SCHEMBL13480893

SCHEMBL13480893

Cc1cc(Br)c(S(N)(=O)=O)c(Br)c1

nearest known ligand 0.53

Predicted protein targets (top 20)

geneUniProtsupporting neighboursconfidence
ALDH1A1 P00352 3/20 0.48
KDM4E B2RXH2 1/20 0.48
CA2 P00918 12/20 0.41
CA1 P00915 10/20 0.41
CA12 O43570 6/20 0.41
CA7 P43166 5/20 0.41
CA9 Q16790 5/20 0.41
CA6 P23280 3/20 0.41
CA3 P07451 2/20 0.41
CA5A P35218 2/20 0.41
CA5B Q9Y2D0 2/20 0.41
ALDH2 P05091 1/20 0.39
ALDH3A1 P30838 1/20 0.39
CA13 Q8N1Q1 3/20 0.39
F2 P00734 1/20 0.36
PRSS1 P07477 1/20 0.36
PRSS2 P07478 1/20 0.36
PRSS3 P35030 1/20 0.36
CA4 P22748 2/20 0.35
MMP1 P03956 1/20 0.35

Click a target to see other patent compounds predicted against it — the reverse direction, in place.

Similar compounds — the chemically nearest patent molecules

Nearest neighbours by Morgan-fingerprint cosine across the patent-compound collection, with each neighbour's top predicted target and the predicted targets it shares with this molecule.

Compoundsimilaritytop predictedshared targets
SCHEMBL27780672 0.79 CA2 (0.44) CA2CA1CA12CA7CA9
SCHEMBL27998991 0.78 ALDH1A1 (0.38) ALDH1A1KDM4ECA2CA1CA12
SCHEMBL27998700 0.78 CA1 (0.39) ALDH1A1KDM4ECA2CA1ALDH2
SCHEMBL1913756 0.77 GAA (0.50) ALDH1A1KDM4ECA2CA1CA12
SCHEMBL113366 0.77 CA1 (0.52) ALDH1A1KDM4ECA2CA1CA12
Hydrochloric Acid SCHEMBL28213767 0.76 CA1 (0.38) ALDH1A1KDM4ECA2CA1ALDH2
SCHEMBL30851364 0.73 LMNA (0.43) ALDH1A1KDM4ECA2CA1CA12
SCHEMBL3091347 0.73 KDM4E (0.46) ALDH1A1KDM4ECA2CA1CA12
SCHEMBL14431630 0.73 KDM4E (0.46) ALDH1A1KDM4ECA2CA1CA12
Sulfamide SCHEMBL29026073 0.72 ALDH1A1 (0.55) ALDH1A1KDM4ECA2CA1CA12

Similarity is cosine over the 2,048-bit Morgan fingerprint (≈ Tanimoto). Identical fingerprints score 1.00.

Patent provenance — the patents this molecule appears in, and who filed them

Claimed or disclosed in 8 patents. claimed = in the patent's claims; disclosed = body only.

PatentTitleAssigneePublishedPriorityFilingCountryStatus
US-7655688-B2 Treating nuclear hormone receptor-associated conditions such as cancer and immune disorders; (3a alpha ,4 alpha ,7 alpha ,7a alpha )-2-(3-Chloro-4-hydroxyphenyl)hexahydro-4,7-methano-1H-isoindole-1,3(2H)-dione BRISTOL-MYERS SQUIBB COMPANY (US) 2010-02-02 US disclosed
US-7655689-B2 Fused heterocyclic succinimide compounds and analogs thereof, modulators of nuclear hormone receptor function BRISTOL-MYERS SQUIBB COMPANY (US) 2010-02-02 US disclosed
US-7655688-B2 Treating nuclear hormone receptor-associated conditions such as cancer and immune disorders; (3a alpha ,4 alpha ,7 alpha ,7a alpha )-2-(3-Chloro-4-hydroxyphenyl)hexahydro-4,7-methano-1H-isoindole-1,3(2H)-dione BRISTOL-MYERS SQUIBB COMPANY (US) 2010-02-02 US disclosed
US-7655689-B2 Fused heterocyclic succinimide compounds and analogs thereof, modulators of nuclear hormone receptor function BRISTOL-MYERS SQUIBB COMPANY (US) 2010-02-02 US disclosed
US-7517904-B2 Fused heterocyclic succinimide compounds and analogs thereof, modulators of nuclear hormone receptor function BRISTOL-MYERS SQUIBB COMPANY (US) 2009-04-14 US disclosed
US-7517904-B2 Fused heterocyclic succinimide compounds and analogs thereof, modulators of nuclear hormone receptor function BRISTOL-MYERS SQUIBB COMPANY (US) 2009-04-14 US disclosed
US-7470797-B2 Fused heterocyclic imido and amido compounds BRISTOL-MYERS SQUIBB COMPANY (US) 2008-12-30 US disclosed
US-7470797-B2 Fused heterocyclic imido and amido compounds BRISTOL-MYERS SQUIBB COMPANY (US) 2008-12-30 US disclosed