Tirbanibulin
drugOn this page
Also known as KlisyriKX-01KX-2391KX01KX2391TirbanibulinaTirbanibulineSID164339429Tirbanibulin
Summary
Tirbanibulin (CHEMBL571546) is an approved small-molecule antineoplastic agent (ATC D06BX03) targeting SRC; indicated across 6 conditions including actinic keratosis and basal cell carcinoma; with CIViC clinical evidence for 1 variant-indication association (e.g. FLT3 ITD AND FLT3 F691L in acute myeloid leukemia).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: D06BX03
- Targets: 1 (SRC)
- Indications: 6 conditions
- Clinical trials: 12
- Precision-oncology evidence (CIViC): 1 variant–indication association
- Chemistry: 431.5 Da · C26H29N3O3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL571546 |
| Name | Tirbanibulin |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 23635314 |
| ChEBI | CHEBI:231702 |
| ATC | D06BX03 |
| Molecular formula | C26H29N3O3 |
| Molecular weight | 431.5 |
| InChIKey | HUNGUWOZPQBXGX-UHFFFAOYSA-N |
SMILES: C1COCCN1CCOC2=CC=C(C=C2)C3=CN=C(C=C3)CC(=O)NCC4=CC=CC=C4
IUPAC name: N-benzyl-2-[5-[4-(2-morpholin-4-ylethoxy)phenyl]-2-pyridinyl]acetamide
ChEBI definition: A member of the class of pyridines that is pyridine substituted by 2-(benzylamino)-2-oxoethyl and 4-[2-(morpholin-4-yl)ethoxy]phenyl groups at positions 2 and 5, respectively. It is a dual inhibitor of Src kinase and tubulin and approved by the FDA for the topical treatment of actinic keratosis on the face or scalp.
Pharmacological roles (ChEBI): antineoplastic agent, apoptosis inducer, EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor, microtubule-destabilising agent.
Also known as: Klisyri, KX-01, KX-2391, KX01, KX2391, Tirbanibulin, Tirbanibulina, Tirbanibuline, SID164339429, TIRBANIBULIN, Klisyri; Tirbanibulin
Parent form; salt/anhydrous children: CHEMBL4594279
Patent coverage: 459 distinct patent families (1,192 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 1,047 (88%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| SRC | SRC proto-oncogene, non-receptor tyrosine kinase | Inhibition | 4.34 | 3.7% | P12931 |
Broader ChEMBL bioactivity targets: 4 (assay-derived). Sample: Tubulin, Bcr/Abl fusion protein, Proto-oncogene tyrosine-protein kinase Src, Tyrosine-protein kinase Lyn.
Bioactivity
ChEMBL activities: 6 potent at pChembl ≥ 5 of 8 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| SRC | 8.19 | IC50 | 6.5 | nM | CHEMBL_ACT_19114101 |
| SRC | 7.89 | IC50 | 13 | nM | CHEMBL_ACT_19114089 |
| SRC | 7.7 | IC50 | 20 | nM | CHEMBL_ACT_6175412 |
| ABL1 | 7 | IC50 | 100 | nM | CHEMBL_ACT_19114111 |
| LYN | 7 | IC50 | 100 | nM | CHEMBL_ACT_19114126 |
| TUBB4A | 5.96 | Kd | 1110 | nM | CHEMBL_ACT_24359813 |
Target pathways
Aggregated over 1 target gene(s): SRC.
Top Reactome pathways
121 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Hemostasis | 1 | SRC |
| Neurotransmitter receptors and postsynaptic signal transmission | 1 | SRC |
| Transmission across Chemical Synapses | 1 | SRC |
| Neuronal System | 1 | SRC |
| Signaling by ERBB2 | 1 | SRC |
| Signaling by ERBB4 | 1 | SRC |
| Nuclear signaling by ERBB4 | 1 | SRC |
| Downregulation of ERBB4 signaling | 1 | SRC |
| PIP3 activates AKT signaling | 1 | SRC |
| Developmental Biology | 1 | SRC |
| Cytokine Signaling in Immune system | 1 | SRC |
| Spry regulation of FGF signaling | 1 | SRC |
| Signaling by SCF-KIT | 1 | SRC |
| Regulation of KIT signaling | 1 | SRC |
| Signal Transduction | 1 | SRC |
| Disease | 1 | SRC |
| Signaling by NTRKs | 1 | SRC |
| Immune System | 1 | SRC |
| p38MAPK events | 1 | SRC |
| Signaling by EGFR | 1 | SRC |
| GAB1 signalosome | 1 | SRC |
| Downstream signal transduction | 1 | SRC |
| Signaling by PDGF | 1 | SRC |
| Regulation of gap junction activity | 1 | SRC |
| Signaling by Rho GTPases | 1 | SRC |
| Negative regulation of the PI3K/AKT network | 1 | SRC |
| Signaling by ALK | 1 | SRC |
| FCGR activation | 1 | SRC |
| PECAM1 interactions | 1 | SRC |
| Generic Transcription Pathway | 1 | SRC |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| negative regulation of transcription by RNA polymerase II | 1 |
| stimulatory C-type lectin receptor signaling pathway | 1 |
| negative regulation of inflammatory response to antigenic stimulus | 1 |
| cell adhesion | 1 |
| signal transduction | 1 |
| signal complex assembly | 1 |
| epidermal growth factor receptor signaling pathway | 1 |
| transforming growth factor beta receptor signaling pathway | 1 |
| integrin-mediated signaling pathway | 1 |
| regulation of epithelial cell migration | 1 |
| positive regulation of epithelial cell migration | 1 |
| positive regulation of protein processing | 1 |
| macroautophagy | 1 |
| peptidyl-tyrosine phosphorylation | 1 |
| regulation of cell-cell adhesion | 1 |
Indications & clinical
Indications
6 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| actinic keratosis | 4 | MONDO:0005173 | EFO:0002496 |
| basal cell carcinoma | 2 | MONDO:0020804 | EFO:0004193 |
| acute myeloid leukemia | 1 | MONDO:0018874 | EFO:0000222 |
| lymphoma | 1 | MONDO:0005062 | EFO:0000574 |
| neoplasm | 1 | MONDO:0005070 | EFO:0000616 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 12.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE1 | 4 |
| PHASE4 | 2 |
| PHASE3 | 2 |
| PHASE2 | 2 |
| PHASE1/PHASE2 | 1 |
| Not specified | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT05900258 | PHASE4 | COMPLETED | Tirbanibulin 1% Ointment for the Treatment of Chronically Sun-damaged Skin on the Face |
| NCT06026358 | PHASE4 | WITHDRAWN | Tirbanibulin 1% Ointment for the Treatment of Actinic Keratosis on the Back of the Hands |
| NCT07273656 | PHASE3 | NOT_YET_RECRUITING | Efficacy and Safety of Cryotherapy Followed by Tirbanibulin Ointment for Actinic Keratosis on the Scalp and Forehead |
| NCT06135415 | PHASE3 | COMPLETED | A Study to Evaluate the Efficacy and Safety of Tirbanibulin Ointment in Adult Participants With Actinic Keratosis |
| NCT01074138 | PHASE2 | COMPLETED | Safety and Efficacy Study of KX2-391 for Treatment of Bone-Metastatic, Castration-Resistant Prostate Cancer |
| NCT01764087 | PHASE1/PHASE2 | UNKNOWN | A Study of KX2-391 With Paclitaxel in Patients With Solid Tumors |
| NCT06112522 | PHASE2 | UNKNOWN | Tirbanubulin (Klisiry®) in the Treatment of Basal Cell Carcinoma |
| NCT00658970 | PHASE1 | COMPLETED | Evaluation of KX2-391 in Patients With Advanced Malignancies |
| NCT01397799 | PHASE1 | COMPLETED | Evaluation of KX2-391 in Elderly Subjects With Acute Myeloid Leukemia (AML) |
| NCT02337205 | PHASE1 | COMPLETED | Ph 1, Single-Center, Safety, Tolerability & Pharmacokinetic Study of KX2 391 Ointment in Subj. w Actinic Keratosis |
| NCT05522816 | PHASE1 | COMPLETED | KX01 Ointment Phase 1 Study in Patients With Plaque Type Psoriasis |
| NCT05260073 | Not specified | COMPLETED | Patient and Clinician Reported Outcomes for Tirbanibulin Effectiveness and Safety in Actinic Keratosis |
Clinical evidence (CIViC)
Variant × indication × effect (1 predictive associations from 1 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| FLT3 ITD AND FLT3 F691L | Acute Myeloid Leukemia | Sensitivity/Response | Tirbanibulin | CIViC D | EID9774 |
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
85 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AFATINIB | ChEMBL + PubChem | Phase 4 (approved) | SRC |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | SRC |
| DACOMITINIB | ChEMBL + PubChem | Phase 4 (approved) | SRC |
| PAZOPANIB | ChEMBL + PubChem | Phase 4 (approved) | SRC |
| ADENOSINE | ChEMBL | Phase 4 (approved) | SRC |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | SRC |
| BRIGATINIB | ChEMBL | Phase 4 (approved) | SRC |
| CABOZANTINIB | ChEMBL | Phase 4 (approved) | SRC |
| CERITINIB | ChEMBL | Phase 4 (approved) | SRC |
| DASATINIB | ChEMBL | Phase 4 (approved) | SRC |
| ENTRECTINIB | ChEMBL | Phase 4 (approved) | SRC |
| ERLOTINIB | ChEMBL | Phase 4 (approved) | SRC |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | SRC |
| GEFITINIB | ChEMBL | Phase 4 (approved) | SRC |
| IBRUTINIB | ChEMBL | Phase 4 (approved) | SRC |
| IMATINIB | ChEMBL | Phase 4 (approved) | SRC |
| INFIGRATINIB | ChEMBL | Phase 4 (approved) | SRC |
| LAPATINIB | ChEMBL | Phase 4 (approved) | SRC |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | SRC |
| NERATINIB | ChEMBL | Phase 4 (approved) | SRC |
| NICLOSAMIDE | ChEMBL | Phase 4 (approved) | SRC |
| NILOTINIB | ChEMBL | Phase 4 (approved) | SRC |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | SRC |
| PONATINIB | ChEMBL | Phase 4 (approved) | SRC |
| REPOTRECTINIB | ChEMBL | Phase 4 (approved) | SRC |
| SORAFENIB | ChEMBL | Phase 4 (approved) | SRC |
| SUNITINIB | ChEMBL | Phase 4 (approved) | SRC |
| TIVOZANIB | ChEMBL | Phase 4 (approved) | SRC |
| VANDETANIB | ChEMBL | Phase 4 (approved) | SRC |
| ALISERTIB | ChEMBL | Phase 3 | SRC |
| ALVOCIDIB | ChEMBL | Phase 3 | SRC |
| BRIVANIB | ChEMBL | Phase 3 | SRC |
| CANERTINIB | ChEMBL | Phase 3 | SRC |
| CEDIRANIB | ChEMBL | Phase 3 | SRC |
| DOVITINIB | ChEMBL | Phase 3 | SRC |
| INDIGO | ChEMBL | Phase 3 | SRC |
| LESTAURTINIB | ChEMBL | Phase 3 | SRC |
| LINIFANIB | ChEMBL | Phase 3 | SRC |
| MASITINIB | ChEMBL | Phase 3 | SRC |
| QUERCETIN | ChEMBL | Phase 3 | SRC |
| SARACATINIB | ChEMBL | Phase 3 | SRC |
| SEMAXANIB | ChEMBL | Phase 3 | SRC |
| TESEVATINIB | ChEMBL | Phase 3 | SRC |
| AT-9283 | ChEMBL | Phase 2 | SRC |
| AZD-3759 | ChEMBL | Phase 2 | SRC |
| AZD-6482 | ChEMBL | Phase 2 | SRC |
| AZM-475271 | ChEMBL | Phase 2 | SRC |
| BEMCENTINIB | ChEMBL | Phase 2 | SRC |
| BIIB-091 | ChEMBL | Phase 2 | SRC |
| BMS-690514 | ChEMBL | Phase 2 | SRC |
| BMS-754807 | ChEMBL | Phase 2 | SRC |
| BMS-986142 | ChEMBL | Phase 2 | SRC |
| CENISERTIB | ChEMBL | Phase 2 | SRC |
| CEP-11981 | ChEMBL | Phase 2 | SRC |
| DALMELITINIB | ChEMBL | Phase 2 | SRC |
| DANUSERTIB | ChEMBL | Phase 2 | SRC |
| DORAMAPIMOD | ChEMBL | Phase 2 | SRC |
| ELLAGIC ACID | ChEMBL | Phase 2 | SRC |
| ELZOVANTINIB | ChEMBL | Phase 2 | SRC |
| ENMD-2076 | ChEMBL | Phase 2 | SRC |
Related Atlas pages
- Genes: SRC
- Diseases: actinic keratosis, acute myeloid leukemia by FAB classification
- Drugs: Afatinib, Crizotinib, Dacomitinib, Pazopanib, Adenosine, Bosutinib, Brigatinib, Cabozantinib, Ceritinib, Dasatinib, Entrectinib, Erlotinib, Fedratinib, Gefitinib, Ibrutinib, Imatinib, Infigratinib, Lapatinib, Midostaurin, Neratinib, Niclosamide, Nilotinib, Nintedanib, Ponatinib, Repotrectinib, Sorafenib, Sunitinib, Tivozanib, Vandetanib, Alisertib, Alvocidib, Brivanib, Canertinib, Cediranib, Dovitinib, Indigo, Lestaurtinib, Linifanib, Masitinib, Quercetin, Saracatinib, Semaxanib, Tesevatinib