Predicted protein targets (top 20)
| gene | UniProt | supporting neighbours | confidence | |
|---|---|---|---|---|
| ▸ | POLB | P06746 | 2/20 | 0.41 |
| ▸ | GAA | P10253 | 2/20 | 0.41 |
| ▸ | CES2 | O00748 | 1/20 | 0.40 |
| ▸ | CES1 | P23141 | 1/20 | 0.40 |
| ▸ | SMN1; SMN2 | Q16637 | 2/20 | 0.39 |
| ▸ | MEN1 | O00255 | 1/20 | 0.39 |
| ▸ | KMT2A | Q03164 | 1/20 | 0.39 |
| ▸ | HSD17B10 | Q99714 | 1/20 | 0.39 |
| ▸ | FSCN1 | Q16658 | 1/20 | 0.39 |
| ▸ | ALDH1A1 | P00352 | 2/20 | 0.39 |
| ▸ | GPBAR1 | Q8TDU6 | 1/20 | 0.37 |
| ▸ | TSHR | P16473 | 2/20 | 0.36 |
| ▸ | MAPT | P10636 | 2/20 | 0.36 |
| ▸ | ESR1 | P03372 | 1/20 | 0.36 |
| ▸ | TP53 | P04637 | 1/20 | 0.36 |
| ▸ | BCL2A1 | Q16548 | 1/20 | 0.36 |
| ▸ | CYP1A2 | P05177 | 1/20 | 0.36 |
| ▸ | HPGD | P15428 | 1/20 | 0.36 |
| ▸ | CYP2C19 | P33261 | 1/20 | 0.36 |
| ▸ | LMNA | P02545 | 1/20 | 0.36 |
Click a target to see other patent compounds predicted against it — the reverse direction, in place.
Similar compounds — the chemically nearest patent molecules
Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.
| Compound | similarity | top predicted | shared targets | |
|---|---|---|---|---|
| SCHEMBL3157322 | 0.79 | GAA (0.41) | POLBGAACES2CES1SMN1; SMN2 | |
| SCHEMBL29524083 | 0.79 | GAA (0.41) | POLBGAACES2CES1SMN1; SMN2 | |
| SCHEMBL6393802 | 0.79 | FSCN1 (0.61) | POLBGAACES2CES1SMN1; SMN2 | |
| SCHEMBL879547 | 0.79 | ALDH1A1 (0.39) | POLBGAACES2CES1SMN1; SMN2 | |
| SCHEMBL25774606 | 0.79 | BCL2A1 (0.40) | POLBGAACES2CES1SMN1; SMN2 | |
| SCHEMBL27641816 | 0.78 | GAA (0.39) | POLBGAACES2CES1SMN1; SMN2 | |
| SCHEMBL10441686 | 0.78 | AOC3 (0.40) | POLBGAACES2CES1SMN1; SMN2 | |
| SCHEMBL3285068 | 0.77 | LMNA (0.51) | GAASMN1; SMN2MEN1KMT2AALDH1A1 | |
| SCHEMBL17671167 | 0.75 | GAA (0.41) | GAASMN1; SMN2ALDH1A1TSHRMAPT | |
| SCHEMBL28645802 | 0.75 | GAA (0.41) | GAASMN1; SMN2HSD17B10ALDH1A1TSHR |
Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.
Patent provenance — the patents this molecule appears in, and who filed them
Claimed or disclosed in 1 patent. claimed = in the patent's claims; disclosed = body only.
| Patent | Title | Assignee | Published | Priority | Filing | Country | Status |
|---|---|---|---|---|---|---|---|
| US-4598156-A | Process for producing indoles unsubstituted in the 2,3-position and N(3-chloropropionyl)indole produced thereby | CIBA GEIGY CORPORATION (US) | 1986-07-01 | — | — | US | disclosed |