Tiludronic Acid
drugOn this page
Also known as Acide tiludroniqueAcido tiludronicoSkelidSR 41319SR-41319TiludronateACIDE_TILUDRONIQUETiludronate disodium
Summary
Tiludronic Acid (CHEMBL1350) is an approved small molecule (ATC M05BA05) targeting MMP2; indicated across 2 conditions including bone disorder and otosclerosis.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: M05BA05
- Targets: 1 (MMP2)
- Indications: 2 conditions
- Clinical trials: 1
- Chemistry: 318.61 Da · C7H9ClO6P2S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1350 |
| Name | Tiludronic Acid |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 60937 |
| ATC | M05BA05 |
| Molecular formula | C7H9ClO6P2S |
| Molecular weight | 318.61 |
| InChIKey | DKJJVAGXPKPDRL-UHFFFAOYSA-N |
SMILES: C1=CC(=CC=C1SC(P(=O)(O)O)P(=O)(O)O)Cl
IUPAC name: [(4-chlorophenyl)sulfanyl-phosphonomethyl]phosphonic acid
Also known as: Acide tiludronique, Acido tiludronico, Skelid, SR 41319, SR-41319, Tiludronate, Tiludronic acid, tiludronate, ACIDE_TILUDRONIQUE, TILUDRONIC ACID, Tiludronate disodium
Parent form; salt/anhydrous children: CHEMBL1200448
Patent coverage: 3,605 distinct patent families (14,784 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| MMP2 | MMP2 | Inhibition | 5.14 | 0.1% | P08253 |
Broader ChEMBL bioactivity targets: 3 (assay-derived). Sample: 72 kDa type IV collagenase, Matrix metalloproteinase-14, Neutrophil collagenase.
Bioactivity
ChEMBL activities: 1 potent at pChembl ≥ 5 of 3 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| MMP2 | 5.14 | IC50 | 7200 | nM | CHEMBL_ACT_13500876 |
Target pathways
Aggregated over 1 target gene(s): MMP2.
Top Reactome pathways
20 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Developmental Biology | 1 | MMP2 |
| Cytokine Signaling in Immune system | 1 | MMP2 |
| Collagen degradation | 1 | MMP2 |
| Degradation of the extracellular matrix | 1 | MMP2 |
| Extracellular matrix organization | 1 | MMP2 |
| Activation of Matrix Metalloproteinases | 1 | MMP2 |
| Signal Transduction | 1 | MMP2 |
| Immune System | 1 | MMP2 |
| EPH-Ephrin signaling | 1 | MMP2 |
| Regulation of Insulin-like Growth Factor (IGF) transport and uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs) | 1 | MMP2 |
| Metabolism of proteins | 1 | MMP2 |
| EPH-ephrin mediated repulsion of cells | 1 | MMP2 |
| Axon guidance | 1 | MMP2 |
| Signaling by Interleukins | 1 | MMP2 |
| MAPK6/MAPK4 signaling | 1 | MMP2 |
| Interleukin-4 and Interleukin-13 signaling | 1 | MMP2 |
| ESR-mediated signaling | 1 | MMP2 |
| Signaling by Nuclear Receptors | 1 | MMP2 |
| Extra-nuclear estrogen signaling | 1 | MMP2 |
| Nervous system development | 1 | MMP2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| angiogenesis | 1 |
| ovarian follicle development | 1 |
| ovulation from ovarian follicle | 1 |
| luteinization | 1 |
| response to hypoxia | 1 |
| blood vessel maturation | 1 |
| intramembranous ossification | 1 |
| proteolysis | 1 |
| negative regulation of cell adhesion | 1 |
| heart development | 1 |
| parturition | 1 |
| response to xenobiotic stimulus | 1 |
| response to mechanical stimulus | 1 |
| peripheral nervous system axon regeneration | 1 |
| response to activity | 1 |
Indications & clinical
Indications
2 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| bone disorder | 4 | MONDO:0005381 | EFO:0004260 |
| otosclerosis | 3 | MONDO:0005349 | EFO:0004213 |
Clinical trials
Total trials: 1.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT01617057 | PHASE3 | TERMINATED | Therapeutic Efficacy of Tiludronic Acid on Inner Ear Involvement in Advanced Otosclerosis |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 1 clinical and 0 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
23 molecules share ≥1 primary target. Top 23 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | MMP2 |
| DAUNORUBICIN | ChEMBL | Phase 4 (approved) | MMP2 |
| DOXORUBICIN | ChEMBL | Phase 4 (approved) | MMP2 |
| DOXYCYCLINE | ChEMBL | Phase 4 (approved) | MMP2 |
| ZOLEDRONIC ACID | ChEMBL | Phase 4 (approved) | MMP2 |
| ACLARUBICIN | ChEMBL | Phase 3 | MMP2 |
| CAFFEIC ACID | ChEMBL | Phase 3 | MMP2 |
| EPIGALOCATECHIN GALLATE | ChEMBL | Phase 3 | MMP2 |
| MARIMASTAT | ChEMBL | Phase 3 | MMP2 |
| MEDRONIC ACID | ChEMBL | Phase 3 | MMP2 |
| PRINOMASTAT | ChEMBL | Phase 3 | MMP2 |
| QUERCETIN | ChEMBL | Phase 3 | MMP2 |
| ALDUMASTAT | ChEMBL | Phase 2 | MMP2 |
| BATIMASTAT | ChEMBL | Phase 2 | MMP2 |
| CIPEMASTAT | ChEMBL | Phase 2 | MMP2 |
| CTS-1027 | ChEMBL | Phase 2 | MMP2 |
| ILOMASTAT | ChEMBL | Phase 2 | MMP2 |
| LUTEOLIN | ChEMBL | Phase 2 | MMP2 |
| REBIMASTAT | ChEMBL | Phase 2 | MMP2 |
| SOLIMASTAT | ChEMBL | Phase 2 | MMP2 |
| TANOMASTAT | ChEMBL | Phase 2 | MMP2 |
| TOSEDOSTAT | ChEMBL | Phase 2 | MMP2 |
| UBENIMEX | ChEMBL | Phase 2 | MMP2 |
Related Atlas pages
- Genes: MMP2
- Diseases: bone disorder, otosclerosis
- Drugs: Chlorhexidine, Daunorubicin, Doxorubicin, Doxycycline, Zoledronic Acid, Aclarubicin, Caffeic Acid, Epigalocatechin Gallate, Marimastat, Medronic Acid, Prinomastat, Quercetin