Triphosphate
drugOn this page
Summary
Triphosphate (CHEMBL1230191) is a phase-3 clinical-stage small molecule targeting P2RY1, P2RY2, and P2RY4; indicated across 1 condition including neoplasm.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 21 (P2RY1, P2RY2, P2RY4…)
- Indications: 1 condition
- Chemistry: 257.96 Da · H5O10P3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1230191 |
| Name | Triphosphate |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 983 |
| ChEBI | CHEBI:39949 |
| Molecular formula | H5O10P3 |
| Molecular weight | 257.96 |
| InChIKey | UNXRWKVEANCORM-UHFFFAOYSA-N |
SMILES: OP(=O)(O)OP(=O)(O)OP(=O)(O)O
IUPAC name: diphosphono hydrogen phosphate
Also known as: Triphosphate, TRIPHOSPHATE
Parent form; salt/anhydrous children: CHEMBL3183517
Patent coverage: 35,234 distinct patent families (100,600 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| P2RY1 | P2Y1 receptor | Partial agonist | 7.8 | 0% | P47900 |
| P2RY2 | P2Y2 receptor | Full agonist | 7.1 | 1% | P41231 |
| P2RY4 | P2Y4 receptor | Agonist | 5.37 | 0% | P51582 |
| P2RY11 | P2Y11 receptor | Full agonist | 5.6 | 0% | Q96G91 |
| P2RY13 | P2Y13 receptor | Full agonist | 5.4 | 0% | Q9BPV8 |
| KCNT2 | KNa1.2 | 0.1% | Q6UVM3 | ||
| KCNJ8 | Kir6.1 | Agonist | 0% | Q15842 | |
| KCNJ11 | Kir6.2 | Antagonist | 0.1% | Q14654 | |
| P2RX1 | P2X1 | Agonist | 7.25 | 0.3% | P51575 |
| P2RX2 | P2X2 | Agonist | 5.85 | 2% | Q9UBL9 |
| P2RX3 | P2X3 | Agonist | 6.47 | 1.6% | P56373 |
| P2RX4 | P2X4 | Agonist | 5.9 | 1.2% | Q99571 |
| P2RX5 | P2X5 | Agonist | 6 | 0% | Q93086 |
| P2RX6 | P2X6 | Agonist | 6 | 0.5% | O15547 |
| P2RX7 | P2X7 | Agonist | 3.11 | 1.7% | Q99572 |
| TRPM4 | TRPM4 | Antagonist | 5.8 | 0.5% | Q8TD43 |
| ITPR1 | IP3R1 | 1.4% | Q14643 | ||
| RYR1 | RyR1 | 1% | P21817 | ||
| RYR2 | RyR2 | 0.3% | Q92736 | ||
| RYR3 | RyR3 | 0% | Q15413 | ||
| GPR17 | GPR17 | Agonist | 7.43 | 1.6% | Q13304 |
Bioactivity
No ChEMBL bioactivity rows at pChembl ≥ 5 (expected for biologics / antibodies).
Target pathways
Aggregated over 21 target gene(s): P2RY1, P2RY2, P2RY4, P2RY11, P2RY13, KCNT2, KCNJ8, KCNJ11, P2RX1, P2RX2, P2RX3, P2RX4, P2RX5, P2RX6, P2RX7, TRPM4, ITPR1, RYR1, RYR2, RYR3, GPR17.
Top Reactome pathways
75 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Elevation of cytosolic Ca2+ levels | 8 | ITPR1, P2RX1, P2RX2, P2RX3, P2RX4, P2RX5, P2RX6, P2RX7 |
| Platelet homeostasis | 8 | ITPR1, P2RX1, P2RX2, P2RX3, P2RX4, P2RX5, P2RX6, P2RX7 |
| P2Y receptors | 6 | GPR17, P2RY1, P2RY11, P2RY13, P2RY2, P2RY4 |
| Muscle contraction | 5 | ITPR1, KCNJ11, RYR1, RYR2, RYR3 |
| G alpha (q) signalling events | 5 | GPR17, ITPR1, P2RY1, P2RY11, P2RY2 |
| Cardiac conduction | 5 | ITPR1, KCNJ11, RYR1, RYR2, RYR3 |
| Ion homeostasis | 5 | ITPR1, KCNJ11, RYR1, RYR2, RYR3 |
| Transport of small molecules | 4 | KCNJ11, RYR1, RYR2, RYR3 |
| G alpha (i) signalling events | 4 | GPR17, ITPR1, P2RY13, P2RY4 |
| Stimuli-sensing channels | 3 | RYR1, RYR2, RYR3 |
| Ion channel transport | 3 | RYR1, RYR2, RYR3 |
| Neuronal System | 2 | KCNJ11, KCNJ8 |
| ATP sensitive Potassium channels | 2 | KCNJ11, KCNJ8 |
| Inwardly rectifying K+ channels | 2 | KCNJ11, KCNJ8 |
| Potassium Channels | 2 | KCNJ11, KCNJ8 |
| Metabolism | 2 | ITPR1, KCNJ11 |
| Integration of energy metabolism | 2 | ITPR1, KCNJ11 |
| Disease | 2 | ITPR1, KCNJ11 |
| Regulation of insulin secretion | 2 | ITPR1, KCNJ11 |
| Purinergic signaling in leishmaniasis infection | 2 | P2RX4, P2RX7 |
| Hemostasis | 1 | ITPR1 |
| Opioid Signalling | 1 | ITPR1 |
| G-protein mediated events | 1 | ITPR1 |
| PLC beta mediated events | 1 | ITPR1 |
| Effects of PIP2 hydrolysis | 1 | ITPR1 |
| Adaptive Immune System | 1 | ITPR1 |
| DAG and IP3 signaling | 1 | ITPR1 |
| Signal Transduction | 1 | ITPR1 |
| Innate Immune System | 1 | ITPR1 |
| Immune System | 1 | ITPR1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| monoatomic ion transport | 16 |
| monoatomic ion transmembrane transport | 15 |
| signal transduction | 13 |
| calcium ion transmembrane transport | 13 |
| monoatomic cation transmembrane transport | 10 |
| cellular response to ATP | 9 |
| calcium-mediated signaling | 9 |
| response to ATP | 9 |
| response to hypoxia | 7 |
| purinergic nucleotide receptor signaling pathway | 7 |
| excitatory postsynaptic potential | 7 |
| G protein-coupled receptor signaling pathway | 6 |
| calcium ion transport | 6 |
| phospholipase C-activating G protein-coupled receptor signaling pathway | 5 |
| G protein-coupled purinergic nucleotide receptor signaling pathway | 5 |
Indications & clinical
Indications
1 indication (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| neoplasm | 3 | MONDO:0005070 | MONDO:0004992 |
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
50 molecules share ≥1 primary target. Top 50 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| SURAMIN | ChEMBL | Phase 3 | P2RX1, P2RX2, P2RX3, P2RX4, P2RX5, P2RX7, P2RY11, P2RY2 |
| ADENOSINE TRIPHOSPHATE | ChEMBL | Phase 2 | P2RX1, P2RX3, P2RX4, P2RY1, P2RY11, P2RY2, P2RY4 |
| ADENOSINE | ChEMBL + PubChem | Phase 4 (approved) | P2RY1, P2RY11, P2RY2, P2RY4 |
| CANGRELOR | ChEMBL + PubChem | Phase 4 (approved) | P2RX1, P2RY13 |
| glyburide | ChEMBL + PubChem | Phase 4 (approved) | KCNJ11, KCNJ8 |
| Indomethacin | ChEMBL + PubChem | Phase 4 (approved) | GPR17, P2RY2 |
| DIQUAFOSOL | ChEMBL | Phase 4 (approved) | P2RY2, P2RY4 |
| DIQUAFOSOL TETRASODIUM | ChEMBL | Phase 4 (approved) | P2RY2, P2RY4 |
| GEFAPIXANT | ChEMBL | Phase 4 (approved) | P2RX2, P2RX3 |
| DENUFOSOL | ChEMBL | Phase 3 | P2RY2, P2RY4 |
| DENUFOSOL TETRASODIUM | ChEMBL | Phase 3 | P2RY2, P2RY4 |
| PYRIDOXAL | ChEMBL | Phase 3 | P2RX1, P2RX2 |
| URIDINE TRIPHOSPHATE | ChEMBL | Phase 3 | P2RY2, P2RY4 |
| CROMAKALIM | ChEMBL | Phase 2 | KCNJ11, KCNJ8 |
| ELIAPIXANT | ChEMBL | Phase 2 | P2RX2, P2RX3 |
| Berberine Chloride | PubChem | Approved | KCNJ11, P2RX7 |
| Oxolinic Acid | PubChem | Approved | RYR2, RYR3 |
| DIAZOXIDE | ChEMBL + PubChem | Phase 4 (approved) | KCNJ11 |
| MONTELUKAST | ChEMBL + PubChem | Phase 4 (approved) | GPR17 |
| PAROXETINE | ChEMBL + PubChem | Phase 4 (approved) | P2RX4 |
| PROPAFENONE | ChEMBL + PubChem | Phase 4 (approved) | KCNJ11 |
| TICAGRELOR | ChEMBL + PubChem | Phase 4 (approved) | P2RY13 |
| BRILLIANT BLUE G | ChEMBL | Phase 4 (approved) | P2RX7 |
| CANGRELOR TETRASODIUM | ChEMBL | Phase 4 (approved) | GPR17 |
| DULOXETINE | ChEMBL | Phase 4 (approved) | P2RX4 |
| PINACIDIL | ChEMBL | Phase 4 (approved) | KCNJ11 |
| PRANLUKAST | ChEMBL | Phase 4 (approved) | GPR17 |
| PROGESTERONE | ChEMBL | Phase 4 (approved) | P2RX3 |
| SURAMIN HEXASODIUM | ChEMBL | Phase 3 | P2RY13 |
| ALADORIAN | ChEMBL | Phase 2 | RYR2 |
| AZD9056 | ChEMBL | Phase 2 | P2RX7 |
| CE-224535 | ChEMBL | Phase 2 | P2RX7 |
| CLAMIKALANT | ChEMBL | Phase 2 | KCNJ11 |
| GAVESTINEL | ChEMBL | Phase 2 | GPR17 |
| JNJ-54175446 | ChEMBL | Phase 2 | P2RX7 |
| OXATOMIDE | ChEMBL | Phase 2 | P2RX7 |
| SALFLUVERINE | ChEMBL | Phase 2 | P2RX1 |
| TIFENAZOXIDE | ChEMBL | Phase 2 | KCNJ11 |
| ZANVIPIXANT | ChEMBL | Phase 2 | P2RX7 |
| Belzutifan | PubChem | Approved | P2RY1 |
| Caffeine | PubChem | Approved | RYR2 |
| Carbachol | PubChem | Approved | P2RY2 |
| Carbamazepine | PubChem | Approved | P2RX4 |
| Dantrolene | PubChem | Approved | RYR2 |
| Eslicarbazepine | PubChem | Approved | P2RX4 |
| Oxcarbazepine | PubChem | Approved | P2RX4 |
| Rizatriptan | PubChem | Approved | GPR17 |
| theophylline | PubChem | Approved | P2RX3 |
| tryptophan | PubChem | Approved | GPR17 |
| Zileuton | PubChem | Approved | GPR17 |
Related Atlas pages
- Genes: P2RY1, P2RY2, P2RY4, P2RY11, P2RY13, KCNT2, KCNJ8, KCNJ11, P2RX1, P2RX2, P2RX3, P2RX4, P2RX5, P2RX6, P2RX7, TRPM4, ITPR1, RYR1, RYR2, RYR3, GPR17
- Diseases: neoplasm
- Drugs: Suramin, Adenosine, Cangrelor, glyburide, Indomethacin, Diquafosol, Gefapixant, Denufosol, Pyridoxal, Uridine Triphosphate, Berberine Chloride, Diazoxide, Montelukast, Paroxetine, Propafenone, Ticagrelor, Duloxetine, Pinacidil, Pranlukast, Progesterone, Belzutifan, Caffeine, Carbachol, Carbamazepine, Dantrolene, Eslicarbazepine, Oxcarbazepine, Rizatriptan, theophylline, tryptophan, Zileuton