SCHEMBL12772018

SCHEMBL12772018

Fc1ccc(P(Cl)Cl)c(CN(c2ccccc2)c2ccccc2)c1

nearest known ligand 0.36

Predicted protein targets (top 20)

geneUniProtsupporting neighboursconfidence
NOS2 P35228 1/20 0.36
ESR1 P03372 1/20 0.33
ESR2 Q92731 1/20 0.33
SLC6A4 P31645 3/20 0.33
SLC6A2 P23975 2/20 0.33
SLC6A3 Q01959 1/20 0.33
MEN1 O00255 1/20 0.33
KMT2A Q03164 1/20 0.33
L3MBTL1 Q9Y468 1/20 0.33
TSHR P16473 1/20 0.32
MAPK1 P28482 1/20 0.32
KCNH2 Q12809 2/20 0.32
TAAR1 Q96RJ0 1/20 0.32
SIGMAR1 Q99720 1/20 0.31
NR3C2 P08235 1/20 0.31
HTR2A P28223 1/20 0.31
NR1H2 P55055 1/20 0.30
KCNH3 Q9ULD8 1/20 0.30
CD74 P04233 1/20 0.30
MIF P14174 1/20 0.30

Click a target to see other patent compounds predicted against it — the reverse direction, in place.

Similar compounds — the chemically nearest patent molecules

Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.

Compoundsimilaritytop predictedshared targets
SCHEMBL12772029 0.84 SLC6A2 (0.37) SLC6A4SLC6A2SLC6A3TSHRMAPK1
SCHEMBL12772013 0.81 TAAR1 (0.36) NOS2ESR1ESR2KCNH2TAAR1
SCHEMBL12772017 0.81 CYP2C19 (0.35) NOS2ESR1ESR2SLC6A4KMT2A
SCHEMBL12772012 0.79 HTT (0.37) MEN1KMT2AL3MBTL1MAPK1NR1H2
SCHEMBL12772010 0.77 CYP2D6 (0.51) NOS2SLC6A4SLC6A2MEN1KMT2A
SCHEMBL12772016 0.77 ALDH1A1 (0.34) NOS2SLC6A4MEN1KMT2ATSHR
SCHEMBL12772001 0.76 SLC6A4 (0.45) SLC6A4SLC6A2SLC6A3MEN1KMT2A
SCHEMBL12772045 0.75 KDM4E (0.49) MEN1KMT2ATSHRMAPK1
SCHEMBL12956810 0.75 NR3C2 (0.31) NR3C2
SCHEMBL12774312 0.75 TSHR (0.34) SLC6A4SLC6A2KMT2AL3MBTL1TSHR

Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.

Patent provenance — the patents this molecule appears in, and who filed them

Claimed or disclosed in 8 patents. claimed = in the patent's claims; disclosed = body only.

PatentTitleAssigneePublishedPriorityFilingCountryStatus
US-7915455-B2 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex SUMITOMO CHEMICAL COMPANY, LIMITED (JP) 2011-03-29 US disclosed
US-7915455-B2 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex SUMITOMO CHEMICAL COMPANY, LIMITED (JP) 2011-03-29 US disclosed
EP-2272852-A1 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex Sumitomo Chemical Company, Limited (JP) 2011-01-12 EP disclosed
US-20090143620-A1 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex SUMITOMO CHEMICAL COMPANY, LIMITED 2009-06-04 US disclosed
US-7482414-B2 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex SUMITOMO CHEMICAL COMPANY, LIMITED (JP) 2009-01-27 US disclosed
US-7482414-B2 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex SUMITOMO CHEMICAL COMPANY, LIMITED (JP) 2009-01-27 US disclosed
US-20070135600-A1 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex SUMITOMO CHEMICAL COMPANY, LIMITED (JP) 2007-06-14 US disclosed
US-20070135600-A1 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex SUMITOMO CHEMICAL COMPANY, LIMITED (JP) 2007-06-14 US disclosed

Patent text — is the patent's own abstract consistent with the prediction?

For each of this compound's patents that has machine-readable text (2 of them — usually the abstract, not the full specification), we ask MedCPT which protein the text reads most about, and where the chemistry-predicted target lands among 4885 human targets. A high rank means the patent's own wording is consistent with the prediction — a weak, independent signal, not proof of activity.

PatentTitleText reads most aboutPredicted target · text-rank
US-20070135600-A1 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex AP1M1, OR10J3, AP2M1 NOS2 1555/4885ESR1 372/4885ESR2 982/4885
US-20090143620-A1 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex AP1M1, OR10J3, AP2M1 NOS2 1555/4885ESR1 372/4885ESR2 982/4885

“Text reads most about” is the patent abstract's nearest protein in MedCPT space (background-debiased). Only ~1.4% of patents have machine-readable text, so most compounds won't have this panel.