Tretinoin
drugOn this page
Also known as AberelActicinAll-trans retinoic acidAll-trans-retinoic acidAltrenoAtralinAvitaEudynaKerlocalNSC-122758Oristar rnaRenovaRetin aRetin-aRetin-a microRetin-a-microRetinoic acidTretinoin component of solageTretinoin component of tri-luma
Summary
Tretinoin (CHEMBL38) is an approved small-molecule keratolytic drug (ATC D10AD51) targeting RARA, RARB, and RARG; indicated across 45 conditions including acne and neoplasm; with CIViC clinical evidence for 12 variant-indication associations (e.g. PML::RARA Fusion in acute promyelocytic leukemia).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: D10AD51 (+2 more)
- Targets: 7 (RARA, RARB, RARG…)
- Indications: 45 conditions
- Clinical trials: 154
- Precision-oncology evidence (CIViC): 12 variant–indication associations
- Chemistry: 300.4 Da · C20H28O2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL38 |
| Name | Tretinoin |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 444795 |
| ChEBI | CHEBI:15367 |
| ATC | D10AD51, L01XF01, D10AD01 |
| Molecular formula | C20H28O2 |
| Molecular weight | 300.4 |
| InChIKey | SHGAZHPCJJPHSC-YCNIQYBTSA-N |
SMILES: CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C(=O)O)/C)/C
IUPAC name: (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid
ChEBI definition: A retinoic acid in which all four exocyclic double bonds have E- (trans-) geometry.
Pharmacological roles (ChEBI): keratolytic drug, antineoplastic agent, antioxidant, signalling molecule, retinoid X receptor agonist, anti-inflammatory agent, AP-1 antagonist, retinoic acid receptor agonist.
Other ChEBI roles (chemical / environmental): human metabolite.
Also known as: Aberel, Acticin, All-trans retinoic acid, All-trans-retinoic acid, Altreno, Atralin, Avita, Eudyna, Kerlocal, NSC-122758, Oristar rna, Renova
Parent form; salt/anhydrous children: CHEMBL2051965
Patent coverage: 55,679 distinct patent families (194,008 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| RARA | Retinoic acid receptor-α | Agonist | 7.77 | 0.8% | P10276 |
| RARB | Retinoic acid receptor-β | Agonist | 9.4 | 0.1% | P10826 |
| RARG | Retinoic acid receptor-γ | Agonist | 9.6 | 1.6% | P13631 |
| PPARD | Peroxisome proliferator-activated receptor-β/δ | Full agonist | 7.8 | 0.6% | Q03181 |
| RORB | RAR-related orphan receptor-β | Agonist | 0.1% | Q92753 | |
| NR2C2 | Testicular receptor 4 | Full agonist | 4.62 | 1.1% | P49116 |
| NR2E1 | TLX | Agonist | 5.74 | 0.5% | Q9Y466 |
Broader ChEMBL bioactivity targets: 51 (assay-derived). Sample: Microtubule-associated protein tau, Lysine-specific demethylase 4E, Nuclear receptor ROR-gamma, Survival motor neuron protein, ATP-dependent DNA helicase Q1, RecQ-like DNA helicase BLM, 4’-phosphopantetheinyl transferase ffp, Ferritin light chain, Geminin, Nuclear receptor ROR-gamma.
Bioactivity
ChEMBL activities: 237 potent at pChembl ≥ 5 of 265 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| RARG | 10.4 | Ki | 0.04 | nM | CHEMBL_ACT_657655 |
| RARA | 10 | Ki | 0.1 | nM | CHEMBL_ACT_194095 |
| RORB | 9.82 | IC50 | 0.15 | nM | CHEMBL_ACT_14551303 |
| RARG | 9.7 | Kd | 0.2 | nM | CHEMBL_ACT_1612380 |
| RARG | 9.7 | EC50 | 0.2 | nM | CHEMBL_ACT_2616029 |
| P18911 | 9.66 | EC50 | 0.22 | nM | CHEMBL_ACT_18488910 |
| RARG | 9.52 | Kd | 0.3 | nM | CHEMBL_ACT_755979 |
| RARB | 9.4 | Ki | 0.4 | nM | CHEMBL_ACT_194093 |
| P62965 | 9.4 | Kd | 0.4 | nM | CHEMBL_ACT_347449 |
| RXRA | 9.4 | Ki | 0.4 | nM | CHEMBL_ACT_663250 |
| RARB | 9.4 | Kd | 0.4 | nM | CHEMBL_ACT_755978 |
| P62965 | 9.4 | Kd | 0.4 | nM | CHEMBL_ACT_895116 |
| RARB | 9.3 | Ki | 0.5 | nM | CHEMBL_ACT_194092 |
| RARG | 9.3 | EC50 | 0.5 | nM | CHEMBL_ACT_207165 |
| RARG | 9.3 | EC50 | 0.5 | nM | CHEMBL_ACT_295012 |
| RARG | 9.3 | EC50 | 0.5 | nM | CHEMBL_ACT_324972 |
| RARG | 9.3 | IC50 | 0.5 | nM | CHEMBL_ACT_379663 |
| RARG | 9.3 | EC50 | 0.5 | nM | CHEMBL_ACT_499179 |
| RXRB | 9.3 | Ki | 0.5 | nM | CHEMBL_ACT_663251 |
| RARG | 9.3 | Ki | 0.5 | nM | CHEMBL_ACT_809836 |
| P22605 | 9.28 | EC50 | 0.52 | nM | CHEMBL_ACT_18488961 |
| P18911 | 9.22 | EC50 | 0.6 | nM | CHEMBL_ACT_19252171 |
| RARG | 9.22 | Ki | 0.6 | nM | CHEMBL_ACT_194096 |
| RARG | 9.21 | IC50 | 0.62 | nM | CHEMBL_ACT_41941 |
| RARG | 9.15 | EC50 | 0.7 | nM | CHEMBL_ACT_580466 |
| RARG | 9.15 | Ki | 0.7 | nM | CHEMBL_ACT_75533 |
| RARG | 9.15 | EC50 | 0.7 | nM | CHEMBL_ACT_854885 |
| RARA | 9.11 | IC50 | 0.78 | nM | CHEMBL_ACT_379661 |
| RARB | 9.05 | IC50 | 0.9 | nM | CHEMBL_ACT_379662 |
| RARA | 9.05 | IC50 | 0.89 | nM | CHEMBL_ACT_41939 |
Target pathways
Aggregated over 7 target gene(s): RARA, RARB, RARG, PPARD, RORB, NR2C2, NR2E1.
Top Reactome pathways
13 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Nuclear Receptor transcription pathway | 7 | NR2C2, NR2E1, PPARD, RARA, RARB, RARG, RORB |
| Signaling by Retinoic Acid | 4 | PPARD, RARA, RARB, RARG |
| Activation of anterior HOX genes in hindbrain development during early embryogenesis | 3 | RARA, RARB, RARG |
| Carnitine shuttle | 1 | PPARD |
| Generic Transcription Pathway | 1 | RORB |
| SUMOylation of intracellular receptors | 1 | RARA |
| RNA Polymerase II Transcription | 1 | RORB |
| Gene expression (Transcription) | 1 | RORB |
| Regulation of PTEN gene transcription | 1 | NR2E1 |
| Transcriptional regulation of granulopoiesis | 1 | RARA |
| TGFBR3 expression | 1 | RARA |
| Expression of BMAL (ARNTL), CLOCK, and NPAS2 | 1 | RORB |
| Interaction of NuRD complexes with transcription factors | 1 | NR2C2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| positive regulation of transcription by RNA polymerase II | 7 |
| regulation of DNA-templated transcription | 7 |
| negative regulation of transcription by RNA polymerase II | 6 |
| cell differentiation | 6 |
| negative regulation of apoptotic process | 4 |
| apoptotic process | 4 |
| cell population proliferation | 4 |
| intracellular receptor signaling pathway | 4 |
| glandular epithelial cell development | 3 |
| growth plate cartilage development | 3 |
| positive regulation of cell population proliferation | 3 |
| regulation of myelination | 3 |
| multicellular organism growth | 3 |
| negative regulation of DNA-templated transcription | 3 |
| positive regulation of DNA-templated transcription | 3 |
Indications & clinical
Indications
45 indications (5 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| acne | 4 | MONDO:0011438 | EFO:0003894 |
| neoplasm | 4 | MONDO:0005070 | EFO:0000616 |
| acute promyelocytic leukemia | 4 | MONDO:0012883 | EFO:0000224 |
| acute myeloid leukemia | 3 | MONDO:0018874 | EFO:0000222 |
| rosacea | 3 | MONDO:0006604 | EFO:1000760 |
| myelodysplastic syndrome | 3 | MONDO:0018881 | EFO:0000198 |
| leukemia | 3 | MONDO:0005059 | EFO:0000565 |
| squamous cell carcinoma | 3 | MONDO:0005096 | EFO:0000707 |
| non-small cell lung carcinoma | 3 | MONDO:0005233 | EFO:0003060 |
| basal cell carcinoma | 3 | MONDO:0020804 | EFO:0004193 |
| autoimmune thrombocytopenic purpura | 3 | MONDO:0008558 | EFO:0007160 |
| breast neoplasm | 3 | MONDO:0021100 | EFO:0003869 |
| skin neoplasm | 3 | MONDO:0002531 | EFO:0004198 |
| lymphoma | 2 | MONDO:0005062 | EFO:0000574 |
| plasma cell myeloma | 2 | MONDO:0009693 | EFO:0001378 |
| cutaneous melanoma | 2 | MONDO:0005012 | EFO:0000389 |
| neuroblastoma | 2 | MONDO:0005072 | EFO:0000621 |
| small cell lung carcinoma | 2 | MONDO:0008433 | EFO:0000702 |
| melanoma | 2 | MONDO:0005105 | EFO:0000756 |
| actinic keratosis | 2 | MONDO:0005173 | EFO:0002496 |
| sclerosing cholangitis | 2 | MONDO:0018646 | EFO:0004268 |
| anti-neutrophil antibody associated vasculitis | 2 | MONDO:0005435 | EFO:0004826 |
| adenoid cystic carcinoma | 2 | MONDO:0004971 | EFO:0000231 |
| prostate adenocarcinoma | 2 | MONDO:0005082 | EFO:0000673 |
| pulmonary emphysema | 2 | MONDO:0004849 | EFO:0000464 |
| exocrine pancreatic carcinoma | 2 | MONDO:0005192 | EFO:0002618 |
| anemia | 2 | MONDO:0002280 | MONDO:0002280 |
| kidney cancer | 2 | MONDO:0002367 | MONDO:0002367 |
| lung neoplasm | 2 | MONDO:0021117 | MONDO:0008903 |
| severe acute respiratory syndrome | 2 | MONDO:0005091 | MONDO:0100096 |
| colorectal neoplasm | 2 | MONDO:0005335 | MONDO:0005575 |
| hematopoietic and lymphoid system neoplasm | 1 | MONDO:0002334 | MONDO:0044881 |
| myelodysplastic/myeloproliferative disease | 1 | MONDO:0020077 | MONDO:0020077 |
| amyotrophic lateral sclerosis | 1 | MONDO:0004976 | MONDO:0004976 |
| plasma cell neoplasm | 1 | MONDO:0004959 | EFO:0000200 |
| glioblastoma | 1 | MONDO:0018177 | EFO:0000519 |
| autism | 0 | MONDO:0005260 | EFO:0003758 |
8 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 154.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 59 |
| PHASE3 | 28 |
| Not specified | 15 |
| PHASE1/PHASE2 | 14 |
| PHASE1 | 14 |
| PHASE4 | 11 |
| PHASE2/PHASE3 | 7 |
| EARLY_PHASE1 | 6 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00408278 | PHASE4 | COMPLETED | Treatment of Newly Diagnosed Patients With Acute Promyelocytic Leukemia (PETHEMA LPA 2005) |
| NCT00504764 | PHASE4 | COMPLETED | Treatment of Relapsed Promyelocytic Leukemia With Arsenic Trioxide (ATO) |
| NCT00835198 | PHASE4 | COMPLETED | Dapsone Gel 5% and Tretinoin Gel 0.025% Versus Tretinoin Gel 0.025% Monotherapy for Facial Acne Vulgaris |
| NCT01047189 | PHASE4 | COMPLETED | Adherence to Study Medication Compared to Generic Topical Clindamycin Plus Generic Topical Tretinoin in Subjects With Mild to Moderate Acne Vulgaris |
| NCT01206348 | PHASE4 | COMPLETED | Combination Treatment for Moderate to Severe Acne |
| NCT01987297 | PHASE4 | UNKNOWN | Combined Retinoic Acid,Arsenic Trioxide and Chemo for Newly-diagnosed APL |
| NCT02020161 | PHASE4 | UNKNOWN | Clinical Guidelines for APL Treatment |
| NCT02200978 | PHASE4 | COMPLETED | A Study for Improving the Outcome of Childhood Acute Promyeloid Leukemia |
| NCT04096742 | PHASE4 | UNKNOWN | Altreno for Chest Rejuvenation |
| NCT04548349 | PHASE4 | COMPLETED | Profiling the Skin Microbiome in Response to Altreno in Acne Patients |
| NCT07012811 | PHASE4 | COMPLETED | Treatment of Plane Warts With Topical and Oral Retinoids |
| NCT02339740 | PHASE3 | ACTIVE_NOT_RECRUITING | Tretinoin and Arsenic Trioxide in Treating Patients With Untreated Acute Promyelocytic Leukemia |
| NCT06706401 | PHASE3 | RECRUITING | Lymphocyte-Sparing And Radio-Immunotherapy in Head and Neck Carcinoma |
| NCT06787222 | PHASE2/PHASE3 | ACTIVE_NOT_RECRUITING | Effectiveness and Safety of Zingiber Officinale Transdermal Patch for Acne Vulgaris; Study of Interleukin 1 and Skin Microbiome |
| NCT07278908 | PHASE2/PHASE3 | NOT_YET_RECRUITING | Avatrombopag Combined With All-trans Retinoic Acid in the Treatment of Primary Immune Thrombocytopenia |
| NCT07503730 | PHASE3 | RECRUITING | Early Use of Realgar-Indigo Naturalis Formula (RIF) Combined With All-trans Retinoic Acid (ATRA) for Treating Acute Promyelocytic Leukemia (APL). |
| NCT07504458 | PHASE3 | RECRUITING | Pivotal Open-label Phase 3 Clinical Study of QTX-2101 in Adult Patients With Acute Promyelocytic Leukemia |
| NCT00002658 | PHASE3 | UNKNOWN | Combination Chemotherapy, Biological Therapy, and Bone Marrow Transplantation in Treating Patients With Acute Myeloid Leukemia |
| NCT00002701 | PHASE3 | UNKNOWN | Combination Chemotherapy With or Without Bone Marrow Transplantation in Treating Patients With Acute Promyelocytic Leukemia |
| NCT00003934 | PHASE3 | COMPLETED | Tretinoin, Cytarabine, and Daunorubicin Hydrochloride With or Without Arsenic Trioxide Followed by Tretinoin With or Without Mercaptopurine and Methotrexate in Treating Patients With Acute Promyelocytic Leukemia |
| NCT00005823 | PHASE3 | COMPLETED | Intensive Compared With Nonintensive Chemotherapy in Treating Older Patients With Acute Myeloid Leukemia or Myelodysplastic Syndrome |
| NCT00005863 | PHASE3 | COMPLETED | Combination Chemotherapy With or Without Filgrastim and/or Tretinoin in Treating Patients With Acute Myeloid Leukemia |
| NCT00007631 | PHASE3 | COMPLETED | Determine the Efficacy of Topical Tretinoin Cream for the Prevention of Nonmelanoma Skin Cancer |
| NCT00151242 | PHASE2/PHASE3 | COMPLETED | Study on All-Trans Retinoic Acid, Induction and Consolidation Therapy, and Pegfilgrastim After Consolidation Therapy in Younger Patients With Newly Diagnosed Acute Myeloid Leukemia |
| NCT00151255 | PHASE3 | COMPLETED | All-Trans Retinoic Acid in Combination With Standard Induction and Consolidation Therapy in Older Patients With Newly Diagnosed Acute Myeloid Leukemia |
| NCT00378365 | PHASE3 | UNKNOWN | Acute Promyelocytic Leukemia 2006 (APL) |
| NCT00482833 | PHASE3 | COMPLETED | Phase III Trial in Acute Promyelocytic Leukemia Patients |
| NCT00492856 | PHASE3 | COMPLETED | S0521, Combination Chemotherapy With or Without Gemtuzumab Followed By Tretinoin, Mercaptopurine, and Methotrexate or Observation in Treating Patients With Acute Promyelocytic Leukemia |
| NCT00599937 | PHASE3 | COMPLETED | APL93: Timing of CxT and Role of Maintenance |
| NCT00647556 | PHASE3 | COMPLETED | Adapalene Gel 0.3% Versus Tretinoin 0.05% Emollient Cream for Treatment of Photodamage |
| NCT00717652 | PHASE2/PHASE3 | SUSPENDED | Efficiency And Safety Of Association Arbutin, Triamcinolone And Tretinoin In Treatment Of Melasma |
| NCT00866918 | PHASE3 | COMPLETED | Combination Chemotherapy in Treating Young Patients With Newly Diagnosed Acute Promyelocytic Leukemia |
| NCT01041833 | PHASE3 | UNKNOWN | Effect of All-trans Retinoic Acid With Chemotherapy Based on Paclitaxel and Cisplatin As First-line Treatment of Patients With Advanced Non-small Cell Lung Cancer and Expression of RAR-alfa and RAR-beta as Response Biomarker |
| NCT01067274 | PHASE3 | WITHDRAWN | ALFA-0703 Study in Older Patients With Acute Myeloblastic Leukemia (AML) |
| NCT01226303 | PHASE3 | UNKNOWN | Treatment Study for Children and Adolescents With Acute Promyelocitic Leukemia |
| NCT01243450 | PHASE3 | COMPLETED | Bioequivalence Study of Generic Tretinoin 0.04% Microsphere Gel, 0.04% Retin-A Micro® and Placebo |
| NCT01406080 | PHASE3 | COMPLETED | A Comparative Study of Adapalene Gel,0.3% Versus Tretinoin Emollient Cream, 0.05% for the Treatment of Photoaging |
| NCT02249767 | PHASE3 | COMPLETED | Bioequivalence Study of Tretinoin Gel 0.05% to Brand Tretinoin Gel |
| NCT02688140 | PHASE3 | COMPLETED | Study for Patients With Newly Diagnosed, High-risk Acute Promyelocytic Leukemia |
| NCT02899169 | PHASE3 | UNKNOWN | Treatment of Non-high-risk Acute Promyelocytic Leukemia (APL) With Realgar-Indigo Naturalis Formula (RIF) |
Clinical evidence (CIViC)
Variant × indication × effect (12 predictive associations from 14 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| PML::RARA Fusion | Acute Promyelocytic Leukemia | Sensitivity/Response | Arsenic Trioxide + Tretinoin | CIViC A | EID1091 |
| NPM1 EXON 11 MUTATION | Acute Myeloid Leukemia | Sensitivity/Response | Tretinoin | CIViC B | EID137 +1 |
| PML::RARA Fusion | Acute Promyelocytic Leukemia | Sensitivity/Response | Tretinoin | CIViC B | EID316 +1 |
| CEBPA Mutation | Acute Myeloid Leukemia | Sensitivity/Response | Tretinoin | CIViC B | EID122 |
| FLT3 ITD | Acute Promyelocytic Leukemia | Resistance | Anthracycline Antineoplastic Antibiotic + Tretinoin | CIViC B | EID1112 |
| FLT3 ITD | Acute Myeloid Leukemia | Resistance | Tretinoin | CIViC B | EID127 |
| PML B2 DOMAIN MUTATION | Acute Promyelocytic Leukemia | Resistance | Tretinoin | CIViC B | EID1092 |
| PML K227_T233del | Acute Promyelocytic Leukemia | Resistance | Tamibarotene + Tretinoin | CIViC C | EID8175 |
| PML::RARA Fusion AND PML A216V | Acute Promyelocytic Leukemia | Resistance | Tretinoin | CIViC C | EID1093 |
| PML::RARA Fusion AND PML L218P | Acute Promyelocytic Leukemia | Resistance | Tretinoin | CIViC C | EID1094 |
| ALDH1A2 Underexpression | Head And Neck Squamous Cell Carcinoma | Sensitivity/Response | Tretinoin | CIViC D | EID1115 |
| NPM1 EXON 11 MUTATION | Acute Myeloid Leukemia | Sensitivity/Response | NSC348884 + Tretinoin | CIViC D | EID149 |
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
72 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Rosiglitazone | ChEMBL + PubChem | Phase 4 (approved) | PPARD, RARA, RARB, RARG |
| Sunitinib | PubChem | Approved | NR2C2, RARA, RARB, RARG |
| Acetaminophen | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| ADAPALENE | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| ALITRETINOIN | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| Alprostadil | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| Amoxicillin | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| BEXAROTENE | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| cyclosporine | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| Olanzapine | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| TAZAROTENE | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| Tolcapone | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| TRIFAROTENE | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| Zafirlukast | ChEMBL + PubChem | Phase 4 (approved) | RARA, RARB, RARG |
| TAMIBAROTENE | ChEMBL | Phase 4 (approved) | RARA, RARB, RARG |
| CONESSINE | ChEMBL | Phase 2 | RARA, RARB, RARG |
| GLIQUIDONE | ChEMBL | Phase 2 | RARA, RARB, RARG |
| Atorvastatin | PubChem | Approved | RARA, RARB, RARG |
| Bosentan | PubChem | Approved | RARA, RARB, RARG |
| Calcitriol | PubChem | Approved | RARA, RARB, RARG |
| Carprofen | PubChem | Approved | RARA, RARB, RARG |
| Diclofenac | PubChem | Approved | RARA, RARB, RARG |
| ethinyl estradiol | PubChem | Approved | RARA, RARB, RARG |
| Repaglinide | PubChem | Approved | RARA, RARB, RARG |
| rifampin | PubChem | Approved | RARA, RARB, RARG |
| Simvastatin | PubChem | Approved | RARA, RARB, RARG |
| Ticlopidine | PubChem | Approved | RARA, RARB, RARG |
| Verapamil | PubChem | Approved | RARA, RARB, RARG |
| TROGLITAZONE | ChEMBL | Phase 4 (approved) | RARB, RARG |
| Retinol | PubChem | Approved | NR2C2, RARA |
| Rivaroxaban | PubChem | Approved | RARB, RARG |
| CAFFEINE | ChEMBL + PubChem | Phase 4 (approved) | NR2E1 |
| PROPAFENONE | ChEMBL + PubChem | Phase 4 (approved) | NR2E1 |
| PROPRANOLOL | ChEMBL + PubChem | Phase 4 (approved) | NR2E1 |
| SELADELPAR | ChEMBL + PubChem | Phase 4 (approved) | PPARD |
| TADALAFIL | ChEMBL + PubChem | Phase 4 (approved) | NR2E1 |
| BERBERINE | ChEMBL | Phase 4 (approved) | PPARD |
| ELAFIBRANOR | ChEMBL | Phase 4 (approved) | PPARD |
| IBUPROFEN | ChEMBL | Phase 4 (approved) | RARB |
| KETOCONAZOLE | ChEMBL | Phase 4 (approved) | RARB |
| PEMAFIBRATE | ChEMBL | Phase 4 (approved) | PPARD |
| PIOGLITAZONE | ChEMBL | Phase 4 (approved) | PPARD |
| RACECADOTRIL | ChEMBL | Phase 4 (approved) | RARG |
| TROVAFLOXACIN | ChEMBL | Phase 4 (approved) | RARB |
| ALEGLITAZAR | ChEMBL | Phase 3 | PPARD |
| BEZAFIBRATE | ChEMBL | Phase 3 | PPARD |
| GAMOLENIC ACID | ChEMBL | Phase 3 | PPARD |
| ICOSAPENT | ChEMBL | Phase 3 | PPARD |
| LANIFIBRANOR | ChEMBL | Phase 3 | PPARD |
| NAMODENOSON | ChEMBL | Phase 3 | PPARD |
| CEP-11981 | ChEMBL | Phase 2 | NR2C2 |
| DEXPROPRANOLOL | ChEMBL | Phase 2 | NR2E1 |
| DIHOMO-GAMMA-LINOLENIC ACID | ChEMBL | Phase 2 | PPARD |
| FARGLITAZAR | ChEMBL | Phase 2 | PPARD |
| GW501516 | ChEMBL | Phase 2 | PPARD |
| GW590735 | ChEMBL | Phase 2 | PPARD |
| INDEGLITAZAR | ChEMBL | Phase 2 | PPARD |
| LEVOPROPRANOLOL | ChEMBL | Phase 2 | NR2E1 |
| LINOLEIC ACID | ChEMBL | Phase 2 | PPARD |
Related Atlas pages
- Genes: RARA, RARB, RARG, PPARD, RORB, NR2C2, NR2E1
- Diseases: acne, neoplasm, acute promyelocytic leukemia, acute myeloid leukemia, rosacea, myelodysplastic syndrome, leukemia, squamous cell carcinoma, non-small cell lung carcinoma, basal cell carcinoma, autoimmune thrombocytopenic purpura, breast neoplasm, skin neoplasm, acute myeloid leukemia by FAB classification, head and neck squamous cell carcinoma
- Drugs: Rosiglitazone, Sunitinib, Acetaminophen, Adapalene, Alitretinoin, Alprostadil, Amoxicillin, Bexarotene, cyclosporine, Olanzapine, Regorafenib, Tazarotene, Tolcapone, Trifarotene, Zafirlukast, Tamibarotene, Atorvastatin, Bosentan, Calcitriol, Carprofen, Diclofenac, ethinyl estradiol, Repaglinide, rifampin, Simvastatin, Ticlopidine, Verapamil, Troglitazone, Retinol, Rivaroxaban, Caffeine, Propafenone, Propranolol, Seladelpar, Tadalafil, Berberine, Elafibranor, Ibuprofen, Ketoconazole, Pemafibrate, Pioglitazone, Racecadotril, Trovafloxacin, Aleglitazar, Bezafibrate, Gamolenic Acid, Icosapent, Lanifibranor, Namodenoson
- Biomarker genes: ALDH1A2, CEBPA, FLT3, NPM1, PML