SCHEMBL2907266

SCHEMBL2907266

Cc1ccc(-c2ncc(-c3ccccc3)nc2-c2ccc(C)cc2)cc1

nearest known ligand 0.59

Predicted protein targets (top 20)

geneUniProtsupporting neighboursconfidence
TDP1 Q9NUW8 2/20 0.59
ALDH1A1 P00352 4/20 0.53
KDM4E B2RXH2 4/20 0.51
MEN1 O00255 4/20 0.51
KMT2A Q03164 4/20 0.51
CNR1 P21554 4/20 0.51
L3MBTL1 Q9Y468 3/20 0.51
USP2 O75604 1/20 0.51
MAPK1 P28482 1/20 0.51
ATM Q13315 1/20 0.51
MAPT P10636 2/20 0.50
HPGD P15428 1/20 0.50
CKS1B P61024 1/20 0.50
SKP1 P63208 1/20 0.50
SKP2 Q13309 1/20 0.50
RAB9A P51151 2/20 0.49
NPC1 O15118 1/20 0.49
PDGFRB P09619 1/20 0.49
KDR P35968 1/20 0.49
FLT3 P36888 1/20 0.49

Click a target to see other patent compounds predicted against it — the reverse direction, in place.

Similar compounds — the chemically nearest patent molecules

Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.

Compoundsimilaritytop predictedshared targets
SCHEMBL2911515 1.00 TDP1 (0.59) TDP1ALDH1A1KDM4EMEN1KMT2A
SCHEMBL16750246 0.89 CKS1B (0.52) TDP1ALDH1A1KDM4EMEN1KMT2A
SCHEMBL87574 0.89 CKS1B (0.55) ALDH1A1KDM4EMEN1KMT2ACNR1
SCHEMBL15256058 0.88 TDP1 (0.50) TDP1ALDH1A1KDM4EMEN1KMT2A
SCHEMBL28243355 0.87 CKS1B (0.53) ALDH1A1KDM4EMEN1KMT2ACNR1
SCHEMBL27816089 0.87 CKS1B (0.53) ALDH1A1KDM4EMEN1KMT2ACNR1
SCHEMBL29406280 0.87 CKS1B (0.53) ALDH1A1KDM4EMEN1KMT2ACNR1
SCHEMBL30709027 0.85 ATR (0.52) TDP1ALDH1A1KDM4EMEN1KMT2A
SCHEMBL15256043 0.85 TDP1 (0.47) TDP1ALDH1A1KDM4EMEN1KMT2A
SCHEMBL16750249 0.85 ADORA2A (0.49) TDP1ALDH1A1KDM4EMEN1KMT2A

Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.

Patent provenance — the patents this molecule appears in, and who filed them

Claimed or disclosed in 21 patents — showing the first 20. claimed = in the patent's claims; disclosed = body only.

PatentTitleAssigneePublishedPriorityFilingCountryStatus
US-10103341-B2 Organometallic complex and light emitting element, light emitting device, and electronic device using the organometallic complex SEMICONDUCTOR ENERGY LABORATORY CO., LTD. (JP) 2018-10-16 US disclosed
CN-105061514-A Organometallic complex and light emitting element, light emitting device, and electronic device using the organometallic complex SEMICONDUCTOR ENERGY LAB 2015-11-18 CN disclosed
CN-104835917-A Light-emitting element, light-emitting device and electronic device SEMICONDUCTOR ENERGY LAB 2015-08-12 CN disclosed
US-20150214484-A1 Organometallic Complex and Light Emitting Element, Light Emitting Device, and Electronic Device Using the Organometallic Complex SEMICONDUCTOR ENERGY LABORATORY CO., LTD. (JP) 2015-07-30 US disclosed
US-20150214484-A1 Organometallic Complex and Light Emitting Element, Light Emitting Device, and Electronic Device Using the Organometallic Complex SEMICONDUCTOR ENERGY LABORATORY CO., LTD. (JP) 2015-07-30 US disclosed
US-20150214484-A1 Organometallic Complex and Light Emitting Element, Light Emitting Device, and Electronic Device Using the Organometallic Complex SEMICONDUCTOR ENERGY LABORATORY CO., LTD. (JP) 2015-07-30 US disclosed
CN-101814583-B Light-emitting element, light-emitting device, and electronic apparatus SEMICONDUCTOR ENERGY LAB 2015-07-08 CN disclosed
US-8999520-B2 Organometallic complex and light emitting element, light emitting device, and electronic device using the organometallic complex SEMICONDUCTOR ENERGY LABORATORY CO., LTD. (JP) 2015-04-07 US disclosed
US-8999520-B2 Organometallic complex and light emitting element, light emitting device, and electronic device using the organometallic complex SEMICONDUCTOR ENERGY LABORATORY CO., LTD. (JP) 2015-04-07 US disclosed
US-8999520-B2 Organometallic complex and light emitting element, light emitting device, and electronic device using the organometallic complex SEMICONDUCTOR ENERGY LABORATORY CO., LTD. (JP) 2015-04-07 US disclosed
EP-2254173-B1 Organometallic complex and light emitting element, light emitting device, and electronic device using the organometallic complex SEMICONDUCTOR ENERGY LAB (JP) 2013-09-18 EP disclosed
EP-2254173-A1 Organometallic complex and light emitting element, light emitting device, and electronic device using the organometallic complex Semiconductor Energy Laboratory Co, Ltd. (JP) 2010-11-24 EP disclosed
EP-2254173-A1 Organometallic complex and light emitting element, light emitting device, and electronic device using the organometallic complex Semiconductor Energy Laboratory Co, Ltd. (JP) 2010-11-24 EP disclosed
EP-1873163-B1 Organometallic complex and light emitting element, light emitting device, and electronic device using the organometallic complex SEMICONDUCTOR ENERGY LAB (JP) 2010-08-25 EP disclosed
EP-1873163-B1 Organometallic complex and light emitting element, light emitting device, and electronic device using the organometallic complex SEMICONDUCTOR ENERGY LAB (JP) 2010-08-25 EP disclosed
EP-1873163-A1 Organometallic complex and light emitting element, light emitting device, and electronic device using the organometallic complex SEMICONDUCTOR ENERGY LABORATORY CO., LTD. (JP) 2008-01-02 EP disclosed
EP-1873163-A1 Organometallic complex and light emitting element, light emitting device, and electronic device using the organometallic complex SEMICONDUCTOR ENERGY LABORATORY CO., LTD. (JP) 2008-01-02 EP disclosed
US-20070244320-A1 Organometallic complex and light emitting element, light emitting device, and electronic device using the organometallic complex SEMICONDUCTOR ENERGY LABORATORY CO., LTD. 2007-10-18 US disclosed
US-20070244320-A1 Organometallic complex and light emitting element, light emitting device, and electronic device using the organometallic complex SEMICONDUCTOR ENERGY LABORATORY CO., LTD. 2007-10-18 US disclosed
US-20070244320-A1 Organometallic complex and light emitting element, light emitting device, and electronic device using the organometallic complex SEMICONDUCTOR ENERGY LABORATORY CO., LTD. 2007-10-18 US disclosed

Patent text — is the patent's own abstract consistent with the prediction?

For each of this compound's patents that has machine-readable text (1 of them — usually the abstract, not the full specification), we ask MedCPT which protein the text reads most about, and where the chemistry-predicted target lands among 4885 human targets. A high rank means the patent's own wording is consistent with the prediction — a weak, independent signal, not proof of activity.

PatentTitleText reads most aboutPredicted target · text-rank
US-10103341-B2 Organometallic complex and light emitting element, light emitting device, and electronic device using the organometallic complex CRY1, AP1M1, AP2M1 TDP1 4035/4885ALDH1A1 102/4885KDM4E 2310/4885

“Text reads most about” is the patent abstract's nearest protein in MedCPT space (background-debiased). Only ~1.4% of patents have machine-readable text, so most compounds won't have this panel.