Temsirolimus
drugOn this page
Also known as CCI-779ToriselSID520036SID144206068
Summary
Temsirolimus (CHEMBL1201182) is an approved small molecule (ATC L01EG01) targeting MTOR; indicated across 88 conditions including renal cell carcinoma and neoplasm; with CIViC clinical evidence for 15 variant-indication associations (e.g. KRAS Mutation in endometrial cancer).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: L01EG01
- Targets: 1 (MTOR)
- Indications: 88 conditions
- Clinical trials: 197
- Precision-oncology evidence (CIViC): 15 variant–indication associations
- Chemistry: 1030.3 Da · C56H87NO16
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1201182 |
| Name | Temsirolimus |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 6918289 |
| ATC | L01EG01 |
| Molecular formula | C56H87NO16 |
| Molecular weight | 1030.3 |
| InChIKey | CBPNZQVSJQDFBE-FUXHJELOSA-N |
SMILES: C[C@@H]1CC[C@H]2C[C@@H](/C(=C/C=C/C=C/[C@H](C[C@H](C(=O)[C@@H]([C@@H](/C(=C/[C@H](C(=O)C[C@H](OC(=O)[C@@H]3CCCCN3C(=O)C(=O)[C@@]1(O2)O)[C@H](C)C[C@@H]4CC[C@H]([C@@H](C4)OC)OC(=O)C(C)(CO)CO)C)/C)O)OC)C)C)/C)OC
IUPAC name: [(1R,2R,4S)-4-[(2R)-2-[(1R,9S,12S,15R,16E,18R,19R,21R,23S,24E,26E,28E,30S,32S,35R)-1,18-dihydroxy-19,30-dimethoxy-15,17,21,23,29,35-hexamethyl-2,3,10,14,20-pentaoxo-11,36-dioxa-4-azatricyclo[30.3.1.04,9]hexatriaconta-16,24,26,28-tetraen-12-yl]propyl]-2-methoxycyclohexyl] 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate
Also known as: CCI-779, Temsirolimus, Torisel, TEMSIROLIMUS, temsirolimus, SID520036, SID144206068
Patent coverage: 8,502 distinct patent families (25,195 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| MTOR | mechanistic target of rapamycin kinase | Inhibition | 5.8 | 98.3% (common-essential) | P42345 |
Broader ChEMBL bioactivity targets: 6 (assay-derived). Sample: ATP-binding cassette sub-family C member 4, Serine/threonine-protein kinase mTOR, Synaptic vesicular amine transporter, ATP-binding cassette sub-family C member 2, ATP-binding cassette sub-family C member 3, Bile salt export pump.
Bioactivity
ChEMBL activities: 7 potent at pChembl ≥ 5 of 11 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| MTOR | 5.75 | IC50 | 1760 | nM | CHEMBL_ACT_25044903 |
| MTOR | 5.75 | IC50 | 1760 | nM | CHEMBL_ACT_25872953 |
| MTOR | 5.75 | IC50 | 1760 | nM | CHEMBL_ACT_29205857 |
| MTOR | 5.75 | IC50 | 1760 | nM | CHEMBL_ACT_6188454 |
| MTOR | 5.64 | IC50 | 2290 | nM | CHEMBL_ACT_23207010 |
| ABCB11 | 5.57 | IC50 | 2690 | nM | CHEMBL_ACT_18129036 |
| ABCB11 | 5.54 | AC50 | 2900 | nM | CHEMBL_ACT_25126989 |
Target pathways
Aggregated over 1 target gene(s): MTOR.
Top Reactome pathways
41 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| PIP3 activates AKT signaling | 1 | MTOR |
| Adaptive Immune System | 1 | MTOR |
| Signal Transduction | 1 | MTOR |
| Macroautophagy | 1 | MTOR |
| Disease | 1 | MTOR |
| MTOR signalling | 1 | MTOR |
| mTORC1-mediated signalling | 1 | MTOR |
| Immune System | 1 | MTOR |
| Signaling by VEGF | 1 | MTOR |
| Generic Transcription Pathway | 1 | MTOR |
| PI3K/AKT Signaling in Cancer | 1 | MTOR |
| Cellular responses to stress | 1 | MTOR |
| Cellular response to heat stress | 1 | MTOR |
| HSF1-dependent transactivation | 1 | MTOR |
| Transcriptional Regulation by TP53 | 1 | MTOR |
| Energy dependent regulation of mTOR by LKB1-AMPK | 1 | MTOR |
| Regulation of T cell activation by CD28 family | 1 | MTOR |
| Co-stimulation by CD28 | 1 | MTOR |
| CD28 dependent PI3K/Akt signaling | 1 | MTOR |
| VEGFA-VEGFR2 Pathway | 1 | MTOR |
| VEGFR2 mediated vascular permeability | 1 | MTOR |
| TP53 Regulates Metabolic Genes | 1 | MTOR |
| Regulation of TP53 Activity | 1 | MTOR |
| Diseases of signal transduction by growth factor receptors and second messengers | 1 | MTOR |
| Constitutive Signaling by AKT1 E17K in Cancer | 1 | MTOR |
| Regulation of TP53 Degradation | 1 | MTOR |
| Regulation of TP53 Expression and Degradation | 1 | MTOR |
| PTEN Regulation | 1 | MTOR |
| RNA Polymerase II Transcription | 1 | MTOR |
| Gene expression (Transcription) | 1 | MTOR |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| regulation of cell growth | 1 |
| T-helper 1 cell lineage commitment | 1 |
| heart morphogenesis | 1 |
| heart valve morphogenesis | 1 |
| energy reserve metabolic process | 1 |
| ‘de novo’ pyrimidine nucleobase biosynthetic process | 1 |
| inflammatory response | 1 |
| DNA damage response | 1 |
| cytoskeleton organization | 1 |
| germ cell development | 1 |
| regulation of cell size | 1 |
| cellular response to starvation | 1 |
| response to heat | 1 |
| response to virus | 1 |
| post-embryonic development | 1 |
Indications & clinical
Indications
88 indications (5 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| renal cell carcinoma | 4 | MONDO:0005086 | EFO:0000681 |
| neoplasm | 4 | MONDO:0005070 | EFO:0000616 |
| mantle cell lymphoma | 4 | MONDO:0018876 | EFO:1001469 |
| clear cell renal carcinoma | 4 | MONDO:0005005 | EFO:0000349 |
| lymphoma | 3 | MONDO:0005062 | EFO:0000574 |
| alveolar rhabdomyosarcoma | 3 | MONDO:0009994 | EFO:0000248 |
| breast carcinoma | 3 | MONDO:0004989 | EFO:0000305 |
| embryonal rhabdomyosarcoma | 3 | MONDO:0009993 | EFO:0000437 |
| breast neoplasm | 3 | MONDO:0021100 | EFO:0003869 |
| hepatoblastoma | 3 | MONDO:0018666 | EFO:1000292 |
| myelodysplastic syndrome | 2 | MONDO:0018881 | EFO:0000198 |
| rheumatoid arthritis | 2 | MONDO:0008383 | EFO:0000685 |
| small cell lung carcinoma | 2 | MONDO:0008433 | EFO:0000702 |
| Hodgkins lymphoma | 2 | MONDO:0004952 | EFO:0000183 |
| acute myeloid leukemia | 2 | MONDO:0018874 | EFO:0000222 |
| non-small cell lung carcinoma | 2 | MONDO:0005233 | EFO:0003060 |
| endometrioid adenocarcinoma | 2 | MONDO:0005026 | EFO:0000466 |
| head and neck squamous cell carcinoma | 2 | MONDO:0010150 | EFO:0000181 |
| hepatocellular carcinoma | 2 | MONDO:0007256 | EFO:0000182 |
| non-Hodgkin lymphoma | 2 | MONDO:0018908 | EFO:0005952 |
| plasma cell myeloma | 2 | MONDO:0009693 | EFO:0001378 |
| gliosarcoma | 2 | MONDO:0016681 | EFO:1001465 |
| cutaneous melanoma | 2 | MONDO:0005012 | EFO:0000389 |
| diffuse large B-cell lymphoma | 2 | MONDO:0018905 | EFO:0000403 |
| glioblastoma | 2 | MONDO:0018177 | EFO:0000519 |
| ischemic disease | 2 | MONDO:0005053 | EFO:0000556 |
| leukemia | 2 | MONDO:0005059 | EFO:0000565 |
| neuroblastoma | 2 | MONDO:0005072 | EFO:0000621 |
| osteosarcoma | 2 | MONDO:0009807 | EFO:0000637 |
| sarcoma | 2 | MONDO:0005089 | EFO:0000691 |
| squamous cell carcinoma | 2 | MONDO:0005096 | EFO:0000707 |
| melanoma | 2 | MONDO:0005105 | EFO:0000756 |
| relapsing-remitting multiple sclerosis | 2 | MONDO:0005314 | EFO:0003929 |
| endometrial carcinoma | 2 | MONDO:0002447 | EFO:1001512 |
| adenoma | 2 | MONDO:0004972 | EFO:0000232 |
| peripheral arterial disease | 2 | MONDO:0005386 | EFO:0004265 |
| pancreatic endocrine carcinoma | 2 | MONDO:0005893 | EFO:0007416 |
| fallopian tube carcinoma | 2 | MONDO:0006206 | EFO:1000251 |
| somatostatinoma | 2 | MONDO:0006976 | EFO:1001187 |
| ganglioneuroblastoma | 2 | MONDO:0005035 | EFO:0000502 |
| central nervous system neoplasm | 2 | MONDO:0006130 | EFO:1000158 |
| uterine carcinosarcoma | 2 | MONDO:0006485 | EFO:1000613 |
| soft tissue sarcoma | 2 | MONDO:0018078 | EFO:1001968 |
| fallopian tube neoplasm | 2 | MONDO:0021092 | MONDO:0002158 |
| kidney cancer | 2 | MONDO:0002367 | MONDO:0002367 |
| ovarian cancer | 2 | MONDO:0008170 | MONDO:0008170 |
| endometrium neoplasm | 2 | MONDO:0021251 | MONDO:0011962 |
| pancreatic insulinoma | 2 | MONDO:0024677 | MONDO:0024677 |
| uterine corpus cancer | 2 | MONDO:0006003 | EFO:0007532 |
| pancreatic insulin-producing neuroendocrine tumor | 2 | MONDO:0005048 | EFO:0000549 |
| exocrine pancreatic carcinoma | 2 | MONDO:0005192 | EFO:0002618 |
| rhabdomyosarcoma | 2 | MONDO:0005212 | EFO:0002918 |
| carcinoid tumor | 2 | MONDO:0005369 | MONDO:0024503 |
| brain neoplasm | 1 | MONDO:0021211 | EFO:0003833 |
| male breast carcinoma | 1 | MONDO:0005628 | EFO:0006861 |
| adenocarcinoma | 1 | MONDO:0004970 | EFO:0000228 |
| carcinoma | 1 | MONDO:0004993 | EFO:0000313 |
| chronic myeloid leukemia | 1 | MONDO:0011996 | EFO:0000339 |
| colorectal adenocarcinoma | 1 | MONDO:0005008 | EFO:0000365 |
| prostate adenocarcinoma | 1 | MONDO:0005082 | EFO:0000673 |
| anaplastic astrocytoma | 1 | MONDO:0016684 | EFO:0002499 |
| anaplastic oligodendroglioma | 1 | MONDO:0016696 | EFO:0002501 |
| female reproductive organ cancer | 1 | MONDO:0001416 | EFO:1001331 |
| diffuse intrinsic pontine glioma | 1 | MONDO:0006033 | EFO:1000026 |
| peritoneal neoplasm | 1 | MONDO:0006901 | MONDO:0002087 |
| glioma | 1 | MONDO:0021042 | MONDO:0003268 |
| lung neoplasm | 1 | MONDO:0021117 | MONDO:0008903 |
| astrocytoma (excluding glioblastoma) | 1 | MONDO:0019781 | MONDO:0016691 |
| prostate carcinoma | 1 | MONDO:0005159 | EFO:0001663 |
| colonic neoplasm | 1 | MONDO:0005401 | EFO:0004288 |
| oligodendroglioma | 1 | MONDO:0016695 | MONDO:0002543 |
| colorectal neoplasm | 1 | MONDO:0005335 | MONDO:0005575 |
| paraganglioma | 0 | MONDO:0000448 | EFO:1000453 |
15 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 197.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 78 |
| PHASE1 | 69 |
| PHASE1/PHASE2 | 28 |
| PHASE3 | 9 |
| Not specified | 9 |
| EARLY_PHASE1 | 3 |
| PHASE4 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT01180049 | PHASE4 | COMPLETED | Comparison Of 2 Doses Of Temsirolimus (Torisel) In Patients With Mantle Cell Lymphoma |
| NCT00980460 | PHASE3 | ACTIVE_NOT_RECRUITING | Risk-Based Therapy in Treating Younger Patients With Newly Diagnosed Liver Cancer |
| NCT02567435 | PHASE3 | ACTIVE_NOT_RECRUITING | Combination Chemotherapy With or Without Temsirolimus in Treating Patients With Intermediate Risk Rhabdomyosarcoma |
| NCT04433572 | PHASE3 | RECRUITING | Temsirolimus Adventitial Delivery to Improve ANGioplasty and/or Atherectomy Revascularization Outcomes Below the Knee |
| NCT00065468 | PHASE3 | COMPLETED | Study Evaluating Interferon And CCI-779 In Advanced Renal Cell Carcinoma |
| NCT00083993 | PHASE3 | TERMINATED | Study Evaluating CCI-779 and Letrozole in Post-menopausal Women With Breast Cancer |
| NCT00117598 | PHASE3 | COMPLETED | Study Evaluating Temsirolimus (CCI-779) In Mantle Cell Lymphoma (MCL) |
| NCT00474786 | PHASE3 | COMPLETED | Temsirolimus Versus Sorafenib As Second-Line Therapy In Patients With Advanced RCC Who Have Failed First-Line Sunitinib |
| NCT00631371 | PHASE3 | COMPLETED | Study Comparing Bevacizumab + Temsirolimus vs. Bevacizumab + Interferon-Alfa In Advanced Renal Cell Carcinoma Subjects |
| NCT01646021 | PHASE3 | COMPLETED | Study of Ibrutinib (a Bruton’s Tyrosine Kinase Inhibitor), Versus Temsirolimus in Patients With Relapsed or Refractory Mantle Cell Lymphoma Who Have Received at Least One Prior Therapy |
| NCT00977574 | PHASE2 | ACTIVE_NOT_RECRUITING | Paclitaxel, Carboplatin, and Bevacizumab or Paclitaxel, Carboplatin, and Temsirolimus or Ixabepilone, Carboplatin, and Bevacizumab in Treating Patients With Stage III, Stage IV, or Recurrent Endometrial Cancer |
| NCT01396408 | PHASE2 | ACTIVE_NOT_RECRUITING | A Phase II Study of Sunitinib or Temsirolimus in Patients With Advanced Rare Tumours |
| NCT01946529 | PHASE2 | ACTIVE_NOT_RECRUITING | Therapeutic Trial for Patients With Ewing Sarcoma Family of Tumor and Desmoplastic Small Round Cell Tumors |
| NCT02693535 | PHASE2 | RECRUITING | TAPUR: Testing the Use of Food and Drug Administration (FDA) Approved Drugs That Target a Specific Abnormality in a Tumor Gene in People With Advanced Stage Cancer |
| NCT03297606 | PHASE2 | RECRUITING | Canadian Profiling and Targeted Agent Utilization Trial (CAPTUR) |
| NCT00012142 | PHASE2 | COMPLETED | CCI-779 in Treating Patients With Prostate Cancer |
| NCT00016328 | PHASE2 | COMPLETED | CCI-779 in Treating Patients With Recurrent Glioblastoma Multiforme |
| NCT00022464 | PHASE2 | COMPLETED | CCI-779 in Treating Patients With Metastatic Melanoma |
| NCT00022724 | PHASE1/PHASE2 | COMPLETED | CCI-779 in Treating Patients With Malignant Glioma |
| NCT00028028 | PHASE2 | COMPLETED | CCI-779 in Treating Patients With Extensive-Stage Small Cell Lung Cancer |
| NCT00033267 | PHASE2 | COMPLETED | CCI-779 in Treating Patients With Mantle Cell Non-Hodgkin’s Lymphoma |
| NCT00062751 | PHASE2 | COMPLETED | Study Evaluating Temsirolimus (CCI-779) In Breast Neoplasms |
| NCT00071968 | PHASE2 | COMPLETED | Neoadjuvant CCI-779 Followed By Radical Prostatectomy in Treating Patients With Newly Diagnosed Prostate Cancer Who Have a High Risk of Relapse |
| NCT00072176 | PHASE2 | COMPLETED | Temsirolimus in Treating Patients With Metastatic or Locally Advanced Recurrent Endometrial Cancer |
| NCT00075647 | PHASE2 | COMPLETED | CCI-779 in Treating Patients With Locally Advanced or Metastatic Pancreatic Cancer |
| NCT00076206 | PHASE2 | TERMINATED | Study Evaluating CCI-779 in Active Rheumatoid Arthritis on Concomitant Methotrexate Therapy |
| NCT00079235 | PHASE2 | COMPLETED | CCI-779 in Treating Patients With Stage IIIB (With Pleural Effusion) or Stage IV Non-Small Cell Lung Cancer |
| NCT00079456 | PHASE2 | COMPLETED | Temsirolimus in Treating Patients With Relapsed or Refractory Multiple Myeloma |
| NCT00084916 | PHASE2 | COMPLETED | CCI-779 in Treating Patients With Relapsed or Refractory Acute Myeloid Leukemia, Acute Lymphoblastic Leukemia, Myelodysplastic Syndromes, or Chronic Myelogenous Leukemia in Blastic Phase |
| NCT00086840 | PHASE2 | TERMINATED | CCI-779 in Treating Patients With Relapsed or Refractory Chronic Lymphocytic Leukemia |
| NCT00087074 | PHASE2 | COMPLETED | CCI-779 in Treating Patients With Soft Tissue Sarcoma or Gastrointestinal Stromal Tumor |
| NCT00093782 | PHASE2 | COMPLETED | Temsirolimus in Treating Patients With Metastatic Neuroendocrine Carcinoma |
| NCT00106353 | PHASE1/PHASE2 | COMPLETED | Study Evaluating Biomarkers In Relapsed/Refractory Pediatric Solid Tumors |
| NCT00109967 | PHASE2 | COMPLETED | CCI-779 and Rituximab in Treating Patients With Relapsed or Refractory Non-Hodgkin’s Lymphoma |
| NCT00112736 | PHASE1/PHASE2 | COMPLETED | Erlotinib and Temsirolimus in Treating Patients With Recurrent Malignant Glioma |
| NCT00112840 | PHASE1/PHASE2 | COMPLETED | CCI-779 and Bevacizumab in Treating Patients With Metastatic or Unresectable Kidney Cancer |
| NCT00228397 | PHASE2 | COMPLETED | Study Evaluating CCI-779 in Relapsing Multiple Sclerosis |
| NCT00281957 | PHASE2 | COMPLETED | Sorafenib With Either Temsirolimus or Tipifarnib in Treating Patients With Stage IV Malignant Melanoma That Cannot Be Removed By Surgery |
| NCT00290472 | PHASE2 | COMPLETED | CCI-779 in Treating Patients With Recurrent or Refractory B-Cell Non-Hodgkin’s Lymphoma or Chronic Lymphocytic Leukemia |
| NCT00329719 | PHASE1/PHASE2 | COMPLETED | Sorafenib Tosylate and Temsirolimus in Treating Patients With Recurrent Glioblastoma |
Clinical evidence (CIViC)
Variant × indication × effect (15 predictive associations from 16 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| KRAS Mutation | Endometrial Cancer | Sensitivity/Response | Ridaforolimus + Temsirolimus | CIViC B | EID894 |
| PIK3CA Mutation | Endometrial Cancer | Sensitivity/Response | Temsirolimus + Ridaforolimus | CIViC B | EID892 |
| PTEN Loss | Endometrial Cancer | Resistance | Temsirolimus + Ridaforolimus | CIViC B | EID893 |
| KIAA1549::BRAF Fusion | Spindle Cell Sarcoma | Sensitivity/Response | Sorafenib + Bevacizumab + Temsirolimus | CIViC C | EID1664 +1 |
| NF2 K159fs | Breast Cancer | Sensitivity/Response | Temsirolimus | CIViC C | EID715 |
| PTPRD R995C | Ewing Sarcoma | Sensitivity/Response | IGF1R Monoclonal Antibody + Temsirolimus | CIViC C | EID10061 |
| PTPRD T781A | Ewing Sarcoma | Sensitivity/Response | Temsirolimus + IGF1R Monoclonal Antibody | CIViC C | EID10062 |
| MTOR Q2223K | Clear Cell Renal Cell Carcinoma | Sensitivity/Response | Temsirolimus | CIViC D | EID4522 |
| PIK3CA E542K | Thyroid Cancer | Sensitivity/Response | Perifosine + Temsirolimus | CIViC D | EID1626 |
| PIK3CA H1047R | Thyroid Cancer | Sensitivity/Response | Perifosine + Temsirolimus | CIViC D | EID1625 |
| PTEN Loss | Endometrial Cancer | Sensitivity/Response | Temsirolimus | CIViC D | EID1614 |
| PTEN Loss | Prostate Cancer | Sensitivity/Response | Temsirolimus | CIViC D | EID507 |
| PTEN R130* | Thyroid Cancer | Sensitivity/Response | Perifosine + Temsirolimus | CIViC D | EID1627 |
| VHL Loss | Renal Carcinoma | Sensitivity/Response | Temsirolimus | CIViC D | EID1035 |
| VHL Loss-of-function | Renal Cell Carcinoma | Sensitivity/Response | Temsirolimus | CIViC D | EID4828 |
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
158 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ALPELISIB | ChEMBL | Phase 4 (approved) | MTOR |
| AMIODARONE | ChEMBL | Phase 4 (approved) | MTOR |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | MTOR |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | MTOR |
| AMSACRINE | ChEMBL | Phase 4 (approved) | MTOR |
| AZACITIDINE | ChEMBL | Phase 4 (approved) | MTOR |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | MTOR |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | MTOR |
| CHLOROQUINE | ChEMBL | Phase 4 (approved) | MTOR |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | MTOR |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | MTOR |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | MTOR |
| COPANLISIB | ChEMBL | Phase 4 (approved) | MTOR |
| CYCLOBENZAPRINE | ChEMBL | Phase 4 (approved) | MTOR |
| CYCLOSPORINE | ChEMBL | Phase 4 (approved) | MTOR |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | MTOR |
| CYTARABINE | ChEMBL | Phase 4 (approved) | MTOR |
| DASATINIB | ChEMBL | Phase 4 (approved) | MTOR |
| DEQUALINIUM | ChEMBL | Phase 4 (approved) | MTOR |
| DESIPRAMINE | ChEMBL | Phase 4 (approved) | MTOR |
| DISULFIRAM | ChEMBL | Phase 4 (approved) | MTOR |
| DOMPERIDONE | ChEMBL | Phase 4 (approved) | MTOR |
| DOPAMINE | ChEMBL | Phase 4 (approved) | MTOR |
| DOXAZOSIN | ChEMBL | Phase 4 (approved) | MTOR |
| EBASTINE | ChEMBL | Phase 4 (approved) | MTOR |
| EMETINE | ChEMBL | Phase 4 (approved) | MTOR |
| EPINEPHRINE | ChEMBL | Phase 4 (approved) | MTOR |
| EVEROLIMUS | ChEMBL | Phase 4 (approved) | MTOR |
| FELODIPINE | ChEMBL | Phase 4 (approved) | MTOR |
| FENOFIBRATE | ChEMBL | Phase 4 (approved) | MTOR |
| FLUOROURACIL | ChEMBL | Phase 4 (approved) | MTOR |
| FLUOXETINE | ChEMBL | Phase 4 (approved) | MTOR |
| FLUPHENAZINE | ChEMBL | Phase 4 (approved) | MTOR |
| FLUSPIRILENE | ChEMBL | Phase 4 (approved) | MTOR |
| GUANABENZ | ChEMBL | Phase 4 (approved) | MTOR |
| HALOPERIDOL | ChEMBL | Phase 4 (approved) | MTOR |
| HYDROQUINONE | ChEMBL | Phase 4 (approved) | MTOR |
| IDARUBICIN | ChEMBL | Phase 4 (approved) | MTOR |
| IMIPRAMINE | ChEMBL | Phase 4 (approved) | MTOR |
| INDOMETHACIN | ChEMBL | Phase 4 (approved) | MTOR |
| ISOPROTERENOL | ChEMBL | Phase 4 (approved) | MTOR |
| ISOTRETINOIN | ChEMBL | Phase 4 (approved) | MTOR |
| LOPERAMIDE | ChEMBL | Phase 4 (approved) | MTOR |
| LORATADINE | ChEMBL | Phase 4 (approved) | MTOR |
| MAPROTILINE | ChEMBL | Phase 4 (approved) | MTOR |
| MASOPROCOL | ChEMBL | Phase 4 (approved) | MTOR |
| MEMANTINE | ChEMBL | Phase 4 (approved) | MTOR |
| METHYLDOPA | ChEMBL | Phase 4 (approved) | MTOR |
| MIBEFRADIL | ChEMBL | Phase 4 (approved) | MTOR |
| MIFEPRISTONE | ChEMBL | Phase 4 (approved) | MTOR |
| MITOXANTRONE | ChEMBL | Phase 4 (approved) | MTOR |
| NAFTOPIDIL | ChEMBL | Phase 4 (approved) | MTOR |
| NICARDIPINE | ChEMBL | Phase 4 (approved) | MTOR |
| NICLOSAMIDE | ChEMBL | Phase 4 (approved) | MTOR |
| NIFEDIPINE | ChEMBL | Phase 4 (approved) | MTOR |
| NORTRIPTYLINE | ChEMBL | Phase 4 (approved) | MTOR |
| PACLITAXEL | ChEMBL | Phase 4 (approved) | MTOR |
| PANCURONIUM | ChEMBL | Phase 4 (approved) | MTOR |
| PAROXETINE | ChEMBL | Phase 4 (approved) | MTOR |
| PENTAMIDINE ISETHIONATE | ChEMBL | Phase 4 (approved) | MTOR |
Related Atlas pages
- Genes: MTOR
- Diseases: renal cell carcinoma, neoplasm, mantle cell lymphoma, clear cell renal carcinoma, lymphoma, alveolar rhabdomyosarcoma, breast carcinoma, embryonal rhabdomyosarcoma, breast neoplasm, hepatoblastoma, endometrial carcinoma, spindle cell sarcoma, Ewing sarcoma, nonpapillary renal cell carcinoma, thyroid gland carcinoma, prostate carcinoma, renal carcinoma
- Drugs: Alpelisib, Amiodarone, Amitriptyline, Amoxapine, Amsacrine, Azacitidine, Bromocriptine, Carvedilol, Chloroquine, Chlorpromazine, Clemastine, Clomipramine, Copanlisib, Cyclobenzaprine, Cyclosporine, Cyproheptadine, Cytarabine, Dasatinib, Dequalinium, Desipramine, Disulfiram, Domperidone, Dopamine, Doxazosin, Ebastine, Emetine, Epinephrine, Everolimus, Felodipine, Fenofibrate, Fluorouracil, Fluoxetine, Fluphenazine, Fluspirilene, Guanabenz, Haloperidol, Hydroquinone, Idarubicin, Imipramine, Indomethacin, Isoproterenol, Isotretinoin, Loperamide, Loratadine, Maprotiline, Masoprocol, Memantine, Methyldopa, Mibefradil, Mifepristone, Mitoxantrone, Naftopidil, Nicardipine, Niclosamide, Nifedipine, Nortriptyline, Paclitaxel, Pancuronium, Paroxetine
- Biomarker genes: NF2, VHL