Topiramate
drugOn this page
Also known as (-)-topiramateEpitomaEpitomaxEprontiaMCN-4853QudexyQudexy xrRWJ-17021SincronilTopamacTopamaxTopamax sprinkleTopimaxTopinaTopiramate component of qsymiaTopiramatoTopomaxTrokendi xrUSL-255
Summary
Topiramate (CHEMBL220492) is an approved small-molecule anticonvulsant (ATC N03AX11) targeting CA1, CA4, and CA12; indicated across 48 conditions including epilepsy and visual epilepsy.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N03AX11
- Targets: 4 (CA1, CA4, CA12…)
- Indications: 48 conditions
- Clinical trials: 230
- Chemistry: 339.36 Da · C12H21NO8S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL220492 |
| Name | Topiramate |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 5284627 |
| ChEBI | CHEBI:63631 |
| ATC | N03AX11 |
| Molecular formula | C12H21NO8S |
| Molecular weight | 339.36 |
| InChIKey | KJADKKWYZYXHBB-XBWDGYHZSA-N |
SMILES: CC1(O[C@@H]2CO[C@@]3([C@H]([C@@H]2O1)OC(O3)(C)C)COS(=O)(=O)N)C
IUPAC name: [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate
ChEBI definition: A hexose derivative that is 2,3:4,5-di-O-isopropylidene-β-D-fructopyranose in which the hydroxy group has been converted to the corresponding sulfamate ester. It blocks voltage-dependent sodium channels and is used as an antiepileptic and for the prevention of migraine.
Pharmacological roles (ChEBI): anticonvulsant, sodium channel blocker.
Also known as: (-)-topiramate, Epitoma, Epitomax, Eprontia, MCN-4853, Qudexy, Qudexy xr, RWJ-17021, Sincronil, Topamac, Topamax, Topamax sprinkle
Patent coverage: 9,527 distinct patent families (35,160 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CA1 | carbonic anhydrase 1 | Inhibition | 6.6 | 0% | P00915 |
| CA4 | carbonic anhydrase 4 | Inhibition | 7.37 | 0.3% | P22748 |
| CA12 | carbonic anhydrase 12 | Inhibition | 8.42 | 0.2% | O43570 |
| CA7 | carbonic anhydrase 7 | Inhibition | 9.05 | 1.6% | P43166 |
Broader ChEMBL bioactivity targets: 23 (assay-derived). Sample: Carbonic anhydrase 2, Carbonic anhydrase V, Carbonic anhydrase 13, Carbonic anhydrase 7, Carbonic anhydrase 1, Carbonic anhydrase 4, Carbonic anhydrase 6, Carbonic anhydrase 12, Sodium channel protein type 2 subunit alpha, Carbonic anhydrase 14.
Bioactivity
ChEMBL activities: 285 potent at pChembl ≥ 5 of 290 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| CA7 | 9.06 | Ki | 0.87 | nM | CHEMBL_ACT_1435974 |
| CA7 | 9.06 | Ki | 0.87 | nM | CHEMBL_ACT_2619678 |
| CA7 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_10950742 |
| CA7 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_13407598 |
| CA7 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_13440683 |
| CA7 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_13859515 |
| CA7 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_1780679 |
| CA7 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_18043977 |
| CA7 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_18952624 |
| CA7 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_1954043 |
| CA7 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_2056568 |
| CA7 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_23169524 |
| CA7 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_25513757 |
| CA7 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_2564675 |
| CA7 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_29315986 |
| CA7 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_2949481 |
| CA7 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_3310916 |
| CA7 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_6168790 |
| CA7 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_6223163 |
| CA7 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_6227541 |
| CA2 | 8.3 | Ki | 5 | nM | CHEMBL_ACT_1435973 |
| CA2 | 8.3 | Ki | 5 | nM | CHEMBL_ACT_1437691 |
| CA2 | 8.3 | Ki | 5 | nM | CHEMBL_ACT_1439693 |
| CA2 | 8.3 | Ki | 5 | nM | CHEMBL_ACT_145891 |
| CA2 | 8.3 | Ki | 5 | nM | CHEMBL_ACT_1606307 |
| CA2 | 8.3 | Ki | 5 | nM | CHEMBL_ACT_2939246 |
| CA2 | 8.3 | Ki | 5 | nM | CHEMBL_ACT_3256657 |
| CA2 | 8.3 | Ki | 5 | nM | CHEMBL_ACT_5303371 |
| CA2 | 8.3 | Ki | 5 | nM | CHEMBL_ACT_533960 |
| CA2 | 8.3 | Ki | 5 | nM | CHEMBL_ACT_591519 |
Target pathways
Aggregated over 4 target gene(s): CA1, CA4, CA12, CA7.
Top Reactome pathways
12 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Metabolism | 4 | CA1, CA12, CA4, CA7 |
| Reversible hydration of carbon dioxide | 4 | CA1, CA12, CA4, CA7 |
| Erythrocytes take up carbon dioxide and release oxygen | 2 | CA1, CA4 |
| Erythrocytes take up oxygen and release carbon dioxide | 2 | CA1, CA4 |
| O2/CO2 exchange in erythrocytes | 2 | CA1, CA4 |
| Transport of small molecules | 2 | CA1, CA4 |
| Cytokine Signaling in Immune system | 1 | CA1 |
| Immune System | 1 | CA1 |
| Interleukin-12 family signaling | 1 | CA1 |
| Signaling by Interleukins | 1 | CA1 |
| Gene and protein expression by JAK-STAT signaling after Interleukin-12 stimulation | 1 | CA1 |
| Interleukin-12 signaling | 1 | CA1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| response to fructose | 1 |
| bicarbonate transport | 1 |
| estrous cycle | 1 |
| chloride ion homeostasis | 1 |
| positive regulation of synaptic transmission, GABAergic | 1 |
| obsolete positive regulation of cellular pH reduction | 1 |
| regulation of intracellular pH | 1 |
| neuron cellular homeostasis | 1 |
| regulation of chloride transport | 1 |
Indications & clinical
Indications
48 indications (4 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| epilepsy | 4 | MONDO:0005027 | EFO:0000474 |
| visual epilepsy | 4 | MONDO:0001386 | HP:0001250 |
| migraine disorder | 4 | MONDO:0005277 | MONDO:0005277 |
| Lennox-Gastaut syndrome | 4 | MONDO:0016532 | MONDO:0016532 |
| cocaine dependence | 3 | MONDO:0005186 | EFO:0002610 |
| pathological gambling | 3 | MONDO:0011662 | EFO:0004699 |
| obesity disorder | 3 | MONDO:0011122 | EFO:0001073 |
| nicotine dependence | 3 | MONDO:0008575 | EFO:0003768 |
| obsessive-compulsive disorder | 3 | MONDO:0008114 | EFO:0004242 |
| essential tremor | 3 | MONDO:0003233 | EFO:0003108 |
| focal epilepsy | 3 | MONDO:0005384 | EFO:0004263 |
| Tourette syndrome | 3 | MONDO:0007661 | EFO:0004895 |
| anxiety | 3 | MONDO:0011918 | EFO:0005230 |
| binge eating disorder | 3 | MONDO:0005582 | EFO:0005924 |
| dementia | 3 | MONDO:0001627 | HP:0000726 |
| hypertensive disorder | 3 | MONDO:0005044 | EFO:0000537 |
| alcohol abuse | 3 | MONDO:0002046 | MONDO:0002046 |
| metabolic syndrome X | 3 | MONDO:0011565 | EFO:0000195 |
| hypertriglyceridemia | 3 | MONDO:0005347 | EFO:0004211 |
| epilepsy with generalized tonic-clonic seizures | 3 | MONDO:0005754 | EFO:0007262 |
| depressive disorder | 3 | MONDO:0002050 | MONDO:0002050 |
| type 2 diabetes mellitus | 3 | MONDO:0005148 | MONDO:0005148 |
| Prader-Willi syndrome | 3 | MONDO:0008300 | MONDO:0008300 |
| hyperlipidemia | 3 | MONDO:0021187 | MONDO:0021187 |
| bipolar disorder | 3 | MONDO:0004985 | MONDO:0004985 |
| mood disorder | 3 | MONDO:0005371 | EFO:0004247 |
| methamphetamine dependence | 2 | MONDO:0005419 | EFO:0004701 |
| post-traumatic stress disorder | 2 | MONDO:0005146 | EFO:0001358 |
| diabetes mellitus | 2 | MONDO:0005015 | EFO:0000400 |
| sciatica | 2 | MONDO:0024333 | HP:0011868 |
| cannabis dependence | 2 | MONDO:0005689 | EFO:0007191 |
| brain ischemia | 2 | MONDO:0005299 | MONDO:0005299 |
| Parkinson disease | 2 | MONDO:0005180 | MONDO:0005180 |
| multiple sclerosis | 2 | MONDO:0005301 | MONDO:0005301 |
| sudden sensorineural hearing loss | 2 | MONDO:0043373 | MONDO:0043373 |
| congenital heart disease | 1 | MONDO:0005453 | EFO:0005207 |
| liver disorder | 1 | MONDO:0005154 | EFO:0001421 |
| bulimia nervosa | 1 | MONDO:0005452 | EFO:0005204 |
| HIV infectious disease | 1 | MONDO:0005109 | EFO:0000180 |
| eating disorder | 0 | MONDO:0005451 | EFO:0005203 |
8 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 230.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 62 |
| PHASE4 | 53 |
| PHASE2 | 47 |
| Not specified | 31 |
| PHASE1 | 20 |
| PHASE2/PHASE3 | 9 |
| PHASE1/PHASE2 | 4 |
| EARLY_PHASE1 | 4 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT04748601 | PHASE4 | RECRUITING | Qudexy XR for the Prevention of Migraine in Children 6 to 11 Years Old |
| NCT05582837 | PHASE4 | RECRUITING | Treatment of Meniere’s Disease With Migraine Medications |
| NCT05975580 | PHASE4 | RECRUITING | Pharmacotherapy in Conjunction With Lifestyle Counseling for Management of Weight Regain After Bariatric Surgery |
| NCT06499116 | PHASE4 | NOT_YET_RECRUITING | Comparison of the Effectiveness of First-line Preventive Treatment of Migraine in Primary Care |
| NCT06799169 | PHASE4 | ACTIVE_NOT_RECRUITING | Management of Acute Tinnitus With Migraine Medications |
| NCT06972056 | PHASE4 | RECRUITING | Comparative Effectiveness of Migraine Preventive Medications: The APT Comparison Study |
| NCT00153699 | PHASE4 | UNKNOWN | Relationship Between Topiramate Use and Ocular Angle Status |
| NCT00154076 | PHASE4 | COMPLETED | A Multicenter Comparative Trial of Zonisamide and Topiramate as Initial Monotherapy in Untreated Epilepsies |
| NCT00182455 | PHASE4 | TERMINATED | Efficacy of Adding Topiramate to Current Treatment in Treatment-Resistant Generalized Social Phobia (GSP) |
| NCT00182520 | PHASE4 | COMPLETED | Efficacy of Adding Topiramate to Current Treatment in Refractory Obsessive Compulsive Disorder (OCD) |
| NCT00200941 | PHASE4 | COMPLETED | Efficacy and Safety Study of Topiramate to Treat Restless Legs Syndrome |
| NCT00203190 | PHASE4 | TERMINATED | A Double-Blind, Placebo-Controlled Study Examining the Use of Topiramate in the Treatment of Cluster Headache |
| NCT00203463 | PHASE4 | COMPLETED | Topiramate in the Treatment of Post Traumatic Stress Disorder (PTSD) |
| NCT00208130 | PHASE4 | COMPLETED | Topiramate in the Treatment of Posttraumatic Stress Disorder in Civilians |
| NCT00211744 | PHASE4 | COMPLETED | Topiramate Augmentation in the Treatment of Obsessive-Compulsive Disorder |
| NCT00212810 | PHASE4 | COMPLETED | Evaluation of the Effectiveness of Topiramate in Preventing the Transformation From Episodic Migraine to Chronic Daily Headache. |
| NCT00216567 | PHASE4 | COMPLETED | Safety and Efficacy of Topamax Versus Carbamazepine in Benign Rolandic Epilepsy |
| NCT00266604 | PHASE4 | COMPLETED | A Study to Evaluate the Dosing, Effectiveness and Safety of Topiramate for the Treatment of Epilepsy |
| NCT00286988 | PHASE4 | TERMINATED | Topiramate for the Prophylactic Treatment of Cyclic Vomiting Syndrome in Children |
| NCT00329407 | PHASE4 | COMPLETED | The Effects of Topiramate on Alcohol Use in Alcohol Dependent Subjects |
| NCT00393978 | PHASE4 | COMPLETED | Efficacy Study of Quetiapine Plus Topiramate for Reducing Cannabis Consumption and Bipolar Mania |
| NCT00394095 | PHASE4 | COMPLETED | Topiramate vs. Placebo in Preventing Weight Gain in Bipolar Disorder Treated With Olanzapine |
| NCT00432549 | PHASE4 | UNKNOWN | Detoxification and Treatment of Subjects With Medication Overuse Headache |
| NCT00550394 | PHASE4 | COMPLETED | Efficacy and Tolerability of Topiramate in Treatment of Bipolar Mania and Alcohol Use in Adolescents and Young Adults |
| NCT00572117 | PHASE4 | COMPLETED | Adjunctive Topiramate for Treatment of Alcohol Dependence in Patients With Bipolar Disorder |
| NCT00626925 | PHASE4 | COMPLETED | Topiramate Treatment of Problem Drinkers |
| NCT00725920 | PHASE4 | COMPLETED | Placebo Controled Clinical Trial Using Topiramate To Treat Posttraumatic Stress Disorder (PTSD) Patients. |
| NCT00846495 | PHASE4 | COMPLETED | Pilot Study to Compare Frovatriptan vs. Topiramate for Prevention of Migraine |
| NCT00855738 | PHASE4 | COMPLETED | A Prospective, Observational Study On The Effectiveness Of New Antiepileptic Drugs As First Bitherapy In The Daily Clinical Practice |
| NCT00862095 | PHASE4 | TERMINATED | Medical Therapies for Chronic Post-Traumatic Headaches |
| NCT00988481 | PHASE4 | WITHDRAWN | Topiramate Augmentation in Bulimia Nervosa Partial Responders |
| NCT01060111 | PHASE4 | COMPLETED | An Efficacy and Tolerability Study of Topiramate in Participants With Migraine |
| NCT01087736 | PHASE4 | COMPLETED | Topiramate Treatment of Alcohol Use Disorders in Veterans With Post Traumatic Stress Disorder (PTSD): A Pilot Controlled Trial of Augmentation Therapy |
| NCT01135602 | PHASE4 | UNKNOWN | Topiramate for Hospitalized Patients With Alcoholism: a 12-week Study |
| NCT01229735 | PHASE4 | COMPLETED | Levetiracetam Versus Topiramate as Adjunctive Therapy to Evaluate Efficacy and Safety in Subjects With Refractory Partial Onset Seizures |
| NCT01627860 | PHASE4 | COMPLETED | First Add-on vs. Mono-therapy Study of Topiramate in Neuro-Surgical Patients |
| NCT01689649 | PHASE4 | COMPLETED | A Study to Assess Tolerability and Efficacy of Topiramate Monotherapy in Recently Diagnosed Patients With Epilepsy |
| NCT01700387 | PHASE4 | COMPLETED | A Study to Evaluate the Tolerability of Botox and Topiramate or Botox and Placebo and Effect on Cognitive Efficiency |
| NCT01749215 | PHASE4 | COMPLETED | A Controlled Trial of Topiramate Treatment for Alcohol Dependence in Veterans With PTSD |
| NCT01750268 | PHASE4 | COMPLETED | Topiramate Treatment of Hazardous and Harmful Alcohol Use in Veterans With TBI |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 6 clinical and 19 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
89 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ACETAMINOPHEN | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| ACETAZOLAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| BORTEZOMIB | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| BRINZOLAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| CELECOXIB | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| CHLORTHALIDONE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| COUMARIN | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| DICHLORPHENAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| DOBUTAMINE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| DORZOLAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| ETHOXZOLAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| FAMOTIDINE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| FUROSEMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| IMATINIB | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| INDAPAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| LACOSAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| LEVETIRACETAM | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| MAFENIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| METHAZOLAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| NILOTINIB | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| SALICYLIC ACID | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| SULFANILAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| TRICHLORMETHIAZIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| TRIENTINE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| VALDECOXIB | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| VERALIPRIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| ZONISAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4, CA7 |
| CAFFEIC ACID | ChEMBL | Phase 3 | CA1, CA12, CA4, CA7 |
| CURCUMIN | ChEMBL | Phase 3 | CA1, CA12, CA4, CA7 |
| QUERCETIN | ChEMBL | Phase 3 | CA1, CA12, CA4, CA7 |
| RESVERATROL | ChEMBL | Phase 3 | CA1, CA12, CA4, CA7 |
| SACCHARIN | ChEMBL | Phase 3 | CA1, CA12, CA4, CA7 |
| SPERMIDINE | ChEMBL | Phase 3 | CA1, CA12, CA4, CA7 |
| COUMAPHOS | ChEMBL | Phase 2 | CA1, CA12, CA4, CA7 |
| ELLAGIC ACID | ChEMBL | Phase 2 | CA1, CA12, CA4, CA7 |
| GALLIC ACID | ChEMBL | Phase 2 | CA1, CA12, CA4, CA7 |
| IROSUSTAT | ChEMBL | Phase 2 | CA1, CA12, CA4, CA7 |
| PCI-27483 | ChEMBL | Phase 2 | CA1, CA12, CA4, CA7 |
| SONEPIPRAZOLE | ChEMBL | Phase 2 | CA1, CA12, CA4, CA7 |
| HYDROQUINONE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| PHENOL | ChEMBL | Phase 4 (approved) | CA1, CA12, CA4 |
| PYRITHIONE ZINC | ChEMBL | Phase 4 (approved) | CA12, CA4, CA7 |
| SULPIRIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| P-TOLUENESULFONAMIDE | ChEMBL | Phase 3 | CA1, CA12, CA7 |
| THIMEROSAL | ChEMBL | Phase 3 | CA12, CA4, CA7 |
| CARZENIDE | ChEMBL | Phase 2 | CA1, CA12, CA7 |
| DAIDZEIN | ChEMBL | Phase 2 | CA12, CA4, CA7 |
| DITIOCARB | ChEMBL | Phase 2 | CA1, CA12, CA4 |
| INDISULAM | ChEMBL | Phase 2 | CA1, CA12, CA7 |
| ISOQUERCETIN | ChEMBL | Phase 2 | CA12, CA4, CA7 |
| LUTEOLIN | ChEMBL | Phase 2 | CA12, CA4, CA7 |
| SULFASUCCINAMIDE | ChEMBL | Phase 2 | CA1, CA12, CA4 |
| PAZOPANIB | ChEMBL + PubChem | Phase 4 (approved) | CA1, CA12 |
| SODIUM | ChEMBL | Phase 4 (approved) | CA1, CA4 |
| SULTHIAME | ChEMBL | Phase 4 (approved) | CA1, CA7 |
| PRITELIVIR | ChEMBL | Phase 3 | CA1, CA12 |
| BENZYLSULFAMIDE | ChEMBL | Phase 2 | CA1, CA12 |
| FLAVONE | ChEMBL | Phase 2 | CA1, CA12 |
| PROPAZOLAMIDE | ChEMBL | Phase 2 | CA1, CA4 |
| PUERARIN | ChEMBL | Phase 2 | CA12, CA7 |
Related Atlas pages
- Genes: CA1, CA4, CA12, CA7
- Diseases: epilepsy, migraine disorder, Lennox-Gastaut syndrome, cocaine dependence, pathological gambling, obesity disorder, nicotine dependence, obsessive-compulsive disorder, essential tremor, focal epilepsy, Tourette syndrome, anxiety, binge eating disorder, dementia, hypertensive disorder, alcohol abuse, metabolic syndrome X, hypertriglyceridemia, epilepsy with generalized tonic-clonic seizures, depressive disorder, type 2 diabetes mellitus, Prader-Willi syndrome, hyperlipidemia, bipolar disorder, mood disorder
- Drugs: Acetaminophen, Acetazolamide, Bortezomib, Brinzolamide, Celecoxib, Chlorthalidone, Dichlorphenamide, Dobutamine, Dorzolamide, Ethoxzolamide, Famotidine, Furosemide, Imatinib, Indapamide, Lacosamide, Levetiracetam, Mafenide, Methazolamide, Nilotinib, Salicylic Acid, Sulfanilamide, Trichlormethiazide, Trientine, Valdecoxib, Veralipride, Zonisamide, Caffeic Acid, Curcumin, Quercetin, Resveratrol, Saccharin, Spermidine, Hydroquinone, Phenol, Pyrithione Zinc, Sulpiride, P-Toluenesulfonamide, Thimerosal, Pazopanib, Sodium, Sulthiame, Pritelivir