SCHEMBL3867706

SCHEMBL3867706

CC[Si](CC)(O[SiH](C)C)O[SiH](C)C

nearest known ligand 0.00

⚠ Novel chemotype — no close known analogue (best Tanimoto < 0.3). Unexplored chemical space relative to ChEMBL.

Similar compounds — the chemically nearest patent molecules

Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.

Compoundsimilaritytop predictedshared targets
SCHEMBL5252842 0.76
SCHEMBL11208027 0.76
SCHEMBL629570 0.73
SCHEMBL47730 0.73
SCHEMBL5701359 0.71
SCHEMBL17807955 0.71
SCHEMBL9350307 0.69
SCHEMBL5701686 0.69
SCHEMBL5701787 0.67
SCHEMBL26780509 0.67

Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.

Patent provenance — the patents this molecule appears in, and who filed them

Claimed or disclosed in 9 patents. claimed = in the patent's claims; disclosed = body only.

PatentTitleAssigneePublishedPriorityFilingCountryStatus
US-20060270787-A1 Additives to prevent degradation of alkyl-hydrogen siloxanes VERSUM MATERIALS US, LLC 2006-11-30 US claimed
US-7129311-B2 Additives to prevent degradation of alkyl-hydrogen siloxanes ARCH SPECIALTY CHEMICALS, INC. (US) 2006-10-31 US claimed
US-20060159861-A1 Additives to prevent degradation of alkyl-hydrogen siloxanes ARCH SPECIALTY CHEMICALS, INC. (US) 2006-07-20 US claimed
US-20040127070-A1 Additives to prevent degradation of alkyl-hydrogen siloxanes ARCH SPECIALTY CHEMICALS, INC. 2004-07-01 US claimed
US-7531590-B2 Additives to prevent degradation of alkyl-hydrogen siloxanes FUJIFILM ELECTRONIC MATERIALS U.S.A., INC. (US) 2009-05-12 US disclosed
US-20060270787-A1 Additives to prevent degradation of alkyl-hydrogen siloxanes VERSUM MATERIALS US, LLC 2006-11-30 US disclosed
US-7129311-B2 Additives to prevent degradation of alkyl-hydrogen siloxanes ARCH SPECIALTY CHEMICALS, INC. (US) 2006-10-31 US disclosed
US-20060159861-A1 Additives to prevent degradation of alkyl-hydrogen siloxanes ARCH SPECIALTY CHEMICALS, INC. (US) 2006-07-20 US disclosed
US-20040127070-A1 Additives to prevent degradation of alkyl-hydrogen siloxanes ARCH SPECIALTY CHEMICALS, INC. 2004-07-01 US disclosed