CYP4F2
gene geneOn this page
Summary
CYP4F2 (cytochrome P450 family 4 subfamily F member 2, HGNC:2645) is a protein-coding gene on chromosome 19p13.12, encoding Cytochrome P450 4F2 (P78329). A cytochrome P450 monooxygenase involved in the metabolism of various endogenous substrates, including fatty acids, eicosanoids and vitamins.
This gene encodes a member of the cytochrome P450 superfamily of enzymes. The cytochrome P450 proteins are monooxygenases which catalyze many reactions involved in drug metabolism and synthesis of cholesterol, steroids and other lipids. This protein localizes to the endoplasmic reticulum. The enzyme starts the process of inactivating and degrading leukotriene B4, a potent mediator of inflammation. This gene is part of a cluster of cytochrome P450 genes on chromosome 19. Another member of this family, CYP4F11, is approximately 16 kb away.
Source: NCBI Gene 8529 — RefSeq curated summary.
At a glance
- GWAS associations: 21
- Clinical variants (ClinVar): 109 total
- Druggable target: yes — 2 molecules with ChEMBL bioactivity
- MANE Select transcript:
NM_001082
Identifiers
Gene identifiers
| Field | Value |
|---|---|
| HGNC ID | HGNC:2645 |
| Approved symbol | CYP4F2 |
| Name | cytochrome P450 family 4 subfamily F member 2 |
| Location | 19p13.12 |
| Locus type | gene with protein product |
| Status | Approved |
| Ensembl gene | ENSG00000186115 |
| Ensembl biotype | protein_coding |
| OMIM | 604426 |
| Entrez | 8529 |
Gene structure
Transcript identifiers
Ensembl transcripts: 23 — 19 protein_coding, 3 retained_intron, 1 nonsense_mediated_decay
ENST00000011989, ENST00000221700, ENST00000392846, ENST00000586927, ENST00000587671, ENST00000589654, ENST00000592710, ENST00000608168, ENST00000886781, ENST00000886782, ENST00000886783, ENST00000886784, ENST00000886785, ENST00000886786, ENST00000886787, ENST00000886788, ENST00000886789, ENST00000886790, ENST00000886791, ENST00000886792, ENST00000886793, ENST00000886794, ENST00000965125
RefSeq mRNA: 1 — MANE Select: NM_001082
NM_001082
CCDS: CCDS12336
Canonical transcript exons
ENST00000221700 — 13 exons
| Exon | Start | End |
|---|---|---|
| ENSE00001347751 | 15898026 | 15898074 |
| ENSE00001666499 | 15878023 | 15878936 |
| ENSE00003482602 | 15879764 | 15879897 |
| ENSE00003501262 | 15890312 | 15890433 |
| ENSE00003507172 | 15885924 | 15886053 |
| ENSE00003529909 | 15889423 | 15889693 |
| ENSE00003589764 | 15886242 | 15886308 |
| ENSE00003625290 | 15879604 | 15879668 |
| ENSE00003634431 | 15879346 | 15879428 |
| ENSE00003637585 | 15895506 | 15895650 |
| ENSE00003706400 | 15897414 | 15897612 |
| ENSE00003725631 | 15892529 | 15892582 |
| ENSE00003728011 | 15892309 | 15892436 |
Expression profiles
Bgee: expression breadth ubiquitous, 148 present calls, max score 98.04.
FANTOM5 (CAGE): breadth tissue_specific, TPM avg 1.2797 / max 518.1381, expressed in 60 samples.
FANTOM5 promoters (1 alternative TSS)
| Promoter ID | TPM avg | Samples expressed |
|---|---|---|
| 179773 | 1.2797 | 60 |
Top tissues by expression
275 total, by Bgee expression score (0-100, higher = more expressed):
| Tissue | Anatomy ID | Expression score | Quality |
|---|---|---|---|
| jejunal mucosa | UBERON:0000399 | 98.04 | gold quality |
| right lobe of liver | UBERON:0001114 | 97.84 | gold quality |
| liver | UBERON:0002107 | 96.42 | gold quality |
| ileal mucosa | UBERON:0000331 | 95.83 | gold quality |
| duodenum | UBERON:0002114 | 93.48 | gold quality |
| corpus epididymis | UBERON:0004359 | 92.92 | gold quality |
| nephron tubule | UBERON:0001231 | 91.88 | gold quality |
| kidney epithelium | UBERON:0004819 | 89.50 | gold quality |
| renal glomerulus | UBERON:0000074 | 86.88 | gold quality |
| primordial germ cell in gonad | CL:0000670 ∩ UBERON:0000991 | 86.19 | gold quality |
| pancreatic ductal cell | CL:0002079 | 85.82 | silver quality |
| mucosa of transverse colon | UBERON:0004991 | 85.82 | gold quality |
| metanephric glomerulus | UBERON:0004736 | 85.72 | gold quality |
| upper arm skin | UBERON:0004263 | 83.47 | silver quality |
| small intestine | UBERON:0002108 | 82.98 | gold quality |
| small intestine Peyer’s patch | UBERON:0003454 | 82.64 | gold quality |
| male germ line stem cell (sensu Vertebrata) in testis | CL:0000089 ∩ UBERON:0000473 | 80.46 | gold quality |
| adult mammalian kidney | UBERON:0000082 | 80.19 | gold quality |
| adult organism | UBERON:0007023 | 79.29 | gold quality |
| kidney | UBERON:0002113 | 77.78 | gold quality |
| bone marrow | UBERON:0002371 | 76.66 | gold quality |
| hair follicle | UBERON:0002073 | 76.31 | gold quality |
| jejunum | UBERON:0002115 | 75.02 | gold quality |
| gall bladder | UBERON:0002110 | 74.56 | gold quality |
| cortex of kidney | UBERON:0001225 | 73.77 | gold quality |
| caput epididymis | UBERON:0004358 | 73.66 | gold quality |
| mammalian vulva | UBERON:0000997 | 72.86 | silver quality |
| epithelium of esophagus | UBERON:0001976 | 71.65 | silver quality |
| upper leg skin | UBERON:0004262 | 70.90 | silver quality |
| blood | UBERON:0000178 | 70.58 | gold quality |
Single-cell (SCXA)
Detected in 1 experiment(s), a significant marker in 1.
| Experiment | Marker? | Max mean expression |
|---|---|---|
| E-ANND-3 | no | 0.00 |
Regulation
Is transcription factor: no
Upstream regulators (CollecTRI, top): PPARA, RARA, SREBF1, SREBF2
miRNA regulators (miRDB)
36 targeting CYP4F2, top 30 by miRDB confidence (max_score; target_count = how many genes the miRNA targets in total — lower means more specific):
| miRNA | Max score | Avg score | miRNA target_count |
|---|---|---|---|
| HSA-MIR-4795-3P | 100.00 | 74.62 | 4024 |
| HSA-MIR-126-5P | 100.00 | 72.71 | 3180 |
| HSA-MIR-4500 | 99.99 | 72.72 | 2367 |
| HSA-LET-7A-5P | 99.98 | 72.29 | 1790 |
| HSA-LET-7B-5P | 99.98 | 72.31 | 1790 |
| HSA-LET-7C-5P | 99.98 | 72.29 | 1790 |
| HSA-LET-7E-5P | 99.98 | 72.29 | 1790 |
| HSA-LET-7F-5P | 99.98 | 72.56 | 1784 |
| HSA-LET-7G-5P | 99.98 | 72.37 | 1784 |
| HSA-LET-7I-5P | 99.98 | 72.37 | 1788 |
| HSA-MIR-98-5P | 99.98 | 72.33 | 1787 |
| HSA-LET-7D-5P | 99.96 | 71.76 | 1632 |
| HSA-MIR-4458 | 99.96 | 71.64 | 1650 |
| HSA-MIR-128-3P | 99.95 | 71.17 | 2484 |
| HSA-MIR-216A-3P | 99.95 | 71.19 | 2505 |
| HSA-MIR-577 | 99.78 | 69.13 | 2479 |
| HSA-MIR-1299 | 99.77 | 71.24 | 2389 |
| HSA-MIR-1296-3P | 99.72 | 64.04 | 636 |
| HSA-MIR-875-3P | 99.63 | 69.47 | 2548 |
| HSA-MIR-567 | 99.63 | 68.57 | 1219 |
| HSA-MIR-2392 | 99.43 | 67.50 | 708 |
| HSA-MIR-889-5P | 99.41 | 68.75 | 1025 |
| HSA-MIR-297 | 99.40 | 69.58 | 1418 |
| HSA-MIR-4318 | 99.38 | 66.94 | 1505 |
| HSA-MIR-7974 | 99.24 | 65.48 | 1137 |
| HSA-MIR-452-3P | 99.01 | 66.25 | 1241 |
| HSA-MIR-4520-3P | 98.75 | 66.55 | 963 |
| HSA-MIR-4501 | 98.72 | 67.19 | 921 |
| HSA-MIR-6830-3P | 98.62 | 68.07 | 1760 |
| HSA-MIR-4490 | 98.51 | 68.47 | 943 |
Literature-anchored findings (GeneRIF, showing 40)
- CYP4F2 transcription and that CYP4F2 induction by statins is mediated by SREBP-2. (PMID:17142457)
- CYP4F2-mediated tocopherol-omega-hydroxylation is a central feature underlying the different biological half-lives, and therefore biopotencies, of the tocopherols and tocotrienols (PMID:17284776)
- identification of a functional variant in the CYP4F2 gene that alters the production of 20-HETE (PMID:17341693)
- 3-hydroxystearate and 3-hydroxypalmitate are converted to omega-hydroxylated 3-OHDCA precursors in liver; CYP4F11 and, to a lesser extent, CYP4F2 catalyzed omega-hydroxylation of 3-hydroxystearate; CYP4F3b, CYP4F12, and CYP4A11 had negligible activity. (PMID:18065749)
- a functional variant of the CYP4F2 regulatory region, which increases the binding affinity of NF-kappaB, increases the risk for hypertension (PMID:18235092)
- Genetic variation of CYP4F2 was associated with a clinically relevant effect on warfarin requirement. (PMID:18250228)
- In humans that polymorphisms of the CYP4F2 and CYP4A11 genes have opposite effects on 20-hydroxyeicosatetraenoic acid excretion. (PMID:18391101)
- A common CYP4F2 V433M polymorphism might increase the risk of incident ischemic stroke in male subjects only partially through its elevating effect on BP. (PMID:18574070)
- analysis of the expression of CYP4F2 in human liver and kidney (PMID:18662666)
- A haplotype of the CYP4F2 gene is associated with cerebral infarction in Japanese men. (PMID:18787519)
- rs1558139 might be a genetic marker for essential hypertension and the T-T-G haplotype might be a protective genetic marker for it in Japanese men (PMID:18971550)
- Polymorphism of CYP4F2 gene is associated with myocardial infarction in Japanese men. (PMID:19097922)
- A relevant role for CYP4F2 V433M polymorphism in the pharmacogenetics of coumarin anticoagulants. (PMID:19270263)
- In the kidney of transgenic mice, human recombinant CYP4F2 was localized to renal proximal tubule epithelia and was expressed at a higher level than in control mice, leading to increased urinary 20-HETE excretion. (PMID:19279555)
- warfarin dose variance is explained by single nucleotide polymorphisms in VKORC1, CYP2C9, and CYP4F2 (PMID:19300499)
- Data from the present results indicated that MI was associated with G allele of rs2108622 in men, suggesting that T-C-G haplotype might serve as genetic marker for Myocardial Infarction in men. (PMID:19957603)
- Association of common variants of CYP4F2 with stroke in male Han Chinese population is reported. (PMID:20130494)
- CYP4F2 gene V433M polymorphism is associated with ischemic stroke in the male Northern Chinese Han population. (PMID:20227456)
- Significant associations with warfarin dose were seen for VKORC1 -1639, CYP2C9*2 and *3, the CYP4F2 SNP, and VKORC1 3730 (PMID:20499136)
- four genetic polymorphisms known to influence warfarin dosing (VKORC1 rs9923231, CYP2C9 rs1799853, CYP2C9 rs1057910 and CYP4F2 rs2108622) (PMID:20555338)
- Two common SNPs in CYP4F2 gene cause significant alterations in vitamin E-omega-hydroxylase specific activity using six dietary tocopherols and tocotrienols and arachidonic acid as substrates. (PMID:20861217)
- Phenprocoumon maintenance dosage depended on polymorphisms in the VKORC1 gene. CYP2C9 and CYP4F2 were of modest relevance. (PMID:21063236)
- Results indicate that pharmacogenetic testing for VKORC1*2, CYP2C9*2 and CYP2C9*3 polymorphisms is more informative regarding warfarin dose requirements than testing for VKORC1*3, VKORC1*4, and CYP4F2 (1347 C > T) polymorphisms. (PMID:21127708)
- The CYP4F2 V433M polymorphism is associated with the size of arterial wave reflections in male Chinese, or individuals with a faster pulse rate. (PMID:21150635)
- limited (to population groups) effect of genetic variants on maintenance warfarin dose in a multi-ethnic Asian population (PMID:21475774)
- Absence of novel CYP4F2 and VKORC1 coding region DNA variants in patients requiring high warfarin doses. (PMID:21562135)
- 1347A allele of CYP4F2 gene is an important risk factor for hypertension and ischemic stroke. (PMID:21625857)
- Impact of genetic factors (VKORC1, CYP2C9, CYP4F2 and EPHX1) on the anticoagulation response to fluindione (PMID:21883387)
- A novel CYP4F2 transgenic mouse model driven by the cyto-megalovirus (CMV) promoter was generated and identified by PCR and subsequent sequencing. (PMID:21887457)
- Quantitative PCR assays for VKORC1, CYP4F2, GGCX and CALU identified two copies in all populations. (PMID:22188360)
- The present study indicated that VKORC1, CYP4F2, and CYP2C9 genotypes and interacting drugs had a significant impact on the warfarin maintenance dose in Chinese patients with heart valve replacement (PMID:22198820)
- Approximately one fourth of Tibetans had the mutant T-allele of CYP4F2 rs108622 (PMID:22393834)
- The researchers evaluated the prevalence of the CYP4F2 polymorphism in a population of Omanis. (PMID:22452429)
- The initial positive association of the CYP4F2 V433M polymorphism with components of metabolic syndrome and MetS itself, found in MDC-CVA, was partially denied in another large cohort. (PMID:22484021)
- The multiple linear regression model including VKORC1-1639G>A, CYP2C9, CYP4F2 and clinical factors (body surface area (BSA) and age) could explain 42 % of the variance in the warfarin maintenance dose. (PMID:22528326)
- Report algorithm predicting warfarin dose in Chinese Han patients with valvular atrial fibrillation based on CYP4F2/CYP2C9/VKORC1 polymorphisms. (PMID:22534826)
- Dose variability in CYP4F2 genotypes is attributable to both warfarin clearance and sensitivity differences in Korean patients with mechanical heart valves. (PMID:22549502)
- Functional polymorphisms in CYP2C9, CYP4F2 and VKORC1 genes affect response to warfarin dose in an admixed Omani patient cohort. (PMID:22854539)
- CYP4F2 genetic variation did not affect the pharmacokinetics and pharmacodynamics of low-dose warfarin. (PMID:22855348)
- Found the frequency of the CYP4F2 rs2108622 C allele in individuals with implanted mechanical valve prostheses was 79.5% and T-allele frequency was 20.5%.TT-homozygous individuals required a 0.56 mg/day higher dose of warfarin than their CC counterparts. (PMID:23013706)
Cross-species orthologs
36 orthologs
| Organism | Symbol | Gene ID |
|---|---|---|
| danio_rerio | cyp4t8 | ENSDARG00000004964 |
| danio_rerio | cyp4f3 | ENSDARG00000053530 |
| mus_musculus | Cyp4f14 | ENSMUSG00000024292 |
| mus_musculus | Cyp4f15 | ENSMUSG00000073424 |
| mus_musculus | Cyp4f40 | ENSMUSG00000090700 |
| rattus_norvegicus | Cyp4f1 | ENSRNOG00000004786 |
| rattus_norvegicus | Cyp4f4 | ENSRNOG00000032895 |
| rattus_norvegicus | Cyp4f40 | ENSRNOG00000043344 |
| drosophila_melanogaster | Cyp4d1 | FBGN0005670 |
| drosophila_melanogaster | Cyp4d2 | FBGN0011576 |
| drosophila_melanogaster | Cyp4e2 | FBGN0014469 |
| drosophila_melanogaster | Cyp4c3 | FBGN0015032 |
| drosophila_melanogaster | Cyp4d8 | FBGN0015033 |
| drosophila_melanogaster | Cyp4e1 | FBGN0015034 |
| drosophila_melanogaster | Cyp4e3 | FBGN0015035 |
| drosophila_melanogaster | Cyp4ae1 | FBGN0015036 |
| drosophila_melanogaster | Cyp4p1 | FBGN0015037 |
| drosophila_melanogaster | Cyp4d14 | FBGN0023541 |
| drosophila_melanogaster | Cyp4s3 | FBGN0030615 |
| drosophila_melanogaster | Cyp4ac1 | FBGN0031693 |
| drosophila_melanogaster | Cyp4ac2 | FBGN0031694 |
| drosophila_melanogaster | Cyp4ac3 | FBGN0031695 |
| drosophila_melanogaster | Cyp4d21 | FBGN0031925 |
| drosophila_melanogaster | Cyp4ad1 | FBGN0033292 |
| drosophila_melanogaster | Cyp4p2 | FBGN0033395 |
| drosophila_melanogaster | Cyp4p3 | FBGN0033397 |
| drosophila_melanogaster | Cyp4aa1 | FBGN0034053 |
| drosophila_melanogaster | Cyp4d20 | FBGN0035344 |
| drosophila_melanogaster | Cyp312a1 | FBGN0036778 |
| caenorhabditis_elegans | WBGENE00007140 | |
| caenorhabditis_elegans | WBGENE00009226 | |
| caenorhabditis_elegans | WBGENE00010354 | |
| caenorhabditis_elegans | WBGENE00013381 | |
| caenorhabditis_elegans | WBGENE00016147 | |
| caenorhabditis_elegans | WBGENE00021200 | |
| caenorhabditis_elegans | WBGENE00021412 |
Paralogs (12): CYP19A1 (ENSG00000137869), CYP4B1 (ENSG00000142973), CYP4V2 (ENSG00000145476), CYP4A22 (ENSG00000162365), CYP4F11 (ENSG00000171903), CYP4F22 (ENSG00000171954), CYP4Z1 (ENSG00000186160), CYP4F12 (ENSG00000186204), CYP4X1 (ENSG00000186377), CYP4F8 (ENSG00000186526), CYP4F3 (ENSG00000186529), CYP4A11 (ENSG00000187048)
Protein
Protein identifiers
Cytochrome P450 4F2 — P78329 (reviewed: P78329)
Alternative names: 20-hydroxyeicosatetraenoic acid synthase, Arachidonic acid omega-hydroxylase, CYPIVF2, Cytochrome P450-LTB-omega, Docosahexaenoic acid omega-hydroxylase, Leukotriene-B(4) 20-monooxygenase 1, Leukotriene-B(4) omega-hydroxylase 1, Phylloquinone omega-hydroxylase CYP4F2
All UniProt accessions (5): A0A0A0MQR0, P78329, K7EK90, K7EPM0, K7EQI8
UniProt curated annotations — full annotation on UniProt →
Function. A cytochrome P450 monooxygenase involved in the metabolism of various endogenous substrates, including fatty acids, eicosanoids and vitamins. Mechanistically, uses molecular oxygen inserting one oxygen atom into a substrate, and reducing the second into a water molecule, with two electrons provided by NADPH via cytochrome P450 reductase (CPR; NADPH-ferrihemoprotein reductase). Catalyzes predominantly the oxidation of the terminal carbon (omega-oxidation) of long- and very long-chain fatty acids. Displays high omega-hydroxylase activity toward polyunsaturated fatty acids (PUFAs). Participates in the conversion of arachidonic acid to omega-hydroxyeicosatetraenoic acid (20-HETE), a signaling molecule acting both as vasoconstrictive and natriuretic with overall effect on arterial blood pressure. Plays a role in the oxidative inactivation of eicosanoids, including both pro-inflammatory and anti-inflammatory mediators such as leukotriene B4 (LTB4), lipoxin A4 (LXA4), and several HETEs. Catalyzes omega-hydroxylation of 3-hydroxy fatty acids. Converts monoepoxides of linoleic acid leukotoxin and isoleukotoxin to omega-hydroxylated metabolites. Contributes to the degradation of very long-chain fatty acids (VLCFAs) by catalyzing successive omega-oxidations and chain shortening. Plays an important role in vitamin metabolism by chain shortening. Catalyzes omega-hydroxylation of the phytyl chain of tocopherols (forms of vitamin E), with preference for gamma-tocopherols over alpha-tocopherols, thus promoting retention of alpha-tocopherols in tissues. Omega-hydroxylates and inactivates phylloquinone (vitamin K1), and menaquinone-4 (MK-4, a form of vitamin K2), both acting as cofactors in blood coagulation.
Subcellular location. Microsome membrane. Endoplasmic reticulum membrane.
Tissue specificity. Liver. Also present in kidney: specifically expressed in the S2 and S3 segments of proximal tubules in cortex and outer medulla.
Disease relevance. Coumarin resistance (CMRES) [MIM:122700] A condition characterized by partial or complete resistance to warfarin or other 4-hydroxycoumarin derivatives. These drugs are used as anti-coagulants for the prevention of thromboembolic diseases in subjects with deep vein thrombosis, atrial fibrillation, or mechanical heart valve replacement. Disease susceptibility may be associated with variants affecting the gene represented in this entry. The variant Met-433 is associated with coumarin (the brand name of warfarin) resistance by increasing coumarin maintenance dose in patients on this anti-coagulant therapy. This is probably due to decreased activity of the phylloquinone omega-hydroxylase activity, leading to an increase in hepatic vitamin K levels that warfarin must antagonize.
Activity regulation. Inhibited by dietary sesamin.
Pathway. Lipid metabolism; arachidonate metabolism. Lipid metabolism; leukotriene B4 degradation. Cofactor degradation; phylloquinone degradation.
Similarity. Belongs to the cytochrome P450 family.
Isoforms (2)
| UniProt ID | Names | Canonical? |
|---|---|---|
| P78329-1 | 1 | yes |
| P78329-2 | 2 |
RefSeq proteins (1): NP_001073* (*=MANE)
Domains & families (InterPro)
| ID | Name | Type |
|---|---|---|
| IPR001128 | Cyt_P450 | Family |
| IPR002401 | Cyt_P450_E_grp-I | Family |
| IPR017972 | Cyt_P450_CS | Conserved_site |
| IPR036396 | Cyt_P450_sf | Homologous_superfamily |
| IPR050196 | Cytochrome_P450_Monoox | Family |
Pfam: PF00067
Enzyme classification (BRENDA):
- EC 1.14.14.94 — leukotriene-B4 20-monooxygenase (BRENDA: 4 organisms, 65 substrates, 15 inhibitors, 41 Km, 0 kcat entries)
Substrate kinetics (BRENDA)
15 substrates with measured Km, best-characterized 15. Km ranges are aggregated across organisms/conditions.
| Substrate | Km (mM) | Measurements |
|---|---|---|
| LEUKOTRIENE B4 | 0.0002–0.868 | 15 |
| 6-TRANS-LEUKOTRIENE B4 | 0.0556–0.0961 | 3 |
| Z12(13)-EPOXYOCTADEC-Z9-ENOIC ACID | 0.0618–0.135 | 3 |
| Z9(10)-EPOXYOCTADEC-Z12-ENOIC ACID | 0.0466–0.1631 | 3 |
| Z9(10)-EPOXYOCTADECANOIC ACID | 0.0063–0.0357 | 3 |
| 12-HYDROXY-5,8,10,14-EICOSATETRAENOIC ACID | 0.0142–0.0752 | 2 |
| 12-HYDROXYSTEARATE | 0.0409–0.0423 | 2 |
| LIPOXIN A4 | 0.0582–0.254 | 2 |
| NADPH | 0.0008–0.001 | 2 |
| 20-HYDROXY-LEUKOTRIENE B4 | 0.0065 | 1 |
| 5-DEOXY-LEUKOTRIENE B4 | 0.0056 | 1 |
| 5-EPI-LEUKOTRIENE B4 | 0.0066 | 1 |
| 6-TRANS-12-EPI-LEUKOTRIENE B4 | 0.0038 | 1 |
| LIPOXIN B4 | 0.0179 | 1 |
| PROSTAGLANDIN A1 | 0.04 | 1 |
Catalyzed reactions (Rhea), 12 shown:
- an organic molecule + reduced [NADPH–hemoprotein reductase] + O2 = an alcohol + oxidized [NADPH–hemoprotein reductase] + H2O + H(+) (RHEA:17149)
- leukotriene B4 + reduced [NADPH–hemoprotein reductase] + O2 = 20-hydroxy-leukotriene B4 + oxidized [NADPH–hemoprotein reductase] + H2O + H(+) (RHEA:22176)
- 22-oxodocosanoate + reduced [NADPH–hemoprotein reductase] + O2 = docosanedioate + oxidized [NADPH–hemoprotein reductase] + H2O + 2 H(+) (RHEA:39043)
- 26-oxohexacosanoate + reduced [NADPH–hemoprotein reductase] + O2 = hexacosanedioate + oxidized [NADPH–hemoprotein reductase] + H2O + 2 H(+) (RHEA:39047)
- 22-hydroxydocosanoate + reduced [NADPH–hemoprotein reductase] + O2 = 22-oxodocosanoate + oxidized [NADPH–hemoprotein reductase] + 2 H2O + H(+) (RHEA:39055)
- 26-hydroxyhexacosanoate + reduced [NADPH–hemoprotein reductase] + O2 = 26-oxohexacosanoate + oxidized [NADPH–hemoprotein reductase] + 2 H2O + H(+) (RHEA:39059)
- tetracosanoate + reduced [NADPH–hemoprotein reductase] + O2 = 24-hydroxytetracosanoate + oxidized [NADPH–hemoprotein reductase] + H2O + H(+) (RHEA:39719)
- 3-hydroxyhexadecanoate + reduced [NADPH–hemoprotein reductase] + O2 = 3,16-dihydroxyhexadecanoate + oxidized [NADPH–hemoprotein reductase] + H2O + H(+) (RHEA:39731)
- 3-hydroxyoctadecanoate + reduced [NADPH–hemoprotein reductase] + O2 = 3,18-dihydroxyoctadecanoate + oxidized [NADPH–hemoprotein reductase] + H2O + H(+) (RHEA:39735)
- (5Z,8Z,11Z,14Z)-eicosatetraenoate + reduced [NADPH–hemoprotein reductase] + O2 = 20-hydroxy-(5Z,8Z,11Z,14Z)-eicosatetraenoate + oxidized [NADPH–hemoprotein reductase] + H2O + H(+) (RHEA:39755)
- (5Z,8Z,11Z,14Z,17Z)-eicosapentaenoate + reduced [NADPH–hemoprotein reductase] + O2 = 20-hydroxy-(5Z,8Z,11Z,14Z,17Z)-eicosapentaenoate + oxidized [NADPH–hemoprotein reductase] + H2O + H(+) (RHEA:39791)
- docosanoate + reduced [NADPH–hemoprotein reductase] + O2 = 22-hydroxydocosanoate + oxidized [NADPH–hemoprotein reductase] + H2O + H(+) (RHEA:40079)
UniProt features (18 total): sequence variant 6, sequence conflict 5, splice variant 3, binding site 2, propeptide 1, chain 1
Structure
Experimental structures (PDB)
0 structures.
Predicted structure (AlphaFold)
| Model | pLDDT | Fraction very-high |
|---|---|---|
| AF-P78329-F1 | 91.97 | 0.80 |
Functional residue map
Curated UniProt residues grouped by drug-discovery relevance — catalytic, ligand-binding, modification, and mutation-validated positions. Source: UniProtKB sequence features.
Ligand- & substrate-binding residues (2): 328 (covalent); 468 (axial binding residue)
Function
Pathways and Gene Ontology
Reactome pathways
5 pathways
| ID | Pathway |
|---|---|
| R-HSA-211935 | Fatty acids |
| R-HSA-211958 | Miscellaneous substrates |
| R-HSA-211979 | Eicosanoids |
| R-HSA-2142691 | Synthesis of Leukotrienes (LT) and Eoxins (EX) |
| R-HSA-2142816 | Synthesis of (16-20)-hydroxyeicosatetraenoic acids (HETE) |
MSigDB gene sets: 218 (showing top):
BROWNE_HCMV_INFECTION_30MIN_DN, GSE45365_CD8A_DC_VS_CD11B_DC_IFNAR_KO_MCMV_INFECTION_DN, GSE45365_NK_CELL_VS_CD8A_DC_MCMV_INFECTION_UP, GOBP_LIPID_MODIFICATION, GOBP_FATTY_ACID_CATABOLIC_PROCESS, REACTOME_BIOLOGICAL_OXIDATIONS, GOBP_REGULATION_OF_ICOSANOID_SECRETION, GOBP_REGULATION_OF_BLOOD_PRESSURE, GOBP_CIRCULATORY_SYSTEM_PROCESS, GOBP_REGULATION_OF_ORGANIC_ACID_TRANSPORT, GOMF_OXIDOREDUCTASE_ACTIVITY_ACTING_ON_PAIRED_DONORS_WITH_INCORPORATION_OR_REDUCTION_OF_MOLECULAR_OXYGEN, GNF2_GSTM1, GOBP_RENAL_SYSTEM_PROCESS_INVOLVED_IN_REGULATION_OF_BLOOD_VOLUME, GNF2_HPN, GOBP_REGULATION_OF_SYSTEMIC_ARTERIAL_BLOOD_PRESSURE
GO Biological Process (23): very long-chain fatty acid metabolic process (GO:0000038), long-chain fatty acid metabolic process (GO:0001676), renal water homeostasis (GO:0003091), pressure natriuresis (GO:0003095), icosanoid metabolic process (GO:0006690), leukotriene metabolic process (GO:0006691), xenobiotic metabolic process (GO:0006805), blood coagulation (GO:0007596), regulation of blood pressure (GO:0008217), fatty acid omega-oxidation (GO:0010430), arachidonate metabolic process (GO:0019369), epoxygenase P450 pathway (GO:0019373), negative regulation of icosanoid secretion (GO:0032304), positive regulation of icosanoid secretion (GO:0032305), leukotriene B4 catabolic process (GO:0036101), vitamin E metabolic process (GO:0042360), menaquinone catabolic process (GO:0042361), phylloquinone catabolic process (GO:0042376), vitamin K catabolic process (GO:0042377), sodium ion homeostasis (GO:0055078), omega-hydroxylase P450 pathway (GO:0097267), lipid metabolic process (GO:0006629), fatty acid metabolic process (GO:0006631)
GO Molecular Function (17): monooxygenase activity (GO:0004497), iron ion binding (GO:0005506), arachidonate epoxygenase activity (GO:0008392), oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen (GO:0016709), alkane 1-monooxygenase activity (GO:0018685), heme binding (GO:0020037), leukotriene-B4 20-monooxygenase activity (GO:0050051), arachidonate omega-hydroxylase activity (GO:0052869), alpha-tocopherol omega-hydroxylase activity (GO:0052871), 20-hydroxy-leukotriene B4 omega oxidase activity (GO:0097258), 20-aldehyde-leukotriene B4 20-monooxygenase activity (GO:0097259), long-chain fatty acid omega-hydroxylase activity (GO:0102033), protein binding (GO:0005515), oxidoreductase activity (GO:0016491), oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen (GO:0016705), oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen (GO:0016712), metal ion binding (GO:0046872)
GO Cellular Component (6): cytoplasm (GO:0005737), endoplasmic reticulum membrane (GO:0005789), apical plasma membrane (GO:0016324), intracellular membrane-bounded organelle (GO:0043231), endoplasmic reticulum (GO:0005783), membrane (GO:0016020)
Reactome top-level categories
Rollup of top-2 pathways:
| Category | Pathways |
|---|---|
| Cytochrome P450 - arranged by substrate type | 3 |
| Arachidonate metabolism | 2 |
GO top-level categories
Rollup of top GO terms by namespace:
| Category | Terms |
|---|---|
| monooxygenase activity | 4 |
| oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen | 3 |
| fatty acid metabolic process | 2 |
| renal system process | 2 |
| icosanoid metabolic process | 2 |
| metabolic process | 2 |
| regulation of icosanoid secretion | 2 |
| icosanoid secretion | 2 |
| ketone catabolic process | 2 |
| oxidoreductase activity | 2 |
| oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen | 2 |
| intracellular anatomical structure | 2 |
| cellular anatomical structure | 2 |
| multicellular organismal-level water homeostasis | 1 |
| regulation of body fluid levels | 1 |
| carboxylic acid metabolic process | 1 |
| cellular response to xenobiotic stimulus | 1 |
| hemostasis | 1 |
| wound healing | 1 |
| coagulation | 1 |
| blood circulation | 1 |
| regulation of biological quality | 1 |
| fatty acid oxidation | 1 |
| long-chain fatty acid metabolic process | 1 |
| unsaturated fatty acid metabolic process | 1 |
| olefinic compound metabolic process | 1 |
| arachidonate metabolic process | 1 |
| negative regulation of secretion | 1 |
| negative regulation of fatty acid transport | 1 |
| positive regulation of secretion | 1 |
| positive regulation of fatty acid transport | 1 |
| leukotriene catabolic process | 1 |
| leukotriene B4 metabolic process | 1 |
| long-chain fatty acid catabolic process | 1 |
| icosanoid catabolic process | 1 |
| menaquinone metabolic process | 1 |
| vitamin K catabolic process | 1 |
| fat-soluble vitamin catabolic process | 1 |
| vitamin K metabolic process | 1 |
| monoatomic cation homeostasis | 1 |
Protein interactions and networks
STRING
1812 interactions, top by confidence (×1000):
| Protein A | Protein B | Partner UniProt | Score |
|---|---|---|---|
| CYP4F2 | VKORC1 | Q9BQB6 | 967 |
| CYP4F2 | GGCX | P38435 | 912 |
| CYP4F2 | PPIG | Q13427 | 846 |
| CYP4F2 | CALU | O43852 | 646 |
| CYP4F2 | F7 | P08709 | 631 |
| CYP4F2 | CYP2C9 | P11712 | 625 |
| CYP4F2 | SLCO1B1 | Q9Y6L6 | 625 |
| CYP4F2 | TPMT | P51580 | 620 |
| CYP4F2 | PROS1 | P07225 | 611 |
| CYP4F2 | NIPAL4 | Q0D2K0 | 609 |
| CYP4F2 | EPHX1 | P07099 | 606 |
| CYP4F2 | TTPA | P49638 | 592 |
| CYP4F2 | NUDT15 | Q9NV35 | 570 |
| CYP4F2 | CYP1A2 | P05177 | 560 |
| CYP4F2 | DPYD | Q12882 | 558 |
IntAct
128 interactions, top by confidence:
| A | B | Type | Score |
|---|---|---|---|
| CYP4F2 | CREB3 | psi-mi:“MI:0915”(physical association) | 0.560 |
| CYP4F2 | SPAG4 | psi-mi:“MI:0915”(physical association) | 0.560 |
| CYP4F2 | ZDHHC15 | psi-mi:“MI:0915”(physical association) | 0.560 |
| CYP4F2 | ROM1 | psi-mi:“MI:0915”(physical association) | 0.560 |
| CYP4F2 | TSPAN31 | psi-mi:“MI:0915”(physical association) | 0.560 |
| CYP4F2 | HSD17B13 | psi-mi:“MI:0915”(physical association) | 0.560 |
| CYP4F2 | TMEM51 | psi-mi:“MI:0915”(physical association) | 0.560 |
| CYP4F2 | REEP2 | psi-mi:“MI:0915”(physical association) | 0.560 |
| CYP4F2 | CPLX4 | psi-mi:“MI:0915”(physical association) | 0.560 |
| CYP4F2 | RETREG3 | psi-mi:“MI:0915”(physical association) | 0.560 |
| LEPROTL1 | CYP4F2 | psi-mi:“MI:0915”(physical association) | 0.560 |
| CYP4F2 | FAM210B | psi-mi:“MI:0915”(physical association) | 0.560 |
| CYP4F2 | SCN3B | psi-mi:“MI:0915”(physical association) | 0.560 |
| CYP4F2 | PLEKHO1 | psi-mi:“MI:0915”(physical association) | 0.560 |
| CYP4F2 | SLC2A13 | psi-mi:“MI:0915”(physical association) | 0.560 |
BioGRID (40): CREB3 (Two-hybrid), CYP4F2 (Affinity Capture-MS), CYP4F2 (Two-hybrid), CYP4F2 (Two-hybrid), CYP4F2 (Two-hybrid), CYP4F2 (Two-hybrid), CYP4F2 (Two-hybrid), CYP4F2 (Two-hybrid), CYP4F2 (Two-hybrid), CYP4F2 (Two-hybrid), CYP4F2 (Two-hybrid), CYP4F2 (Two-hybrid), CYP4F2 (Two-hybrid), CYP4F2 (Two-hybrid), CYP4F2 (Two-hybrid)
ESM2 similar proteins: A0A087X1C5, E9Q816, O18992, O46658, P00191, P03940, P08686, P10633, P10634, P10635, P11714, P12394, P12938, P12939, P15540, P24456, P24457, P30437, P51589, P51590, P52786, P70085, P78329, Q01361, Q0IIF9, Q29473, Q29488, Q2LA59, Q2LA60, Q2LCM1, Q2XNC8, Q2XNC9, Q4V8D1, Q64403, Q64562, Q64680, Q6GUQ4, Q6VVW9, Q6VVX0, Q7Z449
Diamond homologs: A0A067DT54, A0A067E1K2, A0A0S2II38, A0A140JWM8, A0A1B4XBH8, A0A1W5T1Y6, A0A3Q7HBJ5, A0A517FNB9, A0A517FNC6, A0A5B8ND22, A0A9Y1LLN2, A0AAW1NEA3, A2QTE8, A2RRT9, A2Z212, A9QNE7, B0XZV0, B1NF18, B5BSX1, B6SSW8, B8AJL3, B8AV52, B8QHP1, B8QHP5, B9X287, F1SY66, G3XMC3, I1GQE7, K4CI52, L7T720, L7T8H2, O23051, O35728, O49858, O61387, O81077, O88833, P08682, P0DXH4, P14137
SIGNOR signaling
0 interactions.
Enriched among interaction partners
Reactome pathways and GO biological processes over-represented among this gene’s 47 IntAct physical interaction partners (hypergeometric vs the genome-wide background, BH-FDR, gene-set size 15–500, ranked by fold). A functional readout of the neighbourhood — distinct from this gene’s own memberships above, and biased toward well-studied / hub proteins, so read it as themes rather than proof.
Reactome pathways:
| Pathway | Partners | Fold | FDR |
|---|---|---|---|
| FCGR3A-mediated phagocytosis | 5 | 36.0× | 8e-05 |
Disease & clinical
Clinical variants and AI predictions
ClinVar
109 variants total. Per-class counts are floors (≥ shown; pagination cap):
| Classification | Count (floor) |
|---|---|
| Pathogenic | 0 |
| Likely pathogenic | 0 |
| Uncertain significance | 68 |
| Likely benign | 20 |
| Benign | 12 |
Top pathogenic / likely-pathogenic (0)
SpliceAI
1796 predictions. Top by Δscore:
| Variant | Effect | Δscore |
|---|---|---|
| 19:15878935:TC:T | acceptor_gain | 1.0000 |
| 19:15878936:CC:C | acceptor_gain | 1.0000 |
| 19:15878936:CCTAG:C | acceptor_loss | 1.0000 |
| 19:15878937:C:CC | acceptor_gain | 1.0000 |
| 19:15879340:CCTTA:C | donor_loss | 1.0000 |
| 19:15879342:TTACC:T | donor_loss | 1.0000 |
| 19:15879343:TAC:T | donor_loss | 1.0000 |
| 19:15879344:A:AC | donor_gain | 1.0000 |
| 19:15879345:C:CC | donor_gain | 1.0000 |
| 19:15879345:C:CG | donor_loss | 1.0000 |
| 19:15879598:CCGCA:C | donor_loss | 1.0000 |
| 19:15879599:CGCA:C | donor_loss | 1.0000 |
| 19:15879600:GCAC:G | donor_loss | 1.0000 |
| 19:15879601:CACCT:C | donor_loss | 1.0000 |
| 19:15879602:ACCTC:A | donor_loss | 1.0000 |
| 19:15879603:CCTCA:C | donor_loss | 1.0000 |
| 19:15879623:G:C | donor_gain | 1.0000 |
| 19:15879667:GCCTG:G | acceptor_loss | 1.0000 |
| 19:15879670:T:A | acceptor_loss | 1.0000 |
| 19:15889419:CCA:C | donor_loss | 1.0000 |
| 19:15889420:CACCT:C | donor_loss | 1.0000 |
| 19:15889421:ACC:A | donor_loss | 1.0000 |
| 19:15890310:A:AC | donor_gain | 1.0000 |
| 19:15890311:C:CC | donor_gain | 1.0000 |
| 19:15878932:AGTTC:A | acceptor_gain | 0.9900 |
| 19:15878933:GTTC:G | acceptor_gain | 0.9900 |
| 19:15878934:TTC:T | acceptor_gain | 0.9900 |
| 19:15879343:TA:T | donor_gain | 0.9900 |
| 19:15879388:T:A | donor_gain | 0.9900 |
| 19:15879429:CT:C | acceptor_loss | 0.9900 |
AlphaMissense
3438 scored. Top likely-pathogenic:
| Variant | Protein change | am_pathogenicity |
|---|---|---|
| 19:15879360:G:C | F461L | 0.992 |
| 19:15879360:G:T | F461L | 0.992 |
| 19:15879362:A:G | F461L | 0.992 |
| 19:15879849:G:C | S388R | 0.987 |
| 19:15879849:G:T | S388R | 0.987 |
| 19:15879851:T:G | S388R | 0.987 |
| 19:15879408:A:C | F445L | 0.983 |
| 19:15879408:A:T | F445L | 0.983 |
| 19:15879410:A:G | F445L | 0.983 |
| 19:15892369:G:C | F155L | 0.982 |
| 19:15892369:G:T | F155L | 0.982 |
| 19:15892371:A:G | F155L | 0.982 |
| 19:15892391:C:G | R148P | 0.981 |
| 19:15879618:A:G | W434R | 0.980 |
| 19:15879618:A:T | W434R | 0.980 |
| 19:15892392:G:T | R148S | 0.979 |
| 19:15892404:A:G | W144R | 0.978 |
| 19:15892404:A:T | W144R | 0.978 |
| 19:15879369:A:C | F458L | 0.977 |
| 19:15879369:A:T | F458L | 0.977 |
| 19:15879371:A:G | F458L | 0.977 |
| 19:15890427:A:G | W178R | 0.975 |
| 19:15890427:A:T | W178R | 0.975 |
| 19:15878915:G:C | F473L | 0.972 |
| 19:15878915:G:T | F473L | 0.972 |
| 19:15878917:A:G | F473L | 0.972 |
| 19:15878936:C:A | R466S | 0.970 |
| 19:15878936:C:G | R466S | 0.970 |
| 19:15886024:A:G | W339R | 0.970 |
| 19:15886024:A:T | W339R | 0.970 |
dbSNP variants (sampled 300 via entrez): RS1000004278 (19:15885182 C>G), RS1000139809 (19:15885438 T>C,G), RS1000243500 (19:15879179 G>C), RS1000341178 (19:15899461 C>T), RS1000662363 (19:15900071 G>T), RS1000775989 (19:15899241 C>A,G), RS1000841993 (19:15896708 C>T), RS1000858698 (19:15891012 A>C,G), RS1000944570 (19:15895297 G>A), RS1001682680 (19:15894956 A>C), RS1001713734 (19:15894803 G>A), RS1002174112 (19:15891258 G>A,C), RS1002201556 (19:15895812 C>T), RS1002404950 (19:15884561 T>C,G), RS1002857923 (19:15893508 A>G)
Disease associations
OMIM: gene MIM:604426 | disease phenotypes:
GenCC curated gene-disease
Mondo (0):
Orphanet (0):
HPO phenotypes
0 total (0 of 0 shown, HPO-id order):
GWAS associations
21 associations (top):
| Study | Trait | p-value |
|---|---|---|
| GCST000360_3 | Warfarin maintenance dose | 3.000000e-10 |
| GCST000436_3 | Acenocoumarol maintenance dosage | 3.000000e-10 |
| GCST000792_2 | Warfarin maintenance dose | 3.000000e-08 |
| GCST001142_2 | Vitamin E levels | 1.000000e-10 |
| GCST001450_4 | Response to Vitamin E supplementation | 2.000000e-07 |
| GCST001882_6 | Metabolite levels | 9.000000e-24 |
| GCST002653_3 | Circulating phylloquinone levels | 3.000000e-07 |
| GCST009733_117 | Urinary metabolite levels in chronic kidney disease | 2.000000e-18 |
| GCST009733_118 | Urinary metabolite levels in chronic kidney disease | 2.000000e-15 |
| GCST009733_135 | Urinary metabolite levels in chronic kidney disease | 3.000000e-12 |
| GCST009733_70 | Urinary metabolite levels in chronic kidney disease | 4.000000e-20 |
| GCST009735_18 | Urinary metabolite modules (eigenmetabolites) in chronic kidney disease | 6.000000e-20 |
| GCST012020_162 | Serum metabolite levels | 1.000000e-15 |
| GCST012020_525 | Serum metabolite levels | 6.000000e-26 |
| GCST012020_526 | Serum metabolite levels | 6.000000e-17 |
| GCST012021_66 | Serum metabolite levels | 6.000000e-26 |
| GCST012021_67 | Serum metabolite levels | 6.000000e-17 |
| GCST012021_87 | Serum metabolite levels | 1.000000e-15 |
| GCST90011899_162 | Aspartate aminotransferase levels | 3.000000e-08 |
| GCST90013663_15 | Alanine aminotransferase levels | 2.000000e-08 |
| GCST90013664_41 | Aspartate aminotransferase levels | 6.000000e-08 |
EFO canonical traits (4, from GWAS)
| EFO ID | Trait name |
|---|---|
| EFO:0004725 | metabolite measurement |
| EFO:0004618 | vitamin K measurement |
| EFO:0005116 | urinary metabolite measurement |
| EFO:0004736 | aspartate aminotransferase measurement |
Drugs & pharmacology
Drug and pharmacology data
Is drug target: yes
ChEMBL targets (2): CHEMBL3379 (SINGLE PROTEIN), CHEMBL4523986 (PROTEIN FAMILY)
Molecules with ChEMBL bioactivity
2 molecules (phase ≥1), by development phase (incl. off-target/promiscuous compounds). Patent mentions across the top 20 by phase: 90,901 (via chembl_molecule»patent_compound — counts attach to the compound, not the gene–compound relationship, so off-target/promiscuous molecules can dominate).
| Molecule | Name | Phase | Patents |
|---|---|---|---|
| CHEMBL157101 | KETOCONAZOLE | 4 | 75,361 |
| CHEMBL477772 | PAZOPANIB | 4 | 15,540 |
PharmGKB: 1 entry (VIP=true, CPIC=true)
PharmGKB clinical annotations
12 annotations.
| Variant | Type | Level | Drugs | Phenotypes |
|---|---|---|---|---|
| CYP4F21, CYP4F23 | Metabolism/PK | 3 | Vitamin K1 | |
| rs2108622 | Dosage | 1A | warfarin | |
| rs2108622 | Dosage | 2A | acenocoumarol | Atrial Fibrillation |
| rs2108622 | Metabolism/PK | 3 | vitamin e | |
| rs2108622 | Other | 3 | aspirin;clopidogrel | Acute coronary syndrome |
| rs2108622 | Efficacy | 3 | warfarin | |
| rs2108622 | Metabolism/PK | 3 | Vitamin K and analogues | |
| rs2108622 | Dosage | 3 | phenprocoumon | |
| rs2108622 | Other | 4 | warfarin | over-anticoagulation |
| rs2108623 | Toxicity | 4 | anthracyclines and related substances | Neoplasms |
| rs2189784 | Dosage | 3 | warfarin | |
| rs3093105 | Metabolism/PK | 3 | vitamin e |
PharmGKB variants
14 variants.
| Variant | Genes | Level | Score | #Clin annots | Drugs |
|---|---|---|---|---|---|
| rs2108622 | CYP4F2 | 1A | 169.50 | 9 | Vitamin K and analogues;phenprocoumon;vitamin e;acenocoumarol;aspirin;clopidogrel;warfarin |
| rs2108623 | CYP4F2 | 4 | -1.00 | 1 | anthracyclines and related substances |
| rs2189784 | CYP4F2 | 3 | 2.75 | 1 | warfarin |
| rs3093105 | CYP4F2 | 3 | 0.00 | 1 | vitamin e |
| rs3093158 | CYP4F2 | 0.00 | 0 | ||
| rs3093135 | CYP4F2 | 0.00 | 0 | ||
| rs3093153 | CYP4F2 | 0.00 | 0 | ||
| rs2074900 | CYP4F2 | 0.00 | 0 | ||
| rs3093200 | CYP4F2 | 0.00 | 0 | ||
| rs114396708 | CYP4F2 | 0.00 | 0 | ||
| rs753169154 | CYP4F2 | 0.00 | 0 | ||
| rs754533672 | CYP4F2 | 0.00 | 0 | ||
| rs1292029455 | CYP4F2 | 0.00 | 0 | ||
| rs550261161 | CYP4F2 | 0.00 | 0 |
PharmGKB dosing guidelines
1 guidelines.
| Source | Drug | Guideline | Dosing? | Recommendation? |
|---|---|---|---|---|
| CPIC | warfarin | Annotation of CPIC Guideline for warfarin and CYP2C9, CYP4F2, VKORC1 | yes | yes |
GtoPdb / IUPHAR curated pharmacology
(IUPHAR/BPS Guide to Pharmacology — expert-curated)
Target class: enzyme — CYP4 family
Most potent curated ligand interactions (4 total), top 4:
| Ligand | Action | Affinity | Parameter |
|---|---|---|---|
| HET0016 | Inhibition | 7.86 | pIC50 |
| TP0472993 | Inhibition | 7.4 | pIC50 |
| sesamin | Inhibition | 6.42 | pIC50 |
| 17-octadecynoic acid | Inhibition | 5.92 | pKi |
Binding affinities (BindingDB)
116 measured of 117 human assays (117 total across all organisms); most potent 50 below. Values come from heterogeneous assays and are not directly comparable.
| Ligand | Measure | Value | Patent |
|---|---|---|---|
| 1,1,1-trifluoro-3-[3-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]phenyl]propan-2-ol | IC50 | 10 nM | US-11365192: Pyridine compound substituted with azole |
| 3-[8-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxy]octyl]oxolane-3-carboxylic acid | IC50 | 14 nM | US-11365192: Pyridine compound substituted with azole |
| N-[[(2S)-oxolan-2-yl]methyl]-3-[3-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]phenyl]propanamide | IC50 | 18 nM | US-11365192: Pyridine compound substituted with azole |
| 1-acetyl-3-[8-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxy]octyl]pyrrolidine-3-carboxylic acid | IC50 | 18 nM | US-11365192: Pyridine compound substituted with azole |
| 7-[[6-(4-chloro-1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]-3,4-dihydro-2H-chromene-2-carboxylic acid | IC50 | 20 nM | US-11365192: Pyridine compound substituted with azole |
| N-[[(2R)-oxolan-2-yl]methyl]-3-[3-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]phenyl]propanamide | IC50 | 21 nM | US-11365192: Pyridine compound substituted with azole |
| N,N-dimethyl-2-[3-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]phenyl]cyclopropane-1-carboxamide | IC50 | 22 nM | US-11365192: Pyridine compound substituted with azole |
| 3-hydroxy-N,N-dimethyl-3-[3-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]phenyl]cyclobutane-1-carboxamide | IC50 | 28 nM | US-11365192: Pyridine compound substituted with azole |
| 7-[(6-pyrazolidin-3-yl-3-pyridinyl)oxymethyl]-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid | IC50 | 33 nM | US-11365192: Pyridine compound substituted with azole |
| N-[(2R)-2-methoxypropyl]-3-[3-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]phenyl]propanamide | IC50 | 40 nM | US-11365192: Pyridine compound substituted with azole |
| 2,2,2-trifluoro-1-[4-[(6-pyrazolidin-3-yl-3-pyridinyl)oxymethyl]phenyl]ethanol | IC50 | 41 nM | US-11365192: Pyridine compound substituted with azole |
| 2-[8-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxy]octyl]oxolane-2-carboxylic acid | IC50 | 43 nM | US-11365192: Pyridine compound substituted with azole |
| N-methyl-2-[3-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]phenyl]propanamide | IC50 | 55 nM | US-11365192: Pyridine compound substituted with azole |
| trans-(1S,2S)-2-[2-fluoro-3-[2-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxy]ethyl]phenyl]cyclopropane-1-carboxylic acid | IC50 | 58 nM | US-11365192: Pyridine compound substituted with azole |
| 2-[2-fluoro-3-[2-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxy]ethyl]phenyl]cyclopropane-1-carboxylic acid | IC50 | 60 nM | US-11365192: Pyridine compound substituted with azole |
| N-[(2S)-1-hydroxypropan-2-yl]-3-[3-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]phenyl]propanamide | IC50 | 63 nM | US-11365192: Pyridine compound substituted with azole |
| N-[(2S)-2-hydroxypropyl]-3-[3-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]phenyl]propanamide | IC50 | 73 nM | US-11365192: Pyridine compound substituted with azole |
| trans-(1R,2R)-2-[2-fluoro-3-[2-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxy]ethyl]phenyl]cyclopropane-1-carboxylic acid | IC50 | 80 nM | US-11365192: Pyridine compound substituted with azole |
| (3R)-1-[3-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]phenyl]sulfonylpiperidine-3-carboxylic acid | IC50 | 86 nM | US-11365192: Pyridine compound substituted with azole |
| (2S)-2-[7-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxy]heptoxy]butanoic acid | IC50 | 90 nM | US-11365192: Pyridine compound substituted with azole |
| 2-[3-fluoro-4-[2-[(6-pyrazolidin-3-yl-3-pyridinyl)oxy]ethyl]phenyl]cyclopropane-1-carboxylic acid | IC50 | 91 nM | US-11365192: Pyridine compound substituted with azole |
| N-[(2R)-2-hydroxypropyl]-3-[3-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]phenyl]propanamide | IC50 | 92 nM | US-11365192: Pyridine compound substituted with azole |
| 3-[(3R)-3-[(6-pyrazolidin-3-yl-3-pyridinyl)oxymethyl]piperidin-1-yl]sulfonylbenzoic acid | IC50 | 94 nM | US-11365192: Pyridine compound substituted with azole |
| 3-[2-fluoro-5-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]phenyl]-3-hydroxy-N,N-dimethylcyclobutane-1-carboxamide | IC50 | 99 nM | US-11365192: Pyridine compound substituted with azole |
| 1,1-difluoro-3-[3-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]phenyl]propan-2-ol | IC50 | 100 nM | US-11365192: Pyridine compound substituted with azole |
| (2S)-7-[(6-pyrazolidin-3-yl-3-pyridinyl)oxymethyl]-3,4-dihydro-2H-chromene-2-carboxylic acid | IC50 | 110 nM | US-11365192: Pyridine compound substituted with azole |
| N-[(2R)-1-hydroxypropan-2-yl]-3-[3-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]phenyl]propanamide | IC50 | 120 nM | US-11365192: Pyridine compound substituted with azole |
| 2-[2-fluoro-4-[2-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxy]ethyl]phenyl]cyclopropane-1-carboxylic acid | IC50 | 120 nM | US-11365192: Pyridine compound substituted with azole |
| cis-(1R,2S)-2-[4-[2-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxy]ethyl]phenyl]cyclopropane-1-carboxylic acid | IC50 | 120 nM | US-11365192: Pyridine compound substituted with azole |
| 2-[2-fluoro-5-[2-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxy]ethyl]phenyl]cyclopropane-1-carboxylic acid | IC50 | 130 nM | US-11365192: Pyridine compound substituted with azole |
| 7-[(6-pyrazolidin-3-yl-3-pyridinyl)oxymethyl]-3,4-dihydro-2H-chromene-2-carboxylic acid | IC50 | 140 nM | US-11365192: Pyridine compound substituted with azole |
| 2-[7-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxy]heptoxy]butanoic acid | IC50 | 140 nM | US-11365192: Pyridine compound substituted with azole |
| (2S)-7-[2-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxy]ethyl]-3,4-dihydro-2H-chromene-2-carboxylic acid | IC50 | 160 nM | US-11365192: Pyridine compound substituted with azole |
| 7-[(6-pyrazolidin-3-yl-3-pyridinyl)oxymethyl]-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid | IC50 | 170 nM | US-11365192: Pyridine compound substituted with azole |
| 1-[3-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]phenyl]sulfonylpiperidine-3-carboxylic acid | IC50 | 180 nM | US-11365192: Pyridine compound substituted with azole |
| 7-[2-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxy]ethyl]-3,4-dihydro-2H-chromene-2-carboxylic acid | IC50 | 190 nM | US-11365192: Pyridine compound substituted with azole |
| (2S)-7-[(6-pyrazolidin-3-yl-3-pyridinyl)oxymethyl]-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid | IC50 | 200 nM | US-11365192: Pyridine compound substituted with azole |
| 2-[4-[2-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxy]ethyl]phenyl]cyclopropane-1-carboxylic acid | IC50 | 200 nM | US-11365192: Pyridine compound substituted with azole |
| 2-[7-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxy]heptoxy]propanoic acid | IC50 | 200 nM | US-11365192: Pyridine compound substituted with azole |
| (2R)-7-[(6-pyrazolidin-3-yl-3-pyridinyl)oxymethyl]-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid | IC50 | 240 nM | US-11365192: Pyridine compound substituted with azole |
| 1-[3-oxo-3-[3-[2-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxy]ethyl]piperidin-1-yl]propyl]cyclopentane-1-carboxylic acid | IC50 | 260 nM | US-11365192: Pyridine compound substituted with azole |
| 6-[2-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxy]ethyl]-3,4-dihydro-2H-chromene-3-carboxylic acid | IC50 | 260 nM | US-11365192: Pyridine compound substituted with azole |
| 2-[2-fluoro-3-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]phenyl]cyclopropane-1-carboxylic acid | IC50 | 280 nM | US-11365192: Pyridine compound substituted with azole |
| 1,1,1-trifluoro-2-[3-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]phenyl]propan-2-ol | IC50 | 300 nM | US-11365192: Pyridine compound substituted with azole |
| 3-fluoro-1-[4-[(6-pyrazolidin-3-yl-3-pyridinyl)oxymethyl]pyridine-2-carbonyl]pyrrolidine-3-carboxylic acid | IC50 | 300 nM | US-11365192: Pyridine compound substituted with azole |
| (2R)-7-[(6-pyrazolidin-3-yl-3-pyridinyl)oxymethyl]-3,4-dihydro-2H-chromene-2-carboxylic acid | IC50 | 300 nM | US-11365192: Pyridine compound substituted with azole |
| (2R)-2-[7-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxy]heptoxy]butanoic acid | IC50 | 300 nM | US-11365192: Pyridine compound substituted with azole |
| (2R)-7-[2-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxy]ethyl]-3,4-dihydro-2H-chromene-2-carboxylic acid | IC50 | 310 nM | US-11365192: Pyridine compound substituted with azole |
| 4-oxo-4-[(3R)-3-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]piperidin-1-yl]butane-1-sulfonamide | IC50 | 320 nM | US-11365192: Pyridine compound substituted with azole |
| 2-[3-[2-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxy]ethyl]phenyl]cyclopropane-1-carboxylic acid | IC50 | 320 nM | US-11365192: Pyridine compound substituted with azole |
ChEMBL bioactivities
430 potent at pChembl≥5 of 502 total, top 50 by pChembl (potency: 10 = 0.1 nM, 6 = 1 µM).
PubChem BioAssay actives
47 with measured affinity, of 546 total; 40 most potent distinct compounds. Largely complementary to BindingDB; screening values are coarse (µM, 4 dp), so sub-nM hits tie at the floor.
| Compound | Assay | Type | Value | Unit |
|---|---|---|---|---|
| 4-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]benzonitrile | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.0065 | uM |
| 3-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]benzonitrile | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.0150 | uM |
| 4-methyl-5-[2-[4-(1H-pyrazol-5-yl)phenoxy]ethyl]-1,3-thiazole | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.0170 | uM |
| N,N-dimethyl-4-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]piperidine-1-carboxamide | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.0190 | uM |
| 5-[(4-fluorophenyl)methoxy]-2-(1H-pyrazol-5-yl)pyridine | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.0210 | uM |
| 8-imidazol-1-yl-5,6,7,8-tetrahydroquinoline | 2022035: Inhibition of CYP450 (unknown origin) | ic50 | 0.0335 | uM |
| (3S)-N,N-dimethyl-3-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]piperidine-1-sulfonamide | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.0360 | uM |
| 1-[4-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]piperidin-1-yl]ethanone | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.0400 | uM |
| 4-methyl-5-[2-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxy]ethyl]-1,3-thiazole | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.0440 | uM |
| N-methyl-4-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]piperidine-1-carboxamide | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.0630 | uM |
| 4-methyl-5-[2-[2-(1H-pyrazol-5-yl)pyrimidin-5-yl]oxyethyl]-1,3-thiazole | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.0660 | uM |
| 3-methylsulfonyl-5-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]phenol | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.0690 | uM |
| methyl 4-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]piperidine-1-carboxylate | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.0730 | uM |
| 5-[(4-methylsulfonylphenyl)methoxy]-2-(1H-pyrazol-5-yl)pyridine | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.0960 | uM |
| cyclopropyl-[4-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]piperidin-1-yl]methanone | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.1100 | uM |
| N-[4-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]cyclohexyl]acetamide | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.1700 | uM |
| 1-[(3S)-3-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]piperidin-1-yl]ethanone | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.1800 | uM |
| N-(4-chlorophenyl)-5-ethyl-N-methyl-3-phenyl-1,2-oxazole-4-carboxamide | 2108148: Inhibition of CYP450 (unknown origin) | ic50 | 0.2512 | uM |
| 5-[(3-methylsulfonylphenyl)methoxy]-2-(1H-pyrazol-5-yl)pyridine | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.2600 | uM |
| ethyl 4-[2-[4-(1H-pyrazol-5-yl)phenoxy]ethyl]piperazine-1-carboxylate | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.5100 | uM |
| 5-[(1-methylsulfonylpiperidin-4-yl)methoxy]-2-(1H-pyrazol-5-yl)pyridine | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.6400 | uM |
| 1-[(3R)-3-[[6-(1H-pyrazol-5-yl)-3-pyridinyl]oxymethyl]piperidin-1-yl]ethanone | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.6400 | uM |
| 2-(dimethylamino)-2-(2-ethylphenyl)-N-[3-(3-sulfamoylphenyl)-1H-indazol-5-yl]acetamide | 2119433: Inhibition of CYP450 (unknown origin) | ic50 | 0.7000 | uM |
| 5-[[(3R)-1-methylsulfonylpiperidin-3-yl]methoxy]-2-(1H-pyrazol-5-yl)pyridine | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.7100 | uM |
| 5-[[(3S)-1-methylsulfonylpiperidin-3-yl]methoxy]-2-(1H-pyrazol-5-yl)pyridine | 1858242: Inhibition of human recombinant CYP4F2 using Luciferin-4F2/3 as substrate incubated for 60 mins in presence of NADPH regenerating system by luminescence based assay | ic50 | 0.7300 | uM |
| 1-[4-[4-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone | 1216150: Inhibition of human CYP4F2 in human liver microsomes assessed as fingolimod metabolism | ki | 0.7400 | uM |
| 2-[4-(trifluoromethyl)phenyl]chromen-4-one | 1860362: Inhibition of recombinant human CYP4F2 expressed in baculovirus-infected insect cells in presence of arachidonic acid and NADPH incubated for 15 mins by jump-dilution assay relative to control | ic50 | 0.7600 | uM |
| 2-pyrrolidin-1-yl-N-[3-(3-sulfamoylphenyl)-1H-indazol-5-yl]-2-thiophen-3-ylacetamide | 2119433: Inhibition of CYP450 (unknown origin) | ic50 | 0.9000 | uM |
| 4-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-4-N-[[(7R)-5,6,7,8-tetrahydro-1,6-naphthyridin-7-yl]methyl]cyclohexane-1,4-diamine | 2124397: Inhibition of CYP450 (unknown origin) | ic50 | 2.5000 | uM |
| 1-[3-(2,4-dimethoxyphenyl)phenyl]-2,4-dimethoxybenzene | 1973305: Inhibition of CYP450 in pooled human liver microsomes in presence of NADPH measured every 3 mins for 120 mins by fluorescence based analysis | ic50 | 3.7000 | uM |
| 1-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-3,5-dimethoxybenzene | 1973305: Inhibition of CYP450 in pooled human liver microsomes in presence of NADPH measured every 3 mins for 120 mins by fluorescence based analysis | ic50 | 3.7000 | uM |
| 2,4-bis(3,5-dimethoxyphenyl)pyrimidine | 1973305: Inhibition of CYP450 in pooled human liver microsomes in presence of NADPH measured every 3 mins for 120 mins by fluorescence based analysis | ic50 | 3.8000 | uM |
| 2,5-bis(3,5-dimethoxyphenyl)thiophene | 1973305: Inhibition of CYP450 in pooled human liver microsomes in presence of NADPH measured every 3 mins for 120 mins by fluorescence based analysis | ic50 | 3.9000 | uM |
| [(1R,3S,3aR,5aS,5bS,6S,7aR,11aS,13aR,13bR)-1,6-dihydroxy-5a,8,8,11a,13a-pentamethyl-9-oxo-3-propan-2-yl-2,3,4,5,5b,6,7,7a,10,11,13,13b-dodecahydro-1H-cyclopenta[a]chrysen-3a-yl]methyl acetate | 1860381: Inhibition of recombinant CYP4F2 (unknown origin) incubated for 5 to 15 mins in presence of NADPH by LC-MS/MS analysis | ic50 | 4.2000 | uM |
| octadec-17-ynoic acid | 690542: Inhibition of leukotriene B4 omega-hydroxylase in human polymorphonuclear leukocytes by UV spectroscopy | ic50 | 5.0000 | uM |
| 4-[2-(2,4-dimethoxyphenyl)-1,3-thiazol-4-yl]phenol | 1973305: Inhibition of CYP450 in pooled human liver microsomes in presence of NADPH measured every 3 mins for 120 mins by fluorescence based analysis | ic50 | 5.9000 | uM |
| 1-pyridin-4-yl-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-4-ol | 2022025: Inhibition of CYP450 in human liver microsomes | ic50 | 6.0534 | uM |
| (5R)-3-[1-(1H-indol-2-ylmethyl)piperidin-4-yl]-5-(6-methoxyquinolin-4-yl)-1,3-oxazolidin-2-one | 306257: Inhibition of CYP450 | ic50 | 7.9433 | uM |
| 3-[1-[(3,4-dimethylphenyl)methyl]piperidin-4-yl]-5-(6-methoxyquinolin-4-yl)-1,3-oxazolidin-2-one | 306257: Inhibition of CYP450 | ic50 | 10.0000 | uM |
| 1-[3-(3,5-dimethoxyphenyl)phenyl]-3,5-dimethoxybenzene | 1973305: Inhibition of CYP450 in pooled human liver microsomes in presence of NADPH measured every 3 mins for 120 mins by fluorescence based analysis | ic50 | 10.0000 | uM |
CTD chemical–gene interactions
63 total (human), top 30 by PubMed support.
| Chemical | Actions (top 5) | PubMed papers |
|---|---|---|
| Warfarin | affects response to substance, affects cotreatment, increases response to substance | 34 |
| Vitamin K 1 | decreases metabolic processing, affects abundance, increases oxidation | 3 |
| Cyclosporine | decreases expression | 3 |
| Aflatoxin B1 | affects expression, decreases expression, increases expression | 3 |
| Acenocoumarol | affects response to substance | 2 |
| Benzo(a)pyrene | decreases expression | 2 |
| Cisplatin | affects cotreatment, increases expression | 2 |
| 6,7-dimethoxy-2-(pyrrolidin-1-yl)-N-(5-(pyrrolidin-1-yl)pentyl)quinazolin-4-amine | increases expression | 1 |
| rubiarbonone C | decreases reaction, increases hydroxylation, decreases activity | 1 |
| methyleugenol | decreases expression | 1 |
| propionaldehyde | increases expression | 1 |
| pirinixic acid | affects binding, decreases expression, increases activity | 1 |
| sulforaphane | increases expression | 1 |
| tris(1,3-dichloro-2-propyl)phosphate | increases expression | 1 |
| sodium arsenite | decreases expression | 1 |
| periodate-oxidized adenosine | affects expression | 1 |
| menatetrenone | affects abundance | 1 |
| AICA ribonucleotide | increases expression, decreases reaction, affects reaction | 1 |
| pentanal | increases expression | 1 |
| 19-hydroxy-5,8,11,14-eicosatetraenoic acid | increases chemical synthesis | 1 |
| 20-hydroxy-5,8,11,14-eicosatetraenoic acid | increases chemical synthesis | 1 |
| perfluorooctane sulfonic acid | decreases expression | 1 |
| fipronil | affects cotreatment, decreases expression | 1 |
| perfluoro-n-nonanoic acid | decreases expression | 1 |
| splitomicin | decreases reaction, increases expression | 1 |
| 2-chloro-5-nitrobenzanilide | decreases expression, increases reaction | 1 |
| STO 609 | decreases reaction, increases expression | 1 |
| abrine | increases expression | 1 |
| N-(3-chloro-4-morpholin-4-yl) phenyl-N’-hydroxyimido formamide | decreases activity | 1 |
| 4-hydroxy-3-(4-(2-hydroxyphenyl)phenyl)-6-oxo-7H-thieno(2,3-b)pyridine-5-carbonitrile | increases expression | 1 |
ChEMBL screening assays
223 unique, capped per target: 214 admet, 9 binding
Representative assays (with source publication via chembl_document):
| Assay ID | Type | Description | Source paper |
|---|---|---|---|
| CHEMBL2155872 | Binding | Inhibition of leukotriene B4 omega-hydroxylase in human polymorphonuclear leukocytes by UV spectroscopy | 2-Alkynoic fatty acids inhibit topoisomerase IB from Leishmania donovani. — Bioorg Med Chem Lett |
| CHEMBL3509252 | ADMET | Enzyme kinetics constant (Km value) for CYP4F2 was determined in human liver microsome incubated with [14C]SPP100 hemifumarate | FDA drug approval package for Aliskiren hemifumarate |
Clinical trials (associated diseases)
0 trials via MONDO — disease-level, not drug-specific.
Related Atlas pages
No linked Atlas pages yet — the cross-entity mesh grows as the corpus expands.