Ziprasidone
drugOn this page
Also known as CP-88059ZipradonZiprasidonaSID26719835SID144205747SID144207074SID170465342
Summary
Ziprasidone (CHEMBL708) is an approved small-molecule psychotropic drug (ATC N05AE04) targeting HTR7, HTR1A, and DRD2; indicated across 15 conditions including psychotic disorder and schizoaffective disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N05AE04
- Targets: 11 (HTR7, HTR1A, DRD2…)
- Indications: 15 conditions
- Clinical trials: 108
- Chemistry: 412.9 Da · C21H21ClN4OS
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL708 |
| Name | Ziprasidone |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 60854 |
| ChEBI | CHEBI:10119 |
| ATC | N05AE04 |
| Molecular formula | C21H21ClN4OS |
| Molecular weight | 412.9 |
| InChIKey | MVWVFYHBGMAFLY-UHFFFAOYSA-N |
SMILES: C1CN(CCN1CCC2=C(C=C3C(=C2)CC(=O)N3)Cl)C4=NSC5=CC=CC=C54
IUPAC name: 5-[2-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-6-chloro-1,3-dihydroindol-2-one
ChEBI definition: A piperazine compound having 1,2-benzothiazol-3-yl- and 2-(6-chloro-1,3-dihydro-2-oxindol-5-yl)ethyl substituents attached to the nitrogen atoms.
Pharmacological roles (ChEBI): psychotropic drug, histamine antagonist, muscarinic antagonist, serotonergic antagonist, dopaminergic antagonist, antipsychotic agent.
Also known as: CP-88059, Zipradon, Ziprasidona, Ziprasidone, ziprasidone, SID26719835, SID144205747, SID144207074, ZIPRASIDONE, SID170465342
Parent form; salt/anhydrous children: CHEMBL1375743, CHEMBL3989833
Patent coverage: 5,393 distinct patent families (21,536 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 21,392 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| HTR7 | 5-HT7 receptor | Inverse agonist | 8.4 | 0.8% | P34969 |
| HTR1A | 5-HT1A receptor | Partial agonist | 8.9 | 0% | P08908 |
| DRD2 | D2 receptor | Antagonist | 8.55 | 0% | P14416 |
| HRH1 | H1 receptor | Antagonist | 7.8 | 0% | P35367 |
| HTR1B | 5-HT1B receptor | Full agonist | 8.3 | 0.2% | P28222 |
| HTR1D | 5-HT1D receptor | Full agonist | 9 | 0% | P28221 |
| HTR1E | 5-ht1e receptor | Full agonist | 6.4 | 0% | P28566 |
| HTR2A | 5-HT2A receptor | Antagonist | 9.51 | 0% | P28223 |
| HTR2C | 5-HT2C receptor | Inverse agonist | 9.01 | 0% | P28335 |
| SLC6A2 | NET | Inhibition | 7.32 | 0.4% | P23975 |
| SLC6A4 | SERT | Inhibition | 7.28 | 0.7% | P31645 |
Broader ChEMBL bioactivity targets: 44 (assay-derived). Sample: Microtubule-associated protein tau, Nuclear receptor ROR-gamma, 5-hydroxytryptamine receptor 2B, Alpha-2A adrenergic receptor, Adrenergic receptor alpha-1, Alpha-2C adrenergic receptor, Histamine H2 receptor, Alpha-2B adrenergic receptor, D(1A) dopamine receptor, Progesterone receptor.
Bioactivity
ChEMBL activities: 138 potent at pChembl ≥ 5 of 145 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| HTR2A | 10.1 | Ki | 0.08 | nM | CHEMBL_ACT_2075811 |
| HTR2A | 9.6 | Ki | 0.25 | nM | CHEMBL_ACT_694742 |
| HTR2A | 9.55 | Ki | 0.28 | nM | CHEMBL_ACT_16312068 |
| HTR2A | 9.55 | Ki | 0.28 | nM | CHEMBL_ACT_26580330 |
| HTR2A | 9.52 | Ki | 0.3 | nM | CHEMBL_ACT_434838 |
| HTR2A | 9.41 | Ki | 0.39 | nM | CHEMBL_ACT_2577190 |
| HTR2A | 9.4 | Ki | 0.4 | nM | CHEMBL_ACT_13828633 |
| HTR2A | 9.38 | IC50 | 0.42 | nM | CHEMBL_ACT_1617790 |
| P14842 | 9.38 | Ki | 0.42 | nM | CHEMBL_ACT_495499 |
| P14842 | 9.38 | Ki | 0.42 | nM | CHEMBL_ACT_495502 |
| P43140 | 9.3 | Ki | 0.5 | nM | CHEMBL_ACT_2075859 |
| HTR2A | 9.3 | AC50 | 0.5 | nM | CHEMBL_ACT_25173726 |
| HTR2C | 9.26 | Ki | 0.55 | nM | CHEMBL_ACT_694743 |
| HTR2A | 9.2 | Ki | 0.63 | nM | CHEMBL_ACT_1925231 |
| HTR2C | 9.14 | Ki | 0.72 | nM | CHEMBL_ACT_2577206 |
| DRD2 | 9.1 | Ki | 0.8 | nM | CHEMBL_ACT_18653019 |
| DRD2 | 9.07 | Ki | 0.85 | nM | CHEMBL_ACT_19047094 |
| DRD2 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_19047099 |
| DRD2 | 9.05 | Ki | 0.9 | nM | CHEMBL_ACT_19216844 |
| HTR2C | 8.9 | Ki | 1.26 | nM | CHEMBL_ACT_1925257 |
| HTR2C | 8.89 | Ki | 1.3 | nM | CHEMBL_ACT_13828635 |
| HTR2B | 8.8 | Ki | 1.58 | nM | CHEMBL_ACT_1924793 |
| HTR1A | 8.8 | Ki | 1.58 | nM | CHEMBL_ACT_1925222 |
| HTR2A | 8.77 | Ki | 1.7 | nM | CHEMBL_ACT_18653172 |
| ADRA1D | 8.72 | Ki | 1.9 | nM | CHEMBL_ACT_694744 |
| HTR1A | 8.7 | Ki | 2 | nM | CHEMBL_ACT_18653223 |
| DRD2 | 8.68 | Ki | 2.1 | nM | CHEMBL_ACT_17977958 |
| DRD2 | 8.68 | Ki | 2.1 | nM | CHEMBL_ACT_18899365 |
| HTR1A | 8.6 | Ki | 2.5 | nM | CHEMBL_ACT_2577174 |
| DRD2 | 8.55 | Ki | 2.8 | nM | CHEMBL_ACT_694738 |
Target pathways
Aggregated over 11 target gene(s): HTR7, HTR1A, DRD2, HRH1, HTR1B, HTR1D, HTR1E, HTR2A, HTR2C, SLC6A2, SLC6A4.
Top Reactome pathways
25 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 7 | HTR1A, HTR1B, HTR1D, HTR1E, HTR2A, HTR2C, HTR7 |
| Signaling by GPCR | 7 | HTR1A, HTR1B, HTR1D, HTR1E, HTR2A, HTR2C, HTR7 |
| Class A/1 (Rhodopsin-like receptors) | 7 | HTR1A, HTR1B, HTR1D, HTR1E, HTR2A, HTR2C, HTR7 |
| Amine ligand-binding receptors | 7 | HTR1A, HTR1B, HTR1D, HTR1E, HTR2A, HTR2C, HTR7 |
| Serotonin receptors | 7 | HTR1A, HTR1B, HTR1D, HTR1E, HTR2A, HTR2C, HTR7 |
| GPCR ligand binding | 7 | HTR1A, HTR1B, HTR1D, HTR1E, HTR2A, HTR2C, HTR7 |
| GPCR downstream signalling | 6 | HTR1B, HTR1D, HTR1E, HTR2A, HTR2C, HTR7 |
| G alpha (q) signalling events | 3 | HRH1, HTR2A, HTR2C |
| G alpha (i) signalling events | 3 | HTR1B, HTR1D, HTR1E |
| SLC-mediated transport of neurotransmitters | 2 | SLC6A2, SLC6A4 |
| Neurotransmitter clearance | 1 | SLC6A4 |
| Transmission across Chemical Synapses | 1 | SLC6A4 |
| Neuronal System | 1 | SLC6A4 |
| Disease | 1 | SLC6A2 |
| Serotonin clearance from the synaptic cleft | 1 | SLC6A4 |
| Transport of small molecules | 1 | SLC6A2 |
| Histamine receptors | 1 | HRH1 |
| Dopamine receptors | 1 | DRD2 |
| G alpha (s) signalling events | 1 | HTR7 |
| R-HSA-425366 | 1 | SLC6A2 |
| SLC-mediated transmembrane transport | 1 | SLC6A2 |
| SLC transporter disorders | 1 | SLC6A2 |
| Defective SLC6A2 causes orthostatic intolerance (OI) | 1 | SLC6A2 |
| Disorders of transmembrane transporters | 1 | SLC6A2 |
| RHOBTB3 ATPase cycle | 1 | HTR7 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| chemical synaptic transmission | 9 |
| signal transduction | 9 |
| G protein-coupled receptor signaling pathway | 9 |
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 8 |
| vasoconstriction | 4 |
| G protein-coupled serotonin receptor signaling pathway | 4 |
| adenylate cyclase-inhibiting serotonin receptor signaling pathway | 4 |
| response to xenobiotic stimulus | 4 |
| phospholipase C-activating serotonin receptor signaling pathway | 4 |
| serotonin receptor signaling pathway | 3 |
| regulation of behavior | 3 |
| adenylate cyclase-activating G protein-coupled receptor signaling pathway | 3 |
| intracellular calcium ion homeostasis | 3 |
| phospholipase C-activating G protein-coupled receptor signaling pathway | 3 |
| behavioral response to cocaine | 3 |
Indications & clinical
Indications
15 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| psychotic disorder | 4 | MONDO:0005485 | EFO:0005407 |
| schizoaffective disorder | 4 | MONDO:0005487 | EFO:0005411 |
| anxiety | 3 | MONDO:0011918 | EFO:0005230 |
| dementia | 3 | MONDO:0001627 | HP:0000726 |
| depressive disorder | 3 | MONDO:0002050 | MONDO:0002050 |
| bipolar disorder | 3 | MONDO:0004985 | MONDO:0004985 |
| autism | 2 | MONDO:0005260 | EFO:0003758 |
| mood disorder | 2 | MONDO:0005371 | EFO:0004247 |
| social phobia | 2 | MONDO:0001247 | EFO:1001917 |
| borderline personality disorder | 2 | MONDO:0001156 | HP:0012076 |
| major depressive disorder | 2 | MONDO:0002009 | MONDO:0002009 |
| cardiovascular disorder | 1 | MONDO:0004995 | EFO:0000319 |
| opiate dependence | 0 | MONDO:0005530 | EFO:0005611 |
| drug dependence | 0 | MONDO:0005303 | EFO:0003890 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 108.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 45 |
| PHASE3 | 28 |
| Not specified | 16 |
| PHASE2 | 11 |
| PHASE1 | 3 |
| PHASE2/PHASE3 | 2 |
| EARLY_PHASE1 | 2 |
| PHASE1/PHASE2 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00014001 | PHASE4 | COMPLETED | CATIE- Schizophrenia Trial |
| NCT00034801 | PHASE4 | COMPLETED | Olanzapine Versus Active Comparator in the Treatment of Depression in Patients With Schizophrenia |
| NCT00044655 | PHASE4 | COMPLETED | Switching Medication to Treat Schizophrenia |
| NCT00048802 | PHASE4 | COMPLETED | Treatment and Outcome of Early Onset Bipolar Disorder |
| NCT00137020 | PHASE4 | COMPLETED | Clinical Effect Of Cross Titration Of Antipsychotics With Ziprasidone In Schizophrenia Or Schizoaffective Disorder |
| NCT00148564 | PHASE4 | COMPLETED | Energy Homeostasis Under Treatment With Atypical Antipsychotics |
| NCT00181922 | PHASE4 | COMPLETED | Ziprasidone for the Treatment of Mania in Children and Adolescents With Bipolar Disorder |
| NCT00199940 | PHASE4 | COMPLETED | Safety And Efficacy Study Of Ziprasidone In Pediatric Psychotic Illness |
| NCT00208208 | PHASE4 | COMPLETED | Geodon (Ziprasidone) for Posttraumatic Stress Disorder |
| NCT00224315 | PHASE4 | COMPLETED | Clozapine-Augmentation With Ziprasidone or Risperidone, a Randomized, Prospective Trial |
| NCT00237666 | PHASE4 | COMPLETED | Open-Label Study of Geodon in Non-Rapid Cycling Bipolar II Patients With Major Depression |
| NCT00239109 | PHASE4 | COMPLETED | Ziprasidone Versus Olanzapine In The Treatment Of Schizophrenia. |
| NCT00330863 | PHASE4 | COMPLETED | Preventing Relapse in Schizophrenia: Oral Antipsychotics Compared To Injectables: Evaluating Efficacy |
| NCT00351000 | PHASE4 | COMPLETED | Ziprasidone for Clozapine- or Olanzapine-Associated Diabetes Mellitus |
| NCT00374543 | PHASE4 | TERMINATED | Ziprasidone for the Treatment of Generalized Anxiety in Patients With Bipolar Disorder |
| NCT00406315 | PHASE4 | COMPLETED | Study Evaluating The Safety, Tolerability, And Efficacy Of Switching From Quetiapine To Ziprasidone |
| NCT00418171 | PHASE4 | COMPLETED | Large Simple Trial (LST) Of Cardiovascular Safety Of Ziprasidone And Olanzapine- (Zodiac) |
| NCT00458211 | PHASE4 | COMPLETED | Efficacy and Tolerability of Switching to Ziprasidone From Other Antipsychotics |
| NCT00472641 | PHASE4 | COMPLETED | Geodon in Weight Loss Study for Bipolar Disorders |
| NCT00622739 | PHASE4 | COMPLETED | Ziprasidone in Pediatric Bipolar Disorder |
| NCT00634348 | PHASE4 | COMPLETED | A Study Comparing the Efficacy and Safety of Ziprasidone and Aripiprazole for the Treatment fo Schizophrenia or Schizoaffective Disorder in Hospitalized Patients |
| NCT00644800 | PHASE4 | COMPLETED | A Study of the Efficacy and Safety of Intramuscular Ziprasidone Followed by Oral Ziprasidone for the Treatment of Psychosis |
| NCT00645320 | PHASE4 | COMPLETED | A Study of Ziprasidone for the Treatment of Psychosis in Patients Who Had Already Had Benefits From Ziprasidone Treatment in a Previous Study |
| NCT00649064 | PHASE4 | COMPLETED | A Study of the Effects of Ziprasidone for the Treatment of Schizophrenia or Schizoaffective Disorder in Patients Who Were Switched From Other Antipsychotic Drugs |
| NCT00650429 | PHASE4 | COMPLETED | A Study of the Efficacy and Safety of Ziprasidone for the Treatment of Acute Exacerbation of Schizophrenia or Schizoaffective Disorder |
| NCT00748566 | PHASE4 | TERMINATED | One-Year Trial Of Oral Ziprasidone In Patients With Metabolic Syndrome |
| NCT00786318 | PHASE4 | WITHDRAWN | Ziprasidone vs Standard Therapy for Agitated Patients in the ED |
| NCT00932529 | PHASE4 | COMPLETED | Use, Effects and Side-effects of Second-generation Antipsychotics in a Naturalistic Setting |
| NCT01157559 | PHASE4 | COMPLETED | Efficacy and Safety With Ziprasidone in First-episode Psychosis |
| NCT01168674 | PHASE4 | COMPLETED | Predictors of Response to Augmentation With Ziprasidone (Geodon®) in Major Depressive Disorder |
| NCT01172652 | PHASE4 | COMPLETED | Ziprasidone in Bipolar Disorder With Comorbid Lifetime Panic or Generalized Anxiety Disorder(GAD) |
| NCT01185743 | PHASE4 | COMPLETED | Antipsychotics and Gene Expression in Soft Tissues |
| NCT01198353 | PHASE4 | COMPLETED | Effectiveness of Ziprasidone for Patients With Schizophrenia |
| NCT01293825 | PHASE4 | COMPLETED | Ziprasidone Switching in Response to Adherence and Psychotropic-Related Weight Gain Concerns Among Patients With Bipolar Disorder (Zip Ad) |
| NCT01714011 | PHASE4 | COMPLETED | Safety and Efficacy of Aripiprazole and Ziprasidone Among Schizophrenic Patients With Metabolic Syndrome |
| NCT01844700 | PHASE4 | TERMINATED | 1/2-MC4R Genotype and Pediatric Antipsychotic Drug- Induced Weight Gain |
| NCT01893229 | PHASE4 | UNKNOWN | Comparative Efficacy and Acceptability of Antimanic Drugs in Acute Mania |
| NCT02040883 | PHASE4 | UNKNOWN | Tandospirone Combined With Atypical Antipsychotic Drugs in Schizophrenia |
| NCT02282085 | PHASE4 | UNKNOWN | Treatment Study Comparing Aripiprazole Once Monthly With Standard of Care Medication in Outpatients With Schizophrenia |
| NCT02305823 | PHASE4 | COMPLETED | Comparative Study of Aripiprazole, Quetiapine and Ziprasidone in the Treatment of First Episode Nonaffective Psychosis |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 3 clinical and 24 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
950 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| BREXPIPRAZOLE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1B, HTR1D, HTR1E, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| Dihydroergotamine | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1B, HTR1D, HTR1E, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| IMIPRAMINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1B, HTR1D, HTR1E, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| RISPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1B, HTR1D, HTR1E, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| CLOZAPINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1B, HTR1E, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1B, HTR1D, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| AZELASTINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1B, HTR1D, HTR1E, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| NEFAZODONE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1B, HTR1D, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| RITANSERIN | ChEMBL | Phase 2 | DRD2, HRH1, HTR1A, HTR1B, HTR1E, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| CYPROHEPTADINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1E, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| OLANZAPINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1B, HTR1E, HTR2A, HTR2C, HTR7, SLC6A4 |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1B, HTR1D, HTR2A, HTR2C, HTR7, SLC6A4 |
| CINACALCET | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1D, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| KETANSERIN | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1B, HTR1D, HTR2A, HTR2C, HTR7, SLC6A4 |
| MIANSERIN | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1D, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| SALMETEROL | ChEMBL | Phase 4 (approved) | DRD2, HTR1A, HTR1B, HTR1D, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| PENFLURIDOL | ChEMBL | Phase 2 | DRD2, HRH1, HTR1A, HTR1D, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| ASENAPINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1E, HTR2A, HTR2C, SLC6A2, SLC6A4 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| DOXEPIN | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| FLUPHENAZINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| HALOPERIDOL | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| LOXAPINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| PERPHENAZINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| PROMAZINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| SERTINDOLE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1B, HTR2A, HTR2C, SLC6A2, SLC6A4 |
| TEGASEROD | ChEMBL | Phase 4 (approved) | DRD2, HTR1A, HTR1D, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| THIORIDAZINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| VILAZODONE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1B, HTR1D, HTR7, SLC6A2, SLC6A4 |
| LYSERGIDE | ChEMBL | Phase 2 | DRD2, HRH1, HTR1A, HTR1D, HTR1E, HTR2A, HTR2C, HTR7 |
| METERGOLINE | ChEMBL | Phase 2 | DRD2, HRH1, HTR1A, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| NIGULDIPINE | ChEMBL | Phase 2 | DRD2, HRH1, HTR1A, HTR1B, HTR2C, HTR7, SLC6A2, SLC6A4 |
| PIZOTYLINE | ChEMBL | Phase 2 | DRD2, HRH1, HTR1A, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| Pyrazinamide | PubChem | Approved | DRD2, HRH1, HTR1A, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| AMITRIPTYLINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, SLC6A2, SLC6A4 |
| DESLORATADINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, SLC6A2, SLC6A4 |
| ERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HTR1A, HTR1B, HTR1D, HTR1E, HTR2A, HTR2C |
| Fidaxomicin | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, SLC6A2, SLC6A4 |
| PALIPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1B, HTR1D, HTR2A, HTR2C, HTR7 |
| PRAMIPEXOLE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1B, HTR1E, HTR2A, HTR7 |
| Propoxyphene | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, SLC6A2, SLC6A4 |
| QUETIAPINE | ChEMBL + PubChem | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR1E, HTR2A, HTR2C, HTR7 |
| RIZATRIPTAN | ChEMBL + PubChem | Phase 4 (approved) | HRH1, HTR1A, HTR1B, HTR1D, HTR1E, HTR2A, HTR2C |
| SUMATRIPTAN | ChEMBL + PubChem | Phase 4 (approved) | HTR1A, HTR1B, HTR1D, HTR1E, HTR2A, HTR2C, HTR7 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | DRD2, HTR1A, HTR2A, HTR2C, HTR7, SLC6A2, SLC6A4 |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, HTR7, SLC6A4 |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, SLC6A2, SLC6A4 |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, SLC6A2, SLC6A4 |
| CYCLOBENZAPRINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, SLC6A2, SLC6A4 |
| DIBENZEPIN | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR7, SLC6A2, SLC6A4 |
| DOMPERIDONE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, SLC6A2, SLC6A4 |
| DULOXETINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, SLC6A2, SLC6A4 |
| EBASTINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, SLC6A2, SLC6A4 |
| ILOPERIDONE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, SLC6A2, SLC6A4 |
| LURASIDONE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, HTR7, SLC6A2 |
| NORTRIPTYLINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, SLC6A2, SLC6A4 |
| PIMOZIDE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, SLC6A2, SLC6A4 |
| PIPERACETAZINE | ChEMBL | Phase 4 (approved) | DRD2, HRH1, HTR1A, HTR2A, HTR2C, SLC6A2, SLC6A4 |
Related Atlas pages
- Genes: HTR7, HTR1A, DRD2, HRH1, HTR1B, HTR1D, HTR1E, HTR2A, HTR2C, SLC6A2, SLC6A4
- Diseases: psychotic disorder, schizoaffective disorder, anxiety, dementia, depressive disorder, bipolar disorder
- Drugs: Brexpiprazole, Dihydroergotamine, Imipramine, Risperidone, Clozapine, Aripiprazole, Azelastine, Nefazodone, Cyproheptadine, Olanzapine, Cariprazine, Cinacalcet, Ketanserin, Mianserin, Salmeterol, Asenapine, Amoxapine, Astemizole, Chlorpromazine, Doxepin, Fluphenazine, Haloperidol, Loxapine, Perphenazine, Promazine, Sertindole, Tegaserod, Thioridazine, Vilazodone, Pyrazinamide, Amitriptyline, Desloratadine, Ergotamine, Fidaxomicin, Paliperidone, Pramipexole, Propoxyphene, Quetiapine, Rizatriptan, Sumatriptan, Carvedilol, Cisapride, Clemastine, Clomipramine, Cyclobenzaprine, Dibenzepin, Domperidone, Duloxetine, Ebastine, Iloperidone, Lurasidone, Nortriptyline, Pimozide, Piperacetazine