Suprofen
drugOn this page
Also known as NSC-303611ProfenalR-25,061R-25061Racemic suprofenSrendamSulproltinSuprofeneSuprofenoSutoprofenTN-762TopalgicSID26748525SID56463227(+/-) SuprofenSID144204194SID170465412Suprofen (Profenal)
Summary
Suprofen (CHEMBL956) is an approved small-molecule non-steroidal anti-inflammatory drug (ATC M01AE07) targeting PTGS1 and PTGS2; indicated across 1 condition including rheumatic disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: M01AE07
- Targets: 2 (PTGS1, PTGS2)
- Indications: 1 condition
- Chemistry: 260.31 Da · C14H12O3S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL956 |
| Name | Suprofen |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 5359 |
| ChEBI | CHEBI:9362 |
| ATC | M01AE07 |
| Molecular formula | C14H12O3S |
| Molecular weight | 260.31 |
| InChIKey | MDKGKXOCJGEUJW-UHFFFAOYSA-N |
SMILES: CC(C1=CC=C(C=C1)C(=O)C2=CC=CS2)C(=O)O
IUPAC name: 2-[4-(thiophene-2-carbonyl)phenyl]propanoic acid
ChEBI definition: An aromatic ketone that is thiophene substituted at C-2 by a 4-(1-carboxyethyl)benzoyl group.
Pharmacological roles (ChEBI): non-steroidal anti-inflammatory drug, non-narcotic analgesic, EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor, antirheumatic drug, peripheral nervous system drug, drug allergen.
Also known as: NSC-303611, Profenal, R-25,061, R-25061, Racemic suprofen, Srendam, Sulproltin, Suprofen, Suprofene, Suprofeno, Sutoprofen, TN-762
Patent coverage: 7,961 distinct patent families (32,428 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| PTGS1 | COX-1 | Inhibition | 6.25 | 0% | P23219 |
| PTGS2 | COX-2 | Inhibition | 5.56 | 0% | P35354 |
Broader ChEMBL bioactivity targets: 10 (assay-derived). Sample: Lysine-specific demethylase 4E, Inositol monophosphatase 1, 15-hydroxyprostaglandin dehydrogenase [NAD(+)], Relaxin receptor 1, Beta-lactamase, Prostaglandin G/H synthase 1, Prostaglandin G/H synthase 2, Cytochrome P450 2C9, Aldehyde dehydrogenase 1A1, Prostaglandin G/H synthase 1.
Bioactivity
ChEMBL activities: 6 potent at pChembl ≥ 5 of 11 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| Q63921 | 6.55 | AC50 | 284 | nM | CHEMBL_ACT_25174524 |
| PTGS1 | 6.25 | IC50 | 560 | nM | CHEMBL_ACT_2242275 |
| PTGS2 | 5.56 | IC50 | 2750 | nM | CHEMBL_ACT_2242285 |
| CYP2C9 | 5.43 | Ki | 3700 | nM | CHEMBL_ACT_6075058 |
| P97697 | 5.3 | Potency | 5012 | nM | CHEMBL_ACT_4407290 |
| P00811 | 5.2 | Potency | 6310 | nM | CHEMBL_ACT_4684038 |
Target pathways
Aggregated over 2 target gene(s): PTGS1, PTGS2.
Top Reactome pathways
9 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Synthesis of Prostaglandins (PG) and Thromboxanes (TX) | 2 | PTGS1, PTGS2 |
| COX reactions | 1 | PTGS1 |
| Synthesis of 15-eicosatetraenoic acid derivatives | 1 | PTGS2 |
| Interleukin-10 signaling | 1 | PTGS2 |
| Interleukin-4 and Interleukin-13 signaling | 1 | PTGS2 |
| Biosynthesis of DHA-derived SPMs | 1 | PTGS2 |
| Biosynthesis of EPA-derived SPMs | 1 | PTGS2 |
| Biosynthesis of DPAn-3 SPMs | 1 | PTGS2 |
| Biosynthesis of electrophilic ω-3 PUFA oxo-derivatives | 1 | PTGS2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| prostaglandin biosynthetic process | 2 |
| response to oxidative stress | 2 |
| regulation of blood pressure | 2 |
| cyclooxygenase pathway | 2 |
| regulation of cell population proliferation | 2 |
| long-chain fatty acid biosynthetic process | 2 |
| lipid metabolic process | 2 |
| fatty acid metabolic process | 2 |
| fatty acid biosynthetic process | 2 |
| prostaglandin metabolic process | 2 |
| prostanoid biosynthetic process | 2 |
| cellular oxidant detoxification | 2 |
| embryo implantation | 1 |
| response to nematode | 1 |
| response to selenium ion | 1 |
Indications & clinical
Indications
1 indication (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| rheumatic disorder | 4 | MONDO:0005554 | EFO:0005755 |
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
407 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| 3,3’,4’,5-TETRACHLOROSALICYLANILIDE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ACEMETACIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ASPIRIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| BROMFENAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CAPSAICIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CAPTOPRIL | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CARPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CELECOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CIANIDANOL | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DEXIBUPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DEXKETOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DICLOFENAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DOXORUBICIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ESFLURBIPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ETODOLAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ETORICOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| FLURBIPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| GLAFENINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| IBUPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| INDOMETHACIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| KETOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| KETOROLAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| LEVODOPA | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| LOXOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| LUMIRACOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MECLOFENAMIC ACID | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MEFENAMIC ACID | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MELOXICAM | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MOFEZOLAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MONOBENZONE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| NAPROXEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| NIMESULIDE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| OMADACYCLINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| OXAPROZIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| PIROXICAM | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| PRIMAQUINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| RANITIDINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ROFECOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| SELINEXOR | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TEGASEROD | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TELOTRISTAT | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TOLMETIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TROGLITAZONE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| VALDECOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| VORTIOXETINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CURCUMIN | ChEMBL | Phase 3 | PTGS1, PTGS2 |
| RESVERATROL | ChEMBL | Phase 3 | PTGS1, PTGS2 |
| CIMICOXIB | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| DERACOXIB | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| ENOFELAST | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| FIROCOXIB | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| FLUFENAMIC ACID | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| LICOFELONE | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| MAVACOXIB | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| MIROPROFEN | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| NIFLUMIC ACID | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| PHENOTHIAZINE | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| PIRMAGREL | ChEMBL | Phase 2 | PTGS1, PTGS2 |
Related Atlas pages
- Genes: PTGS1, PTGS2
- Diseases: rheumatic disorder
- Drugs: 3,3’,4’,5-TETRACHLOROSALICYLANILIDE, Acemetacin, Aspirin, Bromfenac, Capsaicin, Captopril, Carprofen, Celecoxib, Cianidanol, Dexibuprofen, Dexketoprofen, Diclofenac, Diethylstilbestrol, Doxorubicin, Esflurbiprofen, Etodolac, Etoricoxib, Flurbiprofen, Glafenine, Hexachlorophene, Ibuprofen, Indomethacin, Ketorolac, Levodopa, Loxoprofen, Lumiracoxib, Meclofenamic Acid, Mefenamic Acid, Meloxicam, Mofezolac, Monobenzone, Naproxen, Nimesulide, Omadacycline, Oxaprozin, Piroxicam, Primaquine, Ranitidine, Rofecoxib, Selinexor, Tegaserod, Telotristat, Tolmetin, Troglitazone, Valdecoxib, Vortioxetine, Curcumin, Resveratrol