Tovorafenib
drugOn this page
Also known as Biib-024BIIB024DAY-101DAY101Mln-2480Mln2480OjemdaTak 580Tak-580SID174006384
Summary
Tovorafenib (CHEMBL3348923) is an approved small-molecule antineoplastic agent targeting BRAF; indicated across 14 conditions including glioma and craniopharyngioma; with CIViC clinical evidence for 2 variant-indication associations (e.g. BRAF V600 OR v::BRAF Fusion in childhood low-grade glioma).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- Targets: 1 (BRAF)
- Indications: 14 conditions
- Clinical trials: 15
- Precision-oncology evidence (CIViC): 2 variant–indication associations
- Chemistry: 506.3 Da · C17H12Cl2F3N7O2S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL3348923 |
| Name | Tovorafenib |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 25161177 |
| ChEBI | CHEBI:167672 |
| Molecular formula | C17H12Cl2F3N7O2S |
| Molecular weight | 506.3 |
| InChIKey | VWMJHAFYPMOMGF-ZCFIWIBFSA-N |
SMILES: C[C@H](C1=NC=C(S1)C(=O)NC2=NC=C(C(=C2)C(F)(F)F)Cl)NC(=O)C3=C(C(=NC=N3)N)Cl
IUPAC name: 2-[(1R)-1-[(6-amino-5-chloropyrimidine-4-carbonyl)amino]ethyl]-N-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]-1,3-thiazole-5-carboxamide
ChEBI definition: A 1,3-thiazolecarboxamide that is 2-[(1R)-1-aminoethyl]-1,3-thiazole-5-carboxylic acid in which the carboxy group undergoes formal condensation with the amino group of 5-chloro-4-(trifluoromethyl)pyridin-2-amine and in which the amino group undergoes formal condensation with the carboxy group of 6-amino-5-chloropyrimidine-4-carboxylic acid. It is a pan-RAF kinase inhibitor which is currently in clinical development for the treatment of radiographically recurrent or progressive low-grade glioma in children and young adults.
Pharmacological roles (ChEBI): antineoplastic agent, apoptosis inducer, B-Raf inhibitor.
Also known as: Biib-024, BIIB-024, BIIB024, DAY-101, DAY101, Mln-2480, MLN-2480, Mln2480, Ojemda, Tak 580, Tak-580, TAK-580
Patent coverage: 315 distinct patent families (834 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 740 (89%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| BRAF | B-Raf proto-oncogene, serine/threonine kinase | Inhibition | 5.72 | 8.6% | P15056 |
Broader ChEMBL bioactivity targets: 25 (assay-derived). Sample: Receptor-interacting serine/threonine-protein kinase 3, Tyrosine-protein kinase ABL1, RAF proto-oncogene serine/threonine-protein kinase, Platelet-derived growth factor receptor beta, Ephrin type-A receptor 2, Dual specificity tyrosine-phosphorylation-regulated kinase 1A, Myosin light chain kinase, smooth muscle, Mitogen-activated protein kinase 14, Dual specificity mitogen-activated protein kinase kinase 4, LIM domain kinase 1.
Bioactivity
ChEMBL activities: 27 potent at pChembl ≥ 5 of 28 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| DDR1 | 7.2 | Kd | 63 | nM | CHEMBL_ACT_17896168 |
| RAF1 | 7.03 | IC50 | 94 | nM | CHEMBL_ACT_26027102 |
| BRAF | 7.03 | IC50 | 94.2 | nM | CHEMBL_ACT_26027116 |
| ABL2 | 7 | Kd | 99 | nM | CHEMBL_ACT_17878719 |
| MAP2K4 | 6.84 | Kd | 146 | nM | CHEMBL_ACT_17911060 |
| FRK | 6.76 | Kd | 172 | nM | CHEMBL_ACT_17903825 |
| DDR2 | 6.64 | Kd | 227 | nM | CHEMBL_ACT_17896428 |
| WEE1 | 6.6 | Kd | 252 | nM | CHEMBL_ACT_17947914 |
| BCR | 6.53 | Kd | 296 | nM | CHEMBL_ACT_17884741 |
| MAPK14 | 6.45 | Kd | 358 | nM | CHEMBL_ACT_17915379 |
| MAP3K20 | 6.35 | Kd | 450 | nM | CHEMBL_ACT_17948596 |
| ABL1 | 6.3 | Kd | 498 | nM | CHEMBL_ACT_17878461 |
| RAF1 | 6.3 | IC50 | 495 | nM | CHEMBL_ACT_26027125 |
| BRAF | 6.2 | IC50 | 633 | nM | CHEMBL_ACT_26027107 |
| MAPK11 | 6.17 | Kd | 684 | nM | CHEMBL_ACT_17915107 |
| EPHA2 | 6.09 | Kd | 807 | nM | CHEMBL_ACT_17899527 |
| CLK1 | 6.03 | Kd | 942 | nM | CHEMBL_ACT_17892304 |
| LIMK1 | 5.99 | Kd | 1021 | nM | CHEMBL_ACT_17909719 |
| EPHA1 | 5.97 | Kd | 1067 | nM | CHEMBL_ACT_17899268 |
| TGFBR2 | 5.79 | Kd | 1641 | nM | CHEMBL_ACT_17944942 |
| RIPK3 | 5.75 | Kd | 1800 | nM | CHEMBL_ACT_17935571 |
| MAP3K1 | 5.68 | Kd | 2090 | nM | CHEMBL_ACT_17911666 |
| DYRK1A | 5.49 | Kd | 3218 | nM | CHEMBL_ACT_17898214 |
| EPHB6 | 5.48 | Kd | 3344 | nM | CHEMBL_ACT_17901243 |
| BRAF | 5.42 | Kd | 3772 | nM | CHEMBL_ACT_17885959 |
| MYLK | 5.36 | Kd | 4406 | nM | CHEMBL_ACT_17919928 |
| EPHB4 | 5.03 | Kd | 9434 | nM | CHEMBL_ACT_17900996 |
Target pathways
Aggregated over 1 target gene(s): BRAF.
Top Reactome pathways
39 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Spry regulation of FGF signaling | 1 | BRAF |
| Signal Transduction | 1 | BRAF |
| Disease | 1 | BRAF |
| Signaling by NTRKs | 1 | BRAF |
| Prolonged ERK activation events | 1 | BRAF |
| Frs2-mediated activation | 1 | BRAF |
| ARMS-mediated activation | 1 | BRAF |
| Signaling by NTRK1 (TRKA) | 1 | BRAF |
| Signalling to ERKs | 1 | BRAF |
| Signalling to p38 via RIT and RIN | 1 | BRAF |
| Signaling by FGFR | 1 | BRAF |
| Negative regulation of FGFR1 signaling | 1 | BRAF |
| Negative regulation of FGFR2 signaling | 1 | BRAF |
| Negative regulation of FGFR3 signaling | 1 | BRAF |
| Negative regulation of FGFR4 signaling | 1 | BRAF |
| Signaling by FGFR1 | 1 | BRAF |
| Signaling by FGFR2 | 1 | BRAF |
| Signaling by FGFR3 | 1 | BRAF |
| Signaling by FGFR4 | 1 | BRAF |
| Diseases of signal transduction by growth factor receptors and second messengers | 1 | BRAF |
| RAF activation | 1 | BRAF |
| RAF/MAP kinase cascade | 1 | BRAF |
| MAP2K and MAPK activation | 1 | BRAF |
| Negative feedback regulation of MAPK pathway | 1 | BRAF |
| Negative regulation of MAPK pathway | 1 | BRAF |
| MAPK family signaling cascades | 1 | BRAF |
| MAPK1/MAPK3 signaling | 1 | BRAF |
| Signaling by moderate kinase activity BRAF mutants | 1 | BRAF |
| Signaling by high-kinase activity BRAF mutants | 1 | BRAF |
| Signaling by RAS mutants | 1 | BRAF |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| MAPK cascade | 1 |
| myeloid progenitor cell differentiation | 1 |
| protein phosphorylation | 1 |
| epidermal growth factor receptor signaling pathway | 1 |
| visual learning | 1 |
| animal organ morphogenesis | 1 |
| positive regulation of gene expression | 1 |
| negative regulation of fibroblast migration | 1 |
| positive regulation of D-glucose transmembrane transport | 1 |
| synaptic vesicle exocytosis | 1 |
| thyroid gland development | 1 |
| T cell differentiation in thymus | 1 |
| positive regulation of peptidyl-serine phosphorylation | 1 |
| substrate adhesion-dependent cell spreading | 1 |
| somatic stem cell population maintenance | 1 |
Indications & clinical
Indications
14 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| glioma | 4 | MONDO:0021042 | MONDO:0021637 |
| craniopharyngioma | 2 | MONDO:0018907 | EFO:1000209 |
| Langerhans cell histiocytosis | 2 | MONDO:0018310 | EFO:1000318 |
| neoplasm | 2 | MONDO:0005070 | EFO:0000616 |
| metastatic melanoma | 1 | MONDO:0005191 | EFO:0002617 |
| melanoma | 1 | MONDO:0005105 | EFO:0000756 |
| thyroid gland papillary carcinoma | 1 | MONDO:0005075 | EFO:0000641 |
| exocrine pancreatic carcinoma | 1 | MONDO:0005192 | EFO:0002618 |
| non-small cell lung carcinoma | 1 | MONDO:0005233 | EFO:0003060 |
| astrocytoma (excluding glioblastoma) | 1 | MONDO:0019781 | MONDO:0016691 |
| adenocarcinoma | 1 | MONDO:0004970 | EFO:0000228 |
| colorectal neoplasm | 1 | MONDO:0005335 | MONDO:0005575 |
2 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 15.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE1 | 6 |
| PHASE2 | 5 |
| PHASE3 | 1 |
| PHASE1/PHASE2 | 1 |
| EARLY_PHASE1 | 1 |
| Not specified | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT05566795 | PHASE3 | ACTIVE_NOT_RECRUITING | DAY101 vs. Standard of Care Chemotherapy in Pediatric Participants With Low-Grade Glioma Requiring First-Line Systemic Therapy (LOGGIC/FIREFLY-2) |
| NCT04775485 | PHASE2 | RECRUITING | A Study to Evaluate Tovorafenib in Pediatric and Young Adult Participants With Relapsed or Progressive Low-Grade Glioma and Advance Solid Tumors |
| NCT05465174 | PHASE2 | RECRUITING | Tovorafenib for Treatment of Craniopharyngioma in Children and Young Adults |
| NCT05828069 | PHASE2 | RECRUITING | A Study With Tovorafenib (DAY101) as a Treatment Option for Progressive, Relapsed, or Refractory Langerhans Cell Histiocytosis |
| NCT06965114 | PHASE1/PHASE2 | RECRUITING | Testing the Combination of Anti-cancer Drugs, Tovorafenib Plus Rituximab, in Patients With Hairy Cell Leukemia |
| NCT07206849 | PHASE2 | NOT_YET_RECRUITING | Study of Tovorafenib in High-Grade Glioma and Diffuse Intrinsic Pontine Glioma (DIPG) |
| NCT04985604 | PHASE2 | TERMINATED | Tovorafenib (DAY101) Monotherapy for Patients With Melanoma and Other Solid Tumors |
| NCT07441707 | PHASE1 | RECRUITING | A Study to Assess a Medicine Called Tovorafenib in Japanese Children and Young Adults With Brain Tumours |
| NCT01425008 | PHASE1 | COMPLETED | Study of MLN2480 in Participants With Relapsed or Refractory Solid Tumors Followed by a Dose Expansion in Participants With Metastatic Melanoma |
| NCT02327169 | PHASE1 | COMPLETED | A Study MLN2480 in Combination With MLN0128 or Alisertib, or Paclitaxel, or Cetuximab, or Irinotecan in Adult Participants With Advanced Nonhematologic Malignancies |
| NCT02723006 | PHASE1 | TERMINATED | Study to Evaluate the Safety, Tolerability, and Pharmacodynamics of Investigational Treatments in Combination With Standard of Care Immune Checkpoint Inhibitors in Participants With Advanced Melanoma |
| NCT03429803 | PHASE1 | COMPLETED | DAY101 In Gliomas and Other Tumors |
| NCT07121829 | PHASE1 | TERMINATED | Tovorafenib (DAY101) or in Combination With Pimasertib for Participants With Melanoma and Other Solid Tumors |
| NCT06381570 | EARLY_PHASE1 | RECRUITING | Pilot Study of Vinblastine and Tovorafenib in Pediatric Patients With Recurrent/Progressive RAF Altered Low Grade Gliomas |
| NCT05760586 | Not specified | APPROVED_FOR_MARKETING | Expanded Access Program (EAP) for Tovorafenib (DAY101) in RAF-Altered, Relapsed or Refractory Low-Grade Glioma |
Clinical evidence (CIViC)
Variant × indication × effect (2 predictive associations from 2 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| BRAF V600 OR v::BRAF Fusion | Childhood Low-grade Glioma | Sensitivity/Response | Tovorafenib | CIViC A | EID12028 |
| BRAF V600E OR KIAA1549::BRAF Fusion | Childhood Low-grade Glioma | Sensitivity/Response | Tovorafenib | CIViC A | EID12016 |
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
47 molecules share ≥1 primary target. Top 47 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| GEFITINIB | ChEMBL + PubChem | Phase 4 (approved) | BRAF |
| PAZOPANIB | ChEMBL + PubChem | Phase 4 (approved) | BRAF |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | BRAF |
| ABEMACICLIB | ChEMBL | Phase 4 (approved) | BRAF |
| COBIMETINIB | ChEMBL | Phase 4 (approved) | BRAF |
| DABRAFENIB | ChEMBL | Phase 4 (approved) | BRAF |
| DASATINIB | ChEMBL | Phase 4 (approved) | BRAF |
| ENCORAFENIB | ChEMBL | Phase 4 (approved) | BRAF |
| ERLOTINIB | ChEMBL | Phase 4 (approved) | BRAF |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | BRAF |
| IMATINIB | ChEMBL | Phase 4 (approved) | BRAF |
| INFIGRATINIB | ChEMBL | Phase 4 (approved) | BRAF |
| NILOTINIB | ChEMBL | Phase 4 (approved) | BRAF |
| PONATINIB | ChEMBL | Phase 4 (approved) | BRAF |
| RUXOLITINIB | ChEMBL | Phase 4 (approved) | BRAF |
| SORAFENIB | ChEMBL | Phase 4 (approved) | BRAF |
| VEMURAFENIB | ChEMBL | Phase 4 (approved) | BRAF |
| AVUTOMETINIB | ChEMBL | Phase 3 | BRAF |
| MASITINIB | ChEMBL | Phase 3 | BRAF |
| MOTESANIB | ChEMBL | Phase 3 | BRAF |
| NAPORAFENIB | ChEMBL | Phase 3 | BRAF |
| QUERCETIN | ChEMBL | Phase 3 | BRAF |
| BAFETINIB | ChEMBL | Phase 2 | BRAF |
| BELVARAFENIB | ChEMBL | Phase 2 | BRAF |
| BRIMARAFENIB | ChEMBL | Phase 2 | BRAF |
| CEP-32496 | ChEMBL | Phase 2 | BRAF |
| DORAMAPIMOD | ChEMBL | Phase 2 | BRAF |
| ELLAGIC ACID | ChEMBL | Phase 2 | BRAF |
| EXARAFENIB | ChEMBL | Phase 2 | BRAF |
| FORETINIB | ChEMBL | Phase 2 | BRAF |
| LIFIRAFENIB | ChEMBL | Phase 2 | BRAF |
| MIRDAMETINIB | ChEMBL | Phase 2 | BRAF |
| PEXMETINIB | ChEMBL | Phase 2 | BRAF |
| R-406 | ChEMBL | Phase 2 | BRAF |
| RAF-265 | ChEMBL | Phase 2 | BRAF |
| REBASTINIB | ChEMBL | Phase 2 | BRAF |
| TG100-115 | ChEMBL | Phase 2 | BRAF |
| TINLORAFENIB | ChEMBL | Phase 2 | BRAF |
| XL-281 | ChEMBL | Phase 2 | BRAF |
| Afatinib | PubChem | Approved | BRAF |
| Binimetinib | PubChem | Approved | BRAF |
| Crizotinib | PubChem | Approved | BRAF |
| dacomitinib | PubChem | Approved | BRAF |
| Fostamatinib | PubChem | Approved | BRAF |
| Idelalisib | PubChem | Approved | BRAF |
| Selumetinib | PubChem | Approved | BRAF |
| Trametinib | PubChem | Approved | BRAF |
Related Atlas pages
- Genes: BRAF
- Diseases: glioma, childhood low-grade glioma
- Drugs: Gefitinib, Pazopanib, Regorafenib, Abemaciclib, Cobimetinib, Dabrafenib, Dasatinib, Encorafenib, Erlotinib, Fedratinib, Imatinib, Infigratinib, Nilotinib, Ponatinib, Ruxolitinib, Sorafenib, Vemurafenib, Avutometinib, Masitinib, Motesanib, Naporafenib, Quercetin, Afatinib, Binimetinib, Crizotinib, dacomitinib, Fostamatinib, Idelalisib, Selumetinib, Trametinib