Ticlopidine
drugOn this page
Also known as Ticlopidin-purenTiclopidinaSID11112786SID26751617SID50085878SID104171328SID144204209TiclidSID170464698SID124882626TICLOPIDINE HYDROCHLORIDE
Summary
Ticlopidine (CHEMBL833) is an approved small-molecule fibrin modulating drug (ATC B01AC05) targeting CYP2B6; indicated across 3 conditions including thrombotic disease and internal carotid artery stenosis.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: B01AC05
- Targets: 1 (CYP2B6)
- Indications: 3 conditions
- Clinical trials: 6
- Chemistry: 263.8 Da · C14H14ClNS
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL833 |
| Name | Ticlopidine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 5472 |
| ChEBI | CHEBI:9588 |
| ATC | B01AC05 |
| Molecular formula | C14H14ClNS |
| Molecular weight | 263.8 |
| InChIKey | PHWBOXQYWZNQIN-UHFFFAOYSA-N |
SMILES: C1CN(CC2=C1SC=C2)CC3=CC=CC=C3Cl
IUPAC name: 5-[(2-chlorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine
ChEBI definition: A thienopyridine that is 4,5,6,7-tetrahydrothieno[3,2-c]pyridine in which the hydrogen attached to the nitrogen is replaced by an o-chlorobenzyl group.
Pharmacological roles (ChEBI): fibrin modulating drug, hematologic agent, anticoagulant, platelet aggregation inhibitor, P2Y12 receptor antagonist.
Also known as: Ticlopidin-puren, Ticlopidina, Ticlopidine, SID11112786, SID26751617, SID50085878, SID104171328, ticlopidine, SID144204209, Ticlid, TICLOPIDINE, SID170464698
Parent form; salt/anhydrous children: CHEMBL1717
Patent coverage: 7,945 distinct patent families (30,572 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 30,462 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CYP2B6 | CYP2B6 | Inhibition | 6.7 | 0.1% | P20813 |
Broader ChEMBL bioactivity targets: 29 (assay-derived). Sample: Ubiquitin carboxyl-terminal hydrolase 2, Prelamin-A/C, Ferritin light chain, 5-hydroxytryptamine receptor 2B, Alpha-2A adrenergic receptor, Alpha-2C adrenergic receptor, Histamine H2 receptor, Alpha-2B adrenergic receptor, D(1A) dopamine receptor, Thromboxane A2 receptor.
Bioactivity
ChEMBL activities: 35 potent at pChembl ≥ 5 of 56 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| CYP2C19 | 7.4 | Potency | 39.8 | nM | CHEMBL_ACT_4019499 |
| CYP2C19 | 7.4 | AC50 | 39.81 | nM | CHEMBL_ACT_6052076 |
| ADRA2B | 6.86 | Ki | 139 | nM | CHEMBL_ACT_7810769 |
| ADRA2A | 6.84 | Ki | 143 | nM | CHEMBL_ACT_7810767 |
| ADRA2C | 6.77 | Ki | 171 | nM | CHEMBL_ACT_7810771 |
| SIGMAR1 | 6.75 | Ki | 179 | nM | CHEMBL_ACT_7815020 |
| CYP2B6 | 6.7 | Ki | 200 | nM | CHEMBL_ACT_6075021 |
| CYP2B6 | 6.68 | IC50 | 210 | nM | CHEMBL_ACT_24925630 |
| ADRA2B | 6.52 | IC50 | 304 | nM | CHEMBL_ACT_7810768 |
| ADRA2A | 6.42 | IC50 | 382 | nM | CHEMBL_ACT_7810766 |
| CYP2D6 | 6.4 | Potency | 398.1 | nM | CHEMBL_ACT_4994276 |
| CYP2D6 | 6.4 | AC50 | 398.1 | nM | CHEMBL_ACT_5988630 |
| SIGMAR1 | 6.37 | IC50 | 426 | nM | CHEMBL_ACT_7815019 |
| CYP1A2 | 6.3 | AC50 | 501.2 | nM | CHEMBL_ACT_6051021 |
| CYP2B6 | 6.22 | IC50 | 600 | nM | CHEMBL_ACT_16637021 |
| CYP2C19 | 6.17 | IC50 | 667.8 | nM | CHEMBL_ACT_7812839 |
| CYP2B6 | 6.1 | Ki | 800 | nM | CHEMBL_ACT_6075023 |
| ADRA2B | 5.97 | AC50 | 1077 | nM | CHEMBL_ACT_25143582 |
| ADRA2C | 5.96 | AC50 | 1091 | nM | CHEMBL_ACT_25147753 |
| ADRA2C | 5.93 | IC50 | 1175 | nM | CHEMBL_ACT_7810770 |
| ADRA2A | 5.92 | AC50 | 1200 | nM | CHEMBL_ACT_25219779 |
| CYP2C19 | 5.89 | IC50 | 1300 | nM | CHEMBL_ACT_16621051 |
| ADRA2A | 5.81 | AC50 | 1562 | nM | CHEMBL_ACT_25155903 |
| CYP2C19 | 5.48 | Ki | 3300 | nM | CHEMBL_ACT_12163631 |
| ALDH1A1 | 5.4 | Potency | 3981 | nM | CHEMBL_ACT_4170663 |
| DRD1 | 5.34 | AC50 | 4600 | nM | CHEMBL_ACT_25180400 |
| CYP2D6 | 5.32 | IC50 | 4800 | nM | CHEMBL_ACT_15450958 |
| OPRK1 | 5.23 | AC50 | 5873 | nM | CHEMBL_ACT_25129318 |
| DRD4 | 5.2 | AC50 | 6267 | nM | CHEMBL_ACT_25127352 |
| CYP2D6 | 5.2 | IC50 | 6293 | nM | CHEMBL_ACT_7812843 |
Target pathways
Aggregated over 1 target gene(s): CYP2B6.
Top Reactome pathways
4 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Fatty acids | 1 | CYP2B6 |
| Phase I - Functionalization of compounds | 1 | CYP2B6 |
| Xenobiotics | 1 | CYP2B6 |
| CYP2E1 reactions | 1 | CYP2B6 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| xenobiotic metabolic process | 1 |
| steroid metabolic process | 1 |
| epoxygenase P450 pathway | 1 |
| xenobiotic catabolic process | 1 |
| ketone metabolic process | 1 |
| lipid metabolic process | 1 |
| small molecule metabolic process | 1 |
Indications & clinical
Indications
3 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| thrombotic disease | 4 | MONDO:0000831 | HP:0004419 |
| internal carotid artery stenosis | 3 | MONDO:0005189 | EFO:0002615 |
| peripheral arterial disease | 3 | MONDO:0005386 | EFO:0004265 |
Clinical trials
Total trials: 6.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 3 |
| PHASE4 | 2 |
| PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00004727 | PHASE4 | COMPLETED | Antiplatelet Therapy to Prevent Stroke in African Americans |
| NCT01214941 | PHASE4 | COMPLETED | Effect of Itraconazole and Ticlopidine on the Pharmacokinetics and Pharmacodynamics of Oral Tramadol |
| NCT00821834 | PHASE3 | COMPLETED | Safety Evaluation of Clopidogrel Sulfate in Patients With Stable Angina/Old Myocardial Infarction to Whom Percutaneous Coronary Intervention is Being Planned |
| NCT00862420 | PHASE3 | COMPLETED | Safety Evaluation of Clopidogrel Sulfate in Patients With Peripheral Arterial Disease |
| NCT02133989 | PHASE3 | UNKNOWN | Clopidogrel Resistance and Embolism in Carotid Artery Stenting |
| NCT03298906 | PHASE1 | COMPLETED | A Study to Assess the Effect of Ticlopidine on the Pharmacokinetics, Safety, and Tolerability of Intranasally Administered Esketamine in Healthy Participants |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 2 clinical and 22 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
44 molecules share ≥1 primary target. Top 44 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| MAVACAMTEN | ChEMBL + PubChem | Phase 4 (approved) | CYP2B6 |
| RIFAMPIN | ChEMBL + PubChem | Phase 4 (approved) | CYP2B6 |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | CYP2B6 |
| CLOPIDOGREL | ChEMBL | Phase 4 (approved) | CYP2B6 |
| ESTRADIOL | ChEMBL | Phase 4 (approved) | CYP2B6 |
| ETHINYL ESTRADIOL | ChEMBL | Phase 4 (approved) | CYP2B6 |
| IBRUTINIB | ChEMBL | Phase 4 (approved) | CYP2B6 |
| METHADONE | ChEMBL | Phase 4 (approved) | CYP2B6 |
| PAZOPANIB | ChEMBL | Phase 4 (approved) | CYP2B6 |
| RITONAVIR | ChEMBL | Phase 4 (approved) | CYP2B6 |
| SERTRALINE | ChEMBL | Phase 4 (approved) | CYP2B6 |
| TAMOXIFEN | ChEMBL | Phase 4 (approved) | CYP2B6 |
| THIOTEPA | ChEMBL | Phase 4 (approved) | CYP2B6 |
| TRANYLCYPROMINE | ChEMBL | Phase 4 (approved) | CYP2B6 |
| VORICONAZOLE | ChEMBL | Phase 4 (approved) | CYP2B6 |
| ARTEMISININ | ChEMBL | Phase 3 | CYP2B6 |
| CANNABINOL | ChEMBL | Phase 3 | CYP2B6 |
| CURCUMIN | ChEMBL | Phase 3 | CYP2B6 |
| TEMSAVIR | ChEMBL + PubChem | Phase 2 (approved) | CYP2B6 |
| APINOCALTAMIDE | ChEMBL | Phase 2 | CYP2B6 |
| CANNABIDIVARIN | ChEMBL | Phase 2 | CYP2B6 |
| DARIGABAT | ChEMBL | Phase 2 | CYP2B6 |
| FISOGATINIB | ChEMBL | Phase 2 | CYP2B6 |
| INE-963 | ChEMBL | Phase 2 | CYP2B6 |
| MK-0893 | ChEMBL | Phase 2 | CYP2B6 |
| PHENCYCLIDINE | ChEMBL | Phase 2 | CYP2B6 |
| UDIFITIMOD | ChEMBL | Phase 2 | CYP2B6 |
| Abiraterone | PubChem | Approved | CYP2B6 |
| Aprepitant | PubChem | Approved | CYP2B6 |
| Belzutifan | PubChem | Approved | CYP2B6 |
| Cenobamate | PubChem | Approved | CYP2B6 |
| Clozapine | PubChem | Approved | CYP2B6 |
| Erythromycin | PubChem | Approved | CYP2B6 |
| Imatinib | PubChem | Approved | CYP2B6 |
| Methimazole | PubChem | Approved | CYP2B6 |
| Olanzapine | PubChem | Approved | CYP2B6 |
| Olmesartan | PubChem | Approved | CYP2B6 |
| Oritavancin | PubChem | Approved | CYP2B6 |
| Pimozide | PubChem | Approved | CYP2B6 |
| Safinamide | PubChem | Approved | CYP2B6 |
| saxagliptin | PubChem | Approved | CYP2B6 |
| Tecovirimat | PubChem | Approved | CYP2B6 |
| Vorapaxar | PubChem | Approved | CYP2B6 |
| Zanubrutinib | PubChem | Approved | CYP2B6 |
Related Atlas pages
- Genes: CYP2B6
- Diseases: thrombotic disease, internal carotid artery stenosis, peripheral arterial disease
- Drugs: Mavacamten, Rifampin, Cannabidiol, Clopidogrel, Estradiol, Ethinyl Estradiol, Ibrutinib, Methadone, Pazopanib, Ritonavir, Sertraline, Tamoxifen, Thiotepa, Tranylcypromine, Voriconazole, Artemisinin, Cannabinol, Curcumin, Abiraterone, Aprepitant, Belzutifan, Cenobamate, Clozapine, Erythromycin, Imatinib, Methimazole, Olanzapine, Olmesartan, Oritavancin, Pimozide, Safinamide, saxagliptin, Tecovirimat, Vorapaxar, Zanubrutinib