Tepotinib
drugOn this page
Also known as EMD 1214063Emd-1214063EMD1214063MSC-2156119MSC-2156119JMSC2156119TEPOTINIB_EMD-1214063
Summary
Tepotinib (CHEMBL3402762) is an approved small molecule (ATC L01EX21) targeting MET; indicated across 8 conditions including neoplasm and non-small cell lung carcinoma; with CIViC clinical evidence for 7 variant-indication associations (e.g. MET Exon 14 Skipping Mutation in lung non-small cell carcinoma).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: L01EX21
- Targets: 1 (MET)
- Indications: 8 conditions
- Clinical trials: 24
- Precision-oncology evidence (CIViC): 7 variant–indication associations
- Chemistry: 492.6 Da · C29H28N6O2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL3402762 |
| Name | Tepotinib |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 25171648 |
| ATC | L01EX21 |
| Molecular formula | C29H28N6O2 |
| Molecular weight | 492.6 |
| InChIKey | AHYMHWXQRWRBKT-UHFFFAOYSA-N |
SMILES: CN1CCC(CC1)COC2=CN=C(N=C2)C3=CC=CC(=C3)CN4C(=O)C=CC(=N4)C5=CC=CC(=C5)C#N
IUPAC name: 3-[1-[[3-[5-[(1-methylpiperidin-4-yl)methoxy]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile
Also known as: EMD 1214063, Emd-1214063, EMD-1214063, EMD1214063, MSC-2156119, MSC-2156119J, MSC2156119, Tepotinib, TEPOTINIB, TEPOTINIB_EMD-1214063
Parent form; salt/anhydrous children: CHEMBL4594292
Patent coverage: 537 distinct patent families (1,276 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 1,257 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| MET | MET proto-oncogene, receptor tyrosine kinase | Inhibition | 8.52 | 2.4% | P08581 |
Broader ChEMBL bioactivity targets: 2 (assay-derived). Sample: Hepatocyte growth factor receptor, Ribosyldihydronicotinamide dehydrogenase [quinone].
Bioactivity
ChEMBL activities: 8 potent at pChembl ≥ 5 of 8 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| MET | 9.05 | IC50 | 0.9 | nM | CHEMBL_ACT_29320099 |
| MET | 9 | Kd | 1 | nM | CHEMBL_ACT_17919103 |
| MET | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_16466235 |
| MET | 8.51 | IC50 | 3.1 | nM | CHEMBL_ACT_24672080 |
| MET | 8.4 | IC50 | 4 | nM | CHEMBL_ACT_25527164 |
| MET | 8.05 | IC50 | 9 | nM | CHEMBL_ACT_25881925 |
| MET | 7.92 | IC50 | 12 | nM | CHEMBL_ACT_15165455 |
| NQO2 | 6.06 | Kd | 875 | nM | CHEMBL_ACT_17922440 |
Target pathways
Aggregated over 1 target gene(s): MET.
Top Reactome pathways
44 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| PIP3 activates AKT signaling | 1 | MET |
| Developmental Biology | 1 | MET |
| Signal Transduction | 1 | MET |
| Disease | 1 | MET |
| Negative regulation of the PI3K/AKT network | 1 | MET |
| Generic Transcription Pathway | 1 | MET |
| PI3K/AKT Signaling in Cancer | 1 | MET |
| Constitutive Signaling by Aberrant PI3K in Cancer | 1 | MET |
| Semaphorin interactions | 1 | MET |
| Sema4D in semaphorin signaling | 1 | MET |
| Sema4D mediated inhibition of cell attachment and migration | 1 | MET |
| Axon guidance | 1 | MET |
| Diseases of signal transduction by growth factor receptors and second messengers | 1 | MET |
| Infectious disease | 1 | MET |
| RAF/MAP kinase cascade | 1 | MET |
| MAPK family signaling cascades | 1 | MET |
| MAPK1/MAPK3 signaling | 1 | MET |
| Signaling by MET | 1 | MET |
| MET Receptor Activation | 1 | MET |
| Negative regulation of MET activity | 1 | MET |
| PI5P, PP2A and IER3 Regulate PI3K/AKT Signaling | 1 | MET |
| RNA Polymerase II Transcription | 1 | MET |
| Gene expression (Transcription) | 1 | MET |
| MET activates RAS signaling | 1 | MET |
| MET activates PI3K/AKT signaling | 1 | MET |
| MET activates PTPN11 | 1 | MET |
| MET activates PTK2 signaling | 1 | MET |
| InlB-mediated entry of Listeria monocytogenes into host cell | 1 | MET |
| MET interacts with TNS proteins | 1 | MET |
| MET activates RAP1 and RAC1 | 1 | MET |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| endothelial cell morphogenesis | 1 |
| liver development | 1 |
| cell surface receptor signaling pathway | 1 |
| cell surface receptor protein tyrosine kinase signaling pathway | 1 |
| negative regulation of autophagy | 1 |
| neuron differentiation | 1 |
| pancreas development | 1 |
| positive regulation of transcription by RNA polymerase II | 1 |
| hepatocyte growth factor receptor signaling pathway | 1 |
| branching morphogenesis of an epithelial tube | 1 |
| positive chemotaxis | 1 |
| excitatory postsynaptic potential | 1 |
| semaphorin-plexin signaling pathway | 1 |
| negative regulation of hydrogen peroxide-mediated programmed cell death | 1 |
| positive regulation of endothelial cell chemotaxis | 1 |
Indications & clinical
Indications
8 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| neoplasm | 4 | MONDO:0005070 | EFO:0000616 |
| non-small cell lung carcinoma | 2 | MONDO:0005233 | EFO:0003060 |
| colorectal neoplasm | 2 | MONDO:0005335 | EFO:0004142 |
| lung adenocarcinoma | 2 | MONDO:0005061 | EFO:0000571 |
| hepatocellular carcinoma | 1 | MONDO:0007256 | EFO:0000182 |
| liver disorder | 1 | MONDO:0005154 | EFO:0001421 |
| brain neoplasm | 1 | MONDO:0021211 | EFO:0003833 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 24.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 9 |
| PHASE1 | 9 |
| PHASE1/PHASE2 | 5 |
| PHASE3 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT06908993 | PHASE3 | RECRUITING | Tepotinib vs Standard Treatment in Patients With Advanced MET Exon 14 Mutated Non-Small Cell Lung Cancer Previously Treated |
| NCT02864992 | PHASE2 | ACTIVE_NOT_RECRUITING | Tepotinib Phase II in NSCLC Harboring MET Alterations (VISION) |
| NCT02925234 | PHASE2 | RECRUITING | The Drug Rediscovery Protocol (DRUP Trial) |
| NCT03940703 | PHASE2 | ACTIVE_NOT_RECRUITING | A Study of Tepotinib Plus Osimertinib in Osimertinib Relapsed MET Amplified NSCLC (INSIGHT 2) |
| NCT05159245 | PHASE2 | RECRUITING | The Finnish National Study to Facilitate Patient Access to Targeted Anti-cancer Drugs |
| NCT06031688 | PHASE2 | RECRUITING | Targeted Treatment for Advanced Non-Small Cell Lung Cancer That Has a MET Exon 14 Skipping Gene Change (An Expanded Lung-MAP Treatment Trial) |
| NCT06083857 | PHASE1/PHASE2 | ACTIVE_NOT_RECRUITING | PhI/II Study of Amivantamab and Tepotinib Combo in MET-altered Non-small Cell Lung Cancer |
| NCT06106802 | PHASE2 | RECRUITING | Lazertinib & Tepotinib for EGFR Mutant NSCLC in MET Overexpressed or Amplified Who Progressed After Lazertinib Treatment |
| NCT01982955 | PHASE1/PHASE2 | COMPLETED | Tepotinib With Gefitinib in Participants With Locally Advanced or Metastatic NSCLC (INSIGHT) |
| NCT01988493 | PHASE1/PHASE2 | COMPLETED | Efficacy, Safety, and Pharmacokinetic of MSC2156119J in Asian Participants With Hepatocellular Carcinoma |
| NCT02115373 | PHASE1/PHASE2 | COMPLETED | c-Met Second-Line Hepatocellular Carcinoma |
| NCT04515394 | PHASE2 | TERMINATED | Study of Tepotinib Combined With Cetuximab in Participants With Left-Sided RAS/BRAF Wild Type Metastatic Colorectal Cancer (PERSPECTIVE) |
| NCT04591431 | PHASE2 | UNKNOWN | The Rome Trial From Histology to Target: the Road to Personalize Target Therapy and Immunotherapy |
| NCT04647838 | PHASE2 | UNKNOWN | Tepotinib in Solid Tumors Harboring MET Alterations |
| NCT04739358 | PHASE1/PHASE2 | TERMINATED | CNS Dose Escalation/Expansion of Tepotinib in MET-driven NSCLC |
| NCT05782361 | PHASE1 | ACTIVE_NOT_RECRUITING | POTENT - Tepotinib in Combination With Pembrolizumab in NSCLC |
| NCT03492437 | PHASE1 | COMPLETED | Effect of Tepotinib on the PK of the P-gp Substrate Dabigatran Etexilate |
| NCT03531762 | PHASE1 | COMPLETED | Effect of a Proton Pump Inhibitor on the PK of Tepotinib |
| NCT03546608 | PHASE1 | COMPLETED | Tepotinib Hepatic Impairment Trial |
| NCT03628339 | PHASE1 | COMPLETED | Effect of Tepotinib on PK of CYP3A Substrate Midazolam |
| NCT03629223 | PHASE1 | COMPLETED | Bioequivalence of TF3 and TF2 and Effect of Food on the PK of Tepotinib |
| NCT04204902 | PHASE1 | COMPLETED | Bioequivalence of 5 Tablets of 100 mg Versus 2 Tablets of 250 mg TF3 of Tepotinib |
| NCT05120960 | PHASE1 | WITHDRAWN | A Phase 1a/1b Study to Determine the Recommended Phase 2 Dose, of Tepotinib in Participants With MET Alterations and Brain Tumors |
| NCT05213481 | PHASE1 | COMPLETED | Tepotinib Drug-Drug Interaction Study With Carbamazepine in Healthy Participants |
Clinical evidence (CIViC)
Variant × indication × effect (7 predictive associations from 15 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| MET Exon 14 Skipping Mutation | Lung Non-small Cell Carcinoma | Sensitivity/Response | Tepotinib | CIViC A | EID11766 +3 |
| EGFR Mutation AND ( MET Amplification OR MET Overexpression ) | Lung Non-small Cell Carcinoma | Sensitivity/Response | Tepotinib + Gefitinib | CIViC B | EID11456 |
| MET Exon 14 Skipping Mutation | Lung Adenocarcinoma | Sensitivity/Response | Tepotinib | CIViC C | EID11464 +3 |
| MET Exon 14 Skipping Mutation AND CD274 Overexpression | Lung Adenocarcinoma | Sensitivity/Response | Tepotinib | CIViC C | EID11460 +2 |
| EGFR L858R AND EGFR T790M AND MET Exon 14 Skipping Mutation | Lung Adenocarcinoma | Sensitivity/Response | Tepotinib | CIViC C | EID11486 |
| MET Splice Site (c.3028+2T>C) | Lung Adenocarcinoma | Sensitivity/Response | Capmatinib + Tepotinib | CIViC C | EID11412 |
| MET H1094L | Cancer | Sensitivity/Response | Tepotinib | CIViC D | EID7958 |
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
83 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AFATINIB | ChEMBL + PubChem | Phase 4 (approved) | MET |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | MET |
| PAZOPANIB | ChEMBL + PubChem | Phase 4 (approved) | MET |
| AFATINIB DIMALEATE | ChEMBL | Phase 4 (approved) | MET |
| AXITINIB | ChEMBL | Phase 4 (approved) | MET |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | MET |
| BRIGATINIB | ChEMBL | Phase 4 (approved) | MET |
| CABOZANTINIB | ChEMBL | Phase 4 (approved) | MET |
| CABOZANTINIB S-MALATE | ChEMBL | Phase 4 (approved) | MET |
| CAPMATINIB | ChEMBL | Phase 4 (approved) | MET |
| CERITINIB | ChEMBL | Phase 4 (approved) | MET |
| DABRAFENIB | ChEMBL | Phase 4 (approved) | MET |
| ENSARTINIB | ChEMBL | Phase 4 (approved) | MET |
| ENTRECTINIB | ChEMBL | Phase 4 (approved) | MET |
| ERLOTINIB | ChEMBL | Phase 4 (approved) | MET |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | MET |
| GEFITINIB | ChEMBL | Phase 4 (approved) | MET |
| INFIGRATINIB | ChEMBL | Phase 4 (approved) | MET |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | MET |
| NERATINIB | ChEMBL | Phase 4 (approved) | MET |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | MET |
| PALBOCICLIB | ChEMBL | Phase 4 (approved) | MET |
| SORAFENIB | ChEMBL | Phase 4 (approved) | MET |
| SUNITINIB | ChEMBL | Phase 4 (approved) | MET |
| TIVOZANIB | ChEMBL | Phase 4 (approved) | MET |
| VANDETANIB | ChEMBL | Phase 4 (approved) | MET |
| CANERTINIB | ChEMBL | Phase 3 | MET |
| CEDIRANIB | ChEMBL | Phase 3 | MET |
| DACTOLISIB | ChEMBL | Phase 3 | MET |
| ENZASTAURIN | ChEMBL | Phase 3 | MET |
| EPIGALOCATECHIN GALLATE | ChEMBL | Phase 3 | MET |
| LESTAURTINIB | ChEMBL | Phase 3 | MET |
| LINIFANIB | ChEMBL | Phase 3 | MET |
| LINSITINIB | ChEMBL | Phase 3 | MET |
| POZIOTINIB | ChEMBL | Phase 3 | MET |
| QUERCETIN | ChEMBL | Phase 3 | MET |
| RIGOSERTIB | ChEMBL | Phase 3 | MET |
| SAVOLITINIB | ChEMBL | Phase 3 | MET |
| SITRAVATINIB | ChEMBL | Phase 3 | MET |
| TIVANTINIB | ChEMBL | Phase 3 | MET |
| ALTIRATINIB | ChEMBL | Phase 2 | MET |
| AMG-208 | ChEMBL | Phase 2 | MET |
| AMG-337 | ChEMBL | Phase 2 | MET |
| AT-9283 | ChEMBL | Phase 2 | MET |
| BEMCENTINIB | ChEMBL | Phase 2 | MET |
| BI-2536 | ChEMBL | Phase 2 | MET |
| BMS-754807 | ChEMBL | Phase 2 | MET |
| BMS-777607 | ChEMBL | Phase 2 | MET |
| CENISERTIB | ChEMBL | Phase 2 | MET |
| CEP-32496 | ChEMBL | Phase 2 | MET |
| DALMELITINIB | ChEMBL | Phase 2 | MET |
| DECERNOTINIB | ChEMBL | Phase 2 | MET |
| DEFOSBARASERTIB | ChEMBL | Phase 2 | MET |
| ELLAGIC ACID | ChEMBL | Phase 2 | MET |
| ELZOVANTINIB | ChEMBL | Phase 2 | MET |
| ENVONALKIB | ChEMBL | Phase 2 | MET |
| FORETINIB | ChEMBL | Phase 2 | MET |
| GLESATINIB | ChEMBL | Phase 2 | MET |
| GOLVATINIB | ChEMBL | Phase 2 | MET |
| GUMARONTINIB | ChEMBL | Phase 2 | MET |
Related Atlas pages
- Genes: MET
- Diseases: neoplasm, lung adenocarcinoma, cancer
- Drugs: Afatinib, Crizotinib, Pazopanib, Axitinib, Bosutinib, Brigatinib, Cabozantinib, Capmatinib, Ceritinib, Dabrafenib, Ensartinib, Entrectinib, Erlotinib, Fedratinib, Gefitinib, Infigratinib, Midostaurin, Neratinib, Nintedanib, Palbociclib, Sorafenib, Sunitinib, Tivozanib, Vandetanib, Canertinib, Cediranib, Dactolisib, Enzastaurin, Epigalocatechin Gallate, Lestaurtinib, Linifanib, Linsitinib, Poziotinib, Quercetin, Rigosertib, Savolitinib, Sitravatinib, Tivantinib
- Biomarker genes: SLTM