Sulpiride
drugOn this page
Also known as AbilitAiglonylCoolspanDobrenDogmatilDogmatylDolmatilGuastilMeresaMirbanilMisulvanN05AL01NeogamaNSC-757850OmperanPyrikapplRD-1403SernevinSplotinSulpirida
Summary
Sulpiride (CHEMBL26) is an approved small-molecule antidepressant (ATC N05AL01) targeting DRD2, DRD3, and CA1; indicated across 5 conditions including psychotic disorder and anxiety.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N05AL01
- Targets: 5 (DRD2, DRD3, CA1…)
- Indications: 5 conditions
- Clinical trials: 12
- Chemistry: 341.4 Da · C15H23N3O4S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL26 |
| Name | Sulpiride |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 5355 |
| ChEBI | CHEBI:32168 |
| ATC | N05AL01 |
| Molecular formula | C15H23N3O4S |
| Molecular weight | 341.4 |
| InChIKey | BGRJTUBHPOOWDU-UHFFFAOYSA-N |
SMILES: CCN1CCCC1CNC(=O)C2=C(C=CC(=C2)S(=O)(=O)N)OC
IUPAC name: N-[(1-ethylpyrrolidin-2-yl)methyl]-2-methoxy-5-sulfamoylbenzamide
ChEBI definition: A member of the class of benzamides obtained from formal condensation between the carboxy group of 2-methoxy-5-sulfamoylbenzoic acid and the primary amino group of (1-ethylpyrrolidin-2-yl)methylamine.
Pharmacological roles (ChEBI): antidepressant, antiemetic, antipsychotic agent, dopaminergic antagonist.
Also known as: Abilit, Aiglonyl, Coolspan, Dobren, Dogmatil, Dogmatyl, Dolmatil, Guastil, Meresa, Mirbanil, Misulvan, N05AL01
Patent coverage: 25,200 distinct patent families (58,543 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 58,369 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| DRD2 | D2 receptor | Antagonist | 7.92 | 0% | P14416 |
| DRD3 | D3 receptor | Antagonist | 7.85 | 0% | P35462 |
| CA1 | carbonic anhydrase 1 | Inhibition | 5.92 | 0% | P00915 |
| CA12 | carbonic anhydrase 12 | Inhibition | 8.41 | 0.2% | O43570 |
| CA7 | carbonic anhydrase 7 | Inhibition | 5.44 | 1.6% | P43166 |
Broader ChEMBL bioactivity targets: 28 (assay-derived). Sample: Microtubule-associated protein tau, RecQ-like DNA helicase BLM, Alpha-2A adrenergic receptor, Carbonic anhydrase 2, D(1A) dopamine receptor, Dopamine receptor, D(2) dopamine receptor, D(4) dopamine receptor, Prostaglandin G/H synthase 1, Carbonic anhydrase 7.
Bioactivity
ChEMBL activities: 123 potent at pChembl ≥ 5 of 136 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| CA6 | 9.1 | Ki | 0.8 | nM | CHEMBL_ACT_1804235 |
| CA6 | 9.1 | Ki | 0.8 | nM | CHEMBL_ACT_2496769 |
| CA6 | 9.1 | Ki | 0.8 | nM | CHEMBL_ACT_5131591 |
| P61169 | 8.82 | Kd | 1.5 | nM | CHEMBL_ACT_1283227 |
| BLM | 8.8 | Potency | 1.6 | nM | CHEMBL_ACT_4749991 |
| BLM | 8.8 | Potency | 1.6 | nM | CHEMBL_ACT_4937874 |
| DRD2 | 8.55 | Kd | 2.82 | nM | CHEMBL_ACT_18246939 |
| CA7 | 8.44 | Ki | 3.6 | nM | CHEMBL_ACT_13859513 |
| CA12 | 8.41 | Ki | 3.9 | nM | CHEMBL_ACT_13440640 |
| CA12 | 8.41 | Ki | 3.9 | nM | CHEMBL_ACT_13910691 |
| CA12 | 8.41 | Ki | 3.9 | nM | CHEMBL_ACT_1437700 |
| P61169 | 8.26 | Ki | 5.51 | nM | CHEMBL_ACT_376124 |
| DRD2 | 8.12 | Ki | 7.6 | nM | CHEMBL_ACT_14550162 |
| DRD3 | 8.1 | Ki | 8 | nM | CHEMBL_ACT_690086 |
| DRD2 | 8.01 | Ki | 9.8 | nM | CHEMBL_ACT_24961689 |
| DRD2 | 7.99 | IC50 | 10.28 | nM | CHEMBL_ACT_6200322 |
| CA5B | 7.75 | Ki | 18 | nM | CHEMBL_ACT_1655310 |
| CA9 | 7.51 | Ki | 31 | nM | CHEMBL_ACT_1760578 |
| P61169 | 7.48 | IC50 | 33 | nM | CHEMBL_ACT_143926 |
| P61169 | 7.44 | IC50 | 36 | nM | CHEMBL_ACT_143927 |
| CA2 | 7.4 | Ki | 40 | nM | CHEMBL_ACT_10946403 |
| CA2 | 7.4 | Ki | 40 | nM | CHEMBL_ACT_12655977 |
| CA2 | 7.4 | Ki | 40 | nM | CHEMBL_ACT_13286813 |
| CA2 | 7.4 | Ki | 40 | nM | CHEMBL_ACT_13407616 |
| CA2 | 7.4 | Ki | 40 | nM | CHEMBL_ACT_13440703 |
| CA2 | 7.4 | Ki | 40 | nM | CHEMBL_ACT_13866456 |
| CA2 | 7.4 | Ki | 40 | nM | CHEMBL_ACT_13910733 |
| CA2 | 7.4 | Ki | 40 | nM | CHEMBL_ACT_1437699 |
| CA2 | 7.4 | Ki | 40 | nM | CHEMBL_ACT_14661463 |
| CA2 | 7.4 | Ki | 40 | nM | CHEMBL_ACT_15108416 |
Target pathways
Aggregated over 5 target gene(s): DRD2, DRD3, CA1, CA12, CA7.
Top Reactome pathways
14 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Metabolism | 3 | CA1, CA12, CA7 |
| Reversible hydration of carbon dioxide | 3 | CA1, CA12, CA7 |
| Dopamine receptors | 2 | DRD2, DRD3 |
| Erythrocytes take up carbon dioxide and release oxygen | 1 | CA1 |
| Erythrocytes take up oxygen and release carbon dioxide | 1 | CA1 |
| Cytokine Signaling in Immune system | 1 | CA1 |
| O2/CO2 exchange in erythrocytes | 1 | CA1 |
| Immune System | 1 | CA1 |
| Transport of small molecules | 1 | CA1 |
| G alpha (i) signalling events | 1 | DRD3 |
| Interleukin-12 family signaling | 1 | CA1 |
| Signaling by Interleukins | 1 | CA1 |
| Gene and protein expression by JAK-STAT signaling after Interleukin-12 stimulation | 1 | CA1 |
| Interleukin-12 signaling | 1 | CA1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G protein-coupled receptor internalization | 2 |
| intracellular calcium ion homeostasis | 2 |
| adenylate cyclase-inhibiting dopamine receptor signaling pathway | 2 |
| locomotory behavior | 2 |
| visual learning | 2 |
| response to xenobiotic stimulus | 2 |
| regulation of dopamine secretion | 2 |
| positive regulation of cytokinesis | 2 |
| circadian regulation of gene expression | 2 |
| response to histamine | 2 |
| response to cocaine | 2 |
| dopamine metabolic process | 2 |
| regulation of potassium ion transport | 2 |
| response to morphine | 2 |
| negative regulation of blood pressure | 2 |
Indications & clinical
Indications
5 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| psychotic disorder | 4 | MONDO:0005485 | EFO:0005407 |
| anxiety | 3 | MONDO:0011918 | EFO:0005230 |
| dementia | 3 | MONDO:0001627 | HP:0000726 |
| depressive disorder | 3 | MONDO:0002050 | MONDO:0002050 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 12.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 6 |
| PHASE4 | 3 |
| PHASE2/PHASE3 | 1 |
| PHASE3 | 1 |
| PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00654576 | PHASE4 | COMPLETED | Effectiveness of Antipsychotic Combination With Psychosocial Intervention on Outcome of Patients With Schizophrenia |
| NCT02307396 | PHASE4 | COMPLETED | Evaluation of the Necessity of Long-term Pharmacological Treatment With Antipsychotics in Schizophrenic Patients |
| NCT04583111 | PHASE4 | UNKNOWN | The Effect of Antiemetics on Bowel Preparation Before Colonoscopy |
| NCT00866645 | PHASE2/PHASE3 | COMPLETED | A Study To Evaluate The Efficacy And Safety Of Intramuscular Levosulpiride In Patients With Agitation Of Schizophrenia |
| NCT02374567 | PHASE3 | TERMINATED | Pharmacovigilance in Gerontopsychiatric Patients |
| NCT02481583 | PHASE1 | COMPLETED | Pharmacokinetic Study of Levosulpiride |
| NCT00280501 | Not specified | COMPLETED | Dopaminergic Modulation of Choroidal Blood Flow Changes During Dark/Light Transitions |
| NCT01777685 | Not specified | COMPLETED | Therapeutic Drug Monitoring and Pharmacokinetic Compartmental Analysis of Sulpiride After Oral Administration to Healthy Volunteers |
| NCT01896349 | Not specified | UNKNOWN | Interpersonal Psychotherapy for Treatment Resistant Depression |
| NCT04697641 | Not specified | COMPLETED | Helicobacter Pylori Eradication in Functional Dyspepsia |
| NCT05208294 | Not specified | COMPLETED | The Role of Dopamine, Reward Learning and Prefrontal Activity in Expectation-induced Mood Enhancement |
| NCT05884671 | Not specified | COMPLETED | Dopamine and Cognition |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
595 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| DOBUTAMINE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7, DRD2, DRD3 |
| VERALIPRIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7, DRD2, DRD3 |
| THIMEROSAL | ChEMBL | Phase 3 | CA12, CA7, DRD2, DRD3 |
| SONEPIPRAZOLE | ChEMBL | Phase 2 | CA1, CA12, CA7, DRD2 |
| ACETAMINOPHEN | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| ACETAZOLAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| BORTEZOMIB | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| BRINZOLAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| CELECOXIB | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| CHLORTHALIDONE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| COUMARIN | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| DICHLORPHENAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| DORZOLAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| ETHOXZOLAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| FAMOTIDINE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| FUROSEMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| IMATINIB | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| INDAPAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| LACOSAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| LEVETIRACETAM | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| MAFENIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| METHAZOLAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| NILOTINIB | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| SALICYLIC ACID | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| SULFANILAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| TOPIRAMATE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| TRICHLORMETHIAZIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| TRIENTINE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| VALDECOXIB | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| ZONISAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| CAFFEIC ACID | ChEMBL | Phase 3 | CA1, CA12, CA7 |
| CURCUMIN | ChEMBL | Phase 3 | CA1, CA12, CA7 |
| P-TOLUENESULFONAMIDE | ChEMBL | Phase 3 | CA1, CA12, CA7 |
| QUERCETIN | ChEMBL | Phase 3 | CA1, CA12, CA7 |
| RESVERATROL | ChEMBL | Phase 3 | CA1, CA12, CA7 |
| SACCHARIN | ChEMBL | Phase 3 | CA1, CA12, CA7 |
| SPERMIDINE | ChEMBL | Phase 3 | CA1, CA12, CA7 |
| CARZENIDE | ChEMBL | Phase 2 | CA1, CA12, CA7 |
| COUMAPHOS | ChEMBL | Phase 2 | CA1, CA12, CA7 |
| ELLAGIC ACID | ChEMBL | Phase 2 | CA1, CA12, CA7 |
| GALLIC ACID | ChEMBL | Phase 2 | CA1, CA12, CA7 |
| INDISULAM | ChEMBL | Phase 2 | CA1, CA12, CA7 |
| IROSUSTAT | ChEMBL | Phase 2 | CA1, CA12, CA7 |
| PCI-27483 | ChEMBL | Phase 2 | CA1, CA12, CA7 |
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, DRD3 |
| GENTIAN VIOLET | ChEMBL + PubChem | Phase 4 (approved) | DRD2, DRD3 |
| PAZOPANIB | ChEMBL + PubChem | Phase 4 (approved) | CA1, CA12 |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | DRD2, DRD3 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | DRD2, DRD3 |
| AMISULPRIDE | ChEMBL | Phase 4 (approved) | DRD2, DRD3 |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | DRD2, DRD3 |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | DRD2, DRD3 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | DRD2, DRD3 |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | DRD2, DRD3 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | DRD2, DRD3 |
| ARMODAFINIL | ChEMBL | Phase 4 (approved) | DRD2, DRD3 |
| ASENAPINE | ChEMBL | Phase 4 (approved) | DRD2, DRD3 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | DRD2, DRD3 |
| AZELASTINE | ChEMBL | Phase 4 (approved) | DRD2, DRD3 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | DRD2, DRD3 |
Related Atlas pages
- Genes: DRD2, DRD3, CA1, CA12, CA7
- Diseases: psychotic disorder, anxiety, dementia, depressive disorder
- Drugs: Dobutamine, Veralipride, Thimerosal, Acetaminophen, Acetazolamide, Bortezomib, Brinzolamide, Celecoxib, Chlorthalidone, Dichlorphenamide, Dorzolamide, Ethoxzolamide, Famotidine, Furosemide, Imatinib, Indapamide, Lacosamide, Levetiracetam, Mafenide, Methazolamide, Nilotinib, Salicylic Acid, Sulfanilamide, Topiramate, Trichlormethiazide, Trientine, Valdecoxib, Zonisamide, Caffeic Acid, Curcumin, P-Toluenesulfonamide, Quercetin, Resveratrol, Saccharin, Spermidine, Dihydroergotamine, Pazopanib, Acetophenazine, Amiodarone, Amisulpride, Amitriptyline, Amlodipine, Amoxapine, Apomorphine, Aripiprazole, Armodafinil, Asenapine, Astemizole, Azelastine, Bazedoxifene