Predicted protein targets (top 5)
| gene | UniProt | supporting neighbours | confidence | |
|---|---|---|---|---|
| ▸ | HRH3 | Q9Y5N1 | 20/20 | 0.68 |
| ▸ | KCNH2 | Q12809 | 3/20 | 0.61 |
| ▸ | ACHE | P22303 | 1/20 | 0.61 |
| ▸ | RAD52 | P43351 | 1/20 | 0.61 |
| ▸ | HRH1 | P35367 | 1/20 | 0.60 |
Click a target to see other patent compounds predicted against it — the reverse direction, in place.
Similar compounds — the chemically nearest patent molecules
Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.
| Compound | similarity | top predicted | shared targets | |
|---|---|---|---|---|
| SCHEMBL491848 | 0.98 | HRH3 (0.69) | HRH3KCNH2ACHERAD52HRH1 | |
| Hydrochloric Acid SCHEMBL5692315 | 0.97 | HRH3 (0.68) | HRH3KCNH2ACHERAD52HRH1 | |
| SCHEMBL2005536 | 0.97 | HRH3 (0.67) | HRH3KCNH2ACHERAD52HRH1 | |
| SCHEMBL30411052 | 0.94 | HRH3 (0.68) | HRH3KCNH2 | |
| SCHEMBL30409879 | 0.93 | HRH3 (0.67) | HRH3KCNH2 | |
| SCHEMBL30410433 | 0.93 | HRH3 (0.67) | HRH3KCNH2 | |
| SCHEMBL30409990 | 0.92 | HRH3 (0.65) | HRH3KCNH2 | |
| SCHEMBL30410512 | 0.91 | MEN1 (0.66) | HRH3KCNH2 | |
| SCHEMBL30409967 | 0.91 | MEN1 (0.66) | HRH3KCNH2 | |
| SCHEMBL27593 | 0.91 | PSMB1 (0.69) | HRH3KCNH2 |
Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.
Patent provenance — the patents this molecule appears in, and who filed them
Claimed or disclosed in 1 patent. claimed = in the patent's claims; disclosed = body only.
| Patent | Title | Assignee | Published | Priority | Filing | Country | Status |
|---|---|---|---|---|---|---|---|
| US-7138413-B1 | Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders | SOCIETE CIVILE BIOPROJET (FR) | 2006-11-21 | — | — | US | disclosed |