Trametinib
drugOn this page
Also known as GSK-1120212GSK1120212JTP 74057JTP-74057MekinistTMT-212Tmt212GSK1120212BTRAMETINIB DIMETHYL SULFOXIDECPD 8BGSK 1120212TRAMETINIB (GSK1120212)SID137276024
Summary
Trametinib (CHEMBL2103875) is an approved small-molecule EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (ATC L01EE01) targeting MAP2K1 and MAP2K2; indicated across 52 conditions including neoplasm and melanoma; with CIViC clinical evidence for 134 variant-indication associations (e.g. BRAF V600E in pleomorphic xanthoastrocytoma).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: L01EE01
- Targets: 2 (MAP2K1, MAP2K2)
- Indications: 52 conditions
- Clinical trials: 251
- Precision-oncology evidence (CIViC): 134 variant–indication associations
- Chemistry: 615.4 Da · C26H23FIN5O4
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL2103875 |
| Name | Trametinib |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 11707110 |
| ChEBI | CHEBI:75998 |
| ATC | L01EE01 |
| Molecular formula | C26H23FIN5O4 |
| Molecular weight | 615.4 |
| InChIKey | LIRYPHYGHXZJBZ-UHFFFAOYSA-N |
SMILES: CC1=C2C(=C(N(C1=O)C)NC3=C(C=C(C=C3)I)F)C(=O)N(C(=O)N2C4=CC=CC(=C4)NC(=O)C)C5CC5
IUPAC name: N-[3-[3-cyclopropyl-5-(2-fluoro-4-iodoanilino)-6,8-dimethyl-2,4,7-trioxopyrido[4,3-d]pyrimidin-1-yl]phenyl]acetamide
ChEBI definition: A pyridopyrimidine that is used (as its dimethyl sulfoxide addition compound) for the treatment of patients with unresectable or metastatic melanoma with BRAF V600E or V600K mutations, and who have not received prior BRAF inhibitor treatment.
Pharmacological roles (ChEBI): EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor, antineoplastic agent, anticoronaviral agent, geroprotector.
Also known as: GSK-1120212, GSK1120212, JTP 74057, JTP-74057, Mekinist, TMT-212, Tmt212, TMT212, Trametinib, TRAMETINIB, GSK1120212B, TRAMETINIB DIMETHYL SULFOXIDE
Parent form; salt/anhydrous children: CHEMBL2105741
Patent coverage: 5,853 distinct patent families (14,034 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 13,631 (97%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| MAP2K1 | mitogen-activated protein kinase kinase 1 | Inhibition | 9.15 | 4.7% | Q02750 |
| MAP2K2 | mitogen-activated protein kinase kinase 2 | Inhibition | 8.74 | 3.1% | P36507 |
Broader ChEMBL bioactivity targets: 4 (assay-derived). Sample: Dual specificity mitogen-activated protein kinase kinase; MEK1/2, Dual specificity mitogen-activated protein kinase kinase 2, Dual specificity mitogen-activated protein kinase kinase 1, ATP-dependent translocase ABCB1.
Bioactivity
ChEMBL activities: 43 potent at pChembl ≥ 5 of 43 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| MAP2K1 | 9.32 | IC50 | 0.48 | nM | CHEMBL_ACT_25754167 |
| MAP2K2 | 9.32 | IC50 | 0.48 | nM | CHEMBL_ACT_25754177 |
| MAP2K1 | 9.28 | IC50 | 0.52 | nM | CHEMBL_ACT_25754168 |
| MAP2K2 | 9.28 | IC50 | 0.52 | nM | CHEMBL_ACT_25754178 |
| MAP2K1 | 9.15 | IC50 | 0.7 | nM | CHEMBL_ACT_19449815 |
| MAP2K1 | 9.04 | IC50 | 0.92 | nM | CHEMBL_ACT_24788473 |
| MAP2K1 | 9.04 | IC50 | 0.92 | nM | CHEMBL_ACT_24788639 |
| MAP2K2 | 9.04 | IC50 | 0.92 | nM | CHEMBL_ACT_25755755 |
| MAP2K2 | 8.8 | IC50 | 1.6 | nM | CHEMBL_ACT_13972310 |
| MAP2K2 | 8.8 | IC50 | 1.6 | nM | CHEMBL_ACT_25778537 |
| MAP2K2 | 8.74 | IC50 | 1.8 | nM | CHEMBL_ACT_24788474 |
| MAP2K2 | 8.74 | IC50 | 1.8 | nM | CHEMBL_ACT_24788642 |
| MAP2K1 | 8.74 | IC50 | 1.8 | nM | CHEMBL_ACT_25755754 |
| MAP2K2 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_24789081 |
| MAP2K2 | 8.67 | IC50 | 2.16 | nM | CHEMBL_ACT_29048786 |
| MAP2K1 | 8.66 | IC50 | 2.2 | nM | CHEMBL_ACT_25754176 |
| MAP2K2 | 8.66 | IC50 | 2.2 | nM | CHEMBL_ACT_25754186 |
| MAP2K1 | 8.64 | IC50 | 2.3 | nM | CHEMBL_ACT_25754174 |
| MAP2K2 | 8.64 | IC50 | 2.3 | nM | CHEMBL_ACT_25754184 |
| MAP2K1 | 8.47 | IC50 | 3.4 | nM | CHEMBL_ACT_13972311 |
| MAP2K1 | 8.47 | IC50 | 3.4 | nM | CHEMBL_ACT_25778535 |
| MAP2K1 | 8.39 | IC50 | 4.1 | nM | CHEMBL_ACT_25754172 |
| MAP2K2 | 8.39 | IC50 | 4.1 | nM | CHEMBL_ACT_25754182 |
| MAP2K1 | 8.24 | IC50 | 5.7 | nM | CHEMBL_ACT_25754171 |
| MAP2K2 | 8.24 | IC50 | 5.7 | nM | CHEMBL_ACT_25754181 |
| MAP2K1 | 8.07 | IC50 | 8.5 | nM | CHEMBL_ACT_25754173 |
| MAP2K2 | 8.07 | IC50 | 8.5 | nM | CHEMBL_ACT_25754183 |
| MAP2K2 | 8.05 | Kd | 9 | nM | CHEMBL_ACT_17910570 |
| MAP2K2 | 7.9 | IC50 | 12.7 | nM | CHEMBL_ACT_26329357 |
| MAP2K2 | 7.83 | IC50 | 14.9 | nM | CHEMBL_ACT_19449816 |
Target pathways
Aggregated over 2 target gene(s): MAP2K1, MAP2K2.
Top Reactome pathways
62 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| RAF-independent MAPK1/3 activation | 2 | MAP2K1, MAP2K2 |
| Developmental Biology | 2 | MAP2K1, MAP2K2 |
| Signal Transduction | 2 | MAP2K1, MAP2K2 |
| Disease | 2 | MAP2K1, MAP2K2 |
| Signaling by NTRKs | 2 | MAP2K1, MAP2K2 |
| Prolonged ERK activation events | 2 | MAP2K1, MAP2K2 |
| Frs2-mediated activation | 2 | MAP2K1, MAP2K2 |
| Signaling by NTRK1 (TRKA) | 2 | MAP2K1, MAP2K2 |
| Signalling to ERKs | 2 | MAP2K1, MAP2K2 |
| L1CAM interactions | 2 | MAP2K1, MAP2K2 |
| Axon guidance | 2 | MAP2K1, MAP2K2 |
| Signal transduction by L1 | 2 | MAP2K1, MAP2K2 |
| Uptake and function of anthrax toxins | 2 | MAP2K1, MAP2K2 |
| Uptake and actions of bacterial toxins | 2 | MAP2K1, MAP2K2 |
| Diseases of signal transduction by growth factor receptors and second messengers | 2 | MAP2K1, MAP2K2 |
| Infectious disease | 2 | MAP2K1, MAP2K2 |
| RAF activation | 2 | MAP2K1, MAP2K2 |
| RAF/MAP kinase cascade | 2 | MAP2K1, MAP2K2 |
| MAP2K and MAPK activation | 2 | MAP2K1, MAP2K2 |
| Negative feedback regulation of MAPK pathway | 2 | MAP2K1, MAP2K2 |
| Negative regulation of MAPK pathway | 2 | MAP2K1, MAP2K2 |
| MAPK family signaling cascades | 2 | MAP2K1, MAP2K2 |
| MAPK1/MAPK3 signaling | 2 | MAP2K1, MAP2K2 |
| Signaling by moderate kinase activity BRAF mutants | 2 | MAP2K1, MAP2K2 |
| Signaling by high-kinase activity BRAF mutants | 2 | MAP2K1, MAP2K2 |
| Signaling by RAS mutants | 2 | MAP2K1, MAP2K2 |
| Signaling by BRAF and RAF1 fusions | 2 | MAP2K1, MAP2K2 |
| Paradoxical activation of RAF signaling by kinase inactive BRAF | 2 | MAP2K1, MAP2K2 |
| Oncogenic MAPK signaling | 2 | MAP2K1, MAP2K2 |
| Signaling by Receptor Tyrosine Kinases | 2 | MAP2K1, MAP2K2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| MAPK cascade | 2 |
| heart development | 2 |
| positive regulation of gene expression | 2 |
| Schwann cell development | 2 |
| thyroid gland development | 2 |
| regulation of stress-activated MAPK cascade | 2 |
| ERBB2-ERBB3 signaling pathway | 2 |
| myelination | 2 |
| positive regulation of DNA-templated transcription | 2 |
| insulin-like growth factor receptor signaling pathway | 2 |
| thymus development | 2 |
| regulation of axon regeneration | 2 |
| positive regulation of axonogenesis | 2 |
| face development | 2 |
| trachea formation | 2 |
Indications & clinical
Indications
52 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| neoplasm | 4 | MONDO:0005070 | EFO:0000616 |
| melanoma | 3 | MONDO:0005105 | EFO:0000756 |
| cutaneous melanoma | 3 | MONDO:0005012 | EFO:0000389 |
| thyroid gland papillary carcinoma | 3 | MONDO:0005075 | EFO:0000641 |
| metastatic melanoma | 3 | MONDO:0005191 | EFO:0002617 |
| soft tissue sarcoma | 3 | MONDO:0018078 | EFO:1001968 |
| thyroid gland carcinoma | 3 | MONDO:0015075 | EFO:0002892 |
| acute myeloid leukemia | 2 | MONDO:0018874 | EFO:0000222 |
| non-small cell lung carcinoma | 2 | MONDO:0005233 | EFO:0003060 |
| metastatic prostate carcinoma | 2 | MONDO:0004956 | EFO:0000196 |
| oral cavity neoplasm | 2 | MONDO:0021245 | EFO:0003868 |
| hepatocellular carcinoma | 2 | MONDO:0007256 | EFO:0000182 |
| thyroid gland follicular carcinoma | 2 | MONDO:0005034 | EFO:0000501 |
| plasma cell myeloma | 2 | MONDO:0009693 | EFO:0001378 |
| exocrine pancreatic carcinoma | 2 | MONDO:0005192 | EFO:0002618 |
| Erdheim-Chester disease | 2 | MONDO:0018153 | EFO:1000926 |
| colorectal carcinoma | 2 | MONDO:0024331 | EFO:1001951 |
| colorectal adenocarcinoma | 2 | MONDO:0005008 | EFO:0000365 |
| breast neoplasm | 2 | MONDO:0021100 | MONDO:0007254 |
| lung neoplasm | 2 | MONDO:0021117 | MONDO:0008903 |
| epithelioid hemangioendothelioma | 2 | MONDO:0015523 | MONDO:0015523 |
| ameloblastoma | 2 | MONDO:0017795 | MONDO:0017795 |
| cholangiocarcinoma | 2 | MONDO:0019087 | EFO:0005221 |
| undifferentiated carcinoma | 2 | MONDO:0005617 | EFO:0006772 |
| histiocytosis | 2 | MONDO:0002637 | HP:0100727 |
| gastrointestinal stromal tumor | 2 | MONDO:0011719 | MONDO:0011719 |
| colonic neoplasm | 2 | MONDO:0005401 | MONDO:0021063 |
| triple-negative breast carcinoma | 2 | MONDO:0005494 | EFO:0005537 |
| craniopharyngioma | 2 | MONDO:0018907 | EFO:1000209 |
| breast carcinoma | 2 | MONDO:0004989 | EFO:0000305 |
| prostate carcinoma | 2 | MONDO:0005159 | EFO:0001663 |
| biliary tract neoplasm | 2 | MONDO:0005304 | EFO:0003891 |
| thyroid gland undifferentiated (anaplastic) carcinoma | 2 | MONDO:0006468 | EFO:1000595 |
| uveal melanoma | 2 | MONDO:0006486 | EFO:1000616 |
| colorectal neoplasm | 2 | MONDO:0005335 | MONDO:0005575 |
| arteriovenous malformations of the brain | 2 | MONDO:0007154 | Orphanet:46724 |
| leukemia | 1 | MONDO:0005059 | EFO:0000565 |
| rectal cancer | 1 | MONDO:0006519 | EFO:1000657 |
| lung adenocarcinoma | 1 | MONDO:0005061 | EFO:0000571 |
| bronchial neoplasm | 1 | MONDO:0002807 | EFO:1000849 |
| gastric neoplasm | 1 | MONDO:0021085 | MONDO:0001056 |
| glioma | 1 | MONDO:0021042 | MONDO:0100342 |
| amyotrophic lateral sclerosis | 1 | MONDO:0004976 | MONDO:0004976 |
| meningioma | 1 | MONDO:0016642 | MONDO:0016642 |
| rosacea | 1 | MONDO:0006604 | EFO:1000760 |
| pancreatic ductal adenocarcinoma | 1 | MONDO:0005184 | MONDO:0005184 |
6 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 251.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 108 |
| PHASE1 | 77 |
| PHASE1/PHASE2 | 31 |
| Not specified | 17 |
| PHASE3 | 11 |
| PHASE4 | 3 |
| PHASE2/PHASE3 | 2 |
| EARLY_PHASE1 | 2 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03340506 | PHASE4 | RECRUITING | Dabrafenib and/or Trametinib Rollover Study |
| NCT03975829 | PHASE4 | RECRUITING | Pediatric Long-Term Follow-up and Rollover Study |
| NCT07010393 | PHASE4 | NOT_YET_RECRUITING | Genotype-Driven Neoadjuvant Therapy for Locally Advanced Thyroid Cancer: A Real-World Cohort Study |
| NCT02224781 | PHASE3 | ACTIVE_NOT_RECRUITING | Dabrafenib and Trametinib Followed by Ipilimumab and Nivolumab or Ipilimumab and Nivolumab Followed by Dabrafenib and Trametinib in Treating Patients With Stage III-IV BRAFV600 Melanoma |
| NCT04940052 | PHASE3 | ACTIVE_NOT_RECRUITING | Study of Efficacy and Safety of Dabrafenib in Combination With Trametinib in Previously Treated Patients With Metastatic, Radio-active Iodine Refractory BRAF V600E Mutation Positive Differentiated Thyroid Cancer |
| NCT06346067 | PHASE3 | ACTIVE_NOT_RECRUITING | A Study to Assess Naporafenib (ERAS-254) Administered With Trametinib in Patients With NRAS-mutant Melanoma (SEACRAFT-2) |
| NCT06475989 | PHASE3 | RECRUITING | Study of Targeted Therapy vs. Chemotherapy in Patients With Thyroid Cancer |
| NCT07440290 | PHASE2/PHASE3 | NOT_YET_RECRUITING | DETERMINE Trial Treatment Arm 07: Dabrafenib in Combination With Trametinib in Adult, Paediatric and Teenage/Young Adult Patients With BRAF V600 Mutation-Positive Cancers. |
| NCT01245062 | PHASE3 | COMPLETED | GSK1120212 vs Chemotherapy in Advanced or Metastatic BRAF V600E/K Mutation-positive Melanoma |
| NCT01584648 | PHASE3 | COMPLETED | A Study Comparing Trametinib and Dabrafenib Combination Therapy to Dabrafenib Monotherapy in Subjects With BRAF-mutant Melanoma |
| NCT01597908 | PHASE3 | COMPLETED | Dabrafenib Plus Trametinib vs Vemurafenib Alone in Unresectable or Metastatic BRAF V600E/K Cutaneous Melanoma |
| NCT01682083 | PHASE3 | COMPLETED | Dabrafenib With Trametinib in the Adjuvant Treatment of High-risk BRAF V600 Mutation-positive Melanoma (COMBI-AD). |
| NCT02101788 | PHASE2/PHASE3 | COMPLETED | Trametinib in Treating Patients With Recurrent or Progressive Low-Grade Ovarian Cancer or Peritoneal Cavity Cancer |
| NCT02967692 | PHASE3 | TERMINATED | A Study of the Anti-PD1 Antibody PDR001, in Combination With Dabrafenib and Trametinib in Advanced Melanoma |
| NCT03551626 | PHASE3 | COMPLETED | Study of Dabrafenib+Trametinib in the Adjuvant Treatment of Stage III BRAF V600+ Melanoma After Complete Resection to Evaluate the Impact on Pyrexia Related Outcomes |
| NCT03784014 | PHASE3 | COMPLETED | Molecular Profiling of Advanced Soft-tissue Sarcomas |
| NCT01972347 | PHASE2 | ACTIVE_NOT_RECRUITING | Neoadjuvant Dabrafenib + Trametinib for AJCC Stage IIIB-C BRAF V600 Mutation Positive Melanoma |
| NCT01979523 | PHASE2 | ACTIVE_NOT_RECRUITING | Trametinib With or Without GSK2141795 in Treating Patients With Metastatic Uveal Melanoma |
| NCT01989585 | PHASE1/PHASE2 | ACTIVE_NOT_RECRUITING | Testing the Addition of Navitoclax to the Combination of Dabrafenib and Trametinib in People Who Have BRAF Mutant Melanoma |
| NCT01990196 | PHASE2 | ACTIVE_NOT_RECRUITING | Neoadjuvant Phase 2 Study Comparing the Effects of AR Inhibition With/Without SRC or MEK Inhibition in Prostate Cancer |
| NCT02079740 | PHASE1/PHASE2 | ACTIVE_NOT_RECRUITING | Trametinib and Navitoclax in Treating Patients With Advanced or Metastatic Solid Tumors |
| NCT02152995 | PHASE2 | ACTIVE_NOT_RECRUITING | Trametinib in Increasing Tumoral Iodine Incorporation in Patients With Recurrent or Metastatic Thyroid Cancer |
| NCT02196181 | PHASE2 | ACTIVE_NOT_RECRUITING | Testing Two Different Treatment Schedules of Dabrafenib and Trametinib for Skin Cancer Which Has Spread |
| NCT02231775 | PHASE2 | ACTIVE_NOT_RECRUITING | Dabrafenib and Trametinib Before and After Surgery in Treating Patients With Stage IIIB-C Melanoma With BRAF V600 Mutation |
| NCT02465060 | PHASE2 | ACTIVE_NOT_RECRUITING | Targeted Therapy Directed by Genetic Testing in Treating Patients With Advanced Refractory Solid Tumors, Lymphomas, or Multiple Myeloma (The MATCH Screening Trial) |
| NCT02642042 | PHASE2 | ACTIVE_NOT_RECRUITING | Trametinib and Docetaxel in Treating Patients With Recurrent or Stage IV KRAS Mutation Positive Non-small Cell Lung Cancer |
| NCT02881242 | PHASE2 | ACTIVE_NOT_RECRUITING | Trametinib in Treating Patients With Progressive Metastatic Hormone-Resistant Prostate Cancer |
| NCT02910700 | PHASE2 | ACTIVE_NOT_RECRUITING | Nivolumab With Trametinib and Dabrafenib, or Encorafenib and Binimetinib in Treating Patients With BRAF Mutated Metastatic or Unresectable Stage III-IV Melanoma |
| NCT02925234 | PHASE2 | RECRUITING | The Drug Rediscovery Protocol (DRUP Trial) |
| NCT03087071 | PHASE2 | ACTIVE_NOT_RECRUITING | Panitumumab With or Without Trametinib in Treating Patients With Stage IV Colorectal Cancer |
| NCT03149029 | PHASE2 | ACTIVE_NOT_RECRUITING | Abbreviated MAPK Targeted Therapy Plus Pembrolizumab in Melanoma |
| NCT03190915 | PHASE2 | ACTIVE_NOT_RECRUITING | Trametinib in Treating Patients With Relapsed or Refractory Juvenile Myelomonocytic Leukemia |
| NCT03225664 | PHASE1/PHASE2 | ACTIVE_NOT_RECRUITING | Trametinib and Pembrolizumab in Treating Patients With Recurrent Non-small Cell Lung Cancer That Is Metastatic, Unresectable, or Locally Advanced |
| NCT03363217 | PHASE2 | ACTIVE_NOT_RECRUITING | Trametinib for Pediatric Neuro-oncology Patients With Refractory Tumor and Activation of the MAPK/ERK Pathway. |
| NCT03563729 | PHASE2 | RECRUITING | Melanoma Metastasized to the Brain and Steroids |
| NCT03899155 | PHASE2 | RECRUITING | Pan Tumor Rollover Study |
| NCT03919071 | PHASE2 | ACTIVE_NOT_RECRUITING | Dabrafenib Combined With Trametinib After Radiation Therapy in Treating Patients With Newly-Diagnosed High-Grade Glioma |
| NCT04116541 | PHASE2 | RECRUITING | A Study Evaluating the Activity of Anti-cancer Treatments Targeting Tumor Molecular Alterations/Characteristics in Advanced / Metastatic Tumors. |
| NCT04201457 | PHASE1/PHASE2 | ACTIVE_NOT_RECRUITING | A Trial of Dabrafenib, Trametinib and Hydroxychloroquine for Patients With Recurrent LGG or HGG With a BRAF Aberration |
| NCT04238624 | PHASE2 | ACTIVE_NOT_RECRUITING | Study of Cemiplimab Combined With Dabrafenib and Trametinib in People With Anaplastic Thyroid Cancer |
Clinical evidence (CIViC)
Variant × indication × effect (134 predictive associations from 144 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| BRAF V600E | Pleomorphic Xanthoastrocytoma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC A | EID11312 +1 |
| BRAF V600 | Skin Melanoma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC A | EID1411 |
| BRAF V600E | Pilocytic Astrocytoma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC A | EID11313 |
| BRAF V600E | Solid Tumor | Sensitivity/Response | Trametinib + Dabrafenib | CIViC A | EID12161 |
| BRAF V600E | Low Grade Glioma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC A | EID12162 |
| BRAF V600E | Lung Non-small Cell Carcinoma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC A | EID3017 |
| BRAF V600E | Melanoma | Sensitivity/Response | Trametinib | CIViC B | EID2135 +2 |
| BRAF V600K | Melanoma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC B | EID6939 +2 |
| BRAF V600 | Melanoma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC B | EID6180 +1 |
| BRAF V600E | Cholangiocarcinoma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC B | EID7453 +1 |
| BRAF V600E | Melanoma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC B | EID6178 +1 |
| BRAF V600E | Melanoma | Sensitivity/Response | Trametinib + Dabrafenib | CIViC B | EID6938 +1 |
| KRAS Mutation | Lung Non-small Cell Carcinoma | Sensitivity/Response | Trametinib | CIViC B | EID1220 +1 |
| BRAF Non-V600 | Solid Tumor | Sensitivity/Response | Trametinib | CIViC B | EID7855 |
| BRAF V600 | Colorectal Cancer | Sensitivity/Response | Trametinib + Dabrafenib | CIViC B | EID1415 |
| BRAF V600 | Melanoma | Sensitivity/Response | Trametinib | CIViC B | EID1750 |
| BRAF V600 | Melanoma | Sensitivity/Response | Trametinib + Dabrafenib | CIViC B | EID93 |
| BRAF V600E | Cancer | Sensitivity/Response | Trametinib + Dabrafenib | CIViC B | EID11672 |
| BRAF V600E | Skin Melanoma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC B | EID3758 |
| BRAF V600E | Colorectal Cancer | Sensitivity/Response | Panitumumab + Dabrafenib + Trametinib | CIViC B | EID6123 |
| BRAF V600E | Colorectal Adenocarcinoma | Sensitivity/Response | Trametinib + Panitumumab | CIViC B | EID6124 |
| BRAF V600E | Anaplastic Thyroid Carcinoma | Sensitivity/Response | Dabrafenib + Trametinib | CIViC B | EID6975 |
| BRAF V600E | Biliary Tract Cancer | Sensitivity/Response | Dabrafenib + Trametinib | CIViC B | EID7264 |
| BRAF V600E | Ovarian Cancer | Sensitivity/Response | Trametinib + Dabrafenib | CIViC B | EID7454 |
| BRAF V600E | Papillary Thyroid Carcinoma | Sensitivity/Response | Trametinib + Dabrafenib | CIViC B | EID7762 |
| BRAF V600K | Melanoma | Sensitivity/Response | Trametinib | CIViC B | EID2506 |
| BRAF V600K | Skin Melanoma | Sensitivity/Response | Trametinib + Dabrafenib | CIViC B | EID4181 |
| BRAF V600K | Melanoma | Sensitivity/Response | Trametinib + Dabrafenib | CIViC B | EID6179 |
| BRAF V600R AND BRAF Non-V600 | Melanoma | Sensitivity/Response | Trametinib + Dabrafenib | CIViC B | EID11308 |
| GNAQ Mutation | Uveal Melanoma | Sensitivity/Response | Trametinib | CIViC B | EID1229 |
+104 more predictive associations (showing top 30 by level).
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (1) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of CPIC Guideline for chlorpropamide, dabrafenib, gliclazid | CPIC | G6PD |
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
71 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| BINIMETINIB | ChEMBL + PubChem | Phase 4 (approved) | MAP2K1, MAP2K2 |
| COBIMETINIB | ChEMBL + PubChem | Phase 4 (approved) | MAP2K1, MAP2K2 |
| FEDRATINIB | ChEMBL + PubChem | Phase 4 (approved) | MAP2K1, MAP2K2 |
| RUXOLITINIB | ChEMBL + PubChem | Phase 4 (approved) | MAP2K1, MAP2K2 |
| SELUMETINIB | ChEMBL + PubChem | Phase 4 (approved) | MAP2K1, MAP2K2 |
| SORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | MAP2K1, MAP2K2 |
| VANDETANIB | ChEMBL + PubChem | Phase 4 (approved) | MAP2K1, MAP2K2 |
| VEMURAFENIB | ChEMBL + PubChem | Phase 4 (approved) | MAP2K1, MAP2K2 |
| AXITINIB | ChEMBL | Phase 4 (approved) | MAP2K1, MAP2K2 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | MAP2K1, MAP2K2 |
| DASATINIB | ChEMBL | Phase 4 (approved) | MAP2K1, MAP2K2 |
| GILTERITINIB | ChEMBL | Phase 4 (approved) | MAP2K1, MAP2K2 |
| NERATINIB | ChEMBL | Phase 4 (approved) | MAP2K1, MAP2K2 |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | MAP2K1, MAP2K2 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | MAP2K1, MAP2K2 |
| AVUTOMETINIB | ChEMBL | Phase 3 | MAP2K1, MAP2K2 |
| CANERTINIB | ChEMBL | Phase 3 | MAP2K1, MAP2K2 |
| DOVITINIB | ChEMBL | Phase 3 | MAP2K1, MAP2K2 |
| LESTAURTINIB | ChEMBL | Phase 3 | MAP2K1, MAP2K2 |
| LINSITINIB | ChEMBL | Phase 3 | MAP2K1, MAP2K2 |
| ORANTINIB | ChEMBL | Phase 3 | MAP2K1, MAP2K2 |
| SARACATINIB | ChEMBL | Phase 3 | MAP2K1, MAP2K2 |
| CENISERTIB | ChEMBL | Phase 2 | MAP2K1, MAP2K2 |
| CEP-32496 | ChEMBL | Phase 2 | MAP2K1, MAP2K2 |
| CI-1040 | ChEMBL | Phase 2 | MAP2K1, MAP2K2 |
| DEFOSBARASERTIB | ChEMBL | Phase 2 | MAP2K1, MAP2K2 |
| FORETINIB | ChEMBL | Phase 2 | MAP2K1, MAP2K2 |
| ILORASERTIB | ChEMBL | Phase 2 | MAP2K1, MAP2K2 |
| MIRDAMETINIB | ChEMBL | Phase 2 | MAP2K1, MAP2K2 |
| PELITINIB | ChEMBL | Phase 2 | MAP2K1, MAP2K2 |
| PIMASERTIB | ChEMBL | Phase 2 | MAP2K1, MAP2K2 |
| R-406 | ChEMBL | Phase 2 | MAP2K1, MAP2K2 |
| REFAMETINIB | ChEMBL | Phase 2 | MAP2K1, MAP2K2 |
| SU-014813 | ChEMBL | Phase 2 | MAP2K1, MAP2K2 |
| TAK-733 | ChEMBL | Phase 2 | MAP2K1, MAP2K2 |
| TOZASERTIB | ChEMBL | Phase 2 | MAP2K1, MAP2K2 |
| Afatinib | PubChem | Approved | MAP2K1, MAP2K2 |
| Crizotinib | PubChem | Approved | MAP2K1, MAP2K2 |
| dacomitinib | PubChem | Approved | MAP2K1, MAP2K2 |
| Fostamatinib | PubChem | Approved | MAP2K1, MAP2K2 |
| Gefitinib | PubChem | Approved | MAP2K1, MAP2K2 |
| Idelalisib | PubChem | Approved | MAP2K1, MAP2K2 |
| Pazopanib | PubChem | Approved | MAP2K1, MAP2K2 |
| regorafenib | PubChem | Approved | MAP2K1, MAP2K2 |
| TOFACITINIB | ChEMBL | Phase 4 (approved) | MAP2K1 |
| CEDIRANIB | ChEMBL | Phase 3 | MAP2K2 |
| LINIFANIB | ChEMBL | Phase 3 | MAP2K2 |
| BIIB-091 | ChEMBL | Phase 2 | MAP2K2 |
| E-6201 | ChEMBL | Phase 2 | MAP2K1 |
| SCH-900776 | ChEMBL | Phase 2 | MAP2K2 |
| SOTRASTAURIN | ChEMBL | Phase 2 | MAP2K1 |
| TOLONIUM CHLORIDE | ChEMBL | Phase 2 | MAP2K1 |
| ZAPNOMETINIB | ChEMBL | Phase 2 | MAP2K1 |
| Baricitinib | PubChem | Approved | MAP2K2 |
| Cabozantinib | PubChem | Approved | MAP2K2 |
| Capivasertib | PubChem | Approved | MAP2K2 |
| Capmatinib | PubChem | Approved | MAP2K2 |
| Dabrafenib | PubChem | Approved | MAP2K2 |
| Entrectinib | PubChem | Approved | MAP2K2 |
| Erlotinib | PubChem | Approved | MAP2K2 |
Related Atlas pages
- Genes: MAP2K1, MAP2K2
- Diseases: neoplasm, melanoma, cutaneous melanoma, thyroid gland papillary carcinoma, metastatic melanoma, soft tissue sarcoma, thyroid gland carcinoma, pleomorphic xanthoastrocytoma, pilocytic astrocytoma, low grade glioma, cholangiocarcinoma, colorectal carcinoma, cancer, colorectal adenocarcinoma, thyroid gland undifferentiated (anaplastic) carcinoma, biliary tract cancer, ovarian carcinoma, uveal melanoma
- Drugs: Binimetinib, Cobimetinib, Fedratinib, Ruxolitinib, Selumetinib, Sorafenib, Vandetanib, Vemurafenib, Axitinib, Bosutinib, Dasatinib, Gilteritinib, Neratinib, Nintedanib, Sunitinib, Avutometinib, Canertinib, Dovitinib, Lestaurtinib, Linsitinib, Orantinib, Saracatinib, Afatinib, Crizotinib, dacomitinib, Fostamatinib, Gefitinib, Idelalisib, Pazopanib, regorafenib, Tofacitinib, Cediranib, Linifanib, Baricitinib, Cabozantinib, Capivasertib, Capmatinib, Dabrafenib, Entrectinib, Erlotinib
- Biomarker genes: ARAF, BRAF, DUSP6, ETV4, GNA11, GNAQ, GNAS, KRAS, NF1, NRAS, PDGFRA, RASA1