SCHEMBL12772015

SCHEMBL12772015

CC(C)(C)c1cccc(CN(c2ccccc2)c2ccccc2)c1P(Cl)Cl

nearest known ligand 0.34

Predicted protein targets (top 13)

geneUniProtsupporting neighboursconfidence
ESR1 P03372 1/20 0.34
ESR2 Q92731 1/20 0.34
CYP2D6 P10635 1/20 0.33
NR3C2 P08235 1/20 0.32
POLQ O75417 1/20 0.31
ATM Q13315 1/20 0.31
CA2 P00918 1/20 0.31
NPSR1 Q6W5P4 1/20 0.31
MCOLN3 Q8TDD5 1/20 0.31
NOS2 P35228 1/20 0.30
ALDH1A1 P00352 1/20 0.30
TSHR P16473 1/20 0.30
TDP1 Q9NUW8 1/20 0.30

Click a target to see other patent compounds predicted against it — the reverse direction, in place.

Similar compounds — the chemically nearest patent molecules

Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.

Compoundsimilaritytop predictedshared targets
SCHEMBL12772021 0.87 TAAR1 (0.33) CYP2D6POLQATMCA2NPSR1
SCHEMBL12771997 0.81 CYP1A2 (0.38) CYP2D6CA2ALDH1A1TSHR
SCHEMBL12772023 0.81 CNR2 (0.36) CYP2D6ATMALDH1A1TSHR
SCHEMBL12772019 0.80 ESR1 (0.46) ESR1ESR2NR3C2NOS2ALDH1A1
SCHEMBL12772006 0.79 MAPT (0.36) CYP2D6CA2ALDH1A1TSHRTDP1
SCHEMBL12772039 0.78 KDM4E (0.43) CYP2D6ALDH1A1TSHR
SCHEMBL12772014 0.77 ESR1 (0.34) ESR1ESR2NR3C2CA2NPSR1
SCHEMBL12774307 0.74 CA2 (0.33) CA2MCOLN3ALDH1A1TSHRTDP1
SCHEMBL12774331 0.73 MCOLN3 (0.35) CA2MCOLN3ALDH1A1TSHRTDP1
SCHEMBL12772013 0.71 TAAR1 (0.36) ESR1ESR2NR3C2NOS2

Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.

Patent provenance — the patents this molecule appears in, and who filed them

Claimed or disclosed in 7 patents. claimed = in the patent's claims; disclosed = body only.

PatentTitleAssigneePublishedPriorityFilingCountryStatus
US-7915455-B2 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex SUMITOMO CHEMICAL COMPANY, LIMITED (JP) 2011-03-29 US disclosed
US-7915455-B2 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex SUMITOMO CHEMICAL COMPANY, LIMITED (JP) 2011-03-29 US disclosed
US-20090143620-A1 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex SUMITOMO CHEMICAL COMPANY, LIMITED 2009-06-04 US disclosed
US-7482414-B2 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex SUMITOMO CHEMICAL COMPANY, LIMITED (JP) 2009-01-27 US disclosed
US-7482414-B2 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex SUMITOMO CHEMICAL COMPANY, LIMITED (JP) 2009-01-27 US disclosed
US-20070135600-A1 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex SUMITOMO CHEMICAL COMPANY, LIMITED (JP) 2007-06-14 US disclosed
US-20070135600-A1 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex SUMITOMO CHEMICAL COMPANY, LIMITED (JP) 2007-06-14 US disclosed

Patent text — is the patent's own abstract consistent with the prediction?

For each of this compound's patents that has machine-readable text (2 of them — usually the abstract, not the full specification), we ask MedCPT which protein the text reads most about, and where the chemistry-predicted target lands among 4885 human targets. A high rank means the patent's own wording is consistent with the prediction — a weak, independent signal, not proof of activity.

PatentTitleText reads most aboutPredicted target · text-rank
US-20070135600-A1 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex AP1M1, OR10J3, AP2M1 ESR1 372/4885ESR2 982/4885CYP2D6 2096/4885
US-20090143620-A1 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex AP1M1, OR10J3, AP2M1 ESR1 372/4885ESR2 982/4885CYP2D6 2096/4885

“Text reads most about” is the patent abstract's nearest protein in MedCPT space (background-debiased). Only ~1.4% of patents have machine-readable text, so most compounds won't have this panel.