Terevalefim
drugOn this page
Also known as Ang-3777BB-3BB3RefanalinSNV-003
Summary
Terevalefim (CHEMBL4650326) is a phase-3 clinical-stage small molecule targeting MET; indicated across 3 conditions including acute kidney injury.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 1 (MET)
- Indications: 3 conditions
- Clinical trials: 7
- Chemistry: 176.24 Da · C9H8N2S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL4650326 |
| Name | Terevalefim |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 5714038 |
| Molecular formula | C9H8N2S |
| Molecular weight | 176.24 |
| InChIKey | FOHWAQGURRYJFK-ONEGZZNKSA-N |
SMILES: C1=CSC(=C1)/C=C/C2=CC=NN2
IUPAC name: 5-[(E)-2-thiophen-2-ylethenyl]-1H-pyrazole
Also known as: Ang-3777, ANG-3777, BB-3, BB3, Refanalin, SNV-003, Terevalefim, TEREVALEFIM
Patent coverage: 59 distinct patent families (176 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 144 (82%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| MET | MET proto-oncogene, receptor tyrosine kinase | Activation | 2.4% | P08581 |
Bioactivity
No ChEMBL bioactivity rows at pChembl ≥ 5 (expected for biologics / antibodies).
Target pathways
Aggregated over 1 target gene(s): MET.
Top Reactome pathways
44 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| PIP3 activates AKT signaling | 1 | MET |
| Developmental Biology | 1 | MET |
| Signal Transduction | 1 | MET |
| Disease | 1 | MET |
| Negative regulation of the PI3K/AKT network | 1 | MET |
| Generic Transcription Pathway | 1 | MET |
| PI3K/AKT Signaling in Cancer | 1 | MET |
| Constitutive Signaling by Aberrant PI3K in Cancer | 1 | MET |
| Semaphorin interactions | 1 | MET |
| Sema4D in semaphorin signaling | 1 | MET |
| Sema4D mediated inhibition of cell attachment and migration | 1 | MET |
| Axon guidance | 1 | MET |
| Diseases of signal transduction by growth factor receptors and second messengers | 1 | MET |
| Infectious disease | 1 | MET |
| RAF/MAP kinase cascade | 1 | MET |
| MAPK family signaling cascades | 1 | MET |
| MAPK1/MAPK3 signaling | 1 | MET |
| Signaling by MET | 1 | MET |
| MET Receptor Activation | 1 | MET |
| Negative regulation of MET activity | 1 | MET |
| PI5P, PP2A and IER3 Regulate PI3K/AKT Signaling | 1 | MET |
| RNA Polymerase II Transcription | 1 | MET |
| Gene expression (Transcription) | 1 | MET |
| MET activates RAS signaling | 1 | MET |
| MET activates PI3K/AKT signaling | 1 | MET |
| MET activates PTPN11 | 1 | MET |
| MET activates PTK2 signaling | 1 | MET |
| InlB-mediated entry of Listeria monocytogenes into host cell | 1 | MET |
| MET interacts with TNS proteins | 1 | MET |
| MET activates RAP1 and RAC1 | 1 | MET |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| endothelial cell morphogenesis | 1 |
| liver development | 1 |
| cell surface receptor signaling pathway | 1 |
| cell surface receptor protein tyrosine kinase signaling pathway | 1 |
| negative regulation of autophagy | 1 |
| neuron differentiation | 1 |
| pancreas development | 1 |
| positive regulation of transcription by RNA polymerase II | 1 |
| hepatocyte growth factor receptor signaling pathway | 1 |
| branching morphogenesis of an epithelial tube | 1 |
| positive chemotaxis | 1 |
| excitatory postsynaptic potential | 1 |
| semaphorin-plexin signaling pathway | 1 |
| negative regulation of hydrogen peroxide-mediated programmed cell death | 1 |
| positive regulation of endothelial cell chemotaxis | 1 |
Indications & clinical
Indications
3 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| acute kidney injury | 2 | MONDO:0002492 | HP:0001919 |
2 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 7.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 5 |
| PHASE3 | 1 |
| PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT02474667 | PHASE3 | UNKNOWN | Reduce the Severity of DGF in Recipients of a Deceased Donor Kidney |
| NCT01286727 | PHASE2 | UNKNOWN | Study to Improve Renal Function After Kidney Transplantation |
| NCT01539590 | PHASE2 | TERMINATED | Study to Evaluate the Safety and Activity of BB3 to Treat Heart Attack |
| NCT01561599 | PHASE2 | UNKNOWN | Study on Delayed Graft Function Using Paired Kidneys |
| NCT02771509 | PHASE2 | UNKNOWN | Study to Prevent Acute Kidney Injury After Cardiac Surgery Involving Cardiopulmonary Bypass |
| NCT04459676 | PHASE2 | UNKNOWN | Study to Assess Efficacy and Safety Relative to Standard of Care in Patients With COVID-19 Pneumonia |
| NCT04958187 | PHASE1 | UNKNOWN | Study to Evaluate the Pharmacokinetics of ANG-3777 in Hemodialysis Subjects |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
84 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AFATINIB | ChEMBL + PubChem | Phase 4 (approved) | MET |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | MET |
| PAZOPANIB | ChEMBL + PubChem | Phase 4 (approved) | MET |
| AFATINIB DIMALEATE | ChEMBL | Phase 4 (approved) | MET |
| AXITINIB | ChEMBL | Phase 4 (approved) | MET |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | MET |
| BRIGATINIB | ChEMBL | Phase 4 (approved) | MET |
| CABOZANTINIB | ChEMBL | Phase 4 (approved) | MET |
| CABOZANTINIB S-MALATE | ChEMBL | Phase 4 (approved) | MET |
| CAPMATINIB | ChEMBL | Phase 4 (approved) | MET |
| CERITINIB | ChEMBL | Phase 4 (approved) | MET |
| DABRAFENIB | ChEMBL | Phase 4 (approved) | MET |
| ENSARTINIB | ChEMBL | Phase 4 (approved) | MET |
| ENTRECTINIB | ChEMBL | Phase 4 (approved) | MET |
| ERLOTINIB | ChEMBL | Phase 4 (approved) | MET |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | MET |
| GEFITINIB | ChEMBL | Phase 4 (approved) | MET |
| INFIGRATINIB | ChEMBL | Phase 4 (approved) | MET |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | MET |
| NERATINIB | ChEMBL | Phase 4 (approved) | MET |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | MET |
| PALBOCICLIB | ChEMBL | Phase 4 (approved) | MET |
| SORAFENIB | ChEMBL | Phase 4 (approved) | MET |
| SUNITINIB | ChEMBL | Phase 4 (approved) | MET |
| TEPOTINIB | ChEMBL | Phase 4 (approved) | MET |
| TIVOZANIB | ChEMBL | Phase 4 (approved) | MET |
| VANDETANIB | ChEMBL | Phase 4 (approved) | MET |
| CANERTINIB | ChEMBL | Phase 3 | MET |
| CEDIRANIB | ChEMBL | Phase 3 | MET |
| DACTOLISIB | ChEMBL | Phase 3 | MET |
| ENZASTAURIN | ChEMBL | Phase 3 | MET |
| EPIGALOCATECHIN GALLATE | ChEMBL | Phase 3 | MET |
| LESTAURTINIB | ChEMBL | Phase 3 | MET |
| LINIFANIB | ChEMBL | Phase 3 | MET |
| LINSITINIB | ChEMBL | Phase 3 | MET |
| POZIOTINIB | ChEMBL | Phase 3 | MET |
| QUERCETIN | ChEMBL | Phase 3 | MET |
| RIGOSERTIB | ChEMBL | Phase 3 | MET |
| SAVOLITINIB | ChEMBL | Phase 3 | MET |
| SITRAVATINIB | ChEMBL | Phase 3 | MET |
| TIVANTINIB | ChEMBL | Phase 3 | MET |
| ALTIRATINIB | ChEMBL | Phase 2 | MET |
| AMG-208 | ChEMBL | Phase 2 | MET |
| AMG-337 | ChEMBL | Phase 2 | MET |
| AT-9283 | ChEMBL | Phase 2 | MET |
| BEMCENTINIB | ChEMBL | Phase 2 | MET |
| BI-2536 | ChEMBL | Phase 2 | MET |
| BMS-754807 | ChEMBL | Phase 2 | MET |
| BMS-777607 | ChEMBL | Phase 2 | MET |
| CENISERTIB | ChEMBL | Phase 2 | MET |
| CEP-32496 | ChEMBL | Phase 2 | MET |
| DALMELITINIB | ChEMBL | Phase 2 | MET |
| DECERNOTINIB | ChEMBL | Phase 2 | MET |
| DEFOSBARASERTIB | ChEMBL | Phase 2 | MET |
| ELLAGIC ACID | ChEMBL | Phase 2 | MET |
| ELZOVANTINIB | ChEMBL | Phase 2 | MET |
| ENVONALKIB | ChEMBL | Phase 2 | MET |
| FORETINIB | ChEMBL | Phase 2 | MET |
| GLESATINIB | ChEMBL | Phase 2 | MET |
| GOLVATINIB | ChEMBL | Phase 2 | MET |
Related Atlas pages
- Genes: MET
- Drugs: Afatinib, Crizotinib, Pazopanib, Axitinib, Bosutinib, Brigatinib, Cabozantinib, Capmatinib, Ceritinib, Dabrafenib, Ensartinib, Entrectinib, Erlotinib, Fedratinib, Gefitinib, Infigratinib, Midostaurin, Neratinib, Nintedanib, Palbociclib, Sorafenib, Sunitinib, Tepotinib, Tivozanib, Vandetanib, Canertinib, Cediranib, Dactolisib, Enzastaurin, Epigalocatechin Gallate, Lestaurtinib, Linifanib, Linsitinib, Poziotinib, Quercetin, Rigosertib, Savolitinib, Sitravatinib, Tivantinib