Predicted protein targets (top 11)
| gene | UniProt | supporting neighbours | confidence | |
|---|---|---|---|---|
| ▸ | MEN1 | O00255 | 1/20 | 0.69 |
| ▸ | LMNA | P02545 | 1/20 | 0.69 |
| ▸ | HTT | P42858 | 1/20 | 0.69 |
| ▸ | KMT2A | Q03164 | 1/20 | 0.69 |
| ▸ | HRH3 | Q9Y5N1 | 13/20 | 0.68 |
| ▸ | LTA4H | P09960 | 1/20 | 0.65 |
| ▸ | ATM | Q13315 | 1/20 | 0.65 |
| ▸ | L3MBTL1 | Q9Y468 | 1/20 | 0.65 |
| ▸ | MAPK14 | Q16539 | 1/20 | 0.64 |
| ▸ | KCNH2 | Q12809 | 1/20 | 0.64 |
| ▸ | HRH4 | Q9H3N8 | 1/20 | 0.64 |
Click a target to see other patent compounds predicted against it — the reverse direction, in place.
Similar compounds — the chemically nearest patent molecules
Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.
| Compound | similarity | top predicted | shared targets | |
|---|---|---|---|---|
| SCHEMBL10200144 | 0.98 | MEN1 (0.71) | MEN1LMNAHTTKMT2AHRH3 | |
| SCHEMBL491546 | 0.98 | MEN1 (0.71) | MEN1LMNAHTTKMT2AHRH3 | |
| SCHEMBL12835095 | 0.97 | HRH3 (0.73) | MEN1LMNAHTTKMT2AHRH3 | |
| SCHEMBL13246342 | 0.97 | HRH3 (0.71) | MEN1LMNAHTTKMT2AHRH3 | |
| SCHEMBL13246349 | 0.95 | HRH3 (0.73) | MEN1LMNAHTTKMT2AHRH3 | |
| SCHEMBL5281009 | 0.92 | MAOA (0.64) | MEN1LMNAHTTKMT2AHRH3 | |
| SCHEMBL2629440 | 0.92 | HRH3 (0.72) | MEN1KMT2AHRH3L3MBTL1MAPK14 | |
| SCHEMBL10200146 | 0.90 | HRH3 (0.75) | MEN1KMT2AHRH3L3MBTL1MAPK14 | |
| SCHEMBL2827364 | 0.90 | HRH3 (0.75) | MEN1KMT2AHRH3L3MBTL1MAPK14 | |
| SCHEMBL15834050 | 0.88 | HRH3 (0.67) | MEN1KMT2AHRH3L3MBTL1MAPK14 |
Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.
Patent provenance — the patents this molecule appears in, and who filed them
Claimed or disclosed in 1 patent. claimed = in the patent's claims; disclosed = body only.
| Patent | Title | Assignee | Published | Priority | Filing | Country | Status |
|---|---|---|---|---|---|---|---|
| US-7138413-B1 | Administering tertiary amines, e.g., 3,3-Dimethylbutyl 3-piperidinopropyl ether, 3-Phenylpropyl 3-piperidinopropyl ether, or3-(4-Chlorophenyl)propyl 3-piperidinopropyl ether to treat cognitive disorders such as attention, wakefulness and memory disorders | SOCIETE CIVILE BIOPROJET (FR) | 2006-11-21 | — | — | US | disclosed |