Stanozolol
drugOn this page
Also known as AndrostanazolAndrostanazoleEstanozololNSC-233046NSC-43193Stanozolol ciiiStrombaTevabolinWIN 14833WIN-14833WinstrolWinstrol depotSID170465251C0164535
Summary
Stanozolol (CHEMBL2079587) is an approved small-molecule anabolic agent (ATC A14AA02) targeting ESR1 and AR; indicated across 1 condition including myelodysplastic syndrome.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: A14AA02
- Targets: 2 (ESR1, AR)
- Indications: 1 condition
- Clinical trials: 1
- Chemistry: 328.5 Da · C21H32N2O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL2079587 |
| Name | Stanozolol |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 25249 |
| ChEBI | CHEBI:9249 |
| ATC | A14AA02 |
| Molecular formula | C21H32N2O |
| Molecular weight | 328.5 |
| InChIKey | LKAJKIOFIWVMDJ-IYRCEVNGSA-N |
SMILES: C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C)O)CC[C@@H]4[C@@]3(CC5=C(C4)NN=C5)C
IUPAC name: (1S,2S,10S,13R,14S,17S,18S)-2,17,18-trimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5-dien-17-ol
ChEBI definition: An organic heteropentacyclic compound resulting from the formal condensation of the 3-keto-aldehyde moiety of oxymetholone with hydrazine. Like oxymetholone, it is a synthetic anabolic steroid. It has both anabolic and androgenic properties, and has been used to treat hereditary angioedema and various vascular disorders. It has also been widely abused by professional athletes.
Pharmacological roles (ChEBI): androgen, anabolic agent.
Also known as: Androstanazol, Androstanazole, Estanozolol, NSC-233046, NSC-43193, Stanozolol, Stanozolol ciii, Stromba, Tevabolin, WIN 14833, WIN-14833, Winstrol
Patent coverage: 3,743 distinct patent families (13,336 SureChEMBL compound mentions), from 2 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ESR1 | Estrogen receptor-α | Agonist | 6.95 | 1.7% | P03372 |
| AR | Androgen receptor | Agonist | 7.66 | P10275 |
Broader ChEMBL bioactivity targets: 6 (assay-derived). Sample: Estrogen receptor, Adenosine receptor A3, Cytochrome P450 2D6, Androgen receptor, Cytochrome P450 2C9, Cytochrome P450 2C19.
Bioactivity
ChEMBL activities: 9 potent at pChembl ≥ 5 of 9 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P15207 | 7.82 | Ki | 15 | nM | CHEMBL_ACT_7809784 |
| P15207 | 7.66 | IC50 | 22 | nM | CHEMBL_ACT_7809783 |
| ESR1 | 7.5 | Ki | 32 | nM | CHEMBL_ACT_7807614 |
| CYP2C19 | 7.32 | IC50 | 48 | nM | CHEMBL_ACT_7807591 |
| ESR1 | 6.95 | IC50 | 113 | nM | CHEMBL_ACT_7807613 |
| CYP2C9 | 5.95 | IC50 | 1128 | nM | CHEMBL_ACT_7807593 |
| ADORA3 | 5.33 | Ki | 4705 | nM | CHEMBL_ACT_7805522 |
| ADORA3 | 5.08 | IC50 | 8325 | nM | CHEMBL_ACT_7805521 |
| CYP2D6 | 5.03 | IC50 | 9274 | nM | CHEMBL_ACT_7807595 |
Target pathways
Aggregated over 2 target gene(s): ESR1, AR.
Top Reactome pathways
38 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Nuclear Receptor transcription pathway | 2 | AR, ESR1 |
| SUMOylation of intracellular receptors | 2 | AR, ESR1 |
| Nuclear signaling by ERBB4 | 1 | ESR1 |
| PIP3 activates AKT signaling | 1 | ESR1 |
| Signal Transduction | 1 | AR |
| Signaling by Rho GTPases | 1 | AR |
| RHO GTPase Effectors | 1 | AR |
| Generic Transcription Pathway | 1 | AR |
| Constitutive Signaling by Aberrant PI3K in Cancer | 1 | ESR1 |
| Cellular responses to stress | 1 | AR |
| SUMOylation | 1 | AR |
| SUMO E3 ligases SUMOylate target proteins | 1 | AR |
| HSP90 chaperone cycle for steroid hormone receptors (SHR) in the presence of ligand | 1 | AR |
| Metabolism of proteins | 1 | AR |
| RHO GTPases activate PKNs | 1 | AR |
| Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3 | 1 | AR |
| Deubiquitination | 1 | AR |
| Ub-specific processing proteases | 1 | AR |
| Ovarian tumor domain proteases | 1 | ESR1 |
| Post-translational protein modification | 1 | AR |
| PI5P, PP2A and IER3 Regulate PI3K/AKT Signaling | 1 | ESR1 |
| RNA Polymerase II Transcription | 1 | AR |
| Gene expression (Transcription) | 1 | AR |
| TFAP2 (AP-2) family regulates transcription of growth factors and their receptors | 1 | ESR1 |
| Transcriptional regulation by RUNX2 | 1 | AR |
| RUNX1 regulates estrogen receptor mediated transcription | 1 | ESR1 |
| ESR-mediated signaling | 1 | ESR1 |
| RUNX1 regulates transcription of genes involved in WNT signaling | 1 | ESR1 |
| Regulation of RUNX2 expression and activity | 1 | ESR1 |
| RUNX2 regulates osteoblast differentiation | 1 | AR |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| negative regulation of transcription by RNA polymerase II | 2 |
| regulation of DNA-templated transcription | 2 |
| regulation of transcription by RNA polymerase II | 2 |
| signal transduction | 2 |
| male gonad development | 2 |
| nuclear receptor-mediated steroid hormone signaling pathway | 2 |
| estrogen receptor signaling pathway | 2 |
| positive regulation of DNA-templated transcription | 2 |
| positive regulation of transcription by RNA polymerase II | 2 |
| mammary gland alveolus development | 2 |
| cellular response to estrogen stimulus | 2 |
| transcription by RNA polymerase II | 2 |
| regulation of gene expression | 2 |
| antral ovarian follicle growth | 1 |
| epithelial cell development | 1 |
Indications & clinical
Indications
1 indication (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| myelodysplastic syndrome | 2 | MONDO:0018881 | EFO:0000198 |
Clinical trials
Total trials: 1.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2/PHASE3 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT05024877 | PHASE2/PHASE3 | UNKNOWN | Hetrombopag for Low/Intermediate-1 Risk MDS With Thrombocytopenia |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
261 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| TAFENOQUINE | ChEMBL + PubChem | Phase 4 (approved) | AR, ESR1 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| BITHIONOL | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| CLOMIPHENE | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| CYCLOFENIL | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| DESOGESTREL | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| ESTRADIOL | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| ESTRADIOL CYPIONATE | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| ESTRADIOL VALERATE | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| ESTRIOL | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| ESTRONE | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| ETHINYL ESTRADIOL | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| ETHYNODIOL DIACETATE | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| ETONOGESTREL | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| HEXESTROL | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| LEVONORGESTREL | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| MEDROXYPROGESTERONE | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| MIFEPRISTONE | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| NORETHINDRONE | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| NORETHYNODREL | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| SPIRONOLACTONE | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| ULIPRISTAL | ChEMBL | Phase 4 (approved) | AR, ESR1 |
| ASOPRISNIL | ChEMBL | Phase 3 | AR, ESR1 |
| ETHISTERONE | ChEMBL | Phase 3 | AR, ESR1 |
| GESTODENE | ChEMBL | Phase 3 | AR, ESR1 |
| GOSSYPOL | ChEMBL | Phase 3 | AR, ESR1 |
| ALLYLESTRENOL | ChEMBL | Phase 2 | AR, ESR1 |
| CLOFOCTOL | ChEMBL | Phase 2 | AR, ESR1 |
| ROMURTIDE | ChEMBL | Phase 2 | AR, ESR1 |
| TUROFEXORATE ISOPROPYL | ChEMBL | Phase 2 | AR, ESR1 |
| Echothiophate | PubChem | Approved | AR, ESR1 |
| levocarnitine | PubChem | Approved | AR, ESR1 |
| Perindopril | PubChem | Approved | AR, ESR1 |
| Pimavanserin | PubChem | Approved | AR, ESR1 |
| podofilox | PubChem | Approved | AR, ESR1 |
| Propylene Glycol | PubChem | Approved | AR, ESR1 |
| Pyrazinamide | PubChem | Approved | AR, ESR1 |
| Pyridoxine | PubChem | Approved | AR, ESR1 |
| Quinaprilat | PubChem | Approved | AR, ESR1 |
| Vorapaxar | PubChem | Approved | AR, ESR1 |
| FULVESTRANT | ChEMBL + PubChem | Phase 4 (approved) | ESR1 |
| MEGESTROL | ChEMBL + PubChem | Phase 4 (approved) | AR |
| ABIRATERONE | ChEMBL | Phase 4 (approved) | AR |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | ESR1 |
| ALECTINIB | ChEMBL | Phase 4 (approved) | ESR1 |
| APALUTAMIDE | ChEMBL | Phase 4 (approved) | AR |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | ESR1 |
| ASPIRIN | ChEMBL | Phase 4 (approved) | ESR1 |
| AZTREONAM | ChEMBL | Phase 4 (approved) | ESR1 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | ESR1 |
| BECLOMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | AR |
| BELINOSTAT | ChEMBL | Phase 4 (approved) | ESR1 |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | ESR1 |
| BETAMETHASONE | ChEMBL | Phase 4 (approved) | AR |
| BEXAROTENE | ChEMBL | Phase 4 (approved) | ESR1 |
| BICALUTAMIDE | ChEMBL | Phase 4 (approved) | AR |
| BISACODYL | ChEMBL | Phase 4 (approved) | ESR1 |
| BROMHEXINE | ChEMBL | Phase 4 (approved) | AR |
Related Atlas pages
- Genes: ESR1, AR
- Drugs: Tafenoquine, Aripiprazole, Bithionol, Clomiphene, Cyclofenil, Desogestrel, Diethylstilbestrol, Estradiol, Estradiol Cypionate, Estradiol Valerate, Estriol, Estrone, Ethinyl Estradiol, Ethynodiol Diacetate, Etonogestrel, Hexachlorophene, Hexestrol, Levonorgestrel, Medroxyprogesterone, Mifepristone, Norethindrone, Norethynodrel, Spironolactone, Ulipristal, Asoprisnil, Ethisterone, Gestodene, Gossypol, Echothiophate, levocarnitine, Perindopril, Pimavanserin, podofilox, Propylene Glycol, Pyrazinamide, Pyridoxine, Vorapaxar, Fulvestrant, Megestrol, Abiraterone, Acetophenazine, Alectinib, Apalutamide, Apomorphine, Aspirin, Aztreonam, Bazedoxifene, Beclomethasone Dipropionate, Belinostat, Benzbromarone, Betamethasone, Bexarotene, Bicalutamide, Bisacodyl, Bromhexine