SCHEMBL250884

SCHEMBL250884

Oc1ccc(Cc2cc(F)cc(Cc3ccc(O)c(Cl)c3)c2O)cc1Cl

nearest known ligand 0.66

Predicted protein targets (top 20)

geneUniProtsupporting neighboursconfidence
HSD17B10 Q99714 3/20 0.66
CYP2C9 P11712 2/20 0.66
CYP2C19 P33261 2/20 0.66
CYP3A4 P08684 2/20 0.66
CYP1A2 P05177 1/20 0.66
CYP2D6 P10635 1/20 0.66
CA2 P00918 3/20 0.46
MAPT P10636 2/20 0.46
HIF1A Q16665 2/20 0.43
HDAC8 Q9BY41 1/20 0.41
MEN1 O00255 2/20 0.41
KMT2A Q03164 2/20 0.41
MET P08581 1/20 0.41
PIK3CA P42336 1/20 0.40
CA1 P00915 2/20 0.39
CA4 P22748 1/20 0.39
CA6 P23280 1/20 0.39
TSHR P16473 1/20 0.39
SNCA P37840 1/20 0.39
HSD17B2 P37059 1/20 0.38

Click a target to see other patent compounds predicted against it — the reverse direction, in place.

Similar compounds — the chemically nearest patent molecules

Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.

Compoundsimilaritytop predictedshared targets
SCHEMBL13609011 0.83 CYP2C9 (0.66) HSD17B10CYP2C9CYP2C19CYP3A4CYP1A2
SCHEMBL30375459 0.82 MAPT (0.48) HSD17B10CYP2C9CYP2C19CYP3A4CYP1A2
SCHEMBL1269441 0.82 MAPT (0.48) HSD17B10CYP2C9CYP2C19CYP3A4CYP1A2
SCHEMBL27702905 0.80 CYP3A4 (0.54) HSD17B10CYP2C9CYP2C19CYP3A4CYP1A2
SCHEMBL71042 0.79 HSD17B10 (0.63) HSD17B10CYP2C9CYP2C19CYP3A4CYP1A2
SCHEMBL6249245 0.77 CYP3A4 (0.57) HSD17B10CYP2C9CYP2C19CYP3A4CYP1A2
SCHEMBL27906574 0.76 KLKB1 (0.58) HSD17B10CYP2C9CYP2C19CYP3A4CYP1A2
SCHEMBL14864961 0.76 CYP2C9 (0.60) HSD17B10CYP2C9CYP2C19CYP3A4CYP1A2
SCHEMBL14461926 0.74 CYP2C9 (0.55) HSD17B10CYP2C9CYP2C19CYP3A4CYP1A2
SCHEMBL11332215 0.74 HIF1A (0.79) HSD17B10CYP2C9CYP2C19CYP3A4CYP1A2

Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.

Patent provenance — the patents this molecule appears in, and who filed them

Claimed or disclosed in 18 patents. claimed = in the patent's claims; disclosed = body only.

PatentTitleAssigneePublishedPriorityFilingCountryStatus
US-8288072-B2 Antireflection film; fast etching speed whcih reduces deformation; accuracy; 2,3-epoxypropyl methacrylate ester-styrene copolymer SHIN-ETSU CHEMICAL CO., LTD. (JP) 2012-10-16 US disclosed
US-8088554-B2 Bottom resist layer composition and patterning process using the same SHIN-ETSU CHEMICAL CO., LTD (JP) 2012-01-03 US disclosed
US-7871761-B2 Resist lower layer material, resist lower layer substrate comprising the material and method for forming pattern SHIN-ETSU CHEMICAL CO., LTD. (JP) 2011-01-18 US disclosed
US-7745104-B2 Polymer having a hydrocarbon chain backbone and containing units derived from norbornadiene, indene, benzofuran, benzothiophene, acenaphthene, or vinyl pyrene, fluorene, phenanthrene, chrysene, naphthacene, pentacene, or acenaphthene; excellent etching resistance; shorter wavelengths SHIN-ETSU CHEMICAL CO., LTD. (JP) 2010-06-29 US disclosed
US-20100151382-A1 Bottom resist layer composition and patterning process using the same SHIN-ETSU CHEMICAL CO., LTD. (JP) 2010-06-17 US disclosed
US-7687228-B2 Antireflection film composition and patterning process using the same SHIN ETSU CHEMICAL CO., LTD. (JP) 2010-03-30 US disclosed
US-7476485-B2 Resist lower layer film material and method for forming a pattern SHIN-ESTU CHEMICAL CO., LTD. (JP) 2009-01-13 US disclosed
US-20080227037-A1 Resist lower layer film composition and patterning process using the same SHIN-ETSU CHEMICAL CO., LTD. (JP) 2008-09-18 US disclosed
US-20080220381-A1 Antireflection film composition and patterning process using the same SHIN-ETSU CHEMICAL CO., LTD. (JP) 2008-09-11 US disclosed
EP-1798599-B1 Antireflection film composition, patterning process and substrate using the same SHINETSU CHEMICAL CO (JP) 2008-08-06 EP disclosed
US-20080038662-A1 Bottom resist layer composition and patterning process using the same SHIN-ETSU CHEMICAL CO., LTD. (JP) 2008-02-14 US disclosed
US-20080032231-A1 Resist lower layer material, resist lower layer substrate comprising the material and method for forming pattern SHIN-ETSU CHEMICAL CO., LTD. 2008-02-07 US disclosed
EP-1798599-A1 Antireflection film composition, patterning process and substrate using the same Shinetsu Chemical Co., Ltd. (JP) 2007-06-20 EP disclosed
US-20070134916-A1 Antireflection film composition, patterning process and substrate using the same SHIN-ETSU CHEMICAL CO., LTD. (JP) 2007-06-14 US disclosed
US-7214743-B2 Resist lower layer film material and method for forming a pattern SHIN-ETSU CHEMICAL CO., LTD. (JP) 2007-05-08 US disclosed
US-20060234158-A1 Bottom resist layer composition and patterning process using the same SHIN-ETSU CHEMICAL CO., LTD. (JP) 2006-10-19 US disclosed
US-20040259037-A1 Resist lower layer film material and method for forming a pattern SHIN-ETSU CHEMICAL CO., LTD. (JP) 2004-12-23 US disclosed
US-20040241577-A1 Resist lower layer film material and method for forming a pattern SHIN-ETSU CHEMICAL CO., LTD. (JP) 2004-12-02 US disclosed