Predicted protein targets (top 15)
| gene | UniProt | supporting neighbours | confidence | |
|---|---|---|---|---|
| ▸ | HRH3 | Q9Y5N1 | 12/20 | 0.97 |
| ▸ | LTA4H | P09960 | 1/20 | 0.73 |
| ▸ | PTGS1 | P23219 | 1/20 | 0.73 |
| ▸ | PTGS2 | P35354 | 1/20 | 0.73 |
| ▸ | KDM4E | B2RXH2 | 2/20 | 0.68 |
| ▸ | ALDH1A1 | P00352 | 2/20 | 0.68 |
| ▸ | TDP1 | Q9NUW8 | 1/20 | 0.68 |
| ▸ | MEN1 | O00255 | 1/20 | 0.61 |
| ▸ | LMNA | P02545 | 1/20 | 0.61 |
| ▸ | HTT | P42858 | 1/20 | 0.61 |
| ▸ | KMT2A | Q03164 | 1/20 | 0.61 |
| ▸ | KCNH2 | Q12809 | 1/20 | 0.58 |
| ▸ | SMN1; SMN2 | Q16637 | 1/20 | 0.58 |
| ▸ | ATM | Q13315 | 1/20 | 0.57 |
| ▸ | L3MBTL1 | Q9Y468 | 1/20 | 0.57 |
Click a target to see other patent compounds predicted against it — the reverse direction, in place.
Similar compounds — the chemically nearest patent molecules
Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.
| Compound | similarity | top predicted | shared targets | |
|---|---|---|---|---|
| SCHEMBL490968 | 0.99 | HRH3 (1.00) | HRH3LTA4HPTGS1PTGS2KDM4E | |
| SCHEMBL4994427 | 0.96 | HRH3 (0.94) | HRH3LTA4HPTGS1PTGS2KDM4E | |
| SCHEMBL5856034 | 0.93 | HRH3 (0.84) | HRH3LTA4HPTGS1PTGS2KDM4E | |
| SCHEMBL4453239 | 0.93 | HRH3 (0.89) | HRH3LTA4HPTGS1PTGS2KDM4E | |
| SCHEMBL5279316 | 0.92 | HRH3 (0.88) | HRH3LTA4HPTGS1PTGS2KDM4E | |
| SCHEMBL491607 | 0.92 | HRH3 (0.86) | HRH3LTA4HPTGS1PTGS2KDM4E | |
| SCHEMBL21814264 | 0.92 | HRH3 (0.86) | HRH3LTA4HPTGS1PTGS2KDM4E | |
| SCHEMBL519633 | 0.88 | LTA4H (0.91) | HRH3LTA4HPTGS1PTGS2KDM4E | |
| SCHEMBL4992188 | 0.87 | LTA4H (0.89) | HRH3LTA4HPTGS1PTGS2KDM4E | |
| SCHEMBL28180188 | 0.86 | HRH3 (0.78) | HRH3LTA4HPTGS1PTGS2KDM4E |
Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.
Patent provenance — the patents this molecule appears in, and who filed them
Claimed or disclosed in 1 patent. claimed = in the patent's claims; disclosed = body only.
| Patent | Title | Assignee | Published | Priority | Filing | Country | Status |
|---|---|---|---|---|---|---|---|
| US-7138413-B1 | Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders | SOCIETE CIVILE BIOPROJET (FR) | 2006-11-21 | — | — | US | disclosed |