Known targets — ChEMBL curated mechanism
The experimentally established mechanism targets of Oxalic Acid. The predicted profile below is derived independently by chemical similarity — agreement is a validation signal, a miss is honest.
Predicted protein targets (top 13)
| gene | UniProt | supporting neighbours | confidence | |
|---|---|---|---|---|
| ▸ | KDM4E | B2RXH2 | 4/20 | 0.88 |
| ▸ | ALDH1A1 | P00352 | 4/20 | 0.88 |
| ▸ | SMN1; SMN2 | Q16637 | 1/20 | 0.88 |
| ▸ | HRH3 | Q9Y5N1 | 14/20 | 0.82 |
| ▸ | HRH4 | Q9H3N8 | 3/20 | 0.82 |
| ▸ | KCNH2 | Q12809 | 2/20 | 0.82 |
| ▸ | HRH1 | P35367 | 1/20 | 0.82 |
| ▸ | NPC1 | O15118 | 1/20 | 0.78 |
| ▸ | HTT | P42858 | 1/20 | 0.78 |
| ▸ | RAB9A | P51151 | 1/20 | 0.78 |
| ▸ | NPSR1 | Q6W5P4 | 1/20 | 0.78 |
| ▸ | L3MBTL1 | Q9Y468 | 1/20 | 0.78 |
| ▸ | NPY1R | P25929 | 1/20 | 0.76 |
Click a target to see other patent compounds predicted against it — the reverse direction, in place.
Similar compounds — the chemically nearest patent molecules
Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.
| Compound | similarity | top predicted | shared targets | |
|---|---|---|---|---|
| Oxalic Acid SCHEMBL5857809 | 1.00 | KDM4E (0.88) | KDM4EALDH1A1SMN1; SMN2HRH3HRH4 | |
| Oxalic Acid SCHEMBL5855932 | 0.98 | KDM4E (0.86) | KDM4EALDH1A1SMN1; SMN2HRH3HRH4 | |
| Oxalic Acid SCHEMBL5856019 | 0.98 | KDM4E (0.91) | KDM4EALDH1A1SMN1; SMN2HRH3HRH4 | |
| Oxalic Acid SCHEMBL5856230 | 0.94 | KDM4E (1.00) | KDM4EALDH1A1SMN1; SMN2HRH3HRH4 | |
| Oxalic Acid SCHEMBL27731873 | 0.92 | KDM4E (0.97) | KDM4EALDH1A1SMN1; SMN2HRH3HRH4 | |
| SCHEMBL491550 | 0.92 | HRH3 (0.79) | KDM4EALDH1A1SMN1; SMN2HRH3HRH4 | |
| SCHEMBL492176 | 0.92 | HRH3 (0.79) | KDM4EALDH1A1SMN1; SMN2HRH3HRH4 | |
| SCHEMBL5291543 | 0.91 | HRH3 (0.82) | KDM4EALDH1A1SMN1; SMN2HRH3HRH4 | |
| SCHEMBL7398556 | 0.91 | HRH3 (0.82) | KDM4EALDH1A1SMN1; SMN2HRH3HRH4 | |
| SCHEMBL492095 | 0.91 | HRH3 (0.82) | KDM4EALDH1A1SMN1; SMN2HRH3HRH4 |
Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.
Patent provenance — the patents this molecule appears in, and who filed them
Claimed or disclosed in 1 patent. claimed = in the patent's claims; disclosed = body only.
| Patent | Title | Assignee | Published | Priority | Filing | Country | Status |
|---|---|---|---|---|---|---|---|
| US-7138413-B1 | Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders | SOCIETE CIVILE BIOPROJET (FR) | 2006-11-21 | — | — | US | disclosed |