Triamcinolone Acetonide
drugOn this page
Also known as AdcortylAdcortyl in orabaseAllernazeAristocortAristocort aAristogelAudicortAureocortAzmacortExtracortFlutexFtorocortFX-006FX006Gppe ear dps capGppe ear ointKenacort-aKenalogKenalog in orabaseKenalog-10
Summary
Triamcinolone Acetonide (CHEMBL1504) is an approved small-molecule anti-inflammatory drug targeting NR3C1; indicated across 69 conditions including seasonal allergic rhinitis and frozen shoulder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- Targets: 1 (NR3C1)
- Indications: 69 conditions
- Clinical trials: 240
- Chemistry: 434.5 Da · C24H31FO6
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1504 |
| Name | Triamcinolone Acetonide |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 6436 |
| ChEBI | CHEBI:71418 |
| Molecular formula | C24H31FO6 |
| Molecular weight | 434.5 |
| InChIKey | YNDXUCZADRHECN-JNQJZLCISA-N |
SMILES: C[C@]12C[C@@H]([C@]3([C@H]([C@@H]1C[C@@H]4[C@]2(OC(O4)(C)C)C(=O)CO)CCC5=CC(=O)C=C[C@@]53C)F)O
IUPAC name: (1S,2S,4R,8S,9S,11S,12R,13S)-12-fluoro-11-hydroxy-8-(2-hydroxyacetyl)-6,6,9,13-tetramethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one
ChEBI definition: A synthetic glucocorticoid that is the 16,17-acetonide of triamcinolone. Used to treat various skin infections.
Pharmacological roles (ChEBI): anti-inflammatory drug, anti-allergic agent.
Also known as: Adcortyl, Adcortyl in orabase, Allernaze, Aristocort, Aristocort a, Aristogel, Audicort, Aureocort, Azmacort, Extracort, Flutex, Ftorocort
Patent coverage: 14,459 distinct patent families (51,670 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| NR3C1 | Glucocorticoid receptor | Agonist | 8.2 | 0.9% | P04150 |
Broader ChEMBL bioactivity targets: 7 (assay-derived). Sample: Nuclear receptor ROR-gamma, Prelamin-A/C, Beta-lactamase, Glucocorticoid receptor, Progesterone receptor, Nuclear receptor subfamily 1 group I member 2, Hypoxia-inducible factor 1-alpha.
Bioactivity
ChEMBL activities: 8 potent at pChembl ≥ 5 of 11 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| NR3C1 | 8.7 | Ki | 2.01 | nM | CHEMBL_ACT_7784257 |
| NR3C1 | 8.51 | AC50 | 3.1 | nM | CHEMBL_ACT_25175434 |
| NR3C1 | 8.41 | AC50 | 3.9 | nM | CHEMBL_ACT_25116108 |
| NR3C1 | 8.36 | IC50 | 4.41 | nM | CHEMBL_ACT_7784256 |
| HIF1A | 8 | Potency | 10 | nM | CHEMBL_ACT_4132752 |
| HIF1A | 8 | Potency | 10 | nM | CHEMBL_ACT_4519521 |
| PGR | 7.7 | AC50 | 20 | nM | CHEMBL_ACT_25222675 |
| LMNA | 5 | Potency | 10000 | nM | CHEMBL_ACT_3645328 |
Target pathways
Aggregated over 1 target gene(s): NR3C1.
Top Reactome pathways
8 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| HSP90 chaperone cycle for steroid hormone receptors (SHR) in the presence of ligand | 1 | NR3C1 |
| Nuclear Receptor transcription pathway | 1 | NR3C1 |
| SUMOylation of intracellular receptors | 1 | NR3C1 |
| PTK6 Expression | 1 | NR3C1 |
| Regulation of RUNX2 expression and activity | 1 | NR3C1 |
| FOXO-mediated transcription of oxidative stress, metabolic and neuronal genes | 1 | NR3C1 |
| Potential therapeutics for SARS | 1 | NR3C1 |
| Regulation of NPAS4 gene transcription | 1 | NR3C1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| negative regulation of transcription by RNA polymerase II | 1 |
| regulation of gluconeogenesis | 1 |
| chromatin organization | 1 |
| regulation of DNA-templated transcription | 1 |
| regulation of transcription by RNA polymerase II | 1 |
| apoptotic process | 1 |
| chromosome segregation | 1 |
| signal transduction | 1 |
| glucocorticoid metabolic process | 1 |
| response to wounding | 1 |
| gene expression | 1 |
| microglia differentiation | 1 |
| adrenal gland development | 1 |
| nuclear receptor-mediated steroid hormone signaling pathway | 1 |
| regulation of glucocorticoid biosynthetic process | 1 |
Indications & clinical
Indications
69 indications (21 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| seasonal allergic rhinitis | 4 | MONDO:0005324 | EFO:0003956 |
| frozen shoulder | 4 | MONDO:0006763 | EFO:1000941 |
| epicondylitis | 4 | MONDO:0001875 | EFO:1001896 |
| gout | 4 | MONDO:0005393 | EFO:0004274 |
| allergic rhinitis | 4 | MONDO:0011786 | EFO:0005854 |
| bursitis | 4 | MONDO:0002471 | MONDO:0002471 |
| injury | 4 | MONDO:0021178 | EFO:0000546 |
| rheumatoid arthritis | 4 | MONDO:0008383 | EFO:0000685 |
| skin disorder | 4 | MONDO:0005093 | EFO:0000701 |
| pulmonary tuberculosis | 4 | MONDO:0006052 | EFO:1000049 |
| type III hypersensitivity disease | 4 | MONDO:0007004 | EFO:1001222 |
| tenosynovitis | 4 | MONDO:0004855 | EFO:1001435 |
| fungal infectious disease | 4 | MONDO:0002041 | MONDO:0002041 |
| anemia | 4 | MONDO:0002280 | MONDO:0002280 |
| dermatitis | 4 | MONDO:0002406 | MONDO:0002406 |
| asthma | 4 | MONDO:0004979 | MONDO:0004979 |
| osteoarthritis | 4 | MONDO:0005178 | MONDO:0005178 |
| multiple sclerosis | 4 | MONDO:0005301 | MONDO:0005301 |
| diabetic retinopathy | 3 | MONDO:0005266 | EFO:0003770 |
| osteoarthritis, knee | 3 | MONDO:0005416 | EFO:0004616 |
| palmar fibromatosis | 3 | MONDO:0006345 | EFO:0004229 |
| retinal vein occlusion | 3 | MONDO:0006951 | EFO:1001157 |
| uveitis | 3 | MONDO:0020283 | EFO:1001231 |
| anterior ischemic optic neuropathy | 3 | MONDO:0006649 | EFO:1000809 |
| age-related macular degeneration | 3 | MONDO:0005150 | EFO:0001365 |
| pemphigus vulgaris | 3 | MONDO:0008219 | EFO:0004719 |
| chalazion | 3 | MONDO:0005844 | EFO:0007363 |
| proliferative vitreoretinopathy | 3 | MONDO:0700115 | EFO:1001129 |
| interstitial cystitis | 3 | MONDO:0018301 | EFO:0008507 |
| lichen planus, oral | 3 | MONDO:0043923 | EFO:0008517 |
| rhinitis | 3 | MONDO:0003014 | EFO:0008521 |
| macular degeneration | 3 | MONDO:0003004 | EFO:0009606 |
| osteoarthritis, hip | 3 | MONDO:0006629 | EFO:1000786 |
| radiculopathy | 3 | MONDO:0002959 | MONDO:0002959 |
| disease of the tendon | 3 | MONDO:0100010 | MONDO:0004857 |
| otitis media with effusion | 3 | MONDO:0005892 | EFO:0007415 |
| choroidal neovascularization | 3 | MONDO:0810000 | MONDO:0810000 |
| alopecia areata | 2 | MONDO:0005340 | EFO:0004192 |
| vitiligo | 2 | MONDO:0008661 | EFO:0004208 |
| wet macular degeneration | 2 | MONDO:0005417 | EFO:0004683 |
| hand dermatosis | 2 | MONDO:0006556 | EFO:1000706 |
| atopic eczema | 2 | MONDO:0004980 | EFO:0000274 |
| humerus fracture | 2 | MONDO:0005319 | EFO:0003943 |
| keloid | 2 | MONDO:0005348 | EFO:0004212 |
| mucous membrane pemphigoid | 2 | MONDO:0018746 | EFO:1000680 |
| lichen planus | 2 | MONDO:0006572 | EFO:1000726 |
| psoriasis | 2 | MONDO:0005083 | EFO:1001494 |
| cataract | 2 | MONDO:0005129 | MONDO:0005129 |
| breast neoplasm | 2 | MONDO:0021100 | MONDO:0007254 |
| Vogt-Koyanagi-Harada disease | 2 | MONDO:0018092 | MONDO:0018092 |
| ulnar neuropathy | 2 | MONDO:0007006 | EFO:1001224 |
| glaucoma | 2 | MONDO:0005041 | MONDO:0005041 |
| uveal melanoma | 2 | MONDO:0006486 | EFO:1000616 |
| complex regional pain syndrome | 2 | MONDO:0019369 | EFO:1001998 |
| hearing loss disorder | 1 | MONDO:0005365 | EFO:0004238 |
| rotator cuff syndrome | 1 | MONDO:0007028 | EFO:1001250 |
| mucositis | 1 | MONDO:0020579 | EFO:1001898 |
| fibromatosis | 1 | MONDO:0005031 | EFO:0000497 |
| acoustic neuroma | 1 | MONDO:0001569 | HP:0009588 |
| optic papillitis | 0 | MONDO:0006879 | MONDO:0004037 |
9 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 240.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 59 |
| PHASE4 | 49 |
| PHASE2 | 49 |
| PHASE3 | 47 |
| PHASE2/PHASE3 | 13 |
| PHASE1/PHASE2 | 10 |
| PHASE1 | 10 |
| EARLY_PHASE1 | 3 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT04207931 | PHASE4 | RECRUITING | Treatment Results for Patients With Central Centrifugal Cicatricial Alopecia (CCCA): a Multicenter Prospective Study |
| NCT05331664 | PHASE4 | RECRUITING | Dropless Pars Plana Vitrectomy Study |
| NCT05806021 | PHASE4 | RECRUITING | The Efficacy of Intra-articular Triamcinolone Acetonide 5mg vs. 10 mg vs. 40 mg in Patients With Knee Osteoarthritis |
| NCT06578728 | PHASE4 | ACTIVE_NOT_RECRUITING | Local Methotrexate Injections for the Treatment of Nail Psoriasis |
| NCT06897969 | PHASE4 | NOT_YET_RECRUITING | Comparison of Intralesional Triamcinolone Versus Verapamil for Keloid Treatment |
| NCT07006168 | PHASE4 | RECRUITING | Effects Of Intra-Operative Intra-Articular Cocktail Injection In Patella Open Reduction And Internal Fixation |
| NCT07014280 | PHASE4 | ACTIVE_NOT_RECRUITING | Bevacizumab Versus Triamcinolone Acetonide for the Treatment of Keloids. |
| NCT07100145 | PHASE4 | NOT_YET_RECRUITING | Efficacy of Coconut Gel Compared to Corticosteroid Gel in the Management of Oral Lichen Planus |
| NCT07453238 | PHASE4 | NOT_YET_RECRUITING | Comparison of Topical Calcipotriol and Intralesional Steroids in Alopecia Areata |
| NCT00779792 | PHASE4 | UNKNOWN | Efficacy of Glycerol, Two Topical Steroids, and a Topical Immune Modulator Against Skin Irritation |
| NCT01230424 | PHASE4 | COMPLETED | Effect of Steroid Injections in a Knee With Osteoarthritis |
| NCT01652495 | PHASE4 | COMPLETED | Evaluation of Efficacy and Hypothalamus-pituitary-adrenal Axis Suppression Due to Corticosteroids Intrabursal Injection |
| NCT01720056 | PHASE4 | TERMINATED | Verapamil vs Steroid to Prevent Keloid Recurrence |
| NCT02120261 | PHASE4 | TERMINATED | Using Saline for Myofascial Pain Syndromes (USAMPS) |
| NCT02379000 | PHASE4 | UNKNOWN | TTT Versus TTT and Triamcinolone to Decrease Exudation in Choroidal Melanoma After Proton Beam Therapy |
| NCT02592629 | PHASE4 | TERMINATED | The Efficacy of Local Anesthetics to Reduce Shoulder Pain Post-Steroid Injections |
| NCT02598869 | PHASE4 | WITHDRAWN | Posterior Subtenon Versus Intravitreal Injection of Triamcinolone Acetonide for Treatment of Uveitic Cystoid Macular Edema |
| NCT02613455 | PHASE4 | UNKNOWN | Corticosteroid Injection Verses High Energy Extracorporeal Shock Wave Therapy for Lateral Epicondylitis |
| NCT02618603 | PHASE4 | UNKNOWN | Botulinum Toxin A for Shoulder Pain After Stroke |
| NCT02806752 | PHASE4 | UNKNOWN | Intravitreal Ranibizumab and TA Combination Therapy vs. Ranibizumab Monotherapy in Polypoidal Choroidal Vasculopathy |
| NCT02858297 | PHASE4 | COMPLETED | Glucosamine as a Novel Adjunctive Therapy in Oral Lichen Planus |
| NCT02877485 | PHASE4 | COMPLETED | The Effectiveness of Nasal Corticosteroids Versus Placebo in Nasal Obstruction in Patients With Nasal Septal Deviation |
| NCT02917564 | PHASE4 | UNKNOWN | Triamcinolone Injections for Persistent Choroidal Effusions Post Glaucoma Surgery |
| NCT02920177 | PHASE4 | TERMINATED | Platelet-rich Plasma Versus Corticosteroid Injection for the Treatment of Femoroacetabular Impingement |
| NCT03120923 | PHASE4 | COMPLETED | Combined Corticosteroid With Low Volume Compared to High Volume in Impingement Syndrome |
| NCT03166761 | PHASE4 | TERMINATED | Particulate Corticosteroid Versus Non-particulate Corticosteroid for Sacroiliac Joint Injection |
| NCT03319784 | PHASE4 | WITHDRAWN | Analysis for NSAID VS Corticosteroid Shoulder Injection in Diabetic Patients |
| NCT03382821 | PHASE4 | COMPLETED | Comparative Trial Via Tranforaminal Approach Versus Epidural Catheter Via Interlaminar Approach |
| NCT03382925 | PHASE4 | TERMINATED | Does Low-does Cervical Epidural Lidocaine Cause Transient Weakness? |
| NCT03535233 | PHASE4 | COMPLETED | Topical 5% Minoxidil and Potent Topical Corticosteroid Versus Intralesional Corticosteroid in the Treatment of Alopecia Areata |
| NCT03636373 | PHASE4 | TERMINATED | Pilot Study Evaluating The Efficacy Of Etanercept In Acute Gout |
| NCT03895840 | PHASE4 | COMPLETED | The Effect of Intra-articular Bilateral Knee Injections of Zilretta on Performance Measures in Adults With Knee OA |
| NCT03991936 | PHASE4 | COMPLETED | Benefit of Placebo and Different Concentrations of Triamcinolone Acetonide in Nail Psoriasis |
| NCT03995641 | PHASE4 | WITHDRAWN | The Effect of Local Analgesia on Postoperative Gluteal Pain in Patients Undergoing Sacrospinous Ligament Fixation |
| NCT04002037 | PHASE4 | TERMINATED | Differential Efficacy of Corticosteroid Solutions for Non-Operative Treatment of Digit Flexor Tenosynovitis |
| NCT04003376 | PHASE4 | UNKNOWN | Efficacy of Fractional CO2 Laser as a Mono- or Adjuvant Therapy for Alopecia Areata |
| NCT04075136 | PHASE4 | WITHDRAWN | Optical Coherence Tomography Angiography (OCTA) - Directed PDT Triple Therapy |
| NCT04115644 | PHASE4 | TERMINATED | Effectiveness of Corticosteroid vs. Ketorolac Shoulder Injections: A Prospective Double-Blinded Randomized Trial |
| NCT04412148 | PHASE4 | UNKNOWN | Modified SALT Score for Alopecia Areata |
| NCT04701593 | PHASE4 | COMPLETED | Using Triamcinolone Acetonide to Reduce Pain After Scleral Buckle Surgery |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
173 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| FULVESTRANT | ChEMBL + PubChem | Phase 4 (approved) | NR3C1 |
| PODOFILOX | ChEMBL + PubChem | Phase 4 (approved) | NR3C1 |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | NR3C1 |
| ACENOCOUMAROL | ChEMBL | Phase 4 (approved) | NR3C1 |
| ALCLOMETASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| AMCINONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| APREPITANT | ChEMBL | Phase 4 (approved) | NR3C1 |
| AURANOFIN | ChEMBL | Phase 4 (approved) | NR3C1 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BECLOMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE PHOSPHORIC ACID | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE VALERATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BUDESONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BUTOCONAZOLE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | NR3C1 |
| CANRENONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CHLORMADINONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CICLESONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CLOBETASOL PROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CLOFAZIMINE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CORTISONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DANAZOL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DAUNORUBICIN | ChEMBL | Phase 4 (approved) | NR3C1 |
| DEFLAZACORT | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESOGESTREL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESOXIMETASONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESOXYCORTICOSTERONE PIVALATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DEXAMETHASONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DEXTROTHYROXINE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DIENESTROL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DIFLORASONE DIACETATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DOXORUBICIN | ChEMBL | Phase 4 (approved) | NR3C1 |
| DROSPIRENONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | NR3C1 |
| EFAVIRENZ | ChEMBL | Phase 4 (approved) | NR3C1 |
| ENZALUTAMIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| EPLERENONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| ESTRADIOL | ChEMBL | Phase 4 (approved) | NR3C1 |
| ESTRIOL | ChEMBL | Phase 4 (approved) | NR3C1 |
| ETHINYL ESTRADIOL | ChEMBL | Phase 4 (approved) | NR3C1 |
| EXEMESTANE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FELODIPINE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUDROCORTISONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUNISOLIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUOCINOLONE ACETONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUOCINONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUOROMETHOLONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUOXYMESTERONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLURANDRENOLIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUTICASONE FUROATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUTICASONE PROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| GLUCAGON | ChEMBL | Phase 4 (approved) | NR3C1 |
| HALCINONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
Related Atlas pages
- Genes: NR3C1
- Diseases: seasonal allergic rhinitis, frozen shoulder, epicondylitis, gout, allergic rhinitis, bursitis, injury, rheumatoid arthritis, skin disorder, pulmonary tuberculosis, type III hypersensitivity disease, tenosynovitis, fungal infectious disease, anemia, dermatitis, asthma, osteoarthritis, multiple sclerosis, diabetic retinopathy, osteoarthritis, knee, palmar fibromatosis, retinal vein occlusion, uveitis, anterior ischemic optic neuropathy, age-related macular degeneration, pemphigus vulgaris, chalazion, proliferative vitreoretinopathy, interstitial cystitis, lichen planus, oral, rhinitis, macular degeneration, osteoarthritis, hip, radiculopathy, disease of the tendon, otitis media with effusion, choroidal neovascularization
- Drugs: Fulvestrant, Podofilox, Regorafenib, Acenocoumarol, Alclometasone Dipropionate, Amcinonide, Amiodarone, Aprepitant, Auranofin, Bazedoxifene, Beclomethasone Dipropionate, Benzbromarone, Betamethasone, Betamethasone Dipropionate, Betamethasone Phosphoric Acid, Betamethasone Valerate, Budesonide, Butoconazole, Candesartan Cilexetil, Canrenone, Chlormadinone, Ciclesonide, Clobetasol Propionate, Clofazimine, Clotrimazole, Cortisone, Danazol, Daunorubicin, Deflazacort, Desogestrel, Desonide, Desoximetasone, Desoxycorticosterone Pivalate, Dexamethasone, Dextrothyroxine, Dienestrol, Diethylstilbestrol, Diflorasone Diacetate, Doxorubicin, Drospirenone, Econazole, Efavirenz, Enzalutamide, Eplerenone, Estradiol, Estriol, Ethinyl Estradiol, Exemestane, Felodipine, Fludrocortisone, Flunisolide, Fluocinolone Acetonide, Fluocinonide, Fluorometholone, Fluoxymesterone, Flurandrenolide, Fluticasone Furoate, Fluticasone Propionate, Glucagon, Halcinonide