Trimetrexate
drugOn this page
Also known as CI-898NSC-249008TrimetrexatoSID26755046SID50110873C0088486
Summary
Trimetrexate (CHEMBL119) is an approved small molecule (ATC P01AX07) targeting DHFR; indicated across 1 condition including amebiasis.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: P01AX07
- Targets: 1 (DHFR)
- Indications: 1 condition
- Chemistry: 369.4 Da · C19H23N5O3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL119 |
| Name | Trimetrexate |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 5583 |
| ATC | P01AX07 |
| Molecular formula | C19H23N5O3 |
| Molecular weight | 369.4 |
| InChIKey | NOYPYLRCIDNJJB-UHFFFAOYSA-N |
SMILES: CC1=C(C=CC2=C1C(=NC(=N2)N)N)CNC3=CC(=C(C(=C3)OC)OC)OC
IUPAC name: 5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine
Also known as: CI-898, NSC-249008, Trimetrexate, Trimetrexato, trimetrexate, SID26755046, SID50110873, TRIMETREXATE, C0088486
Parent form; salt/anhydrous children: CHEMBL2218878, CHEMBL2358886, CHEMBL3392303
Patent coverage: 13,389 distinct patent families (57,002 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 56,872 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| DHFR | dihydrofolate reductase | Inhibition | 7.89 | 69.8% | P00374 |
Broader ChEMBL bioactivity targets: 33 (assay-derived). Sample: Tyrosyl-DNA phosphodiesterase 1, Bifunctional dihydrofolate reductase-thymidylate synthase, Microtubule-associated protein tau, Fructose-bisphosphate aldolase, RecQ-like DNA helicase BLM, 4’-phosphopantetheinyl transferase ffp, 15-hydroxyprostaglandin dehydrogenase [NAD(+)], Dihydrofolate reductase, Dihydrofolate reductase, Amine oxidase [flavin-containing] A.
Bioactivity
ChEMBL activities: 144 potent at pChembl ≥ 5 of 160 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| DHFR | 10.4 | Ki | 0.04 | nM | CHEMBL_ACT_24959142 |
| P00375 | 10.22 | Ki | 0.06 | nM | CHEMBL_ACT_654949 |
| DHFR | 9.38 | IC50 | 0.42 | nM | CHEMBL_ACT_24999756 |
| P16184 | 9.15 | Ki | 0.71 | nM | CHEMBL_ACT_95459 |
| P00375 | 9.09 | Ki | 0.81 | nM | CHEMBL_ACT_654950 |
| Q07422 | 8.87 | IC50 | 1.35 | nM | CHEMBL_ACT_19365587 |
| DHFR | 8.85 | IC50 | 1.4 | nM | CHEMBL_ACT_220405 |
| DHFR | 8.85 | Ki | 1.4 | nM | CHEMBL_ACT_576794 |
| P22906 | 8.72 | Ki | 1.9 | nM | CHEMBL_ACT_576793 |
| DHFR | 8.59 | IC50 | 2.6 | nM | CHEMBL_ACT_13297381 |
| DHFR | 8.59 | IC50 | 2.6 | nM | CHEMBL_ACT_19192953 |
| DHFR | 8.59 | IC50 | 2.6 | nM | CHEMBL_ACT_28502444 |
| Q920D2 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_1015010 |
| Q920D2 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_1050231 |
| Q920D2 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_1068772 |
| Q920D2 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_1090497 |
| Q920D2 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_1119202 |
| Q920D2 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_1122911 |
| Q920D2 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_1176310 |
| Q920D2 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_1224427 |
| Q920D2 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_1258099 |
| Q920D2 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_13297297 |
| Q920D2 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_172639 |
| Q920D2 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_202736 |
| Q920D2 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_220404 |
| Q920D2 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_227040 |
| Q920D2 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_2361856 |
| Q920D2 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_237267 |
| Q920D2 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_2559435 |
| Q920D2 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_3106726 |
Target pathways
Aggregated over 1 target gene(s): DHFR.
Top Reactome pathways
3 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation | 1 | DHFR |
| Metabolism of folate and pterines | 1 | DHFR |
| G1/S-Specific Transcription | 1 | DHFR |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| tetrahydrobiopterin biosynthetic process | 1 |
| one-carbon metabolic process | 1 |
| negative regulation of translation | 1 |
| axon regeneration | 1 |
| response to methotrexate | 1 |
| dihydrofolate metabolic process | 1 |
| tetrahydrofolate metabolic process | 1 |
| tetrahydrofolate biosynthetic process | 1 |
| folic acid metabolic process | 1 |
| regulation of removal of superoxide radicals | 1 |
Indications & clinical
Indications
1 indication (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| amebiasis | 2 | MONDO:0005644 | EFO:0007144 |
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
22 molecules share ≥1 primary target. Top 22 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| LEUCOVORIN | ChEMBL + PubChem | Phase 4 (approved) | DHFR |
| METHOTREXATE | ChEMBL + PubChem | Phase 4 (approved) | DHFR |
| PEMETREXED | ChEMBL + PubChem | Phase 4 (approved) | DHFR |
| DIFLUNISAL | ChEMBL | Phase 4 (approved) | DHFR |
| GENTAMICIN | ChEMBL | Phase 4 (approved) | DHFR |
| MEFENAMIC ACID | ChEMBL | Phase 4 (approved) | DHFR |
| PRALATREXATE | ChEMBL | Phase 4 (approved) | DHFR |
| PYRIMETHAMINE | ChEMBL | Phase 4 (approved) | DHFR |
| RALTITREXED | ChEMBL | Phase 4 (approved) | DHFR |
| SULFACETAMIDE | ChEMBL | Phase 4 (approved) | DHFR |
| SULFADIAZINE | ChEMBL | Phase 4 (approved) | DHFR |
| TERIFLUNOMIDE | ChEMBL | Phase 4 (approved) | DHFR |
| TRIMETHOPRIM | ChEMBL | Phase 4 (approved) | DHFR |
| ICLAPRIM | ChEMBL | Phase 3 | DHFR |
| AMINOPTERIN | ChEMBL | Phase 2 | DHFR |
| BREQUINAR | ChEMBL | Phase 2 | DHFR |
| CYCLOGUANIL | ChEMBL | Phase 2 | DHFR |
| DIAVERIDINE | ChEMBL | Phase 2 | DHFR |
| EDATREXATE | ChEMBL | Phase 2 | DHFR |
| EPIROPRIM | ChEMBL | Phase 2 | DHFR |
| PIRITREXIM | ChEMBL | Phase 2 | DHFR |
| Folic Acid | PubChem | Approved | DHFR |