Tiratricol
drugOn this page
Also known as 3,5,3'-triiodothyroacetateLevothyroxine sodium impuritytriiodothyroacetic acidNSC-759294TiracanaTriacSID11112109SID855525SID50100372SID144213850SID144203868
Summary
Tiratricol (CHEMBL41632) is a phase-3 clinical-stage small-molecule thyroid hormone (ATC H03AA04) targeting THRA and THRB.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- ATC class: H03AA04 (+1 more)
- Targets: 2 (THRA, THRB)
- Clinical trials: 5
- Chemistry: 621.93 Da · C14H9I3O4
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL41632 |
| Name | Tiratricol |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 5803 |
| ChEBI | CHEBI:40021 |
| ATC | H03AA04, D11AX08 |
| Molecular formula | C14H9I3O4 |
| Molecular weight | 621.93 |
| InChIKey | UOWZUVNAGUAEQC-UHFFFAOYSA-N |
SMILES: C1=CC(=C(C=C1OC2=C(C=C(C=C2I)CC(=O)O)I)I)O
IUPAC name: 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetic acid
ChEBI definition: A monocarboxylic acid that is (4-hydroxy-3,5-diiodophenyl)acetic acid in which the phenolic hydroxy group has been replaced by a 4-hydroxy-3-iodophenoxy group. It is a thyroid hormone analogue that has been used in the treatment of thyroid hormone resistance syndrome.
Pharmacological roles (ChEBI): thyroid hormone, antiviral agent, EC 1.3.5.2 [dihydroorotate dehydrogenase (quinone)] inhibitor, nutraceutical, anti-obesity agent.
Other ChEBI roles (chemical / environmental): human metabolite.
Also known as: 3,5,3’-triiodothyroacetate, Levothyroxine sodium impurity, triiodothyroacetic acid, NSC-759294, Tiracana, Tiratricol, Triac, Triiodothyroacetic acid, SID11112109, SID855525, SID50100372, SID144213850
Patent coverage: 21,341 distinct patent families (46,632 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 46,627 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| THRA | Thyroid hormone receptor-α | Agonist | 1.7% | P10827 | |
| THRB | Thyroid hormone receptor-β | Agonist | 10.7 | 0% | P10828 |
Broader ChEMBL bioactivity targets: 30 (assay-derived). Sample: Survival motor neuron protein, Prelamin-A/C, 15-hydroxyprostaglandin dehydrogenase [NAD(+)], 5-hydroxytryptamine receptor 2B, Thyroid hormone receptor alpha, Alpha-2A adrenergic receptor, Androgen receptor, Thyroid hormone receptor beta, Retinoic acid receptor RXR-alpha, Solute carrier organic anion transporter family member 1C1.
Bioactivity
ChEMBL activities: 30 potent at pChembl ≥ 5 of 44 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| THRB | 10.39 | IC50 | 0.04 | nM | CHEMBL_ACT_2056459 |
| THRB | 10.32 | IC50 | 0.05 | nM | CHEMBL_ACT_1038856 |
| THRB | 10.32 | IC50 | 0.05 | nM | CHEMBL_ACT_1972892 |
| THRA | 9.85 | IC50 | 0.14 | nM | CHEMBL_ACT_1038855 |
| THRA | 9.85 | IC50 | 0.14 | nM | CHEMBL_ACT_2056392 |
| P18113 | 9.82 | IC50 | 0.15 | nM | CHEMBL_ACT_329461 |
| THRA | 8.7 | EC50 | 2 | nM | CHEMBL_ACT_26335914 |
| THRB | 8.4 | EC50 | 4 | nM | CHEMBL_ACT_26335915 |
| PPARG | 6.7 | Kd | 200 | nM | CHEMBL_ACT_20712820 |
| PPARG | 6.43 | EC50 | 370 | nM | CHEMBL_ACT_20712810 |
| RXRA | 5.88 | Kd | 1320 | nM | CHEMBL_ACT_20712833 |
| Q9ERB5 | 5.67 | Ki | 2150 | nM | CHEMBL_ACT_11002742 |
| GABRA1 | 5.64 | AC50 | 2300 | nM | CHEMBL_ACT_25234015 |
| PDE4D | 5.53 | AC50 | 2973 | nM | CHEMBL_ACT_25185092 |
| ADRA1A | 5.38 | AC50 | 4200 | nM | CHEMBL_ACT_25217905 |
| PPARG | 5.3 | AC50 | 5000 | nM | CHEMBL_ACT_25113891 |
| CYP2C9 | 5.3 | Potency | 5012 | nM | CHEMBL_ACT_5041585 |
| CYP2C9 | 5.3 | AC50 | 5012 | nM | CHEMBL_ACT_6014985 |
| HTR2B | 5.24 | AC50 | 5771 | nM | CHEMBL_ACT_25227313 |
| HIF1A | 5.2 | Potency | 6310 | nM | CHEMBL_ACT_4129051 |
| HIF1A | 5.2 | Potency | 6310 | nM | CHEMBL_ACT_4132630 |
| HIF1A | 5.2 | Potency | 6310 | nM | CHEMBL_ACT_4519399 |
| HIF1A | 5.2 | Potency | 6310 | nM | CHEMBL_ACT_4520873 |
| SLC10A1 | 5.16 | IC50 | 6900 | nM | CHEMBL_ACT_19242119 |
| SLC10A1 | 5.16 | IC50 | 6900 | nM | CHEMBL_ACT_24868560 |
| HTR1A | 5.15 | AC50 | 7100 | nM | CHEMBL_ACT_25215849 |
| ADORA3 | 5.12 | AC50 | 7572 | nM | CHEMBL_ACT_25133980 |
| ADRA2A | 5.03 | AC50 | 9300 | nM | CHEMBL_ACT_25219678 |
| HTR2A | 5.02 | AC50 | 9487 | nM | CHEMBL_ACT_25224967 |
| HSD17B10 | 5 | Potency | 10000 | nM | CHEMBL_ACT_4841724 |
Target pathways
Aggregated over 2 target gene(s): THRA, THRB.
Top Reactome pathways
9 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Generic Transcription Pathway | 2 | THRA, THRB |
| Nuclear Receptor transcription pathway | 2 | THRA, THRB |
| SUMOylation of intracellular receptors | 2 | THRA, THRB |
| RNA Polymerase II Transcription | 2 | THRA, THRB |
| Gene expression (Transcription) | 2 | THRA, THRB |
| SUMOylation | 1 | THRB |
| SUMO E3 ligases SUMOylate target proteins | 1 | THRB |
| Metabolism of proteins | 1 | THRB |
| Post-translational protein modification | 1 | THRB |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| negative regulation of transcription by RNA polymerase II | 2 |
| thyroid hormone receptor signaling pathway | 2 |
| positive regulation of thyroid hormone receptor signaling pathway | 2 |
| regulation of transcription by RNA polymerase II | 2 |
| regulation of heart contraction | 2 |
| female courtship behavior | 2 |
| cell differentiation | 2 |
| mRNA transcription by RNA polymerase II | 2 |
| negative regulation of DNA-templated transcription | 2 |
| positive regulation of transcription by RNA polymerase II | 2 |
| retinoic acid receptor signaling pathway | 2 |
| type I pneumocyte differentiation | 2 |
| regulation of DNA-templated transcription | 2 |
| animal organ morphogenesis | 2 |
| intracellular receptor signaling pathway | 2 |
Indications & clinical
Indications
0 indications (0 at ChEMBL trial phase 4).
Clinical trials
Total trials: 5.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 2 |
| PHASE3 | 1 |
| PHASE1 | 1 |
| Not specified | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT05579327 | PHASE3 | COMPLETED | Withdrawal of Tiratricol Treatment in Males With Monocarboxylate Transporter 8 Deficiency (MCT8 Deficiency) |
| NCT02396459 | PHASE2 | ACTIVE_NOT_RECRUITING | Triac Trial II in MCT8 Deficiency Patients |
| NCT02060474 | PHASE2 | COMPLETED | Thyroid Hormone Analog Therapy in MCT8 Deficiency: Triac Trial Patients |
| NCT03783988 | PHASE1 | UNKNOWN | Study With a Topical Gel Containing TRIAC and DHEA in Subjects With Skin Atrophy Due to Glucocorticoids |
| NCT05911399 | Not specified | AVAILABLE | Expanded Access Program for Tiratricol in Patients With Monocarboxylate Transporter 8 Deficiency |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
112 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AMIODARONE | ChEMBL + PubChem | Phase 4 (approved) | THRA, THRB |
| LIOTHYRONINE | ChEMBL + PubChem | Phase 4 (approved) | THRA, THRB |
| RESMETIROM | ChEMBL + PubChem | Phase 4 (approved) | THRA, THRB |
| LEVOTHYROXINE | ChEMBL | Phase 4 (approved) | THRA, THRB |
| ROXADUSTAT | ChEMBL | Phase 4 (approved) | THRA, THRB |
| EPROTIROME | ChEMBL | Phase 3 | THRA, THRB |
| AXITIROME | ChEMBL | Phase 2 | THRA, THRB |
| DETROTHYRONINE | ChEMBL | Phase 2 | THRA, THRB |
| MB07811 | ChEMBL | Phase 2 | THRA, THRB |
| SOBETIROME | ChEMBL | Phase 2 | THRA, THRB |
| THYROPROPIC ACID | ChEMBL | Phase 2 | THRA, THRB |
| ACETAZOLAMIDE | ChEMBL | Phase 4 (approved) | THRB |
| ACETOHEXAMIDE | ChEMBL | Phase 4 (approved) | THRB |
| ACETYLCYSTEINE | ChEMBL | Phase 4 (approved) | THRB |
| ALTRETAMINE | ChEMBL | Phase 4 (approved) | THRB |
| AMANTADINE | ChEMBL | Phase 4 (approved) | THRB |
| AMILORIDE | ChEMBL | Phase 4 (approved) | THRB |
| AMINOCAPROIC ACID | ChEMBL | Phase 4 (approved) | THRB |
| AMINOPYRINE | ChEMBL | Phase 4 (approved) | THRB |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | THRB |
| ATORVASTATIN | ChEMBL | Phase 4 (approved) | THRB |
| AZARIBINE | ChEMBL | Phase 4 (approved) | THRB |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | THRB |
| BISOPROLOL | ChEMBL | Phase 4 (approved) | THRB |
| BITHIONOL | ChEMBL | Phase 4 (approved) | THRB |
| CARBETAPENTANE | ChEMBL | Phase 4 (approved) | THRB |
| CHLORMADINONE | ChEMBL | Phase 4 (approved) | THRB |
| CHLORMEZANONE | ChEMBL | Phase 4 (approved) | THRB |
| CHLORPROPAMIDE | ChEMBL | Phase 4 (approved) | THRB |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | THRB |
| CYCLOTHIAZIDE | ChEMBL | Phase 4 (approved) | THRB |
| CYTARABINE | ChEMBL | Phase 4 (approved) | THRB |
| DAUNORUBICIN | ChEMBL | Phase 4 (approved) | THRB |
| DEBRISOQUIN | ChEMBL | Phase 4 (approved) | THRB |
| DEXTROTHYROXINE | ChEMBL | Phase 4 (approved) | THRB |
| DIAZOXIDE | ChEMBL | Phase 4 (approved) | THRB |
| DILTIAZEM | ChEMBL | Phase 4 (approved) | THRB |
| DIPYRIDAMOLE | ChEMBL | Phase 4 (approved) | THRB |
| DISOPYRAMIDE | ChEMBL | Phase 4 (approved) | THRB |
| DITHIAZANINE IODIDE | ChEMBL | Phase 4 (approved) | THRB |
| DOXORUBICIN | ChEMBL | Phase 4 (approved) | THRB |
| DYCLONINE | ChEMBL | Phase 4 (approved) | THRB |
| GENTIAN VIOLET | ChEMBL | Phase 4 (approved) | THRB |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | THRB |
| HYDROCHLOROTHIAZIDE | ChEMBL | Phase 4 (approved) | THRB |
| IDARUBICIN | ChEMBL | Phase 4 (approved) | THRB |
| INAMRINONE | ChEMBL | Phase 4 (approved) | THRB |
| INDIGOTINDISULFONATE | ChEMBL | Phase 4 (approved) | THRB |
| ISOSORBIDE | ChEMBL | Phase 4 (approved) | THRB |
| ISOTRETINOIN | ChEMBL | Phase 4 (approved) | THRB |
| LEFLUNOMIDE | ChEMBL | Phase 4 (approved) | THRB |
| MECLOFENAMATE | ChEMBL | Phase 4 (approved) | THRB |
| MESALAMINE | ChEMBL | Phase 4 (approved) | THRB |
| METHACYCLINE | ChEMBL | Phase 4 (approved) | THRB |
| METHYLENE BLUE | ChEMBL | Phase 4 (approved) | THRB |
| METHYLENE BLUE CATION | ChEMBL | Phase 4 (approved) | THRB |
| METHYSERGIDE | ChEMBL | Phase 4 (approved) | THRB |
| METRONIDAZOLE | ChEMBL | Phase 4 (approved) | THRB |
| MOLSIDOMINE | ChEMBL | Phase 4 (approved) | THRB |
| OXYTETRACYCLINE | ChEMBL | Phase 4 (approved) | THRB |
Related Atlas pages
- Genes: THRA, THRB
- Drugs: Amiodarone, Liothyronine, Resmetirom, Levothyroxine, Roxadustat, Eprotirome, Acetazolamide, Acetohexamide, Acetylcysteine, Altretamine, Amantadine, Amiloride, Aminocaproic Acid, Aminopyrine, Amoxapine, Atorvastatin, Azaribine, Benzbromarone, Bisoprolol, Bithionol, Carbetapentane, Chlormadinone, Chlormezanone, Chlorpropamide, Clomipramine, Cyclothiazide, Cytarabine, Daunorubicin, Debrisoquin, Diazoxide, Diltiazem, Dipyridamole, Disopyramide, Doxorubicin, Dyclonine, Hexachlorophene, Hydrochlorothiazide, Idarubicin, Inamrinone, Isosorbide, Isotretinoin, Leflunomide, Meclofenamate, Mesalamine, Methacycline, Methylene Blue, Methysergide, Metronidazole, Molsidomine, Oxytetracycline