SCHEMBL2741532

SCHEMBL2741532

CC1CCC(C2CCC(C(F)(F)Oc3cc(F)c(F)c(F)c3)CC2)OC1

nearest known ligand 0.00

⚠ Novel chemotype — no close known analogue (best Tanimoto < 0.3). Unexplored chemical space relative to ChEMBL.

Similar compounds — the chemically nearest patent molecules

Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.

Compoundsimilaritytop predictedshared targets
SCHEMBL18034082 0.93
SCHEMBL17548048 0.92
SCHEMBL14579886 0.90
SCHEMBL17548046 0.89 BACE1 (0.31)
SCHEMBL13433616 0.88 FFAR4 (0.30)
SCHEMBL16790915 0.85
SCHEMBL16546335 0.85
SCHEMBL16546363 0.85
SCHEMBL13295550 0.85
SCHEMBL16789617 0.85

Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.

Patent provenance — the patents this molecule appears in, and who filed them

Claimed or disclosed in 182 patents — showing the first 20. claimed = in the patent's claims; disclosed = body only.

PatentTitleAssigneePublishedPriorityFilingCountryStatus
US-12043781-B2 Liquid-crystalline medium MERCK PATENT GMBH (DE) 2024-07-23 US disclosed
US-20230383186-A1 LIQUID-CRYSTAL MEDIUM MERCK PATENT GMBH (DE) 2023-11-30 US disclosed
US-20230383186-A1 LIQUID-CRYSTAL MEDIUM MERCK PATENT GMBH (DE) 2023-11-30 US disclosed
US-20230323209-A1 LIQUID-CRYSTAL MEDIUM MERCK PATENT GMBH (DE) 2023-10-12 US disclosed
US-11739266-B2 Polymerisable compounds and the use thereof in liquid-crystal displays MERCK PATENT GMBH (DE) 2023-08-29 US disclosed
US-11739267-B2 LC medium MERCK PATENT GMBH (DE) 2023-08-29 US disclosed
US-11739267-B2 LC medium MERCK PATENT GMBH (DE) 2023-08-29 US disclosed
US-11718791-B2 Polymerisable compounds and the use thereof in liquid-crystal displays MERCK PATENT GMBH (DE) 2023-08-08 US disclosed
US-11718791-B2 Polymerisable compounds and the use thereof in liquid-crystal displays MERCK PATENT GMBH (DE) 2023-08-08 US disclosed
US-11685863-B2 Polymerisable compounds and the use thereof in liquid-crystal displays MERCK PATENT GMBH (DE) 2023-06-27 US disclosed
US-7622165-B2 Liquid-crystalline medium MERCK PATENT GMBH (DE) 2009-11-24 US disclosed
US-20090230354-A1 Liquid Crystalline Medium MERCK PATENT GESELLSCHAFT (DE) 2009-09-17 US disclosed
US-7553523-B2 Liquid crystal medium MERCK PATENT GMBH (DE) 2009-06-30 US disclosed
US-20080128653-A1 Liquid Crystalline Medium MERCK PATENT GMBH (DE) 2008-06-05 US disclosed
US-20080083902-A1 an 1-alkoxy-2,3-difluoro-4-cyclohexylenyl-benzene, and a 4,4'(alkyl, alkenyl or alkoxy) bicyclohexyl or a (4 or 4')-(alkyl, alkenyl or alkoxy)phenyl cyclohexane; high specific resistance, short response times, low threshold voltage; for electro-optical liquid-crystal dispaly MERCK PATENT GMBH 2008-04-10 US disclosed
US-20080085380-A1 Electrooptical apparatus; have a very low threshold voltage at the same time as high dielectric anisotropy, a high clearing point, large specific resistance and low birefringence MERCK PATENT GMBH 2008-04-10 US disclosed
US-7291367-B2 Liquid-crystalline compounds MERCK PATENT GMBH (DE) 2007-11-06 US disclosed
US-20070176144-A1 Liquid crystal composition for bistable liquid crystal devices MERCK PATENT GESELLSCHAFT MIT BESCHRANKTER HAFTUNG (DE) 2007-08-02 US disclosed
US-20070170395-A1 Liquid crystal medium MERCK PATENT GESELLSCHAFT 2007-07-26 US disclosed
US-7175891-B2 Liquid-crystalline medium MERCK PATENT GMBH (DE) 2007-02-13 US disclosed