Sulfinpyrazone
drugOn this page
Also known as AnturanAnturaneNSC-75925SulfinpirazonaSID11112139SID26747070SID855982SuphinpyrazoneSID124881954SID46500625SID144203882SID170464677C0164777
Summary
Sulfinpyrazone (CHEMBL832) is an approved small-molecule uricosuric drug (ATC M04AB02) targeting SLC22A12 and FPR1; indicated across 1 condition including gout.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: M04AB02
- Targets: 2 (SLC22A12, FPR1)
- Indications: 1 condition
- Chemistry: C23H20N2O3S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL832 |
| Name | Sulfinpyrazone |
| Type | Small molecule |
| Max phase | 4 |
| ChEBI | CHEBI:9342 |
| ATC | M04AB02 |
| Molecular formula | C23H20N2O3S |
| InChIKey | MBGGBVCUIVRRBF-UHFFFAOYSA-N |
SMILES: O=C1C(CCS(=O)c2ccccc2)C(=O)N(c2ccccc2)N1c1ccccc1
Pharmacological roles (ChEBI): uricosuric drug.
Also known as: Anturan, Anturane, NSC-75925, Sulfinpirazona, Sulfinpyrazone, sulfinpyrazone, SID11112139, SID26747070, SID855982, SULFINPYRAZONE, Suphinpyrazone, SID124881954
Patent coverage: 3,603 distinct patent families (13,780 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| SLC22A12 | Urate anion exchanger 1 | Inhibition | 4 | 0% | Q96S37 |
| FPR1 | FPR1 | Antagonist | 5 | 0% | P21462 |
Broader ChEMBL bioactivity targets: 18 (assay-derived). Sample: Tyrosyl-DNA phosphodiesterase 1, Microtubule-associated protein tau, Lysine-specific demethylase 4E, Nuclear receptor ROR-gamma, Prelamin-A/C, 4’-phosphopantetheinyl transferase ffp, 15-hydroxyprostaglandin dehydrogenase [NAD(+)], Menin/Histone-lysine N-methyltransferase MLL, fMet-Leu-Phe receptor, Cytochrome P450 2C9.
Bioactivity
ChEMBL activities: 14 potent at pChembl ≥ 5 of 36 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| NAPRT | 9.3 | Ki | 0.5 | nM | CHEMBL_ACT_19323245 |
| Q9F4F7 | 8.96 | Potency | 1.1 | nM | CHEMBL_ACT_4805377 |
| ALDH1A1 | 6.1 | Potency | 794.3 | nM | CHEMBL_ACT_4167918 |
| TDP1 | 5.95 | Potency | 1122 | nM | CHEMBL_ACT_3930158 |
| MEN1 | 5.6 | Potency | 2512 | nM | CHEMBL_ACT_4553760 |
| HSD17B10 | 5.3 | Potency | 5012 | nM | CHEMBL_ACT_4873607 |
| CYP3A4 | 5.2 | Potency | 6310 | nM | CHEMBL_ACT_4997965 |
| CYP3A4 | 5.2 | Potency | 6310 | nM | CHEMBL_ACT_5063015 |
| CYP3A4 | 5.2 | AC50 | 6310 | nM | CHEMBL_ACT_6057579 |
| KDM4E | 5 | Potency | 10000 | nM | CHEMBL_ACT_3741524 |
| HPGD | 5 | Potency | 10000 | nM | CHEMBL_ACT_4776203 |
| CYP2C9 | 5 | Potency | 10000 | nM | CHEMBL_ACT_5033428 |
| CYP2C9 | 5 | AC50 | 10000 | nM | CHEMBL_ACT_6049866 |
| FPR1 | 5 | IC50 | 10000 | nM | CHEMBL_ACT_6182024 |
Target pathways
Aggregated over 2 target gene(s): SLC22A12, FPR1.
Top Reactome pathways
13 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Disease | 1 | SLC22A12 |
| Transport of small molecules | 1 | SLC22A12 |
| G alpha (i) signalling events | 1 | FPR1 |
| R-HSA-425366 | 1 | SLC22A12 |
| SLC-mediated transmembrane transport | 1 | SLC22A12 |
| Formyl peptide receptors bind formyl peptides and many other ligands | 1 | FPR1 |
| R-HSA-549132 | 1 | SLC22A12 |
| Organic anion transport by SLC22 transporters | 1 | SLC22A12 |
| Defective SLC22A12 causes renal hypouricemia 1 (RHUC1) | 1 | SLC22A12 |
| SLC transporter disorders | 1 | SLC22A12 |
| Disorders of transmembrane transporters | 1 | SLC22A12 |
| Interleukin-10 signaling | 1 | FPR1 |
| Neutrophil degranulation | 1 | FPR1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| monoatomic ion transport | 1 |
| response to xenobiotic stimulus | 1 |
| obsolete organic anion transport | 1 |
| urate transport | 1 |
| cellular homeostasis | 1 |
| cellular response to insulin stimulus | 1 |
| urate metabolic process | 1 |
| renal urate salt excretion | 1 |
| transmembrane transport | 1 |
| complement receptor mediated signaling pathway | 1 |
| chemotaxis | 1 |
| inflammatory response | 1 |
| signal transduction | 1 |
| G protein-coupled receptor signaling pathway | 1 |
| adenylate cyclase-modulating G protein-coupled receptor signaling pathway | 1 |
Indications & clinical
Indications
1 indication (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| gout | 4 | MONDO:0005393 | EFO:0004274 |
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
25 molecules share ≥1 primary target. Top 25 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| PROBENECID | ChEMBL + PubChem | Phase 4 (approved) | SLC22A12 |
| APREPITANT | ChEMBL | Phase 4 (approved) | FPR1 |
| BENZARONE | ChEMBL | Phase 4 (approved) | SLC22A12 |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | SLC22A12 |
| CINACALCET | ChEMBL | Phase 4 (approved) | FPR1 |
| FENOFIBRIC ACID | ChEMBL | Phase 4 (approved) | SLC22A12 |
| LESINURAD | ChEMBL | Phase 4 (approved) | SLC22A12 |
| LOPERAMIDE | ChEMBL | Phase 4 (approved) | FPR1 |
| MONTELUKAST | ChEMBL | Phase 4 (approved) | FPR1 |
| PENICILLIN G | ChEMBL | Phase 4 (approved) | FPR1 |
| PERPHENAZINE | ChEMBL | Phase 4 (approved) | FPR1 |
| PHENYLBUTAZONE | ChEMBL | Phase 4 (approved) | FPR1 |
| DOTINURAD | ChEMBL | Phase 3 | SLC22A12 |
| SHR-4640 | ChEMBL | Phase 3 | SLC22A12 |
| ARHALOFENATE | ChEMBL | Phase 2 | SLC22A12 |
| FORETINIB | ChEMBL | Phase 2 | FPR1 |
| NIGULDIPINE | ChEMBL | Phase 2 | FPR1 |
| PF-05089771 | ChEMBL | Phase 2 | SLC22A12 |
| PULIGINURAD | ChEMBL | Phase 2 | SLC22A12 |
| VERINURAD | ChEMBL | Phase 2 | SLC22A12 |
| Belzutifan | PubChem | Approved | FPR1 |
| chenodiol | PubChem | Approved | FPR1 |
| cyclosporine | PubChem | Approved | FPR1 |
| Deoxycholic Acid | PubChem | Approved | FPR1 |
| Febuxostat | PubChem | Approved | SLC22A12 |
Related Atlas pages
- Genes: SLC22A12, FPR1
- Diseases: gout
- Drugs: Probenecid, Aprepitant, Benzarone, Benzbromarone, Cinacalcet, Fenofibric Acid, Lesinurad, Loperamide, Montelukast, Penicillin G, Perphenazine, Phenylbutazone, Dotinurad, SHR-4640, Belzutifan, chenodiol, cyclosporine, Deoxycholic Acid, Febuxostat