Simvastatin
drugOn this page
Also known as C10AA01FlolipidLacersaMK-0733MK-733NSC-758706RanzolontSimvadorSimvastatin component of juvisyncSimvastatin component of polycapSimvastatin component of simcorSimvastatin component of vytorinSimvastatinaSimvastatineSynvinolinZocorZocor heart-proSID50086525SID496592
Summary
Simvastatin (CHEMBL1064) is an approved small-molecule EC 3.4.24.83 (anthrax lethal factor endopeptidase) inhibitor (ATC C10AA01) targeting HMGCR; indicated across 108 conditions including cardiovascular disorder and familial hypercholesterolemia.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: C10AA01
- Targets: 1 (HMGCR)
- Indications: 108 conditions
- Clinical trials: 450
- Chemistry: 418.6 Da · C25H38O5
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1064 |
| Name | Simvastatin |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 54454 |
| ChEBI | CHEBI:9150 |
| ATC | C10AA01 |
| Molecular formula | C25H38O5 |
| Molecular weight | 418.6 |
| InChIKey | RYMZZMVNJRMUDD-HGQWONQESA-N |
SMILES: CCC(C)(C)C(=O)O[C@H]1C[C@H](C=C2[C@H]1[C@H]([C@H](C=C2)C)CC[C@@H]3C[C@H](CC(=O)O3)O)C
IUPAC name: [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate
ChEBI definition: A member of the class of hexahydronaphthalenes that is lovastatin in which the 2-methylbutyrate ester moiety has been replaced by a 2,2-dimethylbutyrate ester group. It is used as a cholesterol-lowering and anti-cardiovascular disease drug.
Pharmacological roles (ChEBI): EC 3.4.24.83 (anthrax lethal factor endopeptidase) inhibitor, prodrug, EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor, ferroptosis inducer, geroprotector.
Also known as: C10AA01, Flolipid, Lacersa, MK-0733, MK-733, NSC-758706, Ranzolont, Simvador, Simvastatin, Simvastatin component of juvisync, Simvastatin component of polycap, Simvastatin component of simcor
Patent coverage: 37,438 distinct patent families (123,163 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| HMGCR | hydroxymethylglutaryl-CoA reductase | Competitive | 7.92 | 84.4% | P04035 |
Broader ChEMBL bioactivity targets: 39 (assay-derived). Sample: 3-hydroxy-3-methylglutaryl-coenzyme A reductase, Ferritin light chain, Solute carrier organic anion transporter family member 1B1, 5-hydroxytryptamine receptor 2B, Alpha-2C adrenergic receptor, Alpha-2B adrenergic receptor, Beta-lactamase, Glucocorticoid receptor, Bile acid receptor, D(1A) dopamine receptor.
Bioactivity
ChEMBL activities: 38 potent at pChembl ≥ 5 of 71 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| HMGCR | 9.05 | IC50 | 0.9 | nM | CHEMBL_ACT_18168811 |
| P51639 | 9.05 | IC50 | 0.9 | nM | CHEMBL_ACT_25041352 |
| P51639 | 9.05 | IC50 | 0.9 | nM | CHEMBL_ACT_29284799 |
| HMGCR | 8.59 | Ki | 2.6 | nM | CHEMBL_ACT_1436563 |
| HMGCR | 8.47 | IC50 | 3.39 | nM | CHEMBL_ACT_7822360 |
| P51639 | 8.37 | IC50 | 4.3 | nM | CHEMBL_ACT_2218034 |
| HMGCR | 7.96 | IC50 | 11 | nM | CHEMBL_ACT_1439881 |
| HMGCR | 7.95 | IC50 | 11.2 | nM | CHEMBL_ACT_1436564 |
| P51639 | 7.75 | IC50 | 18 | nM | CHEMBL_ACT_1974261 |
| HMGCR | 7.4 | IC50 | 39.81 | nM | CHEMBL_ACT_15088046 |
| HMGCR | 7.31 | IC50 | 49 | nM | CHEMBL_ACT_1907613 |
| HMGCR | 7.31 | IC50 | 49 | nM | CHEMBL_ACT_2036414 |
| NR1I3 | 6.24 | AC50 | 570 | nM | CHEMBL_ACT_25164334 |
| NR1H4 | 6.24 | AC50 | 570 | nM | CHEMBL_ACT_25234612 |
| P81908 | 6.12 | Ki | 750 | nM | CHEMBL_ACT_12481282 |
| O42275 | 5.75 | Ki | 1800 | nM | CHEMBL_ACT_12481279 |
| DRD1 | 5.75 | AC50 | 1800 | nM | CHEMBL_ACT_25180995 |
| NR1I2 | 5.66 | AC50 | 2196 | nM | CHEMBL_ACT_25188525 |
| HTR2A | 5.64 | AC50 | 2300 | nM | CHEMBL_ACT_25225616 |
| Q63921 | 5.55 | AC50 | 2800 | nM | CHEMBL_ACT_25173867 |
| CYP2C8 | 5.43 | IC50 | 3700 | nM | CHEMBL_ACT_15447378 |
| NR1I2 | 5.42 | AC50 | 3800 | nM | CHEMBL_ACT_25224005 |
| HTR2B | 5.42 | AC50 | 3800 | nM | CHEMBL_ACT_25227986 |
| SLCO1B1 | 5.36 | IC50 | 4400 | nM | CHEMBL_ACT_15448313 |
| ADRB3 | 5.33 | AC50 | 4700 | nM | CHEMBL_ACT_25153421 |
| P81908 | 5.3 | Ki | 5012 | nM | CHEMBL_ACT_12481296 |
| NR4A2 | 5.29 | EC50 | 5100 | nM | CHEMBL_ACT_24824515 |
| TBXA2R | 5.27 | AC50 | 5373 | nM | CHEMBL_ACT_25198311 |
| SLCO1B1 | 5.22 | IC50 | 6000 | nM | CHEMBL_ACT_15448321 |
| SLC6A3 | 5.22 | AC50 | 6067 | nM | CHEMBL_ACT_25125426 |
Target pathways
Aggregated over 1 target gene(s): HMGCR.
Top Reactome pathways
5 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Cholesterol biosynthesis | 1 | HMGCR |
| PPARA activates gene expression | 1 | HMGCR |
| Activation of gene expression by SREBF (SREBP) | 1 | HMGCR |
| EGR2 and SOX10-mediated initiation of Schwann cell myelination | 1 | HMGCR |
| Lanosterol biosynthesis | 1 | HMGCR |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| cholesterol biosynthetic process | 1 |
| isoprenoid biosynthetic process | 1 |
| visual learning | 1 |
| coenzyme A metabolic process | 1 |
| sterol biosynthetic process | 1 |
| negative regulation of protein catabolic process | 1 |
| negative regulation of protein secretion | 1 |
| long-term synaptic potentiation | 1 |
| regulation of ERK1 and ERK2 cascade | 1 |
| negative regulation of amyloid-beta clearance | 1 |
| lipid metabolic process | 1 |
| steroid biosynthetic process | 1 |
| steroid metabolic process | 1 |
| cholesterol metabolic process | 1 |
Indications & clinical
Indications
108 indications (9 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| cardiovascular disorder | 4 | MONDO:0004995 | EFO:0000319 |
| familial hypercholesterolemia | 4 | MONDO:0005439 | EFO:0004911 |
| myocardial infarction | 4 | MONDO:0005068 | EFO:0000612 |
| stroke disorder | 4 | MONDO:0005098 | EFO:0000712 |
| coronary artery disorder | 4 | MONDO:0005010 | EFO:0001645 |
| acute myocardial infarction | 4 | MONDO:0004781 | EFO:0008583 |
| hyperlipidemia | 4 | MONDO:0021187 | MONDO:0021187 |
| chronic obstructive pulmonary disease | 3 | MONDO:0005002 | EFO:0000341 |
| hypertriglyceridemia | 3 | MONDO:0005347 | EFO:0004211 |
| pneumonia | 3 | MONDO:0005249 | EFO:0003106 |
| relapsing-remitting multiple sclerosis | 3 | MONDO:0005314 | EFO:0003929 |
| subarachnoid hemorrhage | 3 | MONDO:0005099 | EFO:0000713 |
| chronic kidney disease | 3 | MONDO:0005300 | EFO:0003884 |
| polycystic ovary syndrome | 3 | MONDO:0008487 | EFO:0000660 |
| atherosclerosis | 3 | MONDO:0005311 | EFO:0003914 |
| hypertensive disorder | 3 | MONDO:0005044 | EFO:0000537 |
| diabetic retinopathy | 3 | MONDO:0005266 | EFO:0003770 |
| cirrhosis of liver | 3 | MONDO:0005155 | EFO:0001422 |
| acute coronary syndrome | 3 | MONDO:0005542 | EFO:0005672 |
| myocardial ischemia | 3 | MONDO:0024644 | EFO:1001375 |
| diabetic kidney disease | 3 | MONDO:0005016 | EFO:0000401 |
| sclerosing cholangitis | 3 | MONDO:0018646 | EFO:0004268 |
| secondary progressive multiple sclerosis | 3 | MONDO:0000450 | EFO:0008522 |
| portal hypertension | 3 | MONDO:0005080 | EFO:0000666 |
| gastric neoplasm | 3 | MONDO:0021085 | MONDO:0001056 |
| intestinal cancer | 3 | MONDO:0005814 | MONDO:0021118 |
| diabetes mellitus | 3 | MONDO:0005015 | EFO:0000400 |
| optic neuritis | 3 | MONDO:0005885 | EFO:0007405 |
| severe acute respiratory syndrome | 3 | MONDO:0005091 | MONDO:0100096 |
| influenza | 3 | MONDO:0005812 | EFO:0007328 |
| essential hypertension | 3 | MONDO:0001134 | MONDO:0001134 |
| Alzheimer disease | 3 | MONDO:0004975 | MONDO:0004975 |
| asthma | 3 | MONDO:0004979 | MONDO:0004979 |
| type 2 diabetes mellitus | 3 | MONDO:0005148 | MONDO:0005148 |
| multiple sclerosis | 3 | MONDO:0005301 | MONDO:0005301 |
| Noonan syndrome | 3 | MONDO:0018997 | MONDO:0018997 |
| aortic valve stenosis | 3 | MONDO:0042981 | HP:0001650 |
| colorectal neoplasm | 3 | MONDO:0005335 | MONDO:0005575 |
| atrial fibrillation | 2 | MONDO:0004981 | EFO:0000275 |
| breast carcinoma | 2 | MONDO:0004989 | EFO:0000305 |
| intracerebral hemorrhage | 2 | MONDO:0013792 | EFO:0005669 |
| non-small cell lung carcinoma | 2 | MONDO:0005233 | EFO:0003060 |
| peripheral arterial disease | 2 | MONDO:0005386 | EFO:0004265 |
| toxic shock syndrome | 2 | MONDO:0001881 | EFO:0006834 |
| pulmonary arterial hypertension | 2 | MONDO:0015924 | EFO:0001361 |
| vitiligo | 2 | MONDO:0008661 | EFO:0004208 |
| sinusitis | 2 | MONDO:0005961 | EFO:0007486 |
| periodontitis | 2 | MONDO:0005076 | EFO:0000649 |
| rectal cancer | 2 | MONDO:0006519 | EFO:1000657 |
| uveitis | 2 | MONDO:0020283 | EFO:1001231 |
| small cell lung carcinoma | 2 | MONDO:0008433 | EFO:0000702 |
| uterine corpus leiomyoma | 2 | MONDO:0007886 | EFO:0000731 |
| plasma cell myeloma | 2 | MONDO:0009693 | EFO:0001378 |
| prostate carcinoma | 2 | MONDO:0005159 | EFO:0001663 |
| exocrine pancreatic carcinoma | 2 | MONDO:0005192 | EFO:0002618 |
| intermittent vascular claudication | 2 | MONDO:0005295 | EFO:0003876 |
| prediabetes syndrome | 2 | MONDO:0006920 | EFO:1001121 |
| mucositis | 2 | MONDO:0020579 | EFO:1001898 |
| dilated cardiomyopathy | 2 | MONDO:0005021 | EFO:0000407 |
| Waldenstrom macroglobulinemia | 2 | MONDO:0100280 | EFO:0009441 |
| carotid artery disorder | 2 | MONDO:0005269 | EFO:0009783 |
| acute pancreatitis | 2 | MONDO:0006515 | EFO:1000652 |
| pulmonary hypertension | 2 | MONDO:0005149 | MONDO:0005149 |
| breast neoplasm | 2 | MONDO:0021100 | MONDO:0007254 |
| lung neoplasm | 2 | MONDO:0021117 | MONDO:0008903 |
| type 1 diabetes mellitus | 2 | MONDO:0005147 | MONDO:0005147 |
| Parkinson disease | 2 | MONDO:0005180 | MONDO:0005180 |
| migraine disorder | 2 | MONDO:0005277 | MONDO:0005277 |
| Smith-Lemli-Opitz syndrome | 2 | MONDO:0010035 | MONDO:0010035 |
| sickle cell disease | 2 | MONDO:0011382 | MONDO:0011382 |
| hepatocellular carcinoma | 2 | MONDO:0007256 | EFO:0000182 |
| malignant pancreatic neoplasm | 2 | MONDO:0009831 | EFO:1000359 |
| bipolar disorder | 2 | MONDO:0004985 | MONDO:0004985 |
| hepatitis B virus infection | 1 | MONDO:0005344 | EFO:0004197 |
| HIV infectious disease | 1 | MONDO:0005109 | EFO:0000764 |
| B-cell chronic lymphocytic leukemia | 1 | MONDO:0004948 | EFO:0000095 |
| alopecia areata | 1 | MONDO:0005340 | EFO:0004192 |
| epilepsy | 1 | MONDO:0005027 | EFO:0000474 |
| rheumatoid arthritis | 1 | MONDO:0008383 | EFO:0000685 |
| vascular disorder | 1 | MONDO:0005385 | EFO:0004264 |
| sleep disorder | 1 | MONDO:0100081 | EFO:0008568 |
| cystic fibrosis | 1 | MONDO:0009061 | MONDO:0009061 |
| choroideremia | 1 | MONDO:0010557 | MONDO:0010557 |
| systemic lupus erythematosus | 1 | MONDO:0007915 | MONDO:0007915 |
| obesity disorder | 1 | MONDO:0011122 | EFO:0001073 |
| dental caries | 1 | MONDO:0005276 | EFO:0003819 |
| heart failure | 0 | MONDO:0005252 | EFO:0003144 |
| lymphoma | 0 | MONDO:0005062 | EFO:0000574 |
| ovarian cancer | 0 | MONDO:0008170 | MONDO:0008170 |
| chronic pancreatitis | 0 | MONDO:0005003 | EFO:0000342 |
| exposure, dental pulp | 0 | MONDO:0020812 | EFO:1001782 |
| neoplasm | 0 | MONDO:0005070 | MONDO:0004992 |
| hemangioma | 0 | MONDO:0006500 | EFO:1000635 |
15 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 450.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 98 |
| PHASE4 | 97 |
| PHASE1 | 78 |
| PHASE2 | 74 |
| Not specified | 64 |
| PHASE2/PHASE3 | 14 |
| EARLY_PHASE1 | 13 |
| PHASE1/PHASE2 | 12 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT05059626 | PHASE4 | RECRUITING | Endometriosis and Microvascular Dysfunction; Simvastatin and Duavee |
| NCT06399783 | PHASE4 | NOT_YET_RECRUITING | Topical Simvastatin Versus Topical Steroid in Treatment of Alopecia Areata |
| NCT00079638 | PHASE4 | COMPLETED | Comparative Efficacy Evaluation of Lipids When Treated With Niaspan & Statin or Other Lipid-Modifying Therapies-COMPELL |
| NCT00125593 | PHASE4 | COMPLETED | Study of Heart and Renal Protection |
| NCT00141141 | PHASE4 | COMPLETED | Efficacy And Safety Study Of Atorvastatin Versus Simvastatin In Type 2 Diabetic Subjects With Hypercholesterolemia |
| NCT00146068 | PHASE4 | COMPLETED | EARLY IFNB-1a and Simvastatin Combination Therapy in Clinically Isolated Syndrome Suggestive of Multiple Sclerosis |
| NCT00159835 | PHASE4 | COMPLETED | Atorvastatin Versus Simvastatin In The Prevention Of Coronary Heart Disease (CHD) In Patients With Known CHD |
| NCT00166530 | PHASE4 | COMPLETED | EASEGO Study: Doubling of Atorvastatin/Simvastatin or INEGY in Patients With Hypercholesterolemia and Coronary Artery Disease(CAD)(0653A-089) |
| NCT00185107 | PHASE4 | COMPLETED | Effect of Combination Therapy With Two Drugs (Colesevelam and Ezetimibe) in Patients With High Cholesterol |
| NCT00189085 | PHASE4 | COMPLETED | Effects of Ezetimibe on Postprandial Hyperlipidemia and Endothelial Function |
| NCT00259441 | PHASE4 | COMPLETED | PROMISS: Simvastatin Prevents the Contrast Induced Acute Renal Failure in Patients With Renal Insufficiency Undergoing Coronary Angiography |
| NCT00291863 | PHASE4 | UNKNOWN | Simvastatin Effect on End Stage Renal Failure Patients Treated by Peritoneal Dialysis |
| NCT00303277 | PHASE4 | COMPLETED | Do HMG CoA Reductase Inhibitors Affect Abeta Levels? |
| NCT00306826 | PHASE4 | WITHDRAWN | Pioglitazone in Impaired Glucose Tolerance |
| NCT00317993 | PHASE4 | COMPLETED | LDL Receptor Under Ezetimibe and Simvastatin |
| NCT00330980 | PHASE4 | COMPLETED | Effects of Statin Medications on Mental Processes, Behavior, and Serotonin Levels |
| NCT00404599 | PHASE4 | UNKNOWN | Oxidative Stress Lowering Effect of Simvastatin and Atorvastatin. |
| NCT00423579 | PHASE4 | COMPLETED | The Effects of Ezetimibe/Simvastatin 10/20 mg Versus Simvastatin 40 mg in High Cholesterol and Coronary Heart Disease Study (P04039AM2)(COMPLETED) |
| NCT00450840 | PHASE4 | UNKNOWN | Simvastatin in Patients With Septic Shock |
| NCT00451828 | PHASE4 | COMPLETED | Cholesterol and Pharmacogenetic Study |
| NCT00466401 | PHASE4 | COMPLETED | Effect of Ezetimibe on Platelet Aggregation and LDL Tendency to Peroxidation |
| NCT00481351 | PHASE4 | COMPLETED | Effects of Statin and Ezetimibe Association on Kinetics of Artificial Chilomicrons |
| NCT00492765 | PHASE4 | COMPLETED | Simvastatin as an Add-on Treatment to Interferon-beta-1a for the Treatment of Relapsing-Remitting Multiple Sclerosis |
| NCT00506961 | PHASE4 | COMPLETED | Evaluate the Efficacy and Safety of Rosuvastatin Versus Simvastatin in Type 2 Diabetic Patients With Dyslipidemia |
| NCT00522158 | PHASE4 | COMPLETED | Effects of Achieving Very Low LDL-Cholesterol After Treatment With Statins on Steroidogenesis and Cognition |
| NCT00535925 | PHASE4 | COMPLETED | Nephropathy In Type 2 Diabetes and Cardio-renal Events |
| NCT00560170 | PHASE4 | COMPLETED | Vascular Effects of Ezetimibe/Simvastatin and Simvastatin on Atherosclerosis |
| NCT00650663 | PHASE4 | COMPLETED | Ezetimibe Plus Simvastatin Versus Simvastatin Alone in African-American Subjects With Primary Hypercholesterolemia (P03377) |
| NCT00652444 | PHASE4 | COMPLETED | Effect Of Ezetimibe Coadministration With Simvastatin In A Middle Eastern Population: A Prospective, Multicentre, Randomized, Double-Blind, Placebo-Controlled Trial (0653-151) |
| NCT00652717 | PHASE4 | COMPLETED | Study To Assess The Efficacy Of A Cholesterol Lowering Drug On Top Of Statins In Patients After Myocardial Infarction (MI)(0653A-150) |
| NCT00653835 | PHASE4 | COMPLETED | Ezetimibe Plus Simvastatin Versus Simvastatin in Untreated Subjects With High Cholesterol (P03435) |
| NCT00656292 | PHASE4 | COMPLETED | Assessing the Role of Statin Therapy and Perioperative Inflammatory Response in Patients Undergoing Major Orthopedic Surgery |
| NCT00669435 | PHASE4 | UNKNOWN | Losartan and Simvastatin in Hypertensive Obeses With Liver Steatosis |
| NCT00672464 | PHASE4 | WITHDRAWN | Cardio Risk of Acute Schizophrenia Olanzapine Duke |
| NCT00678743 | PHASE4 | COMPLETED | An Open-label Extension to Assess the Continued Efficacy of Omacor Plus Simvastatin |
| NCT00680641 | PHASE4 | UNKNOWN | Simvastatin in Chronic Obstructive Pulmonary Disease (COPD) |
| NCT00699023 | PHASE4 | COMPLETED | Ezetimibe and Statins on Postprandial Lipemia in Type 2 Diabetes |
| NCT00704548 | PHASE4 | UNKNOWN | Antihypertensive Effect of Simvastatin in Hypertensive Patients |
| NCT00712049 | PHASE4 | UNKNOWN | Effects of Nicotinic Acid Plus Simvastatin Versus Simvastatin Alone on Carotid and Femoral Intima-Media Thickness in Patients With Peripheral Artery Disease (NASCIT) |
| NCT00736463 | PHASE4 | UNKNOWN | Crossover of Higher Dose Statins in Patients With Low High-density Lipoproteins Cholesterol (HDLc) |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (5) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of CPIC Guideline for simvastatin and SLCO1B1 | CPIC | SLCO1B1 | yes | yes |
| Annotation of DPWG Guideline for simvastatin and SLCO1B1 | DPWG | SLCO1B1 | yes | yes |
| Annotation of RNPGx Guideline for hmg coa reductase inhibitors, simvas | RNPGx | SLCO1B1 | yes | yes |
| Annotation of CPIC Guideline for atorvastatin, fluvastatin, lovastatin | CPIC | ABCG2 | ||
| Annotation of CPIC Guideline for atorvastatin, fluvastatin, lovastatin | CPIC | CYP3A4;CYP3A5;HMGCR |
PharmGKB also curates 55 clinical and 213 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
13 molecules share ≥1 primary target. Top 13 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ATORVASTATIN | ChEMBL + PubChem | Phase 4 (approved) | HMGCR |
| LOVASTATIN | ChEMBL + PubChem | Phase 4 (approved) | HMGCR |
| PITAVASTATIN | ChEMBL + PubChem | Phase 4 (approved) | HMGCR |
| PRAVASTATIN | ChEMBL + PubChem | Phase 4 (approved) | HMGCR |
| ROSUVASTATIN | ChEMBL + PubChem | Phase 4 (approved) | HMGCR |
| CERIVASTATIN | ChEMBL | Phase 4 (approved) | HMGCR |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | HMGCR |
| FLUVASTATIN | ChEMBL | Phase 4 (approved) | HMGCR |
| TANNIC ACID | ChEMBL | Phase 4 (approved) | HMGCR |
| GLENVASTATIN | ChEMBL | Phase 2 | HMGCR |
| MEGLUTOL | ChEMBL | Phase 2 | HMGCR |
| MEVASTATIN | ChEMBL | Phase 2 | HMGCR |
| Vorinostat | PubChem | Approved | HMGCR |
Related Atlas pages
- Genes: HMGCR
- Diseases: cardiovascular disorder, familial hypercholesterolemia, myocardial infarction, stroke disorder, coronary artery disorder, acute myocardial infarction, hyperlipidemia, chronic obstructive pulmonary disease, hypertriglyceridemia, pneumonia, relapsing-remitting multiple sclerosis, subarachnoid hemorrhage, chronic kidney disease, polycystic ovary syndrome, atherosclerosis, hypertensive disorder, diabetic retinopathy, cirrhosis of liver, acute coronary syndrome, myocardial ischemia, diabetic kidney disease, sclerosing cholangitis, secondary progressive multiple sclerosis, portal hypertension, gastric neoplasm, intestinal cancer, diabetes mellitus, optic neuritis, severe acute respiratory syndrome, influenza, essential hypertension, Alzheimer disease, asthma, type 2 diabetes mellitus, multiple sclerosis, Noonan syndrome, aortic valve stenosis, colorectal neoplasm
- Drugs: Atorvastatin, Lovastatin, Pitavastatin, Pravastatin, Rosuvastatin, Cerivastatin, Cisapride, Fluvastatin, Tannic Acid, Vorinostat