SCHEMBL2138974

SCHEMBL2138974

[c]1cc[c]c(OOc2[c]cc[c]c2)c1

nearest known ligand 0.00

⚠ Novel chemotype — no close known analogue (best Tanimoto < 0.3). Unexplored chemical space relative to ChEMBL.

Similar compounds — the chemically nearest patent molecules

Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.

Compoundsimilaritytop predictedshared targets
SCHEMBL707768 0.82
SCHEMBL7168783 0.72
SCHEMBL9398383 0.72
SCHEMBL8535485 0.69 ALDH1A1 (0.34)
SCHEMBL5453657 0.69
SCHEMBL5485453 0.69 LMNA (0.33)
SCHEMBL9294454 0.69 ALDH1A1 (0.46)
SCHEMBL7146702 0.68 USP8 (0.30)
SCHEMBL9398764 0.68 CA12 (0.30)
SCHEMBL2695732 0.61

Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.

Patent provenance — the patents this molecule appears in, and who filed them

Claimed or disclosed in 102 patents — showing the first 20. claimed = in the patent's claims; disclosed = body only.

PatentTitleAssigneePublishedPriorityFilingCountryStatus
EP-0372656-B1 Polymers comprising spirolactam units SHELL INT RESEARCH (NL) 1995-06-07 EP claimed
EP-0384518-B1 Alkenylphenol derivatives SHELL INT RESEARCH (NL) 1994-08-24 EP claimed
EP-0359340-B1 Spirodilactam polymers SHELL INT RESEARCH (NL) 1994-03-16 EP claimed
US-5149823-A Sulfonamide substituted spirodilactams SHELL OIL COMPANY (US) 1992-09-22 US claimed
US-5128436-A Cyclic polyhydroxy polyether oligomers having spirodilactam units SHELL OIL COMPANY (US) 1992-07-07 US claimed
US-5112938-A CYANO- AND CARBOXY-SUBSTITUTED SPIRODILACTAMS SHELL OIL COMPANY (US) 1992-05-12 US claimed
US-5095088-A Cyclic polycarbonate oligomer containing spiro diLactam moieties SHELL OIL COMPANY (US) 1992-03-10 US claimed
US-5093465-A Polyamide containing spirodilactam moieties SHELL OIL COMPANY (US) 1992-03-03 US claimed
US-5093500-A Spirodilactam bisimides SHELL OIL COMPANY (US) 1992-03-03 US claimed
US-5082923-A High glass transition temperature SHELL OIL COMPANY (US) 1992-01-21 US claimed
US-4914176-A Poly(heterocyclic) polymers SHELL OIL COMPANY (US) 1990-04-03 US claimed
EP-0359340-A2 Spirodilactam polymers SHELL INTERNATIONALE RESEARCHMAATSCHAPPIJ B.V. (NL) 1990-03-21 EP claimed
US-4910285-A Polyarylate polymers SHELL OIL COMPANY (US) 1990-03-20 US claimed
US-4908458-A 1,5-Di(benzoheterocyclic)-3-oxopentane derivatives SHELL OIL COMPANY (US) 1990-03-13 US claimed
US-4906725-A Polycarbonate containing spiro dilactam segment SHELL OIL COMPANY (US) 1990-03-06 US claimed
US-4895942-A Novel epoxy compounds SHELL OIL COMPANY (US) 1990-01-23 US claimed
US-4889907-A Polymeric polyhyroxy polyether containing 1,6-diazaspiro-[4.4]nonane-2,7-dione units SHELL OIL COMPANY (US) 1989-12-26 US claimed
US-4888408-A Polymeric polyhydroxy polyether containing 1,6-diazaspiro-[4.4]nonane-2,7-dione units SHELL OIL COMPANY (US) 1989-12-19 US claimed
US-4886863-A Novel alkenylphenol derivatives SHELL OIL COMPANY (US) 1989-12-12 US claimed
US-4847388-A Polycyclic unsaturated ethers and esters SHELL OIL COMPANY (US) 1989-07-11 US claimed