Predicted protein targets (top 8)
| gene | UniProt | supporting neighbours | confidence | |
|---|---|---|---|---|
| ▸ | HRH3 | Q9Y5N1 | 13/20 | 0.94 |
| ▸ | DRD3 | P35462 | 3/20 | 0.68 |
| ▸ | KCNH2 | Q12809 | 1/20 | 0.63 |
| ▸ | HRH4 | Q9H3N8 | 1/20 | 0.63 |
| ▸ | SLC6A2 | P23975 | 2/20 | 0.63 |
| ▸ | SLC6A4 | P31645 | 2/20 | 0.63 |
| ▸ | DRD2 | P14416 | 1/20 | 0.62 |
| ▸ | ADRA1A | P35348 | 1/20 | 0.62 |
Click a target to see other patent compounds predicted against it — the reverse direction, in place.
Similar compounds — the chemically nearest patent molecules
Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.
| Compound | similarity | top predicted | shared targets | |
|---|---|---|---|---|
| SCHEMBL491968 | 0.98 | HRH3 (0.97) | HRH3DRD3KCNH2HRH4SLC6A2 | |
| SCHEMBL12741179 | 0.97 | HRH3 (1.00) | HRH3DRD3KCNH2HRH4 | |
| SCHEMBL14970452 | 0.91 | HRH3 (0.89) | HRH3DRD3KCNH2SLC6A2SLC6A4 | |
| SCHEMBL5288608 | 0.88 | HRH3 (0.79) | HRH3DRD3KCNH2HRH4 | |
| SCHEMBL5277527 | 0.87 | HRH3 (0.79) | HRH3DRD3DRD2ADRA1A | |
| SCHEMBL30186207 | 0.86 | HRH3 (0.81) | HRH3DRD3SLC6A2SLC6A4 | |
| SCHEMBL11151279 | 0.86 | HRH3 (0.81) | HRH3DRD3SLC6A2SLC6A4 | |
| SCHEMBL491550 | 0.81 | HRH3 (0.79) | HRH3KCNH2HRH4 | |
| SCHEMBL492176 | 0.81 | HRH3 (0.79) | HRH3KCNH2HRH4 | |
| SCHEMBL5857700 | 0.81 | HRH3 (0.94) | HRH3KCNH2HRH4 |
Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.
Patent provenance — the patents this molecule appears in, and who filed them
Claimed or disclosed in 1 patent. claimed = in the patent's claims; disclosed = body only.
| Patent | Title | Assignee | Published | Priority | Filing | Country | Status |
|---|---|---|---|---|---|---|---|
| US-7138413-B1 | Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders | SOCIETE CIVILE BIOPROJET (FR) | 2006-11-21 | — | — | US | disclosed |