SCHEMBL390598

SCHEMBL390598

C[C@H](NC(=O)C1(N)CCN(c2ncnc3[nH]nc(Br)c23)CC1)c1ccc(Cl)cc1

nearest known ligand 0.81

Predicted protein targets (top 6)

geneUniProtsupporting neighboursconfidence
AKT1 P31749 15/20 0.81
RPS6KB1 P23443 5/20 0.68
ROCK2 O75116 5/20 0.68
AKT2 P31751 5/20 0.68
AKT3 Q9Y243 5/20 0.68
KCNH2 Q12809 4/20 0.68

Click a target to see other patent compounds predicted against it — the reverse direction, in place.

Similar compounds — the chemically nearest patent molecules

Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.

Compoundsimilaritytop predictedshared targets
SCHEMBL11939690 0.91 AKT1 (0.78) AKT1RPS6KB1ROCK2AKT2AKT3
SCHEMBL390670 0.86 AKT1 (0.82) AKT1RPS6KB1ROCK2AKT2AKT3
SCHEMBL386860 0.86 AKT1 (1.00) AKT1RPS6KB1ROCK2AKT2AKT3
SCHEMBL390667 0.84 AKT1 (1.00) AKT1RPS6KB1ROCK2AKT2AKT3
SCHEMBL390552 0.83 AKT1 (1.00) AKT1RPS6KB1ROCK2AKT2AKT3
SCHEMBL13885616 0.83 AKT2 (0.68) AKT1ROCK2AKT2AKT3KCNH2
SCHEMBL24623102 0.81 AKT1 (0.75) AKT1RPS6KB1ROCK2AKT2AKT3
SCHEMBL14787678 0.81 RPS6KB1 (1.00) AKT1RPS6KB1ROCK2AKT2AKT3
SCHEMBL390673 0.81 AKT1 (1.00) AKT1ROCK2AKT2AKT3KCNH2
SCHEMBL387281 0.81 AKT1 (1.00) AKT1ROCK2AKT2AKT3KCNH2

Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.

Patent provenance — the patents this molecule appears in, and who filed them

Claimed or disclosed in 34 patents — showing the first 20. claimed = in the patent's claims; disclosed = body only.

PatentTitleAssigneePublishedPriorityFilingCountryStatus
US-20120190679-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2012-07-26 US claimed
US-12252495-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2025-03-18 US disclosed
US-20240109902-A1 PROTEIN KINASE B INHIBITORS ASTRAZENECA AB (SE) 2024-04-04 US disclosed
US-11760760-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2023-09-19 US disclosed
US-11760760-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2023-09-19 US disclosed
US-11760760-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2023-09-19 US disclosed
US-20220220116-A1 PROTEIN KINASE B INHIBITORS ASTRAZENECA AB (SE) 2022-07-14 US disclosed
US-20220220116-A1 PROTEIN KINASE B INHIBITORS ASTRAZENECA AB (SE) 2022-07-14 US disclosed
US-11236095-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2022-02-01 US disclosed
US-11236095-B2 Protein kinase B inhibitors ASTRAZENECA AB (SE) 2022-02-01 US disclosed
US-20150182531-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2015-07-02 US disclosed
US-20120190679-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2012-07-26 US disclosed
US-20120190679-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2012-07-26 US disclosed
US-20120190679-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2012-07-26 US disclosed
US-8101623-B2 Substituted pyrrolo[2,3-d]pyrimidine as a protein kinase B inhibitor ASTRAZENECA AB (SE) 2012-01-24 US disclosed
US-8101623-B2 Substituted pyrrolo[2,3-d]pyrimidine as a protein kinase B inhibitor ASTRAZENECA AB (SE) 2012-01-24 US disclosed
US-8101623-B2 Substituted pyrrolo[2,3-d]pyrimidine as a protein kinase B inhibitor ASTRAZENECA AB (SE) 2012-01-24 US disclosed
US-20090163524-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2009-06-25 US disclosed
US-20090163524-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2009-06-25 US disclosed
US-20090163524-A1 Novel Protein Kinase B Inhibitors - 060 ASTRAZENECA AB (SE) 2009-06-25 US disclosed

Patent text — is the patent's own abstract consistent with the prediction?

For each of this compound's patents that has machine-readable text (8 of them — usually the abstract, not the full specification), we ask MedCPT which protein the text reads most about, and where the chemistry-predicted target lands among 4885 human targets. A high rank means the patent's own wording is consistent with the prediction — a weak, independent signal, not proof of activity.

PatentTitleText reads most aboutPredicted target · text-rank
US-12252495-B2 Protein kinase B inhibitors PRKAR2B, PRKCB, AKT1 AKT1 3/4885RPS6KB1 27/4885ROCK2 60/4885
US-20220220116-A1 PROTEIN KINASE B INHIBITORS PRKAR2B, PRKCB, AKT1 AKT1 3/4885RPS6KB1 27/4885ROCK2 60/4885
US-20240109902-A1 PROTEIN KINASE B INHIBITORS PRKAR2B, PRKCB, AKT1 AKT1 3/4885RPS6KB1 27/4885ROCK2 60/4885
US-20090163524-A1 Novel Protein Kinase B Inhibitors - 060 PRKAR2B, PRKCB, MAP3K20 AKT1 4/4885RPS6KB1 28/4885ROCK2 85/4885
US-20120190679-A1 Novel Protein Kinase B Inhibitors - 060 PRKAR2B, PRKCB, MAP3K20 AKT1 4/4885RPS6KB1 28/4885ROCK2 85/4885
US-11236095-B2 Protein kinase B inhibitors PRKAR2B, PRKCB, AKT1 AKT1 3/4885RPS6KB1 27/4885ROCK2 60/4885
US-20150182531-A1 Novel Protein Kinase B Inhibitors - 060 PRKAR2B, PRKCB, MAP3K20 AKT1 4/4885RPS6KB1 28/4885ROCK2 85/4885
US-11760760-B2 Protein kinase B inhibitors PRKAR2B, PRKCB, AKT1 AKT1 3/4885RPS6KB1 27/4885ROCK2 60/4885

“Text reads most about” is the patent abstract's nearest protein in MedCPT space (background-debiased). Only ~1.4% of patents have machine-readable text, so most compounds won't have this panel.