Sumanirole
drugOn this page
Also known as Pnu-95666PNU-95666ESumanirolSID174006884
Summary
Sumanirole (CHEMBL419792) is a phase-3 clinical-stage small molecule targeting DRD2; indicated across 1 condition including parkinson disease.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 1 (DRD2)
- Indications: 1 condition
- Clinical trials: 3
- Chemistry: 203.24 Da · C11H13N3O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL419792 |
| Name | Sumanirole |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 9818479 |
| Molecular formula | C11H13N3O |
| Molecular weight | 203.24 |
| InChIKey | RKZSNTNMEFVBDT-MRVPVSSYSA-N |
SMILES: CN[C@@H]1CC2=C3C(=CC=C2)NC(=O)N3C1
IUPAC name: (10R)-10-(methylamino)-1,3-diazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one
Also known as: Pnu-95666, PNU-95666E, Sumanirol, Sumanirole, SID174006884, sumanirole, SUMANIROLE
Parent form; salt/anhydrous children: CHEMBL5071215
Patent coverage: 298 distinct patent families (1,016 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 1,008 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| DRD2 | D2 receptor | Full agonist | 8.1 | 0% | P14416 |
Broader ChEMBL bioactivity targets: 4 (assay-derived). Sample: 5-hydroxytryptamine receptor 1A, D(2) dopamine receptor, D(3) dopamine receptor, D(2) dopamine receptor.
Bioactivity
ChEMBL activities: 23 potent at pChembl ≥ 5 of 25 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| DRD2 | 8.34 | EC50 | 4.6 | nM | CHEMBL_ACT_16566550 |
| DRD2 | 8.05 | Ki | 9 | nM | CHEMBL_ACT_123808 |
| P61169 | 7.97 | EC50 | 10.8 | nM | CHEMBL_ACT_810474 |
| DRD2 | 7.77 | Ki | 17.1 | nM | CHEMBL_ACT_16565170 |
| DRD2 | 7.49 | EC50 | 32.2 | nM | CHEMBL_ACT_18049331 |
| P61169 | 7.46 | EC50 | 35 | nM | CHEMBL_ACT_810473 |
| DRD2 | 7.33 | Ki | 46.3 | nM | CHEMBL_ACT_18049393 |
| DRD2 | 7.22 | EC50 | 60.1 | nM | CHEMBL_ACT_16566439 |
| DRD2 | 7.19 | EC50 | 64.7 | nM | CHEMBL_ACT_16566495 |
| HTR1A | 7.14 | Ki | 73 | nM | CHEMBL_ACT_123810 |
| DRD2 | 7.13 | EC50 | 74.8 | nM | CHEMBL_ACT_18049526 |
| DRD2 | 7.09 | Ki | 80.6 | nM | CHEMBL_ACT_24988491 |
| DRD2 | 6.78 | EC50 | 165 | nM | CHEMBL_ACT_810472 |
| DRD3 | 6.73 | EC50 | 186 | nM | CHEMBL_ACT_16566467 |
| DRD2 | 6.3 | EC50 | 501.2 | nM | CHEMBL_ACT_18049416 |
| DRD3 | 6.26 | Ki | 546 | nM | CHEMBL_ACT_16565154 |
| DRD2 | 6.26 | EC50 | 543.3 | nM | CHEMBL_ACT_18049471 |
| DRD3 | 6.24 | Ki | 573 | nM | CHEMBL_ACT_18049372 |
| DRD3 | 6.17 | EC50 | 669 | nM | CHEMBL_ACT_16566523 |
| DRD3 | 6.11 | Ki | 784 | nM | CHEMBL_ACT_24988510 |
| DRD3 | 5.63 | Ki | 2333 | nM | CHEMBL_ACT_123809 |
| DRD3 | 5.2 | Ki | 6330 | nM | CHEMBL_ACT_16566403 |
| DRD3 | 5.2 | Ki | 6330 | nM | CHEMBL_ACT_24988567 |
Target pathways
Aggregated over 1 target gene(s): DRD2.
Top Reactome pathways
1 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Dopamine receptors | 1 | DRD2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| temperature homeostasis | 1 |
| response to hypoxia | 1 |
| response to amphetamine | 1 |
| nervous system process involved in regulation of systemic arterial blood pressure | 1 |
| regulation of heart rate | 1 |
| regulation of sodium ion transport | 1 |
| G protein-coupled receptor internalization | 1 |
| positive regulation of neuroblast proliferation | 1 |
| positive regulation of receptor internalization | 1 |
| intracellular calcium ion homeostasis | 1 |
| autophagy | 1 |
| adenylate cyclase-inhibiting dopamine receptor signaling pathway | 1 |
| phospholipase C-activating G protein-coupled receptor signaling pathway | 1 |
| neuron-neuron synaptic transmission | 1 |
| neuroblast proliferation | 1 |
Indications & clinical
Indications
1 indication (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| Parkinson disease | 3 | MONDO:0005180 | MONDO:0005180 |
Clinical trials
Total trials: 3.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 3 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00036205 | PHASE3 | TERMINATED | Open Label Sumanirole Study of Safety, Tolerability, and Therapeutic Response In Patients With Parkinson’s Disease |
| NCT00036218 | PHASE3 | COMPLETED | Study Evaluating Sumanirole for the Treatment of the Signs and Symptoms of Early Parkinson’s Disease. |
| NCT00058838 | PHASE3 | COMPLETED | Study Evaluating Sumanirole for the Treatment of the Signs and Symptoms of Early Parkinson’s Disease |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
296 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2 |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | DRD2 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | DRD2 |
| AMISULPRIDE | ChEMBL | Phase 4 (approved) | DRD2 |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | DRD2 |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | DRD2 |
| AMODIAQUINE | ChEMBL | Phase 4 (approved) | DRD2 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | DRD2 |
| AMSACRINE | ChEMBL | Phase 4 (approved) | DRD2 |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | DRD2 |
| ARFORMOTEROL | ChEMBL | Phase 4 (approved) | DRD2 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | DRD2 |
| ARMODAFINIL | ChEMBL | Phase 4 (approved) | DRD2 |
| ASENAPINE | ChEMBL | Phase 4 (approved) | DRD2 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | DRD2 |
| AZATADINE | ChEMBL | Phase 4 (approved) | DRD2 |
| AZELASTINE | ChEMBL | Phase 4 (approved) | DRD2 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | DRD2 |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | DRD2 |
| BENZQUINAMIDE | ChEMBL | Phase 4 (approved) | DRD2 |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | DRD2 |
| BEPRIDIL | ChEMBL | Phase 4 (approved) | DRD2 |
| BETAMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | DRD2 |
| BLONANSERIN | ChEMBL | Phase 4 (approved) | DRD2 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | DRD2 |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | DRD2 |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | DRD2 |
| BROMPERIDOL | ChEMBL | Phase 4 (approved) | DRD2 |
| BUSPIRONE | ChEMBL | Phase 4 (approved) | DRD2 |
| BUTRIPTYLINE | ChEMBL | Phase 4 (approved) | DRD2 |
| CABERGOLINE | ChEMBL | Phase 4 (approved) | DRD2 |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | DRD2 |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | DRD2 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | DRD2 |
| CEFEPIME | ChEMBL | Phase 4 (approved) | DRD2 |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | DRD2 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | DRD2 |
| CHLORPROTHIXENE | ChEMBL | Phase 4 (approved) | DRD2 |
| CINACALCET | ChEMBL | Phase 4 (approved) | DRD2 |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | DRD2 |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | DRD2 |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | DRD2 |
| CLOFAZIMINE | ChEMBL | Phase 4 (approved) | DRD2 |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | DRD2 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | DRD2 |
| CLOZAPINE | ChEMBL | Phase 4 (approved) | DRD2 |
| CYCLOBENZAPRINE | ChEMBL | Phase 4 (approved) | DRD2 |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | DRD2 |
| DACOMITINIB | ChEMBL | Phase 4 (approved) | DRD2 |
| DARIFENACIN | ChEMBL | Phase 4 (approved) | DRD2 |
| DAUNORUBICIN | ChEMBL | Phase 4 (approved) | DRD2 |
| DESIPRAMINE | ChEMBL | Phase 4 (approved) | DRD2 |
| DESLORATADINE | ChEMBL | Phase 4 (approved) | DRD2 |
| DIBENZEPIN | ChEMBL | Phase 4 (approved) | DRD2 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | DRD2 |
| DIPHENIDOL | ChEMBL | Phase 4 (approved) | DRD2 |
| DISULFIRAM | ChEMBL | Phase 4 (approved) | DRD2 |
| DOBUTAMINE | ChEMBL | Phase 4 (approved) | DRD2 |
| DOMPERIDONE | ChEMBL | Phase 4 (approved) | DRD2 |
| DOPAMINE | ChEMBL | Phase 4 (approved) | DRD2 |
Related Atlas pages
- Genes: DRD2
- Diseases: Parkinson disease
- Drugs: Dihydroergotamine, Acetophenazine, Amiodarone, Amisulpride, Amitriptyline, Amlodipine, Amodiaquine, Amoxapine, Amsacrine, Apomorphine, Arformoterol, Aripiprazole, Armodafinil, Asenapine, Astemizole, Azatadine, Azelastine, Bazedoxifene, Benperidol, Benzquinamide, Benztropine, Bepridil, Betamethasone Dipropionate, Blonanserin, Bosutinib, Brexpiprazole, Bromocriptine, Bromperidol, Buspirone, Butriptyline, Cabergoline, Cannabidiol, Cariprazine, Carvedilol, Cefepime, Chlorhexidine, Chlorpromazine, Chlorprothixene, Cinacalcet, Cinnarizine, Cisapride, Clemastine, Clofazimine, Clomipramine, Clotrimazole, Clozapine, Cyclobenzaprine, Cyproheptadine, Dacomitinib, Darifenacin, Daunorubicin, Desipramine, Desloratadine, Dibenzepin, Diethylstilbestrol, Diphenidol, Disulfiram, Dobutamine, Domperidone, Dopamine