBL | Phase 2 | RET |
| TG100-801 | ChEMBL | Phase 2 | RET |
| TOZASERTIB | ChEMBL | Phase 2 | RET |
Related Atlas pages
- Genes: RET
- Indicated for: non-small cell lung carcinoma, neoplasm, thyroid gland papillary carcinoma, thyroid tumor, medullary thyroid gland carcinoma, thyroid gland carcinoma, lung carcinoma, cancer
- In clinical trials for: thyroid gland follicular carcinoma
- Drugs: Afatinib, Crizotinib, Fostamatinib, Gefitinib, Pazopanib, Regorafenib, Alectinib, Amitriptyline, Axitinib, Baricitinib, Bosutinib, Brigatinib, Cabozantinib, Capivasertib, Ceritinib, Cyclobenzaprine, Dasatinib, Entrectinib, Erlotinib, Fedratinib, Gilteritinib, Ibrutinib, Infigratinib, Lapatinib, Lenvatinib, Midostaurin, Nilotinib, Nintedanib, Nortriptyline, Palbociclib, Ponatinib, Pralsetinib, Quizartinib, Ruxolitinib, Sorafenib, Sunitinib, Tivozanib, Tofacitinib, Upadacitinib, Vandetanib, Vemurafenib, Alisertib, Amitriptylinoxide, Barasertib, Brivanib, Brivanib Alaninate, Canertinib, Cediranib, Crenolanib, Defactinib, Dovitinib, Lestaurtinib, Linifanib, Motesanib, Orantinib, Poziotinib, Quercetin, Rivoceranib, Saracatinib, Semaxanib, Tesevatinib, Vatalanib