SCHEMBL391814

SCHEMBL391814

CC(c1ccc(Cl)cc1)N(N)C(=O)C1(NC(=O)OC(C)(C)C)CCN(c2ncnc3[nH]ccc23)CC1

nearest known ligand 0.55

Predicted protein targets (top 20)

geneUniProtsupporting neighboursconfidence
AKT1 P31749 20/20 0.55
ROCK2 O75116 11/20 0.55
AKT2 P31751 11/20 0.55
AKT3 Q9Y243 10/20 0.55
KCNH2 Q12809 5/20 0.55
PRKD3 O94806 2/20 0.51
LATS1 O95835 2/20 0.51
PRKCB P05771 2/20 0.51
RET P07949 2/20 0.51
FGFR1 P11362 2/20 0.51
PRKCA P17252 2/20 0.51
PRKACA P17612 2/20 0.51
PRKACB P22694 2/20 0.51
GRK2 P25098 2/20 0.51
CLK1 P49759 2/20 0.51
LIMK1 P53667 2/20 0.51
LIMK2 P53671 2/20 0.51
PRKAG1 P54619 2/20 0.51
PRKCQ Q04759 2/20 0.51
PRKCD Q05655 2/20 0.51

Click a target to see other patent compounds predicted against it — the reverse direction, in place.

Similar compounds — the chemically nearest patent molecules

Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.

Compoundsimilaritytop predictedshared targets
SCHEMBL390669 0.91 AKT1 (0.53) AKT1ROCK2AKT2AKT3KCNH2
SCHEMBL20544762 0.89 AKT1 (0.60) AKT1ROCK2AKT2AKT3KCNH2
SCHEMBL390346 0.83 AKT1 (0.71) AKT1ROCK2AKT2AKT3KCNH2
SCHEMBL3655529 0.83 AKT1 (0.57) AKT1ROCK2AKT2AKT3KCNH2
SCHEMBL390345 0.83 AKT1 (0.71) AKT1ROCK2AKT2AKT3KCNH2
SCHEMBL392121 0.83 AKT1 (0.71) AKT1ROCK2AKT2AKT3KCNH2
SCHEMBL391178 0.83 AKT1 (0.71) AKT1ROCK2AKT2AKT3KCNH2
SCHEMBL3650884 0.82 AKT1 (0.52) AKT1ROCK2AKT2AKT3KCNH2
SCHEMBL3650885 0.82 AKT1 (0.57) AKT1ROCK2AKT2AKT3KCNH2
SCHEMBL391519 0.82 AKT1 (0.70) AKT1ROCK2AKT2AKT3KCNH2

Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.

Patent provenance — the patents this molecule appears in, and who filed them

Claimed or disclosed in 15 patents. claimed = in the patent's claims; disclosed = body only.

PatentTitleAssigneePublishedPriorityFilingCountryStatus
US-12252495-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2025-03-18 US disclosed
US-20240109902-A1 PROTEIN KINASE B INHIBITORS ASTRAZENECA AB (SE) 2024-04-04 US disclosed
US-11760760-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2023-09-19 US disclosed
US-20220220116-A1 PROTEIN KINASE B INHIBITORS ASTRAZENECA AB (SE) 2022-07-14 US disclosed
US-11236095-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2022-02-01 US disclosed
US-20200239483-A1 PROTEIN KINASE B INHIBITORS ASTRAZENECA AB (SE) 2020-07-30 US disclosed
US-10654855-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2020-05-19 US disclosed
US-20180312516-A1 Protein Kinase B Inhibitors ASTRAZENECA AB (SE) 2018-11-01 US disclosed
US-10059714-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2018-08-28 US disclosed
US-20170057969-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2017-03-02 US disclosed
US-9492453-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2016-11-15 US disclosed
US-20150182531-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2015-07-02 US disclosed
US-20120190679-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2012-07-26 US disclosed
US-8101623-B2 Substituted pyrrolo[2,3-d]pyrimidine as a protein kinase B inhibitor ASTRAZENECA AB (SE) 2012-01-24 US disclosed
US-20090163524-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2009-06-25 US disclosed

Patent text — is the patent's own abstract consistent with the prediction?

For each of this compound's patents that has machine-readable text (13 of them — usually the abstract, not the full specification), we ask MedCPT which protein the text reads most about, and where the chemistry-predicted target lands among 4885 human targets. A high rank means the patent's own wording is consistent with the prediction — a weak, independent signal, not proof of activity.

PatentTitleText reads most aboutPredicted target · text-rank
US-12252495-B2 Protein kinase B inhibitors PRKAR2B, PRKCB, AKT1 AKT1 3/4885ROCK2 60/4885AKT2 4/4885
US-20220220116-A1 PROTEIN KINASE B INHIBITORS PRKAR2B, PRKCB, AKT1 AKT1 3/4885ROCK2 60/4885AKT2 4/4885
US-20180312516-A1 Protein Kinase B Inhibitors PRKAR2B, PRKCB, AKT1 AKT1 3/4885ROCK2 60/4885AKT2 4/4885
US-10654855-B2 Protein kinase B inhibitors PRKAR2B, PRKCB, AKT1 AKT1 3/4885ROCK2 60/4885AKT2 4/4885
US-20240109902-A1 PROTEIN KINASE B INHIBITORS PRKAR2B, PRKCB, AKT1 AKT1 3/4885ROCK2 60/4885AKT2 4/4885
US-10059714-B2 Protein kinase B inhibitors PRKAR2B, PRKCB, AKT1 AKT1 3/4885ROCK2 60/4885AKT2 4/4885
US-20090163524-A1 Novel Protein Kinase B Inhibitors - 060 PRKAR2B, PRKCB, MAP3K20 AKT1 4/4885ROCK2 85/4885AKT2 6/4885
US-20170057969-A1 Novel Protein Kinase B Inhibitors - 060 PRKAR2B, PRKCB, MAP3K20 AKT1 4/4885ROCK2 85/4885AKT2 6/4885
US-20200239483-A1 PROTEIN KINASE B INHIBITORS PRKAR2B, PRKCB, AKT1 AKT1 3/4885ROCK2 60/4885AKT2 4/4885
US-20120190679-A1 Novel Protein Kinase B Inhibitors - 060 PRKAR2B, PRKCB, MAP3K20 AKT1 4/4885ROCK2 85/4885AKT2 6/4885
US-11236095-B2 Protein kinase B inhibitors PRKAR2B, PRKCB, AKT1 AKT1 3/4885ROCK2 60/4885AKT2 4/4885
US-20150182531-A1 Novel Protein Kinase B Inhibitors - 060 PRKAR2B, PRKCB, MAP3K20 AKT1 4/4885ROCK2 85/4885AKT2 6/4885
US-11760760-B2 Protein kinase B inhibitors PRKAR2B, PRKCB, AKT1 AKT1 3/4885ROCK2 60/4885AKT2 4/4885

“Text reads most about” is the patent abstract's nearest protein in MedCPT space (background-debiased). Only ~1.4% of patents have machine-readable text, so most compounds won't have this panel.