Predicted protein targets (top 5)
| gene | UniProt | supporting neighbours | confidence | |
|---|---|---|---|---|
| ▸ | HRH3 | Q9Y5N1 | 17/20 | 0.94 |
| ▸ | LMNA | P02545 | 1/20 | 0.68 |
| ▸ | MAPK1 | P28482 | 1/20 | 0.68 |
| ▸ | HTT | P42858 | 1/20 | 0.68 |
| ▸ | SMN1; SMN2 | Q16637 | 1/20 | 0.68 |
Click a target to see other patent compounds predicted against it — the reverse direction, in place.
Similar compounds — the chemically nearest patent molecules
Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.
| Compound | similarity | top predicted | shared targets | |
|---|---|---|---|---|
| SCHEMBL491593 | 0.99 | HRH3 (0.97) | HRH3LMNAMAPK1HTTSMN1; SMN2 | |
| SCHEMBL5280015 | 0.89 | HRH3 (0.79) | HRH3 | |
| SCHEMBL14970675 | 0.87 | SMN1; SMN2 (0.85) | HRH3LMNAMAPK1HTTSMN1; SMN2 | |
| SCHEMBL21749204 | 0.86 | HRH3 (0.76) | HRH3LMNAMAPK1HTTSMN1; SMN2 | |
| SCHEMBL5493282 | 0.86 | HRH3 (0.74) | HRH3 | |
| Hydrochloric Acid SCHEMBL14966290 | 0.85 | SMN1; SMN2 (0.82) | HRH3LMNAMAPK1HTTSMN1; SMN2 | |
| SCHEMBL5856212 | 0.82 | HRH3 (0.94) | HRH3LMNAHTT | |
| SCHEMBL5858684 | 0.82 | HRH3 (0.95) | HRH3 | |
| SCHEMBL491769 | 0.80 | HRH3 (0.97) | HRH3LMNAHTT | |
| SCHEMBL22627324 | 0.80 | HRH3 (0.78) | HRH3SMN1; SMN2 |
Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.
Patent provenance — the patents this molecule appears in, and who filed them
Claimed or disclosed in 1 patent. claimed = in the patent's claims; disclosed = body only.
| Patent | Title | Assignee | Published | Priority | Filing | Country | Status |
|---|---|---|---|---|---|---|---|
| US-7138413-B1 | Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders | SOCIETE CIVILE BIOPROJET (FR) | 2006-11-21 | — | — | US | disclosed |