Tamibarotene
drugOn this page
Also known as AM-80AmnoidAm80INNO-507NSC-608000OP-01RR-110Sy-1425TamibarotenoTM-411TOS-80TSID50125822SID485050SID144206278SID170465883TamibaroteneÊTamibaroteneÂ
Summary
Tamibarotene (CHEMBL25202) is an approved small-molecule antineoplastic agent targeting RARA, RARB, and RARG; indicated across 10 conditions including myelodysplastic syndrome and crohn disease; with CIViC clinical evidence for 1 variant-indication association (e.g. PML K227_T233del in acute promyelocytic leukemia).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- Targets: 3 (RARA, RARB, RARG)
- Indications: 10 conditions
- Clinical trials: 12
- Precision-oncology evidence (CIViC): 1 variant–indication association
- Chemistry: 351.4 Da · C22H25NO3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL25202 |
| Name | Tamibarotene |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 108143 |
| ChEBI | CHEBI:32181 |
| Molecular formula | C22H25NO3 |
| Molecular weight | 351.4 |
| InChIKey | MUTNCGKQJGXKEM-UHFFFAOYSA-N |
SMILES: CC1(CCC(C2=C1C=CC(=C2)NC(=O)C3=CC=C(C=C3)C(=O)O)(C)C)C
IUPAC name: 4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]benzoic acid
ChEBI definition: A dicarboxylic acid monoamide resulting from the condensation of one of the carboxy groups of terephthalic acid with the amino group of 5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-amine.
Pharmacological roles (ChEBI): antineoplastic agent, retinoic acid receptor α/β agonist.
Also known as: AM-80, Amnoid, Am80, INNO-507, NSC-608000, OP-01, RR-110, Sy-1425, SY-1425, Tamibarotene, Tamibaroteno, TM-411
Patent coverage: 1,449 distinct patent families (5,139 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 4,570 (89%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| RARA | Retinoic acid receptor-α | Agonist | 6.9 | 0.8% | P10276 |
| RARB | Retinoic acid receptor-β | Agonist | 6.63 | 0.1% | P10826 |
| RARG | Retinoic acid receptor-γ | Agonist | 6.23 | 1.6% | P13631 |
Broader ChEMBL bioactivity targets: 10 (assay-derived). Sample: Retinoic acid receptor gamma, Retinoic acid receptor beta, Retinoic acid receptor alpha, Thromboxane A2 receptor, Progesterone receptor, Menin/Histone-lysine N-methyltransferase MLL, Adenosine receptor A3, Cytochrome P450 3A4, Flavin reductase (NADPH), Cytochrome P450 26A1.
Bioactivity
ChEMBL activities: 12 potent at pChembl ≥ 5 of 18 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| RARA | 8.19 | Ki | 6.5 | nM | CHEMBL_ACT_636015 |
| RARB | 7.52 | Ki | 30 | nM | CHEMBL_ACT_636016 |
| RARA | 7.35 | EC50 | 45 | nM | CHEMBL_ACT_3526118 |
| RARA | 7.3 | EC50 | 50 | nM | CHEMBL_ACT_26335883 |
| RARA | 7.11 | IC50 | 78 | nM | CHEMBL_ACT_496727 |
| RARB | 6.7 | EC50 | 200 | nM | CHEMBL_ACT_26335884 |
| RARB | 6.63 | EC50 | 235 | nM | CHEMBL_ACT_3526119 |
| RARG | 6.23 | EC50 | 591 | nM | CHEMBL_ACT_3526120 |
| RARG | 6.22 | EC50 | 600 | nM | CHEMBL_ACT_26335885 |
| BLVRB | 5.86 | Kd | 1380 | nM | CHEMBL_ACT_24380451 |
| BLVRB | 5.86 | Kd | 1380 | nM | CHEMBL_ACT_24380452 |
| TBXA2R | 5 | AC50 | 9940 | nM | CHEMBL_ACT_25197803 |
Target pathways
Aggregated over 3 target gene(s): RARA, RARB, RARG.
Top Reactome pathways
6 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Nuclear Receptor transcription pathway | 3 | RARA, RARB, RARG |
| Signaling by Retinoic Acid | 3 | RARA, RARB, RARG |
| Activation of anterior HOX genes in hindbrain development during early embryogenesis | 3 | RARA, RARB, RARG |
| SUMOylation of intracellular receptors | 1 | RARA |
| Transcriptional regulation of granulopoiesis | 1 | RARA |
| TGFBR3 expression | 1 | RARA |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| negative regulation of transcription by RNA polymerase II | 3 |
| glandular epithelial cell development | 3 |
| growth plate cartilage development | 3 |
| cell differentiation | 3 |
| regulation of myelination | 3 |
| multicellular organism growth | 3 |
| positive regulation of transcription by RNA polymerase II | 3 |
| retinoic acid receptor signaling pathway | 3 |
| negative regulation of cartilage development | 3 |
| regulation of DNA-templated transcription | 3 |
| bone development | 3 |
| ureteric bud development | 2 |
| neural tube closure | 2 |
| outflow tract septum morphogenesis | 2 |
| positive regulation of cell population proliferation | 2 |
Indications & clinical
Indications
10 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| myelodysplastic syndrome | 3 | MONDO:0018881 | EFO:0000198 |
| Crohn disease | 2 | MONDO:0005011 | EFO:0000384 |
| acute myeloid leukemia | 2 | MONDO:0018874 | EFO:0000222 |
| acute promyelocytic leukemia | 2 | MONDO:0012883 | EFO:0000224 |
| lupus nephritis | 2 | MONDO:0005556 | EFO:0005761 |
| tropical spastic paraparesis | 2 | MONDO:0008039 | EFO:0007527 |
| Alzheimer disease | 2 | MONDO:0004975 | MONDO:0004975 |
| autosomal dominant polycystic kidney disease | 2 | MONDO:0004691 | EFO:1001496 |
| exocrine pancreatic carcinoma | 1 | MONDO:0005192 | EFO:0002618 |
| chronic myelomonocytic leukemia | 1 | MONDO:0020311 | EFO:1001779 |
Clinical trials
Total trials: 12.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 7 |
| PHASE1/PHASE2 | 2 |
| PHASE2/PHASE3 | 1 |
| PHASE3 | 1 |
| PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT01343355 | PHASE2/PHASE3 | UNKNOWN | Efficacy and Safety of Tamibarotene(AM80H) for HTLV-1 Associated Myelopathy/ Tropical Spastic Paraparesis (HAM/TSP) |
| NCT04797780 | PHASE3 | TERMINATED | Tamibarotene Plus Azacitidine in Participants With Newly Diagnosed RARA-positive Higher-Risk Myelodysplastic Syndrome |
| NCT06289998 | PHASE2 | ACTIVE_NOT_RECRUITING | Study of Tamibarotene in Patients With ADPKD |
| NCT00520208 | PHASE2 | COMPLETED | Safety, Efficacy, & Pharmacokinetic Study of Tamibarotene to Treat Patients With Relapsed or Refractory APL |
| NCT01120002 | PHASE2 | UNKNOWN | Efficacy and Safety of Tamibarotene (OAM80) for Alzheimer’s Disease |
| NCT01226147 | PHASE2 | UNKNOWN | Efficacy and Safety of Tamibarotene(AM80) for Lupus Nephritis |
| NCT01337154 | PHASE2 | TERMINATED | First Line Study of Tamibarotene in Combination for Advanced Non-Small Cell Lung Cancer |
| NCT02807558 | PHASE2 | COMPLETED | A Biomarker-Directed Phase 2 Trial of Tamibarotene (SY-1425) in Participants With Acute Myeloid Leukemia or Myelodysplastic Syndrome |
| NCT04905407 | PHASE2 | TERMINATED | Tamibarotene Plus Venetoclax/Azacitidine in Participants With Newly Diagnosed Acute Myeloid Leukemia (AML) |
| NCT05064618 | PHASE1/PHASE2 | UNKNOWN | Investigator-initiated Clinical Trial of MIKE-1 |
| NCT06085638 | PHASE1/PHASE2 | WITHDRAWN | Phase I/II Study of SY-1425 (Tamibarotene) in Combination With Azacitidine and Venetoclax for Patients With Chronic Myelomonocytic Leukemia |
| NCT00985530 | PHASE1 | TERMINATED | Tamibarotene and Arsenic Trioxide for Relapsed Acute Promyelocytic Leukemia |
Clinical evidence (CIViC)
Variant × indication × effect (1 predictive associations from 1 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| PML K227_T233del | Acute Promyelocytic Leukemia | Resistance | Tamibarotene + Tretinoin | CIViC C | EID8175 |
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
42 molecules share ≥1 primary target. Top 42 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Acetaminophen | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| ADAPALENE | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| ALITRETINOIN | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| Alprostadil | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| Amoxicillin | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| BEXAROTENE | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| cyclosporine | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| Olanzapine | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| Rosiglitazone | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| TAZAROTENE | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| Tolcapone | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| TRETINOIN | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| TRIFAROTENE | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| Zafirlukast | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| CONESSINE | ChEMBL | Phase 2 | RARA, RARB, RARG |
| GLIQUIDONE | ChEMBL | Phase 2 | RARA, RARB, RARG |
| Atorvastatin | PubChem | Approved | RARA, RARB, RARG |
| Bosentan | PubChem | Approved | RARA, RARB, RARG |
| Calcitriol | PubChem | Approved | RARA, RARB, RARG |
| Carprofen | PubChem | Approved | RARA, RARB, RARG |
| Diclofenac | PubChem | Approved | RARA, RARB, RARG |
| ethinyl estradiol | PubChem | Approved | RARA, RARB, RARG |
| Repaglinide | PubChem | Approved | RARA, RARB, RARG |
| rifampin | PubChem | Approved | RARA, RARB, RARG |
| Simvastatin | PubChem | Approved | RARA, RARB, RARG |
| Sunitinib | PubChem | Approved | RARA, RARB, RARG |
| Ticlopidine | PubChem | Approved | RARA, RARB, RARG |
| Verapamil | PubChem | Approved | RARA, RARB, RARG |
| TROGLITAZONE | ChEMBL | Phase 4 (approved) | RARB, RARG |
| Rivaroxaban | PubChem | Approved | RARB, RARG |
| IBUPROFEN | ChEMBL | Phase 4 (approved) | RARB |
| KETOCONAZOLE | ChEMBL | Phase 4 (approved) | RARB |
| RACECADOTRIL | ChEMBL | Phase 4 (approved) | RARG |
| TROVAFLOXACIN | ChEMBL | Phase 4 (approved) | RARB |
| MOLIBRESIB | ChEMBL | Phase 2 | RARA |
| NRX195183 | ChEMBL | Phase 2 | RARA |
| arsenic trichloride | PubChem | Approved | RARA |
| arsenic triiodide | PubChem | Approved | RARA |
| Domperidone | PubChem | Approved | RARG |
| Pitavastatin | PubChem | Approved | RARG |
| Retinol | PubChem | Approved | RARA |
Related Atlas pages
- Genes: RARA, RARB, RARG
- Diseases: myelodysplastic syndrome, acute promyelocytic leukemia
- Drugs: Acetaminophen, Adapalene, Alitretinoin, Alprostadil, Amoxicillin, Bexarotene, cyclosporine, Olanzapine, Regorafenib, Rosiglitazone, Tazarotene, Tolcapone, Tretinoin, Trifarotene, Zafirlukast, Atorvastatin, Bosentan, Calcitriol, Carprofen, Diclofenac, ethinyl estradiol, Repaglinide, rifampin, Simvastatin, Sunitinib, Ticlopidine, Verapamil, Troglitazone, Rivaroxaban, Ibuprofen, Ketoconazole, Racecadotril, Trovafloxacin, Domperidone, Pitavastatin, Retinol