SCHEMBL3871948

SCHEMBL3871948

Cc1ccc([SiH](O[Si](O[Si](O[Si](O[Si](O[SiH](c2ccc(C)cc2)c2ccc(C)cc2)(c2ccc(C)cc2)c2ccc(C)cc2)(c2ccc(C)cc2)c2ccc(C)cc2)(c2ccc(C)cc2)c2ccc(C)cc2)(c2ccc(C)cc2)c2ccc(C)cc2)c2ccc(C)cc2)cc1

nearest known ligand 0.31

Predicted protein targets (top 2)

geneUniProtsupporting neighboursconfidence
ACHE P22303 1/20 0.31
TDP1 Q9NUW8 1/20 0.31

Click a target to see other patent compounds predicted against it — the reverse direction, in place.

Similar compounds — the chemically nearest patent molecules

Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.

Compoundsimilaritytop predictedshared targets
SCHEMBL3871070 1.00 ACHE (0.31) ACHETDP1
SCHEMBL3874537 0.98 ACHE (0.32) ACHETDP1
SCHEMBL3878612 0.90 ACHE (0.35) ACHETDP1
SCHEMBL3874041 0.78 ACHE (0.35) ACHETDP1
SCHEMBL3867707 0.76
SCHEMBL3873563 0.76
SCHEMBL3871694 0.74
SCHEMBL20912519 0.73
SCHEMBL20912529 0.73
SCHEMBL10608073 0.73 ACHE (0.39) ACHETDP1

Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.

Patent provenance — the patents this molecule appears in, and who filed them

Claimed or disclosed in 9 patents. claimed = in the patent's claims; disclosed = body only.

PatentTitleAssigneePublishedPriorityFilingCountryStatus
US-20060270787-A1 Additives to prevent degradation of alkyl-hydrogen siloxanes VERSUM MATERIALS US, LLC 2006-11-30 US claimed
US-7129311-B2 Additives to prevent degradation of alkyl-hydrogen siloxanes ARCH SPECIALTY CHEMICALS, INC. (US) 2006-10-31 US claimed
US-20060159861-A1 Additives to prevent degradation of alkyl-hydrogen siloxanes ARCH SPECIALTY CHEMICALS, INC. (US) 2006-07-20 US claimed
US-20040127070-A1 Additives to prevent degradation of alkyl-hydrogen siloxanes ARCH SPECIALTY CHEMICALS, INC. 2004-07-01 US claimed
US-7531590-B2 Additives to prevent degradation of alkyl-hydrogen siloxanes FUJIFILM ELECTRONIC MATERIALS U.S.A., INC. (US) 2009-05-12 US disclosed
US-20060270787-A1 Additives to prevent degradation of alkyl-hydrogen siloxanes VERSUM MATERIALS US, LLC 2006-11-30 US disclosed
US-7129311-B2 Additives to prevent degradation of alkyl-hydrogen siloxanes ARCH SPECIALTY CHEMICALS, INC. (US) 2006-10-31 US disclosed
US-20060159861-A1 Additives to prevent degradation of alkyl-hydrogen siloxanes ARCH SPECIALTY CHEMICALS, INC. (US) 2006-07-20 US disclosed
US-20040127070-A1 Additives to prevent degradation of alkyl-hydrogen siloxanes ARCH SPECIALTY CHEMICALS, INC. 2004-07-01 US disclosed