Tolrestat
drugOn this page
Also known as AlredaseAY-27,773AY-27773AlderaseSID144206867
Summary
Tolrestat (CHEMBL436) is an approved small-molecule EC 1.1.1.21 (aldehyde reductase) inhibitor (ATC A10XA01) targeting AKR1B1; indicated across 1 condition including diabetes mellitus.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: A10XA01
- Targets: 1 (AKR1B1)
- Indications: 1 condition
- Chemistry: 357.3 Da · C16H14F3NO3S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL436 |
| Name | Tolrestat |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 53359 |
| ChEBI | CHEBI:48549 |
| ATC | A10XA01 |
| Molecular formula | C16H14F3NO3S |
| Molecular weight | 357.3 |
| InChIKey | LUBHDINQXIHVLS-UHFFFAOYSA-N |
SMILES: CN(CC(=O)O)C(=S)C1=CC=CC2=C1C=CC(=C2C(F)(F)F)OC
IUPAC name: 2-[[6-methoxy-5-(trifluoromethyl)naphthalene-1-carbothioyl]-methylamino]acetic acid
Pharmacological roles (ChEBI): EC 1.1.1.21 (aldehyde reductase) inhibitor.
Also known as: Alredase, AY-27,773, AY-27773, Alderase, Tolrestat, tolrestat, TOLRESTAT, SID144206867
Patent coverage: 1,042 distinct patent families (3,768 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 3,714 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| AKR1B1 | aldo-keto reductase family 1 member B | Inhibition | 7.33 | 1.1% | P15121 |
Broader ChEMBL bioactivity targets: 9 (assay-derived). Sample: Aldo-keto reductase family 1 member C21, Aldo-keto reductase family 1 member B1, Aldo-keto reductase family 1 member A1, Aldo-keto reductase family 1 member B1, Aldo-keto reductase family 1 member B1, Aldo-keto reductase family 1 member A1, Aldo-keto reductase family 1 member A1, Aldo-keto reductase family 1 member B1, Aldo-keto reductase family 1 member B10.
Bioactivity
ChEMBL activities: 40 potent at pChembl ≥ 5 of 42 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P07943 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_370514 |
| P07943 | 8.54 | IC50 | 2.9 | nM | CHEMBL_ACT_503310 |
| AKR1B1 | 8 | IC50 | 10 | nM | CHEMBL_ACT_18093249 |
| AKR1B1 | 8 | IC50 | 10 | nM | CHEMBL_ACT_3357322 |
| AKR1B10 | 7.94 | IC50 | 11.6 | nM | CHEMBL_ACT_2151206 |
| AKR1B1 | 7.89 | IC50 | 13 | nM | CHEMBL_ACT_1505638 |
| AKR1B1 | 7.85 | IC50 | 14 | nM | CHEMBL_ACT_29120149 |
| P80276 | 7.82 | IC50 | 15 | nM | CHEMBL_ACT_1263515 |
| P80276 | 7.8 | IC50 | 16 | nM | CHEMBL_ACT_230522 |
| AKR1B1 | 7.62 | IC50 | 23.9 | nM | CHEMBL_ACT_308983 |
| P80276 | 7.52 | IC50 | 30 | nM | CHEMBL_ACT_1468032 |
| P16116 | 7.48 | IC50 | 33 | nM | CHEMBL_ACT_1003995 |
| P16116 | 7.48 | IC50 | 33 | nM | CHEMBL_ACT_308981 |
| P16116 | 7.47 | IC50 | 34 | nM | CHEMBL_ACT_1074579 |
| AKR1B1 | 7.46 | IC50 | 35 | nM | CHEMBL_ACT_1060906 |
| P16116 | 7.46 | IC50 | 35 | nM | CHEMBL_ACT_291520 |
| P16116 | 7.46 | IC50 | 35 | nM | CHEMBL_ACT_472319 |
| P16116 | 7.46 | IC50 | 35 | nM | CHEMBL_ACT_910580 |
| AKR1B1 | 7.4 | IC50 | 40 | nM | CHEMBL_ACT_2139918 |
| P07943 | 7.34 | IC50 | 46 | nM | CHEMBL_ACT_92689 |
| AKR1B1 | 7.33 | IC50 | 47 | nM | CHEMBL_ACT_166000 |
| AKR1B10 | 7.3 | Ki | 50 | nM | CHEMBL_ACT_12095092 |
| P07943 | 7.3 | IC50 | 50 | nM | CHEMBL_ACT_18152790 |
| P07943 | 7.3 | IC50 | 50 | nM | CHEMBL_ACT_286384 |
| AKR1B10 | 7.3 | IC50 | 50 | nM | CHEMBL_ACT_29120155 |
| P07943 | 7.3 | IC50 | 50 | nM | CHEMBL_ACT_3196728 |
| P07943 | 7.3 | IC50 | 50 | nM | CHEMBL_ACT_92690 |
| AKR1B10 | 7.27 | IC50 | 54 | nM | CHEMBL_ACT_18093248 |
| AKR1B10 | 7.27 | IC50 | 54 | nM | CHEMBL_ACT_3357313 |
| AKR1A1 | 7.19 | IC50 | 65 | nM | CHEMBL_ACT_25529946 |
Target pathways
Aggregated over 1 target gene(s): AKR1B1.
Top Reactome pathways
9 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Metabolism | 1 | AKR1B1 |
| Metabolism of steroid hormones | 1 | AKR1B1 |
| Pregnenolone biosynthesis | 1 | AKR1B1 |
| Metabolism of lipids | 1 | AKR1B1 |
| Fructose metabolism | 1 | AKR1B1 |
| Fructose biosynthesis | 1 | AKR1B1 |
| Galactose catabolism | 1 | AKR1B1 |
| Metabolism of carbohydrates and carbohydrate derivatives | 1 | AKR1B1 |
| Metabolism of steroids | 1 | AKR1B1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| retinoid metabolic process | 1 |
| epithelial cell maturation | 1 |
| renal water homeostasis | 1 |
| carbohydrate metabolic process | 1 |
| C21-steroid hormone biosynthetic process | 1 |
| regulation of urine volume | 1 |
| negative regulation of apoptotic process | 1 |
| daunorubicin metabolic process | 1 |
| doxorubicin metabolic process | 1 |
| fructose biosynthetic process | 1 |
| cellular hyperosmotic salinity response | 1 |
| metanephric collecting duct development | 1 |
| lipid metabolic process | 1 |
| prostaglandin metabolic process | 1 |
| retinol metabolic process | 1 |
Indications & clinical
Indications
1 indication (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| diabetes mellitus | 4 | MONDO:0005015 | EFO:0000400 |
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
36 molecules share ≥1 primary target. Top 36 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| FOLIC ACID | ChEMBL + PubChem | Phase 4 (approved) | AKR1B1 |
| EPALRESTAT | ChEMBL | Phase 4 (approved) | AKR1B1 |
| ESTRADIOL | ChEMBL | Phase 4 (approved) | AKR1B1 |
| ESTRONE | ChEMBL | Phase 4 (approved) | AKR1B1 |
| INDOMETHACIN | ChEMBL | Phase 4 (approved) | AKR1B1 |
| MEFENAMIC ACID | ChEMBL | Phase 4 (approved) | AKR1B1 |
| NITAZOXANIDE | ChEMBL | Phase 4 (approved) | AKR1B1 |
| SULINDAC | ChEMBL | Phase 4 (approved) | AKR1B1 |
| TOLMETIN | ChEMBL | Phase 4 (approved) | AKR1B1 |
| CAFFEIC ACID | ChEMBL | Phase 3 | AKR1B1 |
| CURCUMIN | ChEMBL | Phase 3 | AKR1B1 |
| GOSSYPOL | ChEMBL | Phase 3 | AKR1B1 |
| QUERCETIN | ChEMBL | Phase 3 | AKR1B1 |
| RANIRESTAT | ChEMBL | Phase 3 | AKR1B1 |
| RESVERATROL | ChEMBL | Phase 3 | AKR1B1 |
| SORBINIL | ChEMBL | Phase 3 | AKR1B1 |
| ALRESTATIN | ChEMBL | Phase 2 | AKR1B1 |
| AZD1981 | ChEMBL | Phase 2 | AKR1B1 |
| CHLOROGENIC ACID | ChEMBL | Phase 2 | AKR1B1 |
| ELLAGIC ACID | ChEMBL | Phase 2 | AKR1B1 |
| FIDARESTAT | ChEMBL | Phase 2 | AKR1B1 |
| FLUFENAMIC ACID | ChEMBL | Phase 2 | AKR1B1 |
| GENISTEIN | ChEMBL | Phase 2 | AKR1B1 |
| HYMECROMONE | ChEMBL | Phase 2 | AKR1B1 |
| IMIRESTAT | ChEMBL | Phase 2 | AKR1B1 |
| ISOQUERCETIN | ChEMBL | Phase 2 | AKR1B1 |
| LIDORESTAT | ChEMBL | Phase 2 | AKR1B1 |
| LUTEOLIN | ChEMBL | Phase 2 | AKR1B1 |
| MINALRESTAT | ChEMBL | Phase 2 | AKR1B1 |
| OXEPINAC | ChEMBL | Phase 2 | AKR1B1 |
| PONALRESTAT | ChEMBL | Phase 2 | AKR1B1 |
| SEPRANOLONE | ChEMBL | Phase 2 | AKR1B1 |
| TIOPINAC | ChEMBL | Phase 2 | AKR1B1 |
| URSOLIC ACID | ChEMBL | Phase 2 | AKR1B1 |
| ZENARESTAT | ChEMBL | Phase 2 | AKR1B1 |
| ZOPOLRESTAT | ChEMBL | Phase 2 | AKR1B1 |
Related Atlas pages
- Genes: AKR1B1
- Diseases: diabetes mellitus
- Drugs: Folic Acid, Epalrestat, Estradiol, Estrone, Indomethacin, Mefenamic Acid, Nitazoxanide, Sulindac, Tolmetin, Caffeic Acid, Curcumin, Gossypol, Quercetin, Ranirestat, Resveratrol, Sorbinil