SCHEMBL386860

SCHEMBL386860

C[C@H](NC(=O)C1(N)CCN(c2ncnc3[nH]cc(Br)c23)CC1)c1ccc(Cl)cc1

nearest known ligand 1.00 ✓ in ChEMBL — recovers established targets

Predicted protein targets (top 6)

geneUniProtsupporting neighboursconfidence
AKT1 P31749 16/20 1.00
RPS6KB1 P23443 4/20 0.71
AKT2 P31751 5/20 0.70
AKT3 Q9Y243 5/20 0.70
ROCK2 O75116 4/20 0.70
KCNH2 Q12809 4/20 0.70

Click a target to see other patent compounds predicted against it — the reverse direction, in place.

Similar compounds — the chemically nearest patent molecules

Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.

Compoundsimilaritytop predictedshared targets
SCHEMBL390667 0.91 AKT1 (1.00) AKT1RPS6KB1AKT2AKT3ROCK2
SCHEMBL390552 0.90 AKT1 (1.00) AKT1RPS6KB1AKT2AKT3ROCK2
SCHEMBL387742 0.86 AKT1 (1.00) AKT1RPS6KB1AKT2AKT3ROCK2
SCHEMBL387743 0.86 AKT1 (1.00) AKT1RPS6KB1AKT2AKT3ROCK2
SCHEMBL390598 0.86 AKT1 (0.81) AKT1RPS6KB1AKT2AKT3ROCK2
SCHEMBL11939690 0.84 AKT1 (0.78) AKT1RPS6KB1AKT2AKT3ROCK2
SCHEMBL24623102 0.83 AKT1 (0.75) AKT1RPS6KB1AKT2AKT3ROCK2
SCHEMBL14787678 0.83 RPS6KB1 (1.00) AKT1RPS6KB1AKT2AKT3ROCK2
SCHEMBL3650075 0.83 AKT1 (0.71) AKT1AKT2AKT3ROCK2KCNH2
SCHEMBL390673 0.83 AKT1 (1.00) AKT1AKT2AKT3ROCK2KCNH2

Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.

Patent provenance — the patents this molecule appears in, and who filed them

Claimed or disclosed in 32 patents — showing the first 20. claimed = in the patent's claims; disclosed = body only.

PatentTitleAssigneePublishedPriorityFilingCountryStatus
US-20120190679-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2012-07-26 US claimed
US-12252495-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2025-03-18 US disclosed
US-20240109902-A1 PROTEIN KINASE B INHIBITORS ASTRAZENECA AB (SE) 2024-04-04 US disclosed
US-11760760-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2023-09-19 US disclosed
US-11760760-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2023-09-19 US disclosed
US-11760760-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2023-09-19 US disclosed
US-20220220116-A1 PROTEIN KINASE B INHIBITORS ASTRAZENECA AB (SE) 2022-07-14 US disclosed
US-20220220116-A1 PROTEIN KINASE B INHIBITORS ASTRAZENECA AB (SE) 2022-07-14 US disclosed
US-11236095-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2022-02-01 US disclosed
US-11236095-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2022-02-01 US disclosed
US-20150182531-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2015-07-02 US disclosed
US-20150182531-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2015-07-02 US disclosed
US-20150182531-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2015-07-02 US disclosed
US-20120190679-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2012-07-26 US disclosed
US-8101623-B2 Substituted pyrrolo[2,3-d]pyrimidine as a protein kinase B inhibitor ASTRAZENECA AB (SE) 2012-01-24 US disclosed
US-8101623-B2 Substituted pyrrolo[2,3-d]pyrimidine as a protein kinase B inhibitor ASTRAZENECA AB (SE) 2012-01-24 US disclosed
US-8101623-B2 Substituted pyrrolo[2,3-d]pyrimidine as a protein kinase B inhibitor ASTRAZENECA AB (SE) 2012-01-24 US disclosed
US-20090163524-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2009-06-25 US disclosed
US-20090163524-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2009-06-25 US disclosed
US-20090163524-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2009-06-25 US disclosed

Patent text — is the patent's own abstract consistent with the prediction?

For each of this compound's patents that has machine-readable text (8 of them — usually the abstract, not the full specification), we ask MedCPT which protein the text reads most about, and where the chemistry-predicted target lands among 4885 human targets. A high rank means the patent's own wording is consistent with the prediction — a weak, independent signal, not proof of activity.

PatentTitleText reads most aboutPredicted target · text-rank
US-12252495-B2 Protein kinase B inhibitors PRKAR2B, PRKCB, AKT1 AKT1 3/4885RPS6KB1 27/4885AKT2 4/4885
US-20220220116-A1 PROTEIN KINASE B INHIBITORS PRKAR2B, PRKCB, AKT1 AKT1 3/4885RPS6KB1 27/4885AKT2 4/4885
US-20240109902-A1 PROTEIN KINASE B INHIBITORS PRKAR2B, PRKCB, AKT1 AKT1 3/4885RPS6KB1 27/4885AKT2 4/4885
US-20090163524-A1 Novel Protein Kinase B Inhibitors - 060 PRKAR2B, PRKCB, MAP3K20 AKT1 4/4885RPS6KB1 28/4885AKT2 6/4885
US-20120190679-A1 Novel Protein Kinase B Inhibitors - 060 PRKAR2B, PRKCB, MAP3K20 AKT1 4/4885RPS6KB1 28/4885AKT2 6/4885
US-11236095-B2 Protein kinase B inhibitors PRKAR2B, PRKCB, AKT1 AKT1 3/4885RPS6KB1 27/4885AKT2 4/4885
US-20150182531-A1 Novel Protein Kinase B Inhibitors - 060 PRKAR2B, PRKCB, MAP3K20 AKT1 4/4885RPS6KB1 28/4885AKT2 6/4885
US-11760760-B2 Protein kinase B inhibitors PRKAR2B, PRKCB, AKT1 AKT1 3/4885RPS6KB1 27/4885AKT2 4/4885

“Text reads most about” is the patent abstract's nearest protein in MedCPT space (background-debiased). Only ~1.4% of patents have machine-readable text, so most compounds won't have this panel.