Thalidomide
drugOn this page
Also known as .alpha.-phthalimidoglutarimideCelgeneConterganDistavalK-17KevadonMyrinN-phthalylglutamic acid imideNeurosedynNSC-527179NSC-66847PantosedivPharmionSoftenonTalidexTalidomidaThaledThalidomide lipomedThalomid
Summary
Thalidomide (CHEMBL468) is an approved small molecule (ATC L04AX02) targeting CRBN; indicated across 94 conditions including immune system disorder and plasma cell myeloma.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: L04AX02
- Targets: 1 (CRBN)
- Indications: 94 conditions
- Clinical trials: 344
- Chemistry: 258.23 Da · C13H10N2O4
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL468 |
| Name | Thalidomide |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 5426 |
| ChEBI | CHEBI:74947 |
| ATC | L04AX02 |
| Molecular formula | C13H10N2O4 |
| Molecular weight | 258.23 |
| InChIKey | UEJJHQNACJXSKW-UHFFFAOYSA-N |
SMILES: C1CC(=O)NC(=O)C1N2C(=O)C3=CC=CC=C3C2=O
IUPAC name: 2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione
ChEBI definition: A dicarboximide that is isoindole-1,3(2H)-dione in which the hydrogen attached to the nitrogen is substituted by a 2,6-dioxopiperidin-3-yl group.
Also known as: .alpha.-phthalimidoglutarimide, Celgene, Contergan, Distaval, K-17, Kevadon, Myrin, N-phthalylglutamic acid imide, Neurosedyn, NSC-527179, NSC-66847, Pantosediv
Patent coverage: 25,098 distinct patent families (97,393 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 95,046 (98%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CRBN | cereblon | Binding | 8.07 | 0.2% | Q96SW2 |
Broader ChEMBL bioactivity targets: 8 (assay-derived). Sample: Muscarinic acetylcholine receptor M2, Mu-type opioid receptor, Prostaglandin G/H synthase 1, Aldehyde dehydrogenase 1A1, Protein cereblon, Prostaglandin G/H synthase 2, Protein cereblon/DNA damage-binding protein 1, Zinc finger protein Aiolos.
Bioactivity
ChEMBL activities: 27 potent at pChembl ≥ 5 of 32 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| DDB1 | 7.44 | EC50 | 36 | nM | CHEMBL_ACT_24860456 |
| OPRM1 | 6.69 | AC50 | 202.2 | nM | CHEMBL_ACT_25158213 |
| CRBN | 6.6 | Kd | 250 | nM | CHEMBL_ACT_25848527 |
| CRBN | 6.6 | Kd | 250 | nM | CHEMBL_ACT_26133921 |
| DDB1 | 6.57 | IC50 | 268 | nM | CHEMBL_ACT_28440005 |
| DDB1 | 6.52 | IC50 | 301 | nM | CHEMBL_ACT_28439915 |
| IKZF3 | 6.48 | EC50 | 330 | nM | CHEMBL_ACT_25673168 |
| P05979 | 6.43 | IC50 | 370 | nM | CHEMBL_ACT_435711 |
| IKZF3 | 6.3 | EC50 | 500 | nM | CHEMBL_ACT_29220691 |
| P79208 | 6.3 | IC50 | 500 | nM | CHEMBL_ACT_435712 |
| CRBN | 6.29 | Kd | 510 | nM | CHEMBL_ACT_29075682 |
| DDB1 | 6.25 | IC50 | 560 | nM | CHEMBL_ACT_25673120 |
| CRBN | 6.14 | IC50 | 720 | nM | CHEMBL_ACT_29075708 |
| DDB1 | 6.11 | IC50 | 770 | nM | CHEMBL_ACT_29220594 |
| CRBN | 5.89 | IC50 | 1300 | nM | CHEMBL_ACT_29075648 |
| DDB1 | 5.86 | IC50 | 1380 | nM | CHEMBL_ACT_24375641 |
| CRBN | 5.83 | IC50 | 1490 | nM | CHEMBL_ACT_25083005 |
| CRBN | 5.75 | Ki | 1800 | nM | CHEMBL_ACT_25639174 |
| CRBN | 5.75 | Ki | 1800 | nM | CHEMBL_ACT_26016804 |
| CRBN | 5.57 | IC50 | 2700 | nM | CHEMBL_ACT_25885804 |
| CRBN | 5.54 | IC50 | 2900 | nM | CHEMBL_ACT_25472085 |
| CRBN | 5.49 | IC50 | 3260 | nM | CHEMBL_ACT_29103055 |
| CRBN | 5.36 | Ki | 4400 | nM | CHEMBL_ACT_25528464 |
| CRBN | 5.07 | Ki | 8510 | nM | CHEMBL_ACT_22446499 |
| CRBN | 5.07 | Ki | 8500 | nM | CHEMBL_ACT_25589462 |
| CRBN | 5.07 | Ki | 8500 | nM | CHEMBL_ACT_25908410 |
| CRBN | 5.07 | Ki | 8550 | nM | CHEMBL_ACT_26009932 |
Target pathways
Aggregated over 1 target gene(s): CRBN.
Top Reactome pathways
1 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Potential therapeutics for SARS | 1 | CRBN |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| protein ubiquitination | 1 |
| positive regulation of Wnt signaling pathway | 1 |
| negative regulation of protein-containing complex assembly | 1 |
| positive regulation of protein-containing complex assembly | 1 |
| negative regulation of monoatomic ion transmembrane transport | 1 |
| locomotory exploration behavior | 1 |
| proteasome-mediated ubiquitin-dependent protein catabolic process | 1 |
| limb development | 1 |
Indications & clinical
Indications
94 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| immune system disorder | 4 | MONDO:0005046 | EFO:0000540 |
| plasma cell myeloma | 4 | MONDO:0009693 | EFO:0001378 |
| Crohn disease | 3 | MONDO:0005011 | EFO:0000384 |
| colorectal adenocarcinoma | 3 | MONDO:0005008 | EFO:0000365 |
| neoplasm | 3 | MONDO:0005070 | EFO:0000616 |
| hepatocellular carcinoma | 3 | MONDO:0007256 | EFO:0000182 |
| myelodysplastic syndrome | 3 | MONDO:0018881 | EFO:0000198 |
| diffuse large B-cell lymphoma | 3 | MONDO:0018905 | EFO:0000403 |
| ulcerative colitis | 3 | MONDO:0005101 | EFO:0000729 |
| idiopathic pulmonary fibrosis | 3 | MONDO:0800504 | EFO:0000768 |
| kidney neoplasm | 3 | MONDO:0021163 | EFO:0003865 |
| colorectal neoplasm | 3 | MONDO:0005335 | EFO:0004142 |
| vascular malformation | 3 | MONDO:0024291 | EFO:0006888 |
| colorectal carcinoma | 3 | MONDO:0024331 | EFO:1001951 |
| peritoneal neoplasm | 3 | MONDO:0006901 | MONDO:0002087 |
| fallopian tube neoplasm | 3 | MONDO:0021092 | MONDO:0002158 |
| kidney cancer | 3 | MONDO:0002367 | MONDO:0002367 |
| lung neoplasm | 3 | MONDO:0021117 | MONDO:0008903 |
| nasal cavity and paranasal sinus lethal midline granuloma | 3 | MONDO:0006828 | MONDO:0019472 |
| sarcoidosis | 3 | MONDO:0019338 | MONDO:0019338 |
| hereditary amyloidosis | 3 | MONDO:0018634 | MONDO:0019438 |
| beta thalassemia | 3 | MONDO:0019402 | Orphanet:848 |
| plasma cell neoplasm | 3 | MONDO:0004959 | EFO:0000200 |
| stomatitis | 3 | MONDO:0004842 | EFO:1001904 |
| sarcoma | 2 | MONDO:0005089 | EFO:0000691 |
| primary myelofibrosis | 2 | MONDO:0009692 | EFO:0002430 |
| HIV infectious disease | 2 | MONDO:0005109 | EFO:0000764 |
| ankylosing spondylitis | 2 | MONDO:0005306 | EFO:0003898 |
| B-cell chronic lymphocytic leukemia | 2 | MONDO:0004948 | EFO:0000095 |
| hepatitis C virus infection | 2 | MONDO:0005231 | EFO:0003047 |
| sclerosing cholangitis | 2 | MONDO:0018646 | EFO:0004268 |
| non-small cell lung carcinoma | 2 | MONDO:0005233 | EFO:0003060 |
| neoplasm of mature B-cells | 2 | MONDO:0004949 | EFO:0000096 |
| Hodgkins lymphoma | 2 | MONDO:0004952 | EFO:0000183 |
| MALT lymphoma | 2 | MONDO:0007650 | EFO:0000191 |
| chronic pancreatitis | 2 | MONDO:0005003 | EFO:0000342 |
| cutaneous melanoma | 2 | MONDO:0005012 | EFO:0000389 |
| glioblastoma | 2 | MONDO:0018177 | EFO:0000519 |
| leukemia | 2 | MONDO:0005059 | EFO:0000565 |
| lymphoma | 2 | MONDO:0005062 | EFO:0000574 |
| prostate adenocarcinoma | 2 | MONDO:0005082 | EFO:0000673 |
| psoriasis | 2 | MONDO:0005083 | EFO:0000676 |
| renal cell carcinoma | 2 | MONDO:0005086 | EFO:0000681 |
| melanoma | 2 | MONDO:0005105 | EFO:0000756 |
| AIDS | 2 | MONDO:0012268 | EFO:0000765 |
| medulloblastoma | 2 | MONDO:0007959 | EFO:0002939 |
| non-Hodgkin lymphoma | 2 | MONDO:0018908 | EFO:0005952 |
| head and neck cancer | 2 | MONDO:0005627 | EFO:0006859 |
| autoimmune thrombocytopenic purpura | 2 | MONDO:0008558 | EFO:0007160 |
| HIV wasting syndrome | 2 | MONDO:0005797 | EFO:0007312 |
| pancreatic neuroendocrine tumor | 2 | MONDO:0019954 | EFO:1000045 |
| brainstem neoplasm | 2 | MONDO:0021228 | EFO:1001767 |
| neuroendocrine neoplasm | 2 | MONDO:0019496 | EFO:1001901 |
| thalassemia | 2 | MONDO:0000984 | EFO:1001996 |
| Waldenstrom macroglobulinemia | 2 | MONDO:0100280 | EFO:0009441 |
| neuroblastoma | 2 | MONDO:0005072 | EFO:0000621 |
| oral cavity cancer | 2 | MONDO:0005515 | EFO:0005570 |
| central nervous system neoplasm | 2 | MONDO:0006130 | EFO:1000158 |
| Langerhans cell histiocytosis | 2 | MONDO:0018310 | EFO:1000318 |
| uterine carcinosarcoma | 2 | MONDO:0006485 | EFO:1000613 |
| soft tissue sarcoma | 2 | MONDO:0018078 | EFO:1001968 |
| appendiceal neoplasm | 2 | MONDO:0001236 | MONDO:0003196 |
| breast neoplasm | 2 | MONDO:0021100 | MONDO:0007254 |
| ovarian cancer | 2 | MONDO:0008170 | MONDO:0008170 |
| Castleman disease | 2 | MONDO:0015564 | MONDO:0015564 |
| follicular lymphoma | 2 | MONDO:0018906 | MONDO:0018906 |
| colonic neoplasm | 2 | MONDO:0005401 | MONDO:0021063 |
| proctitis | 2 | MONDO:0005538 | EFO:0005628 |
| mantle cell lymphoma | 2 | MONDO:0018876 | EFO:1001469 |
| discoid lupus erythematosus | 2 | MONDO:0019558 | MONDO:0019558 |
| severe acute respiratory syndrome | 2 | MONDO:0005091 | MONDO:0100096 |
| Alzheimer disease | 2 | MONDO:0004975 | MONDO:0004975 |
| amyotrophic lateral sclerosis | 2 | MONDO:0004976 | MONDO:0004976 |
| lymphoid leukemia | 2 | MONDO:0005402 | EFO:0004289 |
| ocular melanoma | 2 | MONDO:0006325 | EFO:1000403 |
| paraganglioma | 2 | MONDO:0000448 | EFO:1000453 |
| syringomyelia | 2 | MONDO:0017987 | MONDO:0017987 |
| systemic sclerosis | 1 | MONDO:0005100 | EFO:0000717 |
| epilepsy | 1 | MONDO:0005027 | EFO:0000474 |
| endometriosis | 1 | MONDO:0005133 | EFO:0001065 |
| amyloidosis | 1 | MONDO:0019065 | EFO:1001875 |
13 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 344.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 204 |
| PHASE3 | 59 |
| PHASE4 | 18 |
| Not specified | 18 |
| PHASE1 | 17 |
| PHASE2/PHASE3 | 13 |
| PHASE1/PHASE2 | 13 |
| EARLY_PHASE1 | 2 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT06276933 | PHASE4 | NOT_YET_RECRUITING | A Study of Camrelizumab Combined With Chemotherapy ± Thalidomide in First-line Treatment of Patients With Advanced Non-small Cell Lung Cancer (NSCLC) |
| NCT00314665 | PHASE4 | TERMINATED | Use of Thalidomide in Chronic Uveitis |
| NCT00390247 | PHASE4 | WITHDRAWN | Thalidomide for the Treatment of Malnutrition Inflammation Syndrome in Peritoneal Dialysis Patients |
| NCT00652041 | PHASE4 | COMPLETED | Bortezomib/Adriamycine/Melfalan/Prednisone (VAMP)/Thalidomide/Cyclophosphamide/Dexamethasone (TaCyDex) or Bortezomib/Melfalan/Prednisone (V-MP)/TaCyDex) in Refractary or Relapsed Multiple Myeloma |
| NCT01249690 | PHASE4 | UNKNOWN | Efficacy Study of PAD and TAD in Newly Diagnosed Multiple Myeloma |
| NCT01638078 | PHASE4 | UNKNOWN | Thalidomide fOr the Prevention of Restenosis After Coronary ArtERy Stent Implantation |
| NCT01640639 | PHASE4 | UNKNOWN | THalidomide on Left ventricUlar Morphology aND Function in congEstive heaRt Failure |
| NCT02401971 | PHASE4 | UNKNOWN | Irinotecan Plus Thalidomide in Second Line Advanced Gastric Cancer |
| NCT02559154 | PHASE4 | UNKNOWN | Modified Bortezomib-based Combination Therapy for Multiple Myeloma |
| NCT02778893 | PHASE4 | UNKNOWN | Conmana Combined With Thalidomide to Treat NSCLC |
| NCT02844309 | PHASE4 | COMPLETED | The Efficacy of TCD Following by TP Maintenance Therapy in Newly Diagnosed WM |
| NCT02858804 | PHASE4 | COMPLETED | EDOCH Alternating With DHAP for New Diagnosed Younger MCL |
| NCT03122431 | PHASE4 | COMPLETED | Relevance of Monitoring Blood and Salivar Levels of Drugs Used in Rheumatic Autoimmune Diseases |
| NCT03777930 | PHASE4 | UNKNOWN | The Evaluation of Curative Effect on Treatment of Tumor Above Thalidomide Combined With Megestrol |
| NCT04612582 | PHASE4 | UNKNOWN | Comparison of BTD and BCD Based Regimens in the Treatment of AL Amyloidosis |
| NCT05525234 | PHASE4 | UNKNOWN | A Study of Thalidomide in the Treatment of Refractory Uremic Pruritus |
| NCT05527444 | PHASE4 | UNKNOWN | The Clinical Efficacy and the Changes of Immune Cells Subsets With Bioagents in Ankylosing Spondylitis Patients |
| NCT06299670 | PHASE4 | UNKNOWN | Efficacy of Combination of Hdroxyurea and Thalidomide Over Either Hydroxyurea or Thalidomide Alone in the Treatment of Transfusion Dependent Thalassemia in Children: A Quasi-Randomised Clinical Trial |
| NCT00098475 | PHASE3 | ACTIVE_NOT_RECRUITING | Lenalidomide and Dexamethasone With or Without Thalidomide in Treating Patients With Multiple Myeloma |
| NCT00572169 | PHASE3 | ACTIVE_NOT_RECRUITING | UARK 2006-66, Total Therapy 3B: An Extension of UARK 2003-33 Total Therapy |
| NCT00602641 | PHASE3 | ACTIVE_NOT_RECRUITING | Melphalan, Prednisone, and Thalidomide or Lenalidomide in Treating Patients With Newly Diagnosed Multiple Myeloma |
| NCT03562169 | PHASE3 | RECRUITING | The Role of Ixazomib in Autologous Stem Cell Transplant in Relapsed Myeloma - Myeloma XII (ACCoRd) |
| NCT06017284 | PHASE3 | RECRUITING | Thalidomide to Chemotherapy Related Nausea and Vomiting in Pancreatic Cancer |
| NCT07309419 | PHASE2/PHASE3 | NOT_YET_RECRUITING | A Phase III Randomized Study of TACE Plus an Oral Triple-Agent Cocktail Versus TACE Plus First-Line Targeted Immunotherapy in Unresectable Hepatocellular Carcinoma |
| NCT00004635 | PHASE3 | COMPLETED | Thalidomide for the Treatment of Hormone-Dependent Prostate Cancer |
| NCT00004859 | PHASE3 | TERMINATED | Carboplatin, Paclitaxel, and Radiation Therapy With or Without Thalidomide in Patients With Stage III Non-small Cell Lung Cancer |
| NCT00005834 | PHASE3 | TERMINATED | S9922 Combination Chemo Plus Filgrastim With or Without Thalidomide in Refractory Multiple Myeloma |
| NCT00005966 | PHASE3 | COMPLETED | Interferon Alfa-2b With or Without Thalidomide in Treating Patients With Metastatic or Unresectable Kidney Cancer |
| NCT00028886 | PHASE3 | UNKNOWN | Combination Chemotherapy With or Without Thalidomide in Treating Patients With Multiple Myeloma |
| NCT00033254 | PHASE3 | COMPLETED | Radiation Therapy With or Without Thalidomide in Treating Patients With Brain Metastases |
| NCT00033332 | PHASE3 | COMPLETED | Dexamethasone With or Without Thalidomide in Treating Patients With Newly Diagnosed Multiple Myeloma |
| NCT00038090 | PHASE2/PHASE3 | COMPLETED | Thalidomide-Dexamethasone for Multiple Myeloma |
| NCT00038233 | PHASE3 | COMPLETED | Thalidomide for Multiple Myeloma |
| NCT00041080 | PHASE3 | COMPLETED | Tamoxifen Compared With Thalidomide in Treating Women With Ovarian Epithelial Cancer, Fallopian Tube Cancer, or Primary Peritoneal Cancer |
| NCT00049673 | PHASE3 | COMPLETED | Thalidomide and Prednisone After Autologous Stem Cell Transplantation Multiple Myeloma |
| NCT00050843 | PHASE3 | COMPLETED | A Study to Access the Safety/Efficacy of Thalidomide in the Treatment of Anemia in Patients With Myelodysplastic Syndromes |
| NCT00075829 | PHASE3 | COMPLETED | Stem Cell Transplantation in Individuals With Multiple Myeloma (BMT CTN 0102) |
| NCT00083551 | PHASE3 | COMPLETED | UARK 98-026 TT II: Multiple Myeloma Evaluating Anti-Angiogenesis With Thalidomide and Post-Transplant Consolidation Chemotherapy |
| NCT00083876 | PHASE3 | COMPLETED | D.T. PACE Versus High Dose Melphalan and Autologous Transplant in Patients With Previously Treated Multiple Myeloma |
| NCT00083915 | PHASE3 | COMPLETED | DTPACE Followed by Tandem Transplant With Melphalan (MEL) 200 Versus MEL/Dexamethasone/Thalidomide (DT) Platinol/Adriamycin/Etoposide (PACE) Hybrid and DTPACE Consolidation |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 26 clinical and 32 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
18 molecules share ≥1 primary target. Top 18 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | CRBN |
| POMALIDOMIDE | ChEMBL + PubChem | Phase 4 (approved) | CRBN |
| ASCIMINIB | ChEMBL | Phase 4 (approved) | CRBN |
| BRIGATINIB | ChEMBL | Phase 4 (approved) | CRBN |
| DASABUVIR | ChEMBL | Phase 4 (approved) | CRBN |
| LENALIDOMIDE | ChEMBL | Phase 4 (approved) | CRBN |
| PONATINIB | ChEMBL | Phase 4 (approved) | CRBN |
| IBERDOMIDE | ChEMBL | Phase 3 | CRBN |
| MEZIGDOMIDE | ChEMBL | Phase 3 | CRBN |
| URACIL | ChEMBL | Phase 3 | CRBN |
| VEPDEGESTRANT | ChEMBL | Phase 3 | CRBN |
| ADAVOSERTIB | ChEMBL | Phase 2 | CRBN |
| AVADOMIDE | ChEMBL | Phase 2 | CRBN |
| E-7820 | ChEMBL | Phase 2 | CRBN |
| FORETINIB | ChEMBL | Phase 2 | CRBN |
| INDISULAM | ChEMBL | Phase 2 | CRBN |
| Fulvestrant | PubChem | Approved | CRBN |
| Sotorasib | PubChem | Approved | CRBN |
Related Atlas pages
- Genes: CRBN
- Diseases: immune system disorder, plasma cell myeloma, Crohn disease, colorectal adenocarcinoma, neoplasm, hepatocellular carcinoma, myelodysplastic syndrome, diffuse large B-cell lymphoma, ulcerative colitis, idiopathic pulmonary fibrosis, kidney neoplasm, colorectal neoplasm, vascular malformation, colorectal carcinoma, peritoneal neoplasm, fallopian tube neoplasm, kidney cancer, lung neoplasm, nasal cavity and paranasal sinus lethal midline granuloma, sarcoidosis, hereditary amyloidosis, beta thalassemia, plasma cell neoplasm, stomatitis
- Drugs: Crizotinib, Pomalidomide, Asciminib, Brigatinib, Dasabuvir, Lenalidomide, Ponatinib, Iberdomide, Mezigdomide, Uracil, Vepdegestrant, Fulvestrant, Sotorasib