Ximelagatran
drugOn this page
Also known as ExantaH 376/95H-376/95SID144207182
Summary
Ximelagatran (CHEMBL522038) is an approved small molecule (ATC B01AE05) targeting F2; indicated across 3 conditions including thrombotic disease and atrial fibrillation.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: B01AE05
- Targets: 1 (F2)
- Indications: 3 conditions
- Clinical trials: 2
- Chemistry: 473.6 Da · C24H35N5O5
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL522038 |
| Name | Ximelagatran |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 5478933 |
| ChEBI | CHEBI:136702 |
| ATC | B01AE05 |
| Molecular formula | C24H35N5O5 |
| Molecular weight | 473.6 |
| InChIKey | ZXIBCJHYVWYIKI-PZJWPPBQSA-N |
SMILES: CCOC(=O)CN[C@H](C1CCCCC1)C(=O)N2CC[C@H]2C(=O)NCC3=CC=C(C=C3)/C(=N\O)/N
IUPAC name: ethyl 2-[[(1R)-1-cyclohexyl-2-[(2S)-2-[[4-[(E)-N’-hydroxycarbamimidoyl]phenyl]methylcarbamoyl]azetidin-1-yl]-2-oxoethyl]amino]acetate
ChEBI definition: A member of the class of azetidines that is melagatran in which the carboxylic acid group has been converted into the corresponding ethyl ester and in which the amidine group has been converted to the corresponding hydroxylamine. Tautomeric with the oxime form of ximelagatran.
Also known as: Exanta, H 376/95, H-376/95, Ximelagatran, ximelagatran, XIMELAGATRAN, SID144207182
Patent coverage: 1,647 distinct patent families (7,429 SureChEMBL compound mentions), from 4 matched compound structure(s). One matched structure accounts for 7,374 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| F2 | coagulation factor II, thrombin | 1.4% | P00734 |
Broader ChEMBL bioactivity targets: 1 (assay-derived). Sample: Prothrombin.
Bioactivity
ChEMBL activities: 2 potent at pChembl ≥ 5 of 2 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| F2 | 8.7 | Ki | 2.01 | nM | CHEMBL_ACT_18916473 |
| F2 | 6.5 | AC50 | 320 | nM | CHEMBL_ACT_25197154 |
Target pathways
Aggregated over 1 target gene(s): F2.
Top Reactome pathways
38 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Hemostasis | 1 | F2 |
| R-HSA-140837 | 1 | F2 |
| R-HSA-140875 | 1 | F2 |
| R-HSA-140877 | 1 | F2 |
| Gamma-carboxylation of protein precursors | 1 | F2 |
| Transport of gamma-carboxylated protein precursors from the endoplasmic reticulum to the Golgi apparatus | 1 | F2 |
| Removal of aminoterminal propeptides from gamma-carboxylated proteins | 1 | F2 |
| Gamma-carboxylation, transport, and amino-terminal cleavage of proteins | 1 | F2 |
| Signal Transduction | 1 | F2 |
| Gamma carboxylation, hypusinylation, hydroxylation, and arylsulfatase activation | 1 | F2 |
| Disease | 1 | F2 |
| Complement cascade | 1 | F2 |
| Innate Immune System | 1 | F2 |
| Immune System | 1 | F2 |
| Cell surface interactions at the vascular wall | 1 | F2 |
| Signaling by GPCR | 1 | F2 |
| Class A/1 (Rhodopsin-like receptors) | 1 | F2 |
| Peptide ligand-binding receptors | 1 | F2 |
| Regulation of Insulin-like Growth Factor (IGF) transport and uptake by Insulin-like Growth Factor Binding Proteins (IGFBPs) | 1 | F2 |
| GPCR downstream signalling | 1 | F2 |
| Metabolism of proteins | 1 | F2 |
| G alpha (q) signalling events | 1 | F2 |
| Thrombin signalling through proteinase activated receptors (PARs) | 1 | F2 |
| GPCR ligand binding | 1 | F2 |
| Post-translational protein modification | 1 | F2 |
| Platelet activation, signaling and aggregation | 1 | F2 |
| Platelet Aggregation (Plug Formation) | 1 | F2 |
| R-HSA-9651496 | 1 | F2 |
| Defective factor XII causes hereditary angioedema | 1 | F2 |
| Defective factor VIII causes hemophilia A | 1 | F2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| proteolysis | 1 |
| acute-phase response | 1 |
| cell surface receptor signaling pathway | 1 |
| blood coagulation | 1 |
| positive regulation of cell population proliferation | 1 |
| regulation of cell shape | 1 |
| response to wounding | 1 |
| negative regulation of platelet activation | 1 |
| platelet activation | 1 |
| regulation of blood coagulation | 1 |
| positive regulation of blood coagulation | 1 |
| negative regulation of blood coagulation | 1 |
| positive regulation of cell growth | 1 |
| positive regulation of insulin secretion | 1 |
| positive regulation of collagen biosynthetic process | 1 |
Indications & clinical
Indications
3 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| thrombotic disease | 4 | MONDO:0000831 | HP:0004419 |
| atrial fibrillation | 2 | MONDO:0004981 | EFO:0000275 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 2.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 1 |
| PHASE2 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00206089 | PHASE3 | TERMINATED | Melagatran/Ximelagatran Versus Enoxaparin for the Prevention of Venous Thromboembolic Events |
| NCT00206063 | PHASE2 | TERMINATED | Long Term Open Follow-up With H376/95 vs. Warfarin |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
50 molecules share ≥1 primary target. Top 50 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| APIXABAN | ChEMBL + PubChem | Phase 4 (approved) | F2 |
| EDOXABAN | ChEMBL + PubChem | Phase 4 (approved) | F2 |
| ARGATROBAN | ChEMBL | Phase 4 (approved) | F2 |
| BENZOYL PEROXIDE | ChEMBL | Phase 4 (approved) | F2 |
| BETRIXABAN | ChEMBL | Phase 4 (approved) | F2 |
| BIVALIRUDIN | ChEMBL | Phase 4 (approved) | F2 |
| BORTEZOMIB | ChEMBL | Phase 4 (approved) | F2 |
| CAPTOPRIL | ChEMBL | Phase 4 (approved) | F2 |
| CIANIDANOL | ChEMBL | Phase 4 (approved) | F2 |
| DABIGATRAN ETEXILATE | ChEMBL | Phase 4 (approved) | F2 |
| DEQUALINIUM | ChEMBL | Phase 4 (approved) | F2 |
| GENTIAN VIOLET | ChEMBL | Phase 4 (approved) | F2 |
| HEXAMIDINE | ChEMBL | Phase 4 (approved) | F2 |
| INDIGOTINDISULFONATE | ChEMBL | Phase 4 (approved) | F2 |
| LIOTHYRONINE | ChEMBL | Phase 4 (approved) | F2 |
| LUSUTROMBOPAG | ChEMBL | Phase 4 (approved) | F2 |
| MELAGATRAN | ChEMBL | Phase 4 (approved) | F2 |
| METHYLPREDNISOLONE | ChEMBL | Phase 4 (approved) | F2 |
| PENTAMIDINE | ChEMBL | Phase 4 (approved) | F2 |
| RIVAROXABAN | ChEMBL | Phase 4 (approved) | F2 |
| SUCCIMER | ChEMBL | Phase 4 (approved) | F2 |
| SULFAGUANIDINE | ChEMBL | Phase 4 (approved) | F2 |
| TELOTRISTAT | ChEMBL | Phase 4 (approved) | F2 |
| CAMOSTAT | ChEMBL | Phase 3 | F2 |
| CAMOSTAT MESILATE | ChEMBL | Phase 3 | F2 |
| DABIGATRAN | ChEMBL | Phase 3 | F2 |
| GABEXATE | ChEMBL | Phase 3 | F2 |
| MILVEXIAN | ChEMBL | Phase 3 | F2 |
| NAFAMOSTAT | ChEMBL | Phase 3 | F2 |
| QUERCETIN | ChEMBL | Phase 3 | F2 |
| SILIBININ | ChEMBL | Phase 3 | F2 |
| BMS-986141 | ChEMBL | Phase 2 | F2 |
| CETRAXATE | ChEMBL | Phase 2 | F2 |
| DIBROMPROPAMIDINE | ChEMBL | Phase 2 | F2 |
| EFEGATRAN | ChEMBL | Phase 2 | F2 |
| FIDEXABAN | ChEMBL | Phase 2 | F2 |
| GW813893 | ChEMBL | Phase 2 | F2 |
| INOGATRAN | ChEMBL | Phase 2 | F2 |
| LETAXABAN | ChEMBL | Phase 2 | F2 |
| NAPSAGATRAN | ChEMBL | Phase 2 | F2 |
| PROFLAVINE | ChEMBL | Phase 2 | F2 |
| RAZAXABAN | ChEMBL | Phase 2 | F2 |
| SEGATROXABAN | ChEMBL | Phase 2 | F2 |
| TANOGITRAN | ChEMBL | Phase 2 | F2 |
| Echothiophate | PubChem | Approved | F2 |
| Pimavanserin | PubChem | Approved | F2 |
| Propylene Glycol | PubChem | Approved | F2 |
| Pyrazinamide | PubChem | Approved | F2 |
| Pyridoxine | PubChem | Approved | F2 |
| Vorapaxar | PubChem | Approved | F2 |
Related Atlas pages
- Genes: F2
- Diseases: thrombotic disease
- Drugs: Apixaban, Edoxaban, Argatroban, Benzoyl Peroxide, Betrixaban, Bivalirudin, Bortezomib, Captopril, Cianidanol, Dabigatran Etexilate, Dequalinium, Hexamidine, Liothyronine, Lusutrombopag, Melagatran, Methylprednisolone, Pentamidine, Rivaroxaban, Succimer, Sulfaguanidine, Telotristat, Camostat, Gabexate, Milvexian, Nafamostat, Quercetin, Silibinin, Echothiophate, Pimavanserin, Propylene Glycol, Pyrazinamide, Pyridoxine, Vorapaxar