Spironolactone
drugOn this page
Also known as AbbolactoneAldactoneCarospirDiatensecEspironolactonaGx spironolLaractoneNSC-150399QaialdoSC-9420SpireticSpiroctan 100Spiroctan 25Spiroctan 50Spironolactone cevaSpironolactone component of aldactazideSpironolactone component of cardalisSpironolactonumSpirospare 100
Summary
Spironolactone (CHEMBL1393) is an approved small-molecule diuretic (ATC C03DA01) targeting NR3C2; indicated across 44 conditions including heart failure and hypertensive disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: C03DA01
- Targets: 1 (NR3C2)
- Indications: 44 conditions
- Clinical trials: 201
- Chemistry: 416.6 Da · C24H32O4S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1393 |
| Name | Spironolactone |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 5833 |
| ChEBI | CHEBI:9241 |
| ATC | C03DA01 |
| Molecular formula | C24H32O4S |
| Molecular weight | 416.6 |
| InChIKey | LXMSZDCAJNLERA-ZHYRCANASA-N |
SMILES: CC(=O)S[C@@H]1CC2=CC(=O)CC[C@@]2([C@@H]3[C@@H]1[C@@H]4CC[C@]5([C@]4(CC3)C)CCC(=O)O5)C
IUPAC name: S-[(7R,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-3,5’-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2’-oxolane]-7-yl] ethanethioate
ChEBI definition: A steroid lactone that is 17α-pregn-4-ene-21,17-carbolactone substituted by an oxo group at position 3 and an α-acetylsulfanyl group at position 7.
Pharmacological roles (ChEBI): diuretic, antihypertensive agent.
Other ChEBI roles (chemical / environmental): environmental contaminant, xenobiotic.
Also known as: Abbolactone, Aldactone, Carospir, Diatensec, Espironolactona, Gx spironol, Laractone, NSC-150399, Qaialdo, SC-9420, Spiretic, Spiroctan 100
Patent coverage: 14,744 distinct patent families (49,171 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| NR3C2 | Mineralocorticoid receptor | Antagonist | 8.63 | 0% | P08235 |
Broader ChEMBL bioactivity targets: 15 (assay-derived). Sample: Multidrug and toxin extrusion protein 1, 5-hydroxytryptamine receptor 2B, Androgen receptor, Mineralocorticoid receptor, Glucocorticoid receptor, Estrogen receptor, Progesterone receptor, Muscarinic acetylcholine receptor M2, Alpha-1A adrenergic receptor, Kappa-type opioid receptor.
Bioactivity
ChEMBL activities: 49 potent at pChembl ≥ 5 of 56 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| NR3C2 | 8.8 | IC50 | 1.6 | nM | CHEMBL_ACT_3224290 |
| NR3C2 | 8.63 | Ki | 2.32 | nM | CHEMBL_ACT_2008173 |
| NR3C2 | 8.3 | Ki | 5.01 | nM | CHEMBL_ACT_19363717 |
| NR3C2 | 8.06 | IC50 | 8.7 | nM | CHEMBL_ACT_24808080 |
| NR3C2 | 8.02 | IC50 | 9.62 | nM | CHEMBL_ACT_24808037 |
| NR3C2 | 7.96 | IC50 | 11 | nM | CHEMBL_ACT_13393481 |
| NR3C2 | 7.96 | IC50 | 11 | nM | CHEMBL_ACT_14566205 |
| NR3C2 | 7.96 | IC50 | 11 | nM | CHEMBL_ACT_22825220 |
| NR3C2 | 7.89 | IC50 | 13 | nM | CHEMBL_ACT_3403606 |
| NR3C1 | 7.49 | Ki | 32.6 | nM | CHEMBL_ACT_2008189 |
| AR | 7.41 | Ki | 39.4 | nM | CHEMBL_ACT_2008193 |
| AR | 7.32 | IC50 | 48 | nM | CHEMBL_ACT_24808042 |
| NR3C2 | 7.31 | IC50 | 49 | nM | CHEMBL_ACT_15095258 |
| NR3C2 | 7.31 | IC50 | 49 | nM | CHEMBL_ACT_7970151 |
| NR3C2 | 7.3 | IC50 | 50.12 | nM | CHEMBL_ACT_19363718 |
| PGR | 7.3 | AC50 | 50 | nM | CHEMBL_ACT_25192988 |
| NR3C2 | 7.22 | IC50 | 60 | nM | CHEMBL_ACT_15099906 |
| NR3C2 | 7.22 | IC50 | 60 | nM | CHEMBL_ACT_7970232 |
| NR3C2 | 7.12 | IC50 | 76 | nM | CHEMBL_ACT_24697149 |
| AR | 7.11 | IC50 | 77 | nM | CHEMBL_ACT_29092451 |
| P15207 | 7.04 | Ki | 90.6 | nM | CHEMBL_ACT_7796899 |
| AR | 6.92 | IC50 | 120 | nM | CHEMBL_ACT_15095285 |
| P15207 | 6.92 | AC50 | 120 | nM | CHEMBL_ACT_25187795 |
| AR | 6.92 | IC50 | 120 | nM | CHEMBL_ACT_7970193 |
| P15207 | 6.87 | IC50 | 135.9 | nM | CHEMBL_ACT_7796898 |
| NR3C1 | 6.72 | AC50 | 190 | nM | CHEMBL_ACT_25176434 |
| P15207 | 6.64 | AC50 | 230 | nM | CHEMBL_ACT_25233210 |
| NR3C2 | 6.57 | IC50 | 270 | nM | CHEMBL_ACT_29241937 |
| PGR | 6.4 | Ki | 399.7 | nM | CHEMBL_ACT_2008197 |
| NR3C2 | 6.31 | IC50 | 490 | nM | CHEMBL_ACT_29211760 |
Target pathways
Aggregated over 1 target gene(s): NR3C2.
Top Reactome pathways
9 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Cellular responses to stress | 1 | NR3C2 |
| SUMOylation | 1 | NR3C2 |
| SUMO E3 ligases SUMOylate target proteins | 1 | NR3C2 |
| HSP90 chaperone cycle for steroid hormone receptors (SHR) in the presence of ligand | 1 | NR3C2 |
| Nuclear Receptor transcription pathway | 1 | NR3C2 |
| Metabolism of proteins | 1 | NR3C2 |
| SUMOylation of intracellular receptors | 1 | NR3C2 |
| Post-translational protein modification | 1 | NR3C2 |
| Cellular responses to stimuli | 1 | NR3C2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| regulation of transcription by RNA polymerase II | 1 |
| signal transduction | 1 |
| nuclear receptor-mediated steroid hormone signaling pathway | 1 |
| positive regulation of non-canonical NF-kappaB signal transduction | 1 |
| regulation of DNA-templated transcription | 1 |
| cellular response to hormone stimulus | 1 |
| response to lipid | 1 |
Indications & clinical
Indications
44 indications (13 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| heart failure | 4 | MONDO:0005252 | EFO:0003144 |
| hypertensive disorder | 4 | MONDO:0005044 | EFO:0000537 |
| myocardial infarction | 4 | MONDO:0005068 | EFO:0000612 |
| cardiovascular disorder | 4 | MONDO:0004995 | EFO:0000319 |
| congestive heart failure | 4 | MONDO:0005009 | EFO:0000373 |
| nephrotic syndrome | 4 | MONDO:0005377 | EFO:0004255 |
| preeclampsia | 4 | MONDO:0005081 | EFO:0000668 |
| cirrhosis of liver | 4 | MONDO:0005155 | EFO:0001422 |
| essential hypertension | 4 | MONDO:0001134 | MONDO:0001134 |
| hyperaldosteronism | 4 | MONDO:0003009 | HP:0011736 |
| chronic kidney disease | 3 | MONDO:0005300 | EFO:0003884 |
| atrial fibrillation | 3 | MONDO:0004981 | EFO:0000275 |
| diastolic heart failure | 3 | MONDO:0006727 | EFO:1000899 |
| acne | 3 | MONDO:0011438 | EFO:0003894 |
| acute kidney injury | 3 | MONDO:0002492 | HP:0001919 |
| ST-elevation myocardial infarction | 3 | MONDO:0041656 | EFO:0008585 |
| autosomal dominant polycystic kidney disease | 3 | MONDO:0004691 | EFO:1001496 |
| aortic valve stenosis | 3 | MONDO:0042981 | EFO:0000266 |
| rheumatoid arthritis | 3 | MONDO:0008383 | EFO:0000685 |
| Duchenne muscular dystrophy | 3 | MONDO:0010679 | MONDO:0010679 |
| pulmonary arterial hypertension | 2 | MONDO:0015924 | EFO:0001361 |
| polycystic ovary syndrome | 2 | MONDO:0008487 | EFO:0000660 |
| fatty liver disease | 2 | MONDO:0004790 | HP:0001397 |
| precocious puberty | 2 | MONDO:0000088 | MONDO:0000088 |
| age-related macular degeneration | 2 | MONDO:0005150 | EFO:0001365 |
| intracerebral hemorrhage | 2 | MONDO:0013792 | EFO:0005669 |
| severe acute respiratory syndrome | 2 | MONDO:0005091 | MONDO:0100096 |
| arrhythmogenic right ventricular cardiomyopathy | 2 | MONDO:0016587 | Orphanet:247 |
| cardiomyopathy | 2 | MONDO:0004994 | EFO:0000318 |
| neuroblastoma | 2 | MONDO:0005072 | EFO:0000621 |
| neoplasm | 2 | MONDO:0005070 | MONDO:0004992 |
| diabetic kidney disease | 1 | MONDO:0005016 | EFO:0000401 |
| acute myeloid leukemia | 1 | MONDO:0018874 | EFO:0000222 |
| leukemia | 1 | MONDO:0005059 | EFO:0000565 |
| metabolic dysfunction-associated steatohepatitis | 1 | MONDO:0007027 | EFO:1001249 |
| chorioretinitis | 1 | MONDO:0004674 | HP:0012424 |
| diabetes mellitus | 1 | MONDO:0005015 | EFO:0000400 |
| alcohol abuse | 1 | MONDO:0002046 | MONDO:0007079 |
| dry eye syndrome | 0 | MONDO:0006733 | EFO:1000906 |
5 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 201.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 64 |
| PHASE2 | 39 |
| Not specified | 38 |
| PHASE3 | 26 |
| PHASE1 | 14 |
| PHASE2/PHASE3 | 8 |
| PHASE1/PHASE2 | 7 |
| EARLY_PHASE1 | 5 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03984591 | PHASE4 | ENROLLING_BY_INVITATION | A Registry-based Cluster Randomized Trial to Compare the Effect of Spironolactone vs. Eplerenone on Clinical Outcomes in Patients With Symptomatic Systolic Heart Failure |
| NCT04582383 | PHASE4 | ACTIVE_NOT_RECRUITING | Comparative Effectiveness Study of Spironolactone Versus Doxycycline for Acne |
| NCT06457074 | PHASE4 | RECRUITING | Finerenone for Patients With Primary Aldosteronism (FAIRY) |
| NCT07281014 | PHASE4 | RECRUITING | Unmitigated Aldosterone Signaling During Standard Clinical MRA Dosing |
| NCT07523867 | PHASE4 | NOT_YET_RECRUITING | Spironolactone Alternate Dosing vs Finerenone in Elevated Potassium - K Safety Study |
| NCT00206232 | PHASE4 | COMPLETED | Novel Treatment for Diastolic Heart Failure in Women |
| NCT00226109 | PHASE4 | SUSPENDED | Clinical Trial Studying the Effects of Spironolactone on Heart and Skeletal Muscle Function in Chronic Alcoholics |
| NCT00277693 | PHASE4 | UNKNOWN | Cardiovascular Protective Effect of Spironolactone in Hemodialysis |
| NCT00306696 | PHASE4 | COMPLETED | Examining the Effect of Different Diuretics on Fluid Retention in Diabetics Treated With Rosiglitazone. |
| NCT00317954 | PHASE4 | COMPLETED | Spironolactone in Diabetic Nephropathy |
| NCT00328809 | PHASE4 | WITHDRAWN | Spironolactone Safety in Dialysis Patients |
| NCT00332904 | PHASE4 | UNKNOWN | Effect of Betablocker or Aldosterone Antagonist Therapy on Patients With Liver Cirrhosis |
| NCT00335413 | PHASE4 | COMPLETED | Autoregulation of Glomerular Filtration Rate in Patients With Type 1 Diabetes During Spironolactone Therapy |
| NCT00391846 | PHASE4 | COMPLETED | Evaluation of Heart Failure Treatment Guided by N-terminal Pro B-type Natriuretic Peptide (NTproBNP) vs Clinical Symptoms and Signs Alone |
| NCT00524615 | PHASE4 | UNKNOWN | Addition of Spironolactone in Patients With Resistant Arterial Hypertension |
| NCT00527059 | PHASE4 | UNKNOWN | Renal Effects of Levosimendan in Patients Admitted With Acute Decompensated Heart Failure |
| NCT00548912 | PHASE4 | WITHDRAWN | Left Ventricular Hypertrophy and Spironolactone in End Stage Renal Disease |
| NCT00574119 | PHASE4 | COMPLETED | Effect of Aldosterone on Energy Starvation in Heart Failure |
| NCT00663195 | PHASE4 | COMPLETED | Effects of Spironolactone on Matrix Metalloproteinases (MMPs) in Heart Failure |
| NCT00664222 | PHASE4 | COMPLETED | Spironolactone and Insulin Resistance in Chronic Heart Failure (CHF) |
| NCT00741663 | PHASE4 | COMPLETED | Spironolactone Versus Spironolactone Plus Furosemide (SVSSF) |
| NCT00870402 | PHASE4 | UNKNOWN | Aldosterone in Diabetic Nephropathy |
| NCT00879060 | PHASE4 | COMPLETED | Clinical and Therapeutic Implications of Fibrosis in Hypertrophic Cardiomyopathy |
| NCT01089309 | PHASE4 | COMPLETED | Effect of Aldosterone Blockade on Arterial Compliance |
| NCT01128101 | PHASE4 | UNKNOWN | Effects of Spironolactone in Dialysis |
| NCT01388088 | PHASE4 | COMPLETED | The Effect of Amiloride and Spironolactone in Patients With Hypertension |
| NCT01468571 | PHASE4 | UNKNOWN | Effects of Spironolactone on Collagen Metabolism in Patients With Pulmonary Arterial Hypertension |
| NCT01510795 | PHASE4 | UNKNOWN | Mineralocorticoid Receptor Antagonist and Kidney Allograft Histology |
| NCT01602861 | PHASE4 | COMPLETED | The Effects of Spironolactone on Calcineurin Inhibitor Induced Nephrotoxicity |
| NCT01643434 | PHASE4 | UNKNOWN | Resistant Hypertension Optimal Treatment |
| NCT01687699 | PHASE4 | COMPLETED | Effects of Spironolactone on Cardio- and Cerebrovascular Morbidity and Mortality in Hemodialysis Patients |
| NCT01843309 | PHASE4 | TERMINATED | Use of Spironolactone for the Prevention of Electrolyte Abnormalities in Patients Treated With Amphotericin B |
| NCT01855334 | PHASE4 | WITHDRAWN | L-Arginine and Spironolactone Trial in Dialysis-Dependent ESRD |
| NCT01944384 | PHASE4 | COMPLETED | Impacts of Aldosterone Blockade on Myocardial Remodeling in Hypertensive Patients With Diastolic Failing Heart |
| NCT02046668 | PHASE4 | COMPLETED | The Effect of Spironolactone on Pain in Older People With Osteoarthritis |
| NCT02053974 | PHASE4 | COMPLETED | Spironolactone Against Anthracycline-induced Cardiomyopathy |
| NCT02169089 | PHASE4 | COMPLETED | Mineralocorticoid Receptor Antagonism Clinical Evaluation in Atherosclerosis Trial |
| NCT02369081 | PHASE4 | UNKNOWN | Optimum Treatment for Drug-Resistant Hypertension |
| NCT02429388 | PHASE4 | WITHDRAWN | High-Dose Aldactone for Treatment of Diuretic Resistant Heart Failure |
| NCT02483195 | PHASE4 | WITHDRAWN | The Use of 5mg Finasteride Versus 200mg Spironolactone and Topical 5% Minoxidil in Treating Postmenopausal Female Androgenetic Alopecia |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 8 clinical and 15 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
25 molecules share ≥1 primary target. Top 25 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| EPLERENONE | ChEMBL + PubChem | Phase 4 (approved) | NR3C2 |
| BUDESONIDE | ChEMBL | Phase 4 (approved) | NR3C2 |
| DEXAMETHASONE | ChEMBL | Phase 4 (approved) | NR3C2 |
| FINERENONE | ChEMBL | Phase 4 (approved) | NR3C2 |
| FLUTICASONE FUROATE | ChEMBL | Phase 4 (approved) | NR3C2 |
| FLUTICASONE PROPIONATE | ChEMBL | Phase 4 (approved) | NR3C2 |
| HYDROCORTISONE | ChEMBL | Phase 4 (approved) | NR3C2 |
| HYDROCORTISONE BUTYRATE | ChEMBL | Phase 4 (approved) | NR3C2 |
| MEDROXYPROGESTERONE | ChEMBL | Phase 4 (approved) | NR3C2 |
| MIFEPRISTONE | ChEMBL | Phase 4 (approved) | NR3C2 |
| PREDNISOLONE | ChEMBL | Phase 4 (approved) | NR3C2 |
| PROGESTERONE | ChEMBL | Phase 4 (approved) | NR3C2 |
| ASOPRISNIL | ChEMBL | Phase 3 | NR3C2 |
| BALCINRENONE | ChEMBL | Phase 3 | NR3C2 |
| CORTICOSTERONE | ChEMBL | Phase 3 | NR3C2 |
| ALDOSTERONE | ChEMBL | Phase 2 | NR3C2 |
| LY2623091 | ChEMBL | Phase 2 | NR3C2 |
| METRIBOLONE | ChEMBL | Phase 2 | NR3C2 |
| MT-3995 | ChEMBL | Phase 2 | NR3C2 |
| ONAPRISTONE | ChEMBL | Phase 2 | NR3C2 |
| STANOLONE | ChEMBL | Phase 2 | NR3C2 |
| TUROFEXORATE ISOPROPYL | ChEMBL | Phase 2 | NR3C2 |
| Enzalutamide | PubChem | Approved | NR3C2 |
| Fludrocortisone | PubChem | Approved | NR3C2 |
| ursodiol | PubChem | Approved | NR3C2 |
Related Atlas pages
- Genes: NR3C2
- Diseases: heart failure, hypertensive disorder, myocardial infarction, cardiovascular disorder, congestive heart failure, nephrotic syndrome, preeclampsia, cirrhosis of liver, essential hypertension, hyperaldosteronism, chronic kidney disease, atrial fibrillation, diastolic heart failure, acne, acute kidney injury, ST-elevation myocardial infarction, autosomal dominant polycystic kidney disease, aortic valve stenosis, rheumatoid arthritis, Duchenne muscular dystrophy
- Drugs: Eplerenone, Budesonide, Dexamethasone, Finerenone, Fluticasone Furoate, Fluticasone Propionate, Hydrocortisone, Hydrocortisone Butyrate, Medroxyprogesterone, Mifepristone, Prednisolone, Progesterone, Asoprisnil, Balcinrenone, Corticosterone, Enzalutamide, Fludrocortisone, ursodiol