Zileuton
drugOn this page
Also known as A-64077ABBOTT-64077NSC-730712NSC-759277ZyfloZyflo crSID26719885SID29215400Zileuton (Racemate)SID144205233SID170465222SID174007276SID144211465(R,S)-ZileutonZileutonÊZileutonÂC0164523Ziletuton
Summary
Zileuton (CHEMBL93) is an approved small-molecule EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor targeting ALOX5; indicated across 9 conditions including asthma and chronic obstructive pulmonary disease.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- Targets: 1 (ALOX5)
- Indications: 9 conditions
- Clinical trials: 15
- Chemistry: 236.29 Da · C11H12N2O2S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL93 |
| Name | Zileuton |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 60490 |
| ChEBI | CHEBI:10112 |
| Molecular formula | C11H12N2O2S |
| Molecular weight | 236.29 |
| InChIKey | MWLSOWXNZPKENC-UHFFFAOYSA-N |
SMILES: CC(C1=CC2=CC=CC=C2S1)N(C(=O)N)O
IUPAC name: 1-[1-(1-benzothiophen-2-yl)ethyl]-1-hydroxyurea
ChEBI definition: A member of the class of 1-benzothiophenes that is 1-benzothiophene in which the hydrogen at position 2 is replaced by a 1-[carbamoyl(hydroxy)amino]ethyl group. A selective 5-lipoxygenase inhibitor, it inhibits the formation of leukotrienes LTB4, LTC4, LDT4, and LTE4. It is used for the management of chronic asthma.
Pharmacological roles (ChEBI): EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor, non-steroidal anti-inflammatory drug, anti-asthmatic drug, leukotriene antagonist, ferroptosis inhibitor.
Also known as: A-64077, ABBOTT-64077, NSC-730712, NSC-759277, Zileuton, Zyflo, Zyflo cr, zileuton, SID26719885, SID29215400, ZILEUTON, Zileuton (Racemate)
Patent coverage: 4,994 distinct patent families (21,372 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 21,291 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ALOX5 | 5-LOX | Inhibition | 5.82 | 0.7% | P09917 |
Broader ChEMBL bioactivity targets: 14 (assay-derived). Sample: Prelamin-A/C, Polyunsaturated fatty acid 5-lipoxygenase, Protein-lysine 6-oxidase, Prostaglandin G/H synthase 2, Bifunctional epoxide hydrolase 2, Lysosomal alpha-glucosidase, Polyunsaturated fatty acid lipoxygenase ALOX15, Polyunsaturated fatty acid 5-lipoxygenase, Polyunsaturated fatty acid lipoxygenase ALOX12, Leukotriene B4 receptor 1.
Bioactivity
ChEMBL activities: 127 potent at pChembl ≥ 5 of 135 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P12527 | 6.85 | IC50 | 140 | nM | CHEMBL_ACT_251914 |
| ALOX5 | 6.82 | IC50 | 150 | nM | CHEMBL_ACT_18792994 |
| ALOX5 | 6.82 | IC50 | 150 | nM | CHEMBL_ACT_22956981 |
| ALOX5 | 6.82 | IC50 | 150 | nM | CHEMBL_ACT_29056674 |
| P12527 | 6.75 | IC50 | 180 | nM | CHEMBL_ACT_18720728 |
| P48999 | 6.72 | IC50 | 190 | nM | CHEMBL_ACT_15754985 |
| P12527 | 6.7 | IC50 | 200 | nM | CHEMBL_ACT_578950 |
| LMNA | 6.65 | Potency | 223.9 | nM | CHEMBL_ACT_3648766 |
| ALOX5 | 6.52 | IC50 | 300 | nM | CHEMBL_ACT_13908007 |
| ALOX5 | 6.52 | IC50 | 300 | nM | CHEMBL_ACT_25633110 |
| ALOX5 | 6.5 | IC50 | 320 | nM | CHEMBL_ACT_1079003 |
| P12527 | 6.5 | IC50 | 320 | nM | CHEMBL_ACT_418340 |
| ALOX5 | 6.46 | IC50 | 350 | nM | CHEMBL_ACT_18783118 |
| P12527 | 6.43 | IC50 | 370 | nM | CHEMBL_ACT_221598 |
| ALOX5 | 6.41 | IC50 | 390 | nM | CHEMBL_ACT_25022365 |
| ALOX15 | 6.4 | IC50 | 400 | nM | CHEMBL_ACT_18050072 |
| ALOX5 | 6.4 | IC50 | 400 | nM | CHEMBL_ACT_2594356 |
| ALOX5 | 6.39 | IC50 | 410 | nM | CHEMBL_ACT_13488775 |
| LTB4R | 6.38 | IC50 | 420 | nM | CHEMBL_ACT_828284 |
| ALOX5 | 6.33 | EC50 | 470 | nM | CHEMBL_ACT_717637 |
| ALOX5 | 6.3 | IC50 | 500 | nM | CHEMBL_ACT_10891611 |
| ALOX5 | 6.3 | IC50 | 500 | nM | CHEMBL_ACT_10891647 |
| ALOX5 | 6.3 | IC50 | 500 | nM | CHEMBL_ACT_12086154 |
| ALOX5 | 6.3 | IC50 | 500 | nM | CHEMBL_ACT_12186796 |
| P12527 | 6.3 | IC50 | 500 | nM | CHEMBL_ACT_1238228 |
| ALOX5 | 6.3 | IC50 | 500 | nM | CHEMBL_ACT_19307563 |
| P12527 | 6.3 | IC50 | 500 | nM | CHEMBL_ACT_749562 |
| P12527 | 6.3 | IC50 | 500 | nM | CHEMBL_ACT_804137 |
| ALOX5 | 6.3 | IC50 | 500 | nM | CHEMBL_ACT_8052312 |
| P12527 | 6.3 | IC50 | 500 | nM | CHEMBL_ACT_945300 |
Target pathways
Aggregated over 1 target gene(s): ALOX5.
Top Reactome pathways
29 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Cytokine Signaling in Immune system | 1 | ALOX5 |
| Metabolism | 1 | ALOX5 |
| Innate Immune System | 1 | ALOX5 |
| Immune System | 1 | ALOX5 |
| Synthesis of 5-eicosatetraenoic acids | 1 | ALOX5 |
| Synthesis of Leukotrienes (LT) and Eoxins (EX) | 1 | ALOX5 |
| Biosynthesis of Lipoxins (LX) | 1 | ALOX5 |
| Arachidonate metabolism | 1 | ALOX5 |
| Interleukin-1 family signaling | 1 | ALOX5 |
| Signaling by Interleukins | 1 | ALOX5 |
| Metabolism of lipids | 1 | ALOX5 |
| Interleukin-4 and Interleukin-13 signaling | 1 | ALOX5 |
| Neutrophil degranulation | 1 | ALOX5 |
| Fatty acid metabolism | 1 | ALOX5 |
| Interleukin-18 signaling | 1 | ALOX5 |
| Biosynthesis of D-series resolvins | 1 | ALOX5 |
| Biosynthesis of DHA-derived SPMs | 1 | ALOX5 |
| Biosynthesis of specialized proresolving mediators (SPMs) | 1 | ALOX5 |
| Biosynthesis of EPA-derived SPMs | 1 | ALOX5 |
| Biosynthesis of maresins | 1 | ALOX5 |
| Biosynthesis of DPA-derived SPMs | 1 | ALOX5 |
| Biosynthesis of E-series 18(S)-resolvins | 1 | ALOX5 |
| Biosynthesis of aspirin-triggered D-series resolvins | 1 | ALOX5 |
| Biosynthesis of E-series 18(R)-resolvins | 1 | ALOX5 |
| Biosynthesis of DPAn-3 SPMs | 1 | ALOX5 |
| Biosynthesis of DPAn-3-derived protectins and resolvins | 1 | ALOX5 |
| Biosynthesis of DPAn-3-derived maresins | 1 | ALOX5 |
| Biosynthesis of DPAn-3-derived 13-series resolvins | 1 | ALOX5 |
| Biosynthesis of electrophilic ω-3 PUFA oxo-derivatives | 1 | ALOX5 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| negative regulation of endothelial cell proliferation | 1 |
| leukocyte chemotaxis involved in inflammatory response | 1 |
| leukocyte migration involved in inflammatory response | 1 |
| leukotriene production involved in inflammatory response | 1 |
| leukotriene metabolic process | 1 |
| humoral immune response | 1 |
| negative regulation of angiogenesis | 1 |
| arachidonate metabolic process | 1 |
| leukotriene biosynthetic process | 1 |
| lipoxygenase pathway | 1 |
| positive regulation of bone mineralization | 1 |
| lipid oxidation | 1 |
| dendritic cell migration | 1 |
| glucose homeostasis | 1 |
| long-chain fatty acid biosynthetic process | 1 |
Indications & clinical
Indications
9 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| asthma | 4 | MONDO:0004979 | MONDO:0004979 |
| chronic obstructive pulmonary disease | 3 | MONDO:0005002 | EFO:0000341 |
| nicotine dependence | 2 | MONDO:0008575 | EFO:0003768 |
| idiopathic pulmonary fibrosis | 2 | MONDO:0800504 | EFO:0000768 |
| acne | 2 | MONDO:0011438 | EFO:0003894 |
| lung neoplasm | 2 | MONDO:0021117 | MONDO:0008903 |
| chronic myeloid leukemia | 1 | MONDO:0011996 | EFO:0000339 |
| sickle cell disease | 1 | MONDO:0011382 | MONDO:0011382 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 15.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 7 |
| PHASE1/PHASE2 | 3 |
| PHASE1 | 2 |
| PHASE4 | 1 |
| PHASE3 | 1 |
| EARLY_PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00575861 | PHASE4 | COMPLETED | Zileuton and Exhaled Nitric Oxide in Asthmatics |
| NCT00493974 | PHASE3 | TERMINATED | Zileuton to Treat Adults With Chronic Obstructive Pulmonary Disease (The LEUKO Study) |
| NCT00056004 | PHASE2 | COMPLETED | Zileuton in Preventing Lung Cancer in Patients With Bronchial Dysplasia |
| NCT00070486 | PHASE2 | COMPLETED | Carboplatin and Gemcitabine Combined With Celecoxib and/or Zileuton in Treating Patients With Advanced Non-Small Cell Lung Cancer |
| NCT00098358 | PHASE2 | UNKNOWN | Study of Oral Zileuton in the Treatment of Moderate to Severe Facial Acne Vulgaris |
| NCT00262405 | PHASE2 | COMPLETED | Zileuton for the Treatment of Idiopathic Pulmonary Fibrosis |
| NCT00299065 | PHASE1/PHASE2 | COMPLETED | Safety Study of Zileuton Injection in Patients With Asthma |
| NCT00467831 | PHASE1/PHASE2 | TERMINATED | Pilot Study of a Multi-Drug Regimen for Severe Pulmonary Fibrosis in Hermansky-Pudlak Syndrome |
| NCT00534625 | PHASE2 | COMPLETED | Assessment of PFT, Safety, and PK of Zileuton Injection in Asthma Patients |
| NCT00723021 | PHASE2 | COMPLETED | PF-04191834 Single Dose Bronchodilatory Study In Asthma. |
| NCT01021215 | PHASE1/PHASE2 | COMPLETED | Zileuton With or Without Celecoxib As Chemopreventive Agents in Smokers |
| NCT02348203 | PHASE2 | COMPLETED | Aspirin and Zileuton and Biomarker Expression in Nasal Tissue of Current Smokers |
| NCT01130688 | PHASE1 | TERMINATED | Safety of Zileuton (Zyflo) in Combination With Imatinib Mesylate (Gleevec) in CML. |
| NCT01136941 | PHASE1 | COMPLETED | Trial of Zileuton CR in Children and Adults With Sickle Cell Disease |
| NCT01174056 | EARLY_PHASE1 | COMPLETED | Evaluation of Rosiglitazone Anti-inflammatory Effect With FDG-PET Imaging |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 1 clinical and 1 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
33 molecules share ≥1 primary target. Top 33 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CAPSAICIN | ChEMBL | Phase 4 (approved) | ALOX5 |
| CELECOXIB | ChEMBL | Phase 4 (approved) | ALOX5 |
| CHLOROXINE | ChEMBL | Phase 4 (approved) | ALOX5 |
| HEXYLRESORCINOL | ChEMBL | Phase 4 (approved) | ALOX5 |
| IBUPROFEN | ChEMBL | Phase 4 (approved) | ALOX5 |
| INDOMETHACIN | ChEMBL | Phase 4 (approved) | ALOX5 |
| CAFFEIC ACID | ChEMBL | Phase 3 | ALOX5 |
| CURCUMIN | ChEMBL | Phase 3 | ALOX5 |
| FIBOFLAPON | ChEMBL | Phase 3 | ALOX5 |
| HYDROXYTYROSOL | ChEMBL | Phase 3 | ALOX5 |
| QUERCETIN | ChEMBL | Phase 3 | ALOX5 |
| RESVERATROL | ChEMBL | Phase 3 | ALOX5 |
| VELIFLAPON | ChEMBL | Phase 3 | ALOX5 |
| ANTHRALIN | ChEMBL | Phase 2 | ALOX5 |
| ATRELEUTON | ChEMBL | Phase 2 | ALOX5 |
| DOCEBENONE | ChEMBL | Phase 2 | ALOX5 |
| ENOFELAST | ChEMBL | Phase 2 | ALOX5 |
| ENOXOLONE | ChEMBL | Phase 2 | ALOX5 |
| FENLEUTON | ChEMBL | Phase 2 | ALOX5 |
| LICOFELONE | ChEMBL | Phase 2 | ALOX5 |
| LUTEOLIN | ChEMBL | Phase 2 | ALOX5 |
| MK-7622 | ChEMBL | Phase 2 | ALOX5 |
| NAFAZATROM | ChEMBL | Phase 2 | ALOX5 |
| PIPERINE | ChEMBL | Phase 2 | ALOX5 |
| PRIFELONE | ChEMBL | Phase 2 | ALOX5 |
| PTEROSTILBENE | ChEMBL | Phase 2 | ALOX5 |
| QUIFLAPON | ChEMBL | Phase 2 | ALOX5 |
| SETILEUTON | ChEMBL | Phase 2 | ALOX5 |
| TAGORIZINE | ChEMBL | Phase 2 | ALOX5 |
| TEBUFELONE | ChEMBL | Phase 2 | ALOX5 |
| TEPOXALIN | ChEMBL | Phase 2 | ALOX5 |
| TOMELUKAST | ChEMBL | Phase 2 | ALOX5 |
| XANTHOHUMOL | ChEMBL | Phase 2 | ALOX5 |
Related Atlas pages
- Genes: ALOX5
- Diseases: asthma, chronic obstructive pulmonary disease
- Drugs: Capsaicin, Celecoxib, Chloroxine, Hexylresorcinol, Ibuprofen, Indomethacin, Caffeic Acid, Curcumin, Fiboflapon, Hydroxytyrosol, Quercetin, Resveratrol, Veliflapon