Sorbinil
drugOn this page
Also known as CP-45,634CP-45634NSC-355082SorbiniloSID29215399SID144205232SID170466611
Summary
Sorbinil (CHEMBL266497) is a phase-3 clinical-stage small-molecule EC 1.1.1.21 (aldehyde reductase) inhibitor targeting AKR1B1; indicated across 1 condition including diabetic retinopathy.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 1 (AKR1B1)
- Indications: 1 condition
- Clinical trials: 1
- Chemistry: 236.2 Da · C11H9FN2O3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL266497 |
| Name | Sorbinil |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 337359 |
| ChEBI | CHEBI:102029 |
| Molecular formula | C11H9FN2O3 |
| Molecular weight | 236.2 |
| InChIKey | LXANPKRCLVQAOG-NSHDSACASA-N |
SMILES: C1COC2=C([C@]13C(=O)NC(=O)N3)C=C(C=C2)F
IUPAC name: (4S)-6-fluorospiro[2,3-dihydrochromene-4,5’-imidazolidine]-2’,4’-dione
ChEBI definition: An azaspiro compound having a monofluoro-substituted chromane skeleton spiro-linked to an imidazolidinedione ring.
Pharmacological roles (ChEBI): EC 1.1.1.21 (aldehyde reductase) inhibitor, antioxidant.
Also known as: CP-45,634, CP-45634, NSC-355082, Sorbinil, Sorbinilo, sorbinil, SID29215399, SORBINIL, SID144205232, SID170466611
Patent coverage: 575 distinct patent families (2,026 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 2,024 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| AKR1B1 | aldo-keto reductase family 1 member B | Inhibition | 5.27 | 1.1% | P15121 |
Broader ChEMBL bioactivity targets: 9 (assay-derived). Sample: Microtubule-associated protein tau, Aldo-keto reductase family 1 member B1, Aldo-keto reductase family 1 member A1, Aldo-keto reductase family 1 member B1, Aldo-keto reductase family 1 member B1, Aldo-keto reductase family 1 member A1, Aldo-keto reductase family 1 member A1, Aldo-keto reductase family 1 member B1, Aldo-keto reductase family 1 member B10.
Bioactivity
ChEMBL activities: 88 potent at pChembl ≥ 5 of 89 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P07943 | 7.77 | IC50 | 17 | nM | CHEMBL_ACT_1116355 |
| P07943 | 7.77 | IC50 | 17 | nM | CHEMBL_ACT_900843 |
| P07943 | 7.7 | IC50 | 20 | nM | CHEMBL_ACT_313783 |
| P07943 | 7.54 | IC50 | 29 | nM | CHEMBL_ACT_18152799 |
| P51635 | 7.54 | IC50 | 29 | nM | CHEMBL_ACT_96690 |
| AKR1B1 | 7.17 | IC50 | 67 | nM | CHEMBL_ACT_1231933 |
| AKR1B1 | 7.16 | IC50 | 70 | nM | CHEMBL_ACT_3121835 |
| P07943 | 7.16 | IC50 | 70 | nM | CHEMBL_ACT_330995 |
| P07943 | 7.14 | IC50 | 73 | nM | CHEMBL_ACT_166635 |
| P07943 | 7 | IC50 | 100 | nM | CHEMBL_ACT_354978 |
| AKR1B1 | 6.92 | IC50 | 120 | nM | CHEMBL_ACT_83827 |
| AKR1B1 | 6.85 | IC50 | 140 | nM | CHEMBL_ACT_1618319 |
| AKR1B1 | 6.85 | IC50 | 140 | nM | CHEMBL_ACT_171008 |
| P16116 | 6.82 | IC50 | 150 | nM | CHEMBL_ACT_406559 |
| AKR1B1 | 6.77 | IC50 | 170 | nM | CHEMBL_ACT_219714 |
| P07943 | 6.75 | IC50 | 180 | nM | CHEMBL_ACT_70603 |
| P07943 | 6.72 | IC50 | 190 | nM | CHEMBL_ACT_330994 |
| P07943 | 6.7 | IC50 | 200 | nM | CHEMBL_ACT_406560 |
| P07943 | 6.64 | IC50 | 230 | nM | CHEMBL_ACT_1278080 |
| P07943 | 6.6 | IC50 | 250 | nM | CHEMBL_ACT_1017936 |
| P07943 | 6.6 | IC50 | 250 | nM | CHEMBL_ACT_12631604 |
| P07943 | 6.6 | IC50 | 250 | nM | CHEMBL_ACT_13413155 |
| P07943 | 6.6 | IC50 | 250 | nM | CHEMBL_ACT_14581564 |
| P07943 | 6.6 | IC50 | 249 | nM | CHEMBL_ACT_2189332 |
| P07943 | 6.6 | IC50 | 250 | nM | CHEMBL_ACT_3121834 |
| AKR1B1 | 6.6 | IC50 | 249 | nM | CHEMBL_ACT_3265990 |
| P07943 | 6.6 | IC50 | 250 | nM | CHEMBL_ACT_3559852 |
| AKR1B1 | 6.6 | IC50 | 250 | nM | CHEMBL_ACT_359144 |
| P07943 | 6.55 | IC50 | 280 | nM | CHEMBL_ACT_490200 |
| P07943 | 6.37 | IC50 | 430 | nM | CHEMBL_ACT_16834652 |
Target pathways
Aggregated over 1 target gene(s): AKR1B1.
Top Reactome pathways
9 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Metabolism | 1 | AKR1B1 |
| Metabolism of steroid hormones | 1 | AKR1B1 |
| Pregnenolone biosynthesis | 1 | AKR1B1 |
| Metabolism of lipids | 1 | AKR1B1 |
| Fructose metabolism | 1 | AKR1B1 |
| Fructose biosynthesis | 1 | AKR1B1 |
| Galactose catabolism | 1 | AKR1B1 |
| Metabolism of carbohydrates and carbohydrate derivatives | 1 | AKR1B1 |
| Metabolism of steroids | 1 | AKR1B1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| retinoid metabolic process | 1 |
| epithelial cell maturation | 1 |
| renal water homeostasis | 1 |
| carbohydrate metabolic process | 1 |
| C21-steroid hormone biosynthetic process | 1 |
| regulation of urine volume | 1 |
| negative regulation of apoptotic process | 1 |
| daunorubicin metabolic process | 1 |
| doxorubicin metabolic process | 1 |
| fructose biosynthetic process | 1 |
| cellular hyperosmotic salinity response | 1 |
| metanephric collecting duct development | 1 |
| lipid metabolic process | 1 |
| prostaglandin metabolic process | 1 |
| retinol metabolic process | 1 |
Indications & clinical
Indications
1 indication (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| diabetic retinopathy | 3 | MONDO:0005266 | EFO:0003770 |
Clinical trials
Total trials: 1.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00000159 | PHASE3 | COMPLETED | Sorbinil Retinopathy Trial (SRT) |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
36 molecules share ≥1 primary target. Top 36 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| FOLIC ACID | ChEMBL + PubChem | Phase 4 (approved) | AKR1B1 |
| EPALRESTAT | ChEMBL | Phase 4 (approved) | AKR1B1 |
| ESTRADIOL | ChEMBL | Phase 4 (approved) | AKR1B1 |
| ESTRONE | ChEMBL | Phase 4 (approved) | AKR1B1 |
| INDOMETHACIN | ChEMBL | Phase 4 (approved) | AKR1B1 |
| MEFENAMIC ACID | ChEMBL | Phase 4 (approved) | AKR1B1 |
| NITAZOXANIDE | ChEMBL | Phase 4 (approved) | AKR1B1 |
| SULINDAC | ChEMBL | Phase 4 (approved) | AKR1B1 |
| TOLMETIN | ChEMBL | Phase 4 (approved) | AKR1B1 |
| TOLRESTAT | ChEMBL | Phase 4 (approved) | AKR1B1 |
| CAFFEIC ACID | ChEMBL | Phase 3 | AKR1B1 |
| CURCUMIN | ChEMBL | Phase 3 | AKR1B1 |
| GOSSYPOL | ChEMBL | Phase 3 | AKR1B1 |
| QUERCETIN | ChEMBL | Phase 3 | AKR1B1 |
| RANIRESTAT | ChEMBL | Phase 3 | AKR1B1 |
| RESVERATROL | ChEMBL | Phase 3 | AKR1B1 |
| ALRESTATIN | ChEMBL | Phase 2 | AKR1B1 |
| AZD1981 | ChEMBL | Phase 2 | AKR1B1 |
| CHLOROGENIC ACID | ChEMBL | Phase 2 | AKR1B1 |
| ELLAGIC ACID | ChEMBL | Phase 2 | AKR1B1 |
| FIDARESTAT | ChEMBL | Phase 2 | AKR1B1 |
| FLUFENAMIC ACID | ChEMBL | Phase 2 | AKR1B1 |
| GENISTEIN | ChEMBL | Phase 2 | AKR1B1 |
| HYMECROMONE | ChEMBL | Phase 2 | AKR1B1 |
| IMIRESTAT | ChEMBL | Phase 2 | AKR1B1 |
| ISOQUERCETIN | ChEMBL | Phase 2 | AKR1B1 |
| LIDORESTAT | ChEMBL | Phase 2 | AKR1B1 |
| LUTEOLIN | ChEMBL | Phase 2 | AKR1B1 |
| MINALRESTAT | ChEMBL | Phase 2 | AKR1B1 |
| OXEPINAC | ChEMBL | Phase 2 | AKR1B1 |
| PONALRESTAT | ChEMBL | Phase 2 | AKR1B1 |
| SEPRANOLONE | ChEMBL | Phase 2 | AKR1B1 |
| TIOPINAC | ChEMBL | Phase 2 | AKR1B1 |
| URSOLIC ACID | ChEMBL | Phase 2 | AKR1B1 |
| ZENARESTAT | ChEMBL | Phase 2 | AKR1B1 |
| ZOPOLRESTAT | ChEMBL | Phase 2 | AKR1B1 |
Related Atlas pages
- Genes: AKR1B1
- Diseases: diabetic retinopathy
- Drugs: Folic Acid, Epalrestat, Estradiol, Estrone, Indomethacin, Mefenamic Acid, Nitazoxanide, Sulindac, Tolmetin, Tolrestat, Caffeic Acid, Curcumin, Gossypol, Quercetin, Ranirestat, Resveratrol