SCHEMBL12772012

SCHEMBL12772012

Fc1ccc(P(Cl)Cl)c(CN(Cc2ccccc2)Cc2ccccc2)c1

nearest known ligand 0.38

Predicted protein targets (top 20)

geneUniProtsupporting neighboursconfidence
HTT P42858 1/20 0.37
SNCA P37840 1/20 0.37
KDM4E B2RXH2 1/20 0.36
CNR2 P34972 1/20 0.36
NR1D1 P20393 1/20 0.36
NR1H3 Q13133 1/20 0.36
CD74 P04233 1/20 0.35
MIF P14174 1/20 0.35
PTPN1 P18031 1/20 0.35
NR1H2 P55055 1/20 0.34
MEN1 O00255 1/20 0.34
MAPK1 P28482 1/20 0.34
KMT2A Q03164 1/20 0.34
BCHE P06276 1/20 0.34
KCNA5 P22460 1/20 0.34
L3MBTL1 Q9Y468 1/20 0.34
DPP4 P27487 1/20 0.34
DPP8 Q6V1X1 1/20 0.34
DPP9 Q86TI2 1/20 0.34
DPP7 Q9UHL4 1/20 0.34

Click a target to see other patent compounds predicted against it — the reverse direction, in place.

Similar compounds — the chemically nearest patent molecules

Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.

Compoundsimilaritytop predictedshared targets
SCHEMBL12772045 0.91 KDM4E (0.49) KDM4ECNR2MEN1MAPK1KMT2A
SCHEMBL12772009 0.82 CNR2 (0.41) KDM4ECNR2NR1D1PTPN1MAPK1
SCHEMBL12772007 0.81 CYP2C19 (0.41) HTTKDM4ECNR2CD74MIF
SCHEMBL12772018 0.79 NOS2 (0.36) CD74MIFNR1H2MEN1MAPK1
SCHEMBL12771992 0.79 MPO (0.49) HTTKDM4EMEN1MAPK1KMT2A
SCHEMBL12774301 0.78 NR3C1 (0.39) NR1H3CD74MIFNR1H2KCNA5
SCHEMBL12772022 0.78 CYP2D6 (0.43) CNR2MEN1MAPK1KMT2A
SCHEMBL12772026 0.78 MIF (0.39) KDM4ECNR2MIFMEN1MAPK1
SCHEMBL12772029 0.77 SLC6A2 (0.37) KDM4EMAPK1
SCHEMBL12772001 0.75 SLC6A4 (0.45) KDM4EMEN1KMT2AL3MBTL1

Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.

Patent provenance — the patents this molecule appears in, and who filed them

Claimed or disclosed in 7 patents. claimed = in the patent's claims; disclosed = body only.

PatentTitleAssigneePublishedPriorityFilingCountryStatus
US-7915455-B2 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex SUMITOMO CHEMICAL COMPANY, LIMITED (JP) 2011-03-29 US disclosed
US-7915455-B2 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex SUMITOMO CHEMICAL COMPANY, LIMITED (JP) 2011-03-29 US disclosed
US-20090143620-A1 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex SUMITOMO CHEMICAL COMPANY, LIMITED 2009-06-04 US disclosed
US-7482414-B2 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex SUMITOMO CHEMICAL COMPANY, LIMITED (JP) 2009-01-27 US disclosed
US-7482414-B2 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex SUMITOMO CHEMICAL COMPANY, LIMITED (JP) 2009-01-27 US disclosed
US-20070135600-A1 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex SUMITOMO CHEMICAL COMPANY, LIMITED (JP) 2007-06-14 US disclosed
US-20070135600-A1 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex SUMITOMO CHEMICAL COMPANY, LIMITED (JP) 2007-06-14 US disclosed

Patent text — is the patent's own abstract consistent with the prediction?

For each of this compound's patents that has machine-readable text (2 of them — usually the abstract, not the full specification), we ask MedCPT which protein the text reads most about, and where the chemistry-predicted target lands among 4885 human targets. A high rank means the patent's own wording is consistent with the prediction — a weak, independent signal, not proof of activity.

PatentTitleText reads most aboutPredicted target · text-rank
US-20070135600-A1 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex AP1M1, OR10J3, AP2M1 HTT 4100/4885SNCA 972/4885KDM4E 4395/4885
US-20090143620-A1 Transition metal complex ligand and olefin polymerization catalyst containing transition metal complex AP1M1, OR10J3, AP2M1 HTT 4100/4885SNCA 972/4885KDM4E 4395/4885

“Text reads most about” is the patent abstract's nearest protein in MedCPT space (background-debiased). Only ~1.4% of patents have machine-readable text, so most compounds won't have this panel.